From aedd295bbeac0ec02a4126bb08282eb8b1b6280a Mon Sep 17 00:00:00 2001 From: krakenrf Date: Wed, 1 Feb 2023 21:25:57 +1300 Subject: [PATCH] add missing node modules --- _nodejs/node_modules/.package-lock.json | 604 ++++ _nodejs/node_modules/asynckit/LICENSE | 21 + _nodejs/node_modules/asynckit/README.md | 233 ++ _nodejs/node_modules/asynckit/bench.js | 76 + _nodejs/node_modules/asynckit/index.js | 6 + _nodejs/node_modules/asynckit/lib/abort.js | 29 + _nodejs/node_modules/asynckit/lib/async.js | 34 + _nodejs/node_modules/asynckit/lib/defer.js | 26 + _nodejs/node_modules/asynckit/lib/iterate.js | 75 + .../asynckit/lib/readable_asynckit.js | 91 + .../asynckit/lib/readable_parallel.js | 25 + .../asynckit/lib/readable_serial.js | 25 + .../asynckit/lib/readable_serial_ordered.js | 29 + _nodejs/node_modules/asynckit/lib/state.js | 37 + .../node_modules/asynckit/lib/streamify.js | 141 + .../node_modules/asynckit/lib/terminator.js | 29 + _nodejs/node_modules/asynckit/package.json | 63 + _nodejs/node_modules/asynckit/parallel.js | 43 + _nodejs/node_modules/asynckit/serial.js | 17 + .../node_modules/asynckit/serialOrdered.js | 75 + _nodejs/node_modules/asynckit/stream.js | 21 + _nodejs/node_modules/axios/CHANGELOG.md | 943 ++++++ _nodejs/node_modules/axios/LICENSE | 19 + _nodejs/node_modules/axios/README.md | 991 +++++++ _nodejs/node_modules/axios/SECURITY.md | 5 + _nodejs/node_modules/axios/UPGRADE_GUIDE.md | 168 ++ _nodejs/node_modules/axios/dist/axios.js | 2595 +++++++++++++++++ _nodejs/node_modules/axios/dist/axios.map | 1 + _nodejs/node_modules/axios/dist/axios.min.js | 3 + _nodejs/node_modules/axios/dist/axios.min.map | 1 + _nodejs/node_modules/axios/index.d.ts | 254 ++ _nodejs/node_modules/axios/index.js | 1 + .../node_modules/axios/lib/adapters/README.md | 37 + .../node_modules/axios/lib/adapters/http.js | 424 +++ .../node_modules/axios/lib/adapters/xhr.js | 222 ++ _nodejs/node_modules/axios/lib/axios.js | 64 + .../axios/lib/cancel/CancelToken.js | 119 + .../axios/lib/cancel/CanceledError.js | 22 + .../node_modules/axios/lib/cancel/isCancel.js | 5 + _nodejs/node_modules/axios/lib/core/Axios.js | 160 + .../node_modules/axios/lib/core/AxiosError.js | 86 + .../axios/lib/core/InterceptorManager.js | 54 + _nodejs/node_modules/axios/lib/core/README.md | 8 + .../axios/lib/core/buildFullPath.js | 20 + .../axios/lib/core/dispatchRequest.js | 87 + .../axios/lib/core/mergeConfig.js | 100 + _nodejs/node_modules/axios/lib/core/settle.js | 25 + .../axios/lib/core/transformData.js | 22 + .../axios/lib/defaults/env/FormData.js | 2 + .../node_modules/axios/lib/defaults/index.js | 146 + .../axios/lib/defaults/transitional.js | 7 + _nodejs/node_modules/axios/lib/env/README.md | 3 + _nodejs/node_modules/axios/lib/env/data.js | 3 + .../node_modules/axios/lib/helpers/README.md | 7 + .../node_modules/axios/lib/helpers/bind.js | 11 + .../axios/lib/helpers/buildURL.js | 70 + .../axios/lib/helpers/combineURLs.js | 14 + .../node_modules/axios/lib/helpers/cookies.js | 53 + .../axios/lib/helpers/deprecatedMethod.js | 24 + .../axios/lib/helpers/isAbsoluteURL.js | 14 + .../axios/lib/helpers/isAxiosError.js | 13 + .../axios/lib/helpers/isURLSameOrigin.js | 68 + .../axios/lib/helpers/normalizeHeaderName.js | 12 + .../node_modules/axios/lib/helpers/null.js | 2 + .../axios/lib/helpers/parseHeaders.js | 53 + .../axios/lib/helpers/parseProtocol.js | 6 + .../node_modules/axios/lib/helpers/spread.js | 27 + .../axios/lib/helpers/toFormData.js | 72 + .../axios/lib/helpers/validator.js | 86 + _nodejs/node_modules/axios/lib/utils.js | 470 +++ _nodejs/node_modules/axios/package.json | 87 + _nodejs/node_modules/axios/tsconfig.json | 14 + _nodejs/node_modules/axios/tslint.json | 6 + _nodejs/node_modules/combined-stream/License | 19 + .../node_modules/combined-stream/Readme.md | 138 + .../combined-stream/lib/combined_stream.js | 208 ++ .../node_modules/combined-stream/package.json | 25 + .../node_modules/combined-stream/yarn.lock | 17 + .../node_modules/delayed-stream/.npmignore | 1 + _nodejs/node_modules/delayed-stream/License | 19 + _nodejs/node_modules/delayed-stream/Makefile | 7 + _nodejs/node_modules/delayed-stream/Readme.md | 141 + .../delayed-stream/lib/delayed_stream.js | 107 + .../node_modules/delayed-stream/package.json | 27 + _nodejs/node_modules/follow-redirects/LICENSE | 18 + .../node_modules/follow-redirects/README.md | 155 + .../node_modules/follow-redirects/debug.js | 15 + _nodejs/node_modules/follow-redirects/http.js | 1 + .../node_modules/follow-redirects/https.js | 1 + .../node_modules/follow-redirects/index.js | 598 ++++ .../follow-redirects/package.json | 59 + _nodejs/node_modules/form-data/License | 19 + _nodejs/node_modules/form-data/README.md.bak | 358 +++ _nodejs/node_modules/form-data/Readme.md | 358 +++ _nodejs/node_modules/form-data/index.d.ts | 62 + _nodejs/node_modules/form-data/lib/browser.js | 2 + .../node_modules/form-data/lib/form_data.js | 501 ++++ .../node_modules/form-data/lib/populate.js | 10 + _nodejs/node_modules/form-data/package.json | 68 + _nodejs/node_modules/log-prefix/README.md | 49 + _nodejs/node_modules/log-prefix/log-prefix.js | 20 + _nodejs/node_modules/log-prefix/package.json | 29 + _nodejs/node_modules/log-prefix/tests/func.js | 7 + .../node_modules/log-prefix/tests/simple.js | 7 + _nodejs/node_modules/log-timestamp/README.md | 62 + .../log-timestamp/log-timestamp.js | 21 + .../node_modules/log-timestamp/package.json | 30 + .../log-timestamp/tests/format.js | 5 + .../node_modules/log-timestamp/tests/func.js | 10 + .../log-timestamp/tests/object.js | 5 + .../node_modules/log-timestamp/tests/test.js | 8 + 111 files changed, 12593 insertions(+) create mode 100644 _nodejs/node_modules/.package-lock.json create mode 100644 _nodejs/node_modules/asynckit/LICENSE create mode 100644 _nodejs/node_modules/asynckit/README.md create mode 100644 _nodejs/node_modules/asynckit/bench.js create mode 100644 _nodejs/node_modules/asynckit/index.js create mode 100644 _nodejs/node_modules/asynckit/lib/abort.js create mode 100644 _nodejs/node_modules/asynckit/lib/async.js create mode 100644 _nodejs/node_modules/asynckit/lib/defer.js create mode 100644 _nodejs/node_modules/asynckit/lib/iterate.js create mode 100644 _nodejs/node_modules/asynckit/lib/readable_asynckit.js create mode 100644 _nodejs/node_modules/asynckit/lib/readable_parallel.js create mode 100644 _nodejs/node_modules/asynckit/lib/readable_serial.js create mode 100644 _nodejs/node_modules/asynckit/lib/readable_serial_ordered.js create mode 100644 _nodejs/node_modules/asynckit/lib/state.js create mode 100644 _nodejs/node_modules/asynckit/lib/streamify.js create mode 100644 _nodejs/node_modules/asynckit/lib/terminator.js create mode 100644 _nodejs/node_modules/asynckit/package.json create mode 100644 _nodejs/node_modules/asynckit/parallel.js create mode 100644 _nodejs/node_modules/asynckit/serial.js create mode 100644 _nodejs/node_modules/asynckit/serialOrdered.js create mode 100644 _nodejs/node_modules/asynckit/stream.js create mode 100644 _nodejs/node_modules/axios/CHANGELOG.md create mode 100644 _nodejs/node_modules/axios/LICENSE create mode 100755 _nodejs/node_modules/axios/README.md create mode 100644 _nodejs/node_modules/axios/SECURITY.md create mode 100644 _nodejs/node_modules/axios/UPGRADE_GUIDE.md create mode 100644 _nodejs/node_modules/axios/dist/axios.js create mode 100644 _nodejs/node_modules/axios/dist/axios.map create mode 100644 _nodejs/node_modules/axios/dist/axios.min.js create mode 100644 _nodejs/node_modules/axios/dist/axios.min.map create mode 100644 _nodejs/node_modules/axios/index.d.ts create mode 100644 _nodejs/node_modules/axios/index.js create mode 100644 _nodejs/node_modules/axios/lib/adapters/README.md create mode 100755 _nodejs/node_modules/axios/lib/adapters/http.js create mode 100644 _nodejs/node_modules/axios/lib/adapters/xhr.js create mode 100644 _nodejs/node_modules/axios/lib/axios.js create mode 100644 _nodejs/node_modules/axios/lib/cancel/CancelToken.js create mode 100644 _nodejs/node_modules/axios/lib/cancel/CanceledError.js create mode 100644 _nodejs/node_modules/axios/lib/cancel/isCancel.js create mode 100644 _nodejs/node_modules/axios/lib/core/Axios.js create mode 100644 _nodejs/node_modules/axios/lib/core/AxiosError.js create mode 100644 _nodejs/node_modules/axios/lib/core/InterceptorManager.js create mode 100644 _nodejs/node_modules/axios/lib/core/README.md create mode 100644 _nodejs/node_modules/axios/lib/core/buildFullPath.js create mode 100644 _nodejs/node_modules/axios/lib/core/dispatchRequest.js create mode 100644 _nodejs/node_modules/axios/lib/core/mergeConfig.js create mode 100644 _nodejs/node_modules/axios/lib/core/settle.js create mode 100644 _nodejs/node_modules/axios/lib/core/transformData.js create mode 100644 _nodejs/node_modules/axios/lib/defaults/env/FormData.js create mode 100644 _nodejs/node_modules/axios/lib/defaults/index.js create mode 100644 _nodejs/node_modules/axios/lib/defaults/transitional.js create mode 100644 _nodejs/node_modules/axios/lib/env/README.md create mode 100644 _nodejs/node_modules/axios/lib/env/data.js create mode 100644 _nodejs/node_modules/axios/lib/helpers/README.md create mode 100644 _nodejs/node_modules/axios/lib/helpers/bind.js create mode 100644 _nodejs/node_modules/axios/lib/helpers/buildURL.js create mode 100644 _nodejs/node_modules/axios/lib/helpers/combineURLs.js create mode 100644 _nodejs/node_modules/axios/lib/helpers/cookies.js create mode 100644 _nodejs/node_modules/axios/lib/helpers/deprecatedMethod.js create mode 100644 _nodejs/node_modules/axios/lib/helpers/isAbsoluteURL.js create mode 100644 _nodejs/node_modules/axios/lib/helpers/isAxiosError.js create mode 100644 _nodejs/node_modules/axios/lib/helpers/isURLSameOrigin.js create mode 100644 _nodejs/node_modules/axios/lib/helpers/normalizeHeaderName.js create mode 100644 _nodejs/node_modules/axios/lib/helpers/null.js create mode 100644 _nodejs/node_modules/axios/lib/helpers/parseHeaders.js create mode 100644 _nodejs/node_modules/axios/lib/helpers/parseProtocol.js create mode 100644 _nodejs/node_modules/axios/lib/helpers/spread.js create mode 100644 _nodejs/node_modules/axios/lib/helpers/toFormData.js create mode 100644 _nodejs/node_modules/axios/lib/helpers/validator.js create mode 100644 _nodejs/node_modules/axios/lib/utils.js create mode 100644 _nodejs/node_modules/axios/package.json create mode 100644 _nodejs/node_modules/axios/tsconfig.json create mode 100644 _nodejs/node_modules/axios/tslint.json create mode 100644 _nodejs/node_modules/combined-stream/License create mode 100644 _nodejs/node_modules/combined-stream/Readme.md create mode 100644 _nodejs/node_modules/combined-stream/lib/combined_stream.js create mode 100644 _nodejs/node_modules/combined-stream/package.json create mode 100644 _nodejs/node_modules/combined-stream/yarn.lock create mode 100644 _nodejs/node_modules/delayed-stream/.npmignore create mode 100644 _nodejs/node_modules/delayed-stream/License create mode 100644 _nodejs/node_modules/delayed-stream/Makefile create mode 100644 _nodejs/node_modules/delayed-stream/Readme.md create mode 100644 _nodejs/node_modules/delayed-stream/lib/delayed_stream.js create mode 100644 _nodejs/node_modules/delayed-stream/package.json create mode 100644 _nodejs/node_modules/follow-redirects/LICENSE create mode 100644 _nodejs/node_modules/follow-redirects/README.md create mode 100644 _nodejs/node_modules/follow-redirects/debug.js create mode 100644 _nodejs/node_modules/follow-redirects/http.js create mode 100644 _nodejs/node_modules/follow-redirects/https.js create mode 100644 _nodejs/node_modules/follow-redirects/index.js create mode 100644 _nodejs/node_modules/follow-redirects/package.json create mode 100644 _nodejs/node_modules/form-data/License create mode 100644 _nodejs/node_modules/form-data/README.md.bak create mode 100644 _nodejs/node_modules/form-data/Readme.md create mode 100644 _nodejs/node_modules/form-data/index.d.ts create mode 100644 _nodejs/node_modules/form-data/lib/browser.js create mode 100644 _nodejs/node_modules/form-data/lib/form_data.js create mode 100644 _nodejs/node_modules/form-data/lib/populate.js create mode 100644 _nodejs/node_modules/form-data/package.json create mode 100644 _nodejs/node_modules/log-prefix/README.md create mode 100644 _nodejs/node_modules/log-prefix/log-prefix.js create mode 100644 _nodejs/node_modules/log-prefix/package.json create mode 100644 _nodejs/node_modules/log-prefix/tests/func.js create mode 100644 _nodejs/node_modules/log-prefix/tests/simple.js create mode 100644 _nodejs/node_modules/log-timestamp/README.md create mode 100644 _nodejs/node_modules/log-timestamp/log-timestamp.js create mode 100644 _nodejs/node_modules/log-timestamp/package.json create mode 100644 _nodejs/node_modules/log-timestamp/tests/format.js create mode 100644 _nodejs/node_modules/log-timestamp/tests/func.js create mode 100644 _nodejs/node_modules/log-timestamp/tests/object.js create mode 100644 _nodejs/node_modules/log-timestamp/tests/test.js diff --git a/_nodejs/node_modules/.package-lock.json b/_nodejs/node_modules/.package-lock.json new file mode 100644 index 0000000..40734cd --- /dev/null +++ b/_nodejs/node_modules/.package-lock.json @@ -0,0 +1,604 @@ +{ + "name": "krakensdr_middleware", + "version": "1.0.0", + "lockfileVersion": 2, + "requires": true, + "packages": { + "node_modules/accepts": { + "version": "1.3.8", + "resolved": "https://registry.npmjs.org/accepts/-/accepts-1.3.8.tgz", + "integrity": "sha512-PYAthTa2m2VKxuvSD3DPC/Gy+U+sOA1LAuT8mkmRuvw+NACSaeXEQ+NHcVF7rONl6qcaxV3Uuemwawk+7+SJLw==", + "dependencies": { + "mime-types": "~2.1.34", + "negotiator": "0.6.3" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/array-flatten": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/array-flatten/-/array-flatten-1.1.1.tgz", + "integrity": "sha1-ml9pkFGx5wczKPKgCJaLZOopVdI=" + }, + "node_modules/asynckit": { + "version": "0.4.0", + "resolved": "https://registry.npmjs.org/asynckit/-/asynckit-0.4.0.tgz", + "integrity": "sha512-Oei9OH4tRh0YqU3GxhX79dM/mwVgvbZJaSNaRk+bshkj0S5cfHcgYakreBjrHwatXKbz+IoIdYLxrKim2MjW0Q==" + }, + "node_modules/axios": { + "version": "0.27.2", + "resolved": "https://registry.npmjs.org/axios/-/axios-0.27.2.tgz", + "integrity": "sha512-t+yRIyySRTp/wua5xEr+z1q60QmLq8ABsS5O9Me1AsE5dfKqgnCFzwiCZZ/cGNd1lq4/7akDWMxdhVlucjmnOQ==", + "dependencies": { + "follow-redirects": "^1.14.9", + "form-data": "^4.0.0" + } + }, + "node_modules/body-parser": { + "version": "1.19.2", + "resolved": "https://registry.npmjs.org/body-parser/-/body-parser-1.19.2.tgz", + "integrity": "sha512-SAAwOxgoCKMGs9uUAUFHygfLAyaniaoun6I8mFY9pRAJL9+Kec34aU+oIjDhTycub1jozEfEwx1W1IuOYxVSFw==", + "dependencies": { + "bytes": "3.1.2", + "content-type": "~1.0.4", + "debug": "2.6.9", + "depd": "~1.1.2", + "http-errors": "1.8.1", + "iconv-lite": "0.4.24", + "on-finished": "~2.3.0", + "qs": "6.9.7", + "raw-body": "2.4.3", + "type-is": "~1.6.18" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/bytes": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/bytes/-/bytes-3.1.2.tgz", + "integrity": "sha512-/Nf7TyzTx6S3yRJObOAV7956r8cr2+Oj8AC5dt8wSP3BQAoeX58NoHyCU8P8zGkNXStjTSi6fzO6F0pBdcYbEg==", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/combined-stream": { + "version": "1.0.8", + "resolved": "https://registry.npmjs.org/combined-stream/-/combined-stream-1.0.8.tgz", + "integrity": "sha512-FQN4MRfuJeHf7cBbBMJFXhKSDq+2kAArBlmRBvcvFE5BB1HZKXtSFASDhdlz9zOYwxh8lDdnvmMOe/+5cdoEdg==", + "dependencies": { + "delayed-stream": "~1.0.0" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/content-disposition": { + "version": "0.5.4", + "resolved": "https://registry.npmjs.org/content-disposition/-/content-disposition-0.5.4.tgz", + "integrity": "sha512-FveZTNuGw04cxlAiWbzi6zTAL/lhehaWbTtgluJh4/E95DqMwTmha3KZN1aAWA8cFIhHzMZUvLevkw5Rqk+tSQ==", + "dependencies": { + "safe-buffer": "5.2.1" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/content-type": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/content-type/-/content-type-1.0.4.tgz", + "integrity": "sha512-hIP3EEPs8tB9AT1L+NUqtwOAps4mk2Zob89MWXMHjHWg9milF/j4osnnQLXBCBFBk/tvIG/tUc9mOUJiPBhPXA==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/cookie": { + "version": "0.4.2", + "resolved": "https://registry.npmjs.org/cookie/-/cookie-0.4.2.tgz", + "integrity": "sha512-aSWTXFzaKWkvHO1Ny/s+ePFpvKsPnjc551iI41v3ny/ow6tBG5Vd+FuqGNhh1LxOmVzOlGUriIlOaokOvhaStA==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/cookie-signature": { + "version": "1.0.6", + "resolved": "https://registry.npmjs.org/cookie-signature/-/cookie-signature-1.0.6.tgz", + "integrity": "sha1-4wOogrNCzD7oylE6eZmXNNqzriw=" + }, + "node_modules/debug": { + "version": "2.6.9", + "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", + "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/delayed-stream": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/delayed-stream/-/delayed-stream-1.0.0.tgz", + "integrity": "sha512-ZySD7Nf91aLB0RxL4KGrKHBXl7Eds1DAmEdcoVawXnLD7SDhpNgtuII2aAkg7a7QS41jxPSZ17p4VdGnMHk3MQ==", + "engines": { + "node": ">=0.4.0" + } + }, + "node_modules/depd": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/depd/-/depd-1.1.2.tgz", + "integrity": "sha1-m81S4UwJd2PnSbJ0xDRu0uVgtak=", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/destroy": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/destroy/-/destroy-1.0.4.tgz", + "integrity": "sha1-l4hXRCxEdJ5CBmE+N5RiBYJqvYA=" + }, + "node_modules/ee-first": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/ee-first/-/ee-first-1.1.1.tgz", + "integrity": "sha1-WQxhFWsK4vTwJVcyoViyZrxWsh0=" + }, + "node_modules/encodeurl": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-1.0.2.tgz", + "integrity": "sha1-rT/0yG7C0CkyL1oCw6mmBslbP1k=", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/escape-html": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/escape-html/-/escape-html-1.0.3.tgz", + "integrity": "sha1-Aljq5NPQwJdN4cFpGI7wBR0dGYg=" + }, + "node_modules/etag": { + "version": "1.8.1", + "resolved": "https://registry.npmjs.org/etag/-/etag-1.8.1.tgz", + "integrity": "sha1-Qa4u62XvpiJorr/qg6x9eSmbCIc=", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/express": { + "version": "4.17.3", + "resolved": "https://registry.npmjs.org/express/-/express-4.17.3.tgz", + "integrity": "sha512-yuSQpz5I+Ch7gFrPCk4/c+dIBKlQUxtgwqzph132bsT6qhuzss6I8cLJQz7B3rFblzd6wtcI0ZbGltH/C4LjUg==", + "dependencies": { + "accepts": "~1.3.8", + "array-flatten": "1.1.1", + "body-parser": "1.19.2", + "content-disposition": "0.5.4", + "content-type": "~1.0.4", + "cookie": "0.4.2", + "cookie-signature": "1.0.6", + "debug": "2.6.9", + "depd": "~1.1.2", + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "etag": "~1.8.1", + "finalhandler": "~1.1.2", + "fresh": "0.5.2", + "merge-descriptors": "1.0.1", + "methods": "~1.1.2", + "on-finished": "~2.3.0", + "parseurl": "~1.3.3", + "path-to-regexp": "0.1.7", + "proxy-addr": "~2.0.7", + "qs": "6.9.7", + "range-parser": "~1.2.1", + "safe-buffer": "5.2.1", + "send": "0.17.2", + "serve-static": "1.14.2", + "setprototypeof": "1.2.0", + "statuses": "~1.5.0", + "type-is": "~1.6.18", + "utils-merge": "1.0.1", + "vary": "~1.1.2" + }, + "engines": { + "node": ">= 0.10.0" + } + }, + "node_modules/finalhandler": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/finalhandler/-/finalhandler-1.1.2.tgz", + "integrity": "sha512-aAWcW57uxVNrQZqFXjITpW3sIUQmHGG3qSb9mUah9MgMC4NeWhNOlNjXEYq3HjRAvL6arUviZGGJsBg6z0zsWA==", + "dependencies": { + "debug": "2.6.9", + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "on-finished": "~2.3.0", + "parseurl": "~1.3.3", + "statuses": "~1.5.0", + "unpipe": "~1.0.0" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/follow-redirects": { + "version": "1.15.1", + "resolved": "https://registry.npmjs.org/follow-redirects/-/follow-redirects-1.15.1.tgz", + "integrity": "sha512-yLAMQs+k0b2m7cVxpS1VKJVvoz7SS9Td1zss3XRwXj+ZDH00RJgnuLx7E44wx02kQLrdM3aOOy+FpzS7+8OizA==", + "funding": [ + { + "type": "individual", + "url": "https://github.com/sponsors/RubenVerborgh" + } + ], + "engines": { + "node": ">=4.0" + }, + "peerDependenciesMeta": { + "debug": { + "optional": true + } + } + }, + "node_modules/form-data": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/form-data/-/form-data-4.0.0.tgz", + "integrity": "sha512-ETEklSGi5t0QMZuiXoA/Q6vcnxcLQP5vdugSpuAyi6SVGi2clPPp+xgEhuMaHC+zGgn31Kd235W35f7Hykkaww==", + "dependencies": { + "asynckit": "^0.4.0", + "combined-stream": "^1.0.8", + "mime-types": "^2.1.12" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/forwarded": { + "version": "0.2.0", + "resolved": "https://registry.npmjs.org/forwarded/-/forwarded-0.2.0.tgz", + "integrity": "sha512-buRG0fpBtRHSTCOASe6hD258tEubFoRLb4ZNA6NxMVHNw2gOcwHo9wyablzMzOA5z9xA9L1KNjk/Nt6MT9aYow==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/fresh": { + "version": "0.5.2", + "resolved": "https://registry.npmjs.org/fresh/-/fresh-0.5.2.tgz", + "integrity": "sha1-PYyt2Q2XZWn6g1qx+OSyOhBWBac=", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/http-errors": { + "version": "1.8.1", + "resolved": "https://registry.npmjs.org/http-errors/-/http-errors-1.8.1.tgz", + "integrity": "sha512-Kpk9Sm7NmI+RHhnj6OIWDI1d6fIoFAtFt9RLaTMRlg/8w49juAStsrBgp0Dp4OdxdVbRIeKhtCUvoi/RuAhO4g==", + "dependencies": { + "depd": "~1.1.2", + "inherits": "2.0.4", + "setprototypeof": "1.2.0", + "statuses": ">= 1.5.0 < 2", + "toidentifier": "1.0.1" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/iconv-lite": { + "version": "0.4.24", + "resolved": "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.4.24.tgz", + "integrity": "sha512-v3MXnZAcvnywkTUEZomIActle7RXXeedOR31wwl7VlyoXO4Qi9arvSenNQWne1TcRwhCL1HwLI21bEqdpj8/rA==", + "dependencies": { + "safer-buffer": ">= 2.1.2 < 3" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/inherits": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz", + "integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==" + }, + "node_modules/ipaddr.js": { + "version": "1.9.1", + "resolved": "https://registry.npmjs.org/ipaddr.js/-/ipaddr.js-1.9.1.tgz", + "integrity": "sha512-0KI/607xoxSToH7GjN1FfSbLoU0+btTicjsQSWQlh/hZykN8KpmMf7uYwPW3R+akZ6R/w18ZlXSHBYXiYUPO3g==", + "engines": { + "node": ">= 0.10" + } + }, + "node_modules/log-prefix": { + "version": "0.1.1", + "resolved": "https://registry.npmjs.org/log-prefix/-/log-prefix-0.1.1.tgz", + "integrity": "sha512-aP1Lst8OCdZKATqzXDN0JBissNVZuiKLyo6hOXDBxaQ1jHDsaxh2J1i5Pp0zMy6ayTKDWfUlLMXyLaQe1PJ48g==", + "engines": { + "node": "*" + } + }, + "node_modules/log-timestamp": { + "version": "0.3.0", + "resolved": "https://registry.npmjs.org/log-timestamp/-/log-timestamp-0.3.0.tgz", + "integrity": "sha512-luRz6soxijd1aJh0GkLXFjKABihxthvTfWTzu3XhCgg5EivG2bsTpSd63QFbUgS+/KmFtL+0RfSpeaD2QvOV8Q==", + "dependencies": { + "log-prefix": "0.1.1" + }, + "engines": { + "node": "*" + } + }, + "node_modules/media-typer": { + "version": "0.3.0", + "resolved": "https://registry.npmjs.org/media-typer/-/media-typer-0.3.0.tgz", + "integrity": "sha1-hxDXrwqmJvj/+hzgAWhUUmMlV0g=", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/merge-descriptors": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/merge-descriptors/-/merge-descriptors-1.0.1.tgz", + "integrity": "sha1-sAqqVW3YtEVoFQ7J0blT8/kMu2E=" + }, + "node_modules/methods": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/methods/-/methods-1.1.2.tgz", + "integrity": "sha1-VSmk1nZUE07cxSZmVoNbD4Ua/O4=", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/mime": { + "version": "1.6.0", + "resolved": "https://registry.npmjs.org/mime/-/mime-1.6.0.tgz", + "integrity": "sha512-x0Vn8spI+wuJ1O6S7gnbaQg8Pxh4NNHb7KSINmEWKiPE4RKOplvijn+NkmYmmRgP68mc70j2EbeTFRsrswaQeg==", + "bin": { + "mime": "cli.js" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/mime-db": { + "version": "1.52.0", + "resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.52.0.tgz", + "integrity": "sha512-sPU4uV7dYlvtWJxwwxHD0PuihVNiE7TyAbQ5SWxDCB9mUYvOgroQOwYQQOKPJ8CIbE+1ETVlOoK1UC2nU3gYvg==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/mime-types": { + "version": "2.1.35", + "resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.35.tgz", + "integrity": "sha512-ZDY+bPm5zTTF+YpCrAU9nK0UgICYPT0QtT1NZWFv4s++TNkcgVaT0g6+4R2uI4MjQjzysHB1zxuWL50hzaeXiw==", + "dependencies": { + "mime-db": "1.52.0" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" + }, + "node_modules/negotiator": { + "version": "0.6.3", + "resolved": "https://registry.npmjs.org/negotiator/-/negotiator-0.6.3.tgz", + "integrity": "sha512-+EUsqGPLsM+j/zdChZjsnX51g4XrHFOIXwfnCVPGlQk/k5giakcKsuxCObBRu6DSm9opw/O6slWbJdghQM4bBg==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/on-finished": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/on-finished/-/on-finished-2.3.0.tgz", + "integrity": "sha1-IPEzZIGwg811M3mSoWlxqi2QaUc=", + "dependencies": { + "ee-first": "1.1.1" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/parseurl": { + "version": "1.3.3", + "resolved": "https://registry.npmjs.org/parseurl/-/parseurl-1.3.3.tgz", + "integrity": "sha512-CiyeOxFT/JZyN5m0z9PfXw4SCBJ6Sygz1Dpl0wqjlhDEGGBP1GnsUVEL0p63hoG1fcj3fHynXi9NYO4nWOL+qQ==", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/path-to-regexp": { + "version": "0.1.7", + "resolved": "https://registry.npmjs.org/path-to-regexp/-/path-to-regexp-0.1.7.tgz", + "integrity": "sha1-32BBeABfUi8V60SQ5yR6G/qmf4w=" + }, + "node_modules/proxy-addr": { + "version": "2.0.7", + "resolved": "https://registry.npmjs.org/proxy-addr/-/proxy-addr-2.0.7.tgz", + "integrity": "sha512-llQsMLSUDUPT44jdrU/O37qlnifitDP+ZwrmmZcoSKyLKvtZxpyV0n2/bD/N4tBAAZ/gJEdZU7KMraoK1+XYAg==", + "dependencies": { + "forwarded": "0.2.0", + "ipaddr.js": "1.9.1" + }, + "engines": { + "node": ">= 0.10" + } + }, + "node_modules/qs": { + "version": "6.9.7", + "resolved": "https://registry.npmjs.org/qs/-/qs-6.9.7.tgz", + "integrity": "sha512-IhMFgUmuNpyRfxA90umL7ByLlgRXu6tIfKPpF5TmcfRLlLCckfP/g3IQmju6jjpu+Hh8rA+2p6A27ZSPOOHdKw==", + "engines": { + "node": ">=0.6" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/range-parser": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/range-parser/-/range-parser-1.2.1.tgz", + "integrity": "sha512-Hrgsx+orqoygnmhFbKaHE6c296J+HTAQXoxEF6gNupROmmGJRoyzfG3ccAveqCBrwr/2yxQ5BVd/GTl5agOwSg==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/raw-body": { + "version": "2.4.3", + "resolved": "https://registry.npmjs.org/raw-body/-/raw-body-2.4.3.tgz", + "integrity": "sha512-UlTNLIcu0uzb4D2f4WltY6cVjLi+/jEN4lgEUj3E04tpMDpUlkBo/eSn6zou9hum2VMNpCCUone0O0WeJim07g==", + "dependencies": { + "bytes": "3.1.2", + "http-errors": "1.8.1", + "iconv-lite": "0.4.24", + "unpipe": "1.0.0" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/safe-buffer": { + "version": "5.2.1", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.2.1.tgz", + "integrity": "sha512-rp3So07KcdmmKbGvgaNxQSJr7bGVSVk5S9Eq1F+ppbRo70+YeaDxkw5Dd8NPN+GD6bjnYm2VuPuCXmpuYvmCXQ==", + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/feross" + }, + { + "type": "patreon", + "url": "https://www.patreon.com/feross" + }, + { + "type": "consulting", + "url": "https://feross.org/support" + } + ] + }, + "node_modules/safer-buffer": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/safer-buffer/-/safer-buffer-2.1.2.tgz", + "integrity": "sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg==" + }, + "node_modules/send": { + "version": "0.17.2", + "resolved": "https://registry.npmjs.org/send/-/send-0.17.2.tgz", + "integrity": "sha512-UJYB6wFSJE3G00nEivR5rgWp8c2xXvJ3OPWPhmuteU0IKj8nKbG3DrjiOmLwpnHGYWAVwA69zmTm++YG0Hmwww==", + "dependencies": { + "debug": "2.6.9", + "depd": "~1.1.2", + "destroy": "~1.0.4", + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "etag": "~1.8.1", + "fresh": "0.5.2", + "http-errors": "1.8.1", + "mime": "1.6.0", + "ms": "2.1.3", + "on-finished": "~2.3.0", + "range-parser": "~1.2.1", + "statuses": "~1.5.0" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/send/node_modules/ms": { + "version": "2.1.3", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.3.tgz", + "integrity": "sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==" + }, + "node_modules/serve-static": { + "version": "1.14.2", + "resolved": "https://registry.npmjs.org/serve-static/-/serve-static-1.14.2.tgz", + "integrity": "sha512-+TMNA9AFxUEGuC0z2mevogSnn9MXKb4fa7ngeRMJaaGv8vTwnIEkKi+QGvPt33HSnf8pRS+WGM0EbMtCJLKMBQ==", + "dependencies": { + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "parseurl": "~1.3.3", + "send": "0.17.2" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/setprototypeof": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/setprototypeof/-/setprototypeof-1.2.0.tgz", + "integrity": "sha512-E5LDX7Wrp85Kil5bhZv46j8jOeboKq5JMmYM3gVGdGH8xFpPWXUMsNrlODCrkoxMEeNi/XZIwuRvY4XNwYMJpw==" + }, + "node_modules/statuses": { + "version": "1.5.0", + "resolved": "https://registry.npmjs.org/statuses/-/statuses-1.5.0.tgz", + "integrity": "sha1-Fhx9rBd2Wf2YEfQ3cfqZOBR4Yow=", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/toidentifier": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/toidentifier/-/toidentifier-1.0.1.tgz", + "integrity": "sha512-o5sSPKEkg/DIQNmH43V0/uerLrpzVedkUh8tGNvaeXpfpuwjKenlSox/2O/BTlZUtEe+JG7s5YhEz608PlAHRA==", + "engines": { + "node": ">=0.6" + } + }, + "node_modules/type-is": { + "version": "1.6.18", + "resolved": "https://registry.npmjs.org/type-is/-/type-is-1.6.18.tgz", + "integrity": "sha512-TkRKr9sUTxEH8MdfuCSP7VizJyzRNMjj2J2do2Jr3Kym598JVdEksuzPQCnlFPW4ky9Q+iA+ma9BGm06XQBy8g==", + "dependencies": { + "media-typer": "0.3.0", + "mime-types": "~2.1.24" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/unpipe": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/unpipe/-/unpipe-1.0.0.tgz", + "integrity": "sha1-sr9O6FFKrmFltIF4KdIbLvSZBOw=", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/utils-merge": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/utils-merge/-/utils-merge-1.0.1.tgz", + "integrity": "sha1-n5VxD1CiZ5R7LMwSR0HBAoQn5xM=", + "engines": { + "node": ">= 0.4.0" + } + }, + "node_modules/vary": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/vary/-/vary-1.1.2.tgz", + "integrity": "sha1-IpnwLG3tMNSllhsLn3RSShj2NPw=", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/ws": { + "version": "8.5.0", + "resolved": "https://registry.npmjs.org/ws/-/ws-8.5.0.tgz", + "integrity": "sha512-BWX0SWVgLPzYwF8lTzEy1egjhS4S4OEAHfsO8o65WOVsrnSRGaSiUaa9e0ggGlkMTtBlmOpEXiie9RUcBO86qg==", + "engines": { + "node": ">=10.0.0" + }, + "peerDependencies": { + "bufferutil": "^4.0.1", + "utf-8-validate": "^5.0.2" + }, + "peerDependenciesMeta": { + "bufferutil": { + "optional": true + }, + "utf-8-validate": { + "optional": true + } + } + } + } +} diff --git a/_nodejs/node_modules/asynckit/LICENSE b/_nodejs/node_modules/asynckit/LICENSE new file mode 100644 index 0000000..c9eca5d --- /dev/null +++ b/_nodejs/node_modules/asynckit/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2016 Alex Indigo + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/_nodejs/node_modules/asynckit/README.md b/_nodejs/node_modules/asynckit/README.md new file mode 100644 index 0000000..ddcc7e6 --- /dev/null +++ b/_nodejs/node_modules/asynckit/README.md @@ -0,0 +1,233 @@ +# asynckit [![NPM Module](https://img.shields.io/npm/v/asynckit.svg?style=flat)](https://www.npmjs.com/package/asynckit) + +Minimal async jobs utility library, with streams support. + +[![PhantomJS Build](https://img.shields.io/travis/alexindigo/asynckit/v0.4.0.svg?label=browser&style=flat)](https://travis-ci.org/alexindigo/asynckit) +[![Linux Build](https://img.shields.io/travis/alexindigo/asynckit/v0.4.0.svg?label=linux:0.12-6.x&style=flat)](https://travis-ci.org/alexindigo/asynckit) +[![Windows Build](https://img.shields.io/appveyor/ci/alexindigo/asynckit/v0.4.0.svg?label=windows:0.12-6.x&style=flat)](https://ci.appveyor.com/project/alexindigo/asynckit) + +[![Coverage Status](https://img.shields.io/coveralls/alexindigo/asynckit/v0.4.0.svg?label=code+coverage&style=flat)](https://coveralls.io/github/alexindigo/asynckit?branch=master) +[![Dependency Status](https://img.shields.io/david/alexindigo/asynckit/v0.4.0.svg?style=flat)](https://david-dm.org/alexindigo/asynckit) +[![bitHound Overall Score](https://www.bithound.io/github/alexindigo/asynckit/badges/score.svg)](https://www.bithound.io/github/alexindigo/asynckit) + + + +AsyncKit provides harness for `parallel` and `serial` iterators over list of items represented by arrays or objects. +Optionally it accepts abort function (should be synchronously return by iterator for each item), and terminates left over jobs upon an error event. For specific iteration order built-in (`ascending` and `descending`) and custom sort helpers also supported, via `asynckit.serialOrdered` method. + +It ensures async operations to keep behavior more stable and prevent `Maximum call stack size exceeded` errors, from sync iterators. + +| compression | size | +| :----------------- | -------: | +| asynckit.js | 12.34 kB | +| asynckit.min.js | 4.11 kB | +| asynckit.min.js.gz | 1.47 kB | + + +## Install + +```sh +$ npm install --save asynckit +``` + +## Examples + +### Parallel Jobs + +Runs iterator over provided array in parallel. Stores output in the `result` array, +on the matching positions. In unlikely event of an error from one of the jobs, +will terminate rest of the active jobs (if abort function is provided) +and return error along with salvaged data to the main callback function. + +#### Input Array + +```javascript +var parallel = require('asynckit').parallel + , assert = require('assert') + ; + +var source = [ 1, 1, 4, 16, 64, 32, 8, 2 ] + , expectedResult = [ 2, 2, 8, 32, 128, 64, 16, 4 ] + , expectedTarget = [ 1, 1, 2, 4, 8, 16, 32, 64 ] + , target = [] + ; + +parallel(source, asyncJob, function(err, result) +{ + assert.deepEqual(result, expectedResult); + assert.deepEqual(target, expectedTarget); +}); + +// async job accepts one element from the array +// and a callback function +function asyncJob(item, cb) +{ + // different delays (in ms) per item + var delay = item * 25; + + // pretend different jobs take different time to finish + // and not in consequential order + var timeoutId = setTimeout(function() { + target.push(item); + cb(null, item * 2); + }, delay); + + // allow to cancel "leftover" jobs upon error + // return function, invoking of which will abort this job + return clearTimeout.bind(null, timeoutId); +} +``` + +More examples could be found in [test/test-parallel-array.js](test/test-parallel-array.js). + +#### Input Object + +Also it supports named jobs, listed via object. + +```javascript +var parallel = require('asynckit/parallel') + , assert = require('assert') + ; + +var source = { first: 1, one: 1, four: 4, sixteen: 16, sixtyFour: 64, thirtyTwo: 32, eight: 8, two: 2 } + , expectedResult = { first: 2, one: 2, four: 8, sixteen: 32, sixtyFour: 128, thirtyTwo: 64, eight: 16, two: 4 } + , expectedTarget = [ 1, 1, 2, 4, 8, 16, 32, 64 ] + , expectedKeys = [ 'first', 'one', 'two', 'four', 'eight', 'sixteen', 'thirtyTwo', 'sixtyFour' ] + , target = [] + , keys = [] + ; + +parallel(source, asyncJob, function(err, result) +{ + assert.deepEqual(result, expectedResult); + assert.deepEqual(target, expectedTarget); + assert.deepEqual(keys, expectedKeys); +}); + +// supports full value, key, callback (shortcut) interface +function asyncJob(item, key, cb) +{ + // different delays (in ms) per item + var delay = item * 25; + + // pretend different jobs take different time to finish + // and not in consequential order + var timeoutId = setTimeout(function() { + keys.push(key); + target.push(item); + cb(null, item * 2); + }, delay); + + // allow to cancel "leftover" jobs upon error + // return function, invoking of which will abort this job + return clearTimeout.bind(null, timeoutId); +} +``` + +More examples could be found in [test/test-parallel-object.js](test/test-parallel-object.js). + +### Serial Jobs + +Runs iterator over provided array sequentially. Stores output in the `result` array, +on the matching positions. In unlikely event of an error from one of the jobs, +will not proceed to the rest of the items in the list +and return error along with salvaged data to the main callback function. + +#### Input Array + +```javascript +var serial = require('asynckit/serial') + , assert = require('assert') + ; + +var source = [ 1, 1, 4, 16, 64, 32, 8, 2 ] + , expectedResult = [ 2, 2, 8, 32, 128, 64, 16, 4 ] + , expectedTarget = [ 0, 1, 2, 3, 4, 5, 6, 7 ] + , target = [] + ; + +serial(source, asyncJob, function(err, result) +{ + assert.deepEqual(result, expectedResult); + assert.deepEqual(target, expectedTarget); +}); + +// extended interface (item, key, callback) +// also supported for arrays +function asyncJob(item, key, cb) +{ + target.push(key); + + // it will be automatically made async + // even it iterator "returns" in the same event loop + cb(null, item * 2); +} +``` + +More examples could be found in [test/test-serial-array.js](test/test-serial-array.js). + +#### Input Object + +Also it supports named jobs, listed via object. + +```javascript +var serial = require('asynckit').serial + , assert = require('assert') + ; + +var source = [ 1, 1, 4, 16, 64, 32, 8, 2 ] + , expectedResult = [ 2, 2, 8, 32, 128, 64, 16, 4 ] + , expectedTarget = [ 0, 1, 2, 3, 4, 5, 6, 7 ] + , target = [] + ; + +var source = { first: 1, one: 1, four: 4, sixteen: 16, sixtyFour: 64, thirtyTwo: 32, eight: 8, two: 2 } + , expectedResult = { first: 2, one: 2, four: 8, sixteen: 32, sixtyFour: 128, thirtyTwo: 64, eight: 16, two: 4 } + , expectedTarget = [ 1, 1, 4, 16, 64, 32, 8, 2 ] + , target = [] + ; + + +serial(source, asyncJob, function(err, result) +{ + assert.deepEqual(result, expectedResult); + assert.deepEqual(target, expectedTarget); +}); + +// shortcut interface (item, callback) +// works for object as well as for the arrays +function asyncJob(item, cb) +{ + target.push(item); + + // it will be automatically made async + // even it iterator "returns" in the same event loop + cb(null, item * 2); +} +``` + +More examples could be found in [test/test-serial-object.js](test/test-serial-object.js). + +_Note: Since _object_ is an _unordered_ collection of properties, +it may produce unexpected results with sequential iterations. +Whenever order of the jobs' execution is important please use `serialOrdered` method._ + +### Ordered Serial Iterations + +TBD + +For example [compare-property](compare-property) package. + +### Streaming interface + +TBD + +## Want to Know More? + +More examples can be found in [test folder](test/). + +Or open an [issue](https://github.com/alexindigo/asynckit/issues) with questions and/or suggestions. + +## License + +AsyncKit is licensed under the MIT license. diff --git a/_nodejs/node_modules/asynckit/bench.js b/_nodejs/node_modules/asynckit/bench.js new file mode 100644 index 0000000..c612f1a --- /dev/null +++ b/_nodejs/node_modules/asynckit/bench.js @@ -0,0 +1,76 @@ +/* eslint no-console: "off" */ + +var asynckit = require('./') + , async = require('async') + , assert = require('assert') + , expected = 0 + ; + +var Benchmark = require('benchmark'); +var suite = new Benchmark.Suite; + +var source = []; +for (var z = 1; z < 100; z++) +{ + source.push(z); + expected += z; +} + +suite +// add tests + +.add('async.map', function(deferred) +{ + var total = 0; + + async.map(source, + function(i, cb) + { + setImmediate(function() + { + total += i; + cb(null, total); + }); + }, + function(err, result) + { + assert.ifError(err); + assert.equal(result[result.length - 1], expected); + deferred.resolve(); + }); +}, {'defer': true}) + + +.add('asynckit.parallel', function(deferred) +{ + var total = 0; + + asynckit.parallel(source, + function(i, cb) + { + setImmediate(function() + { + total += i; + cb(null, total); + }); + }, + function(err, result) + { + assert.ifError(err); + assert.equal(result[result.length - 1], expected); + deferred.resolve(); + }); +}, {'defer': true}) + + +// add listeners +.on('cycle', function(ev) +{ + console.log(String(ev.target)); +}) +.on('complete', function() +{ + console.log('Fastest is ' + this.filter('fastest').map('name')); +}) +// run async +.run({ 'async': true }); diff --git a/_nodejs/node_modules/asynckit/index.js b/_nodejs/node_modules/asynckit/index.js new file mode 100644 index 0000000..455f945 --- /dev/null +++ b/_nodejs/node_modules/asynckit/index.js @@ -0,0 +1,6 @@ +module.exports = +{ + parallel : require('./parallel.js'), + serial : require('./serial.js'), + serialOrdered : require('./serialOrdered.js') +}; diff --git a/_nodejs/node_modules/asynckit/lib/abort.js b/_nodejs/node_modules/asynckit/lib/abort.js new file mode 100644 index 0000000..114367e --- /dev/null +++ b/_nodejs/node_modules/asynckit/lib/abort.js @@ -0,0 +1,29 @@ +// API +module.exports = abort; + +/** + * Aborts leftover active jobs + * + * @param {object} state - current state object + */ +function abort(state) +{ + Object.keys(state.jobs).forEach(clean.bind(state)); + + // reset leftover jobs + state.jobs = {}; +} + +/** + * Cleans up leftover job by invoking abort function for the provided job id + * + * @this state + * @param {string|number} key - job id to abort + */ +function clean(key) +{ + if (typeof this.jobs[key] == 'function') + { + this.jobs[key](); + } +} diff --git a/_nodejs/node_modules/asynckit/lib/async.js b/_nodejs/node_modules/asynckit/lib/async.js new file mode 100644 index 0000000..7f1288a --- /dev/null +++ b/_nodejs/node_modules/asynckit/lib/async.js @@ -0,0 +1,34 @@ +var defer = require('./defer.js'); + +// API +module.exports = async; + +/** + * Runs provided callback asynchronously + * even if callback itself is not + * + * @param {function} callback - callback to invoke + * @returns {function} - augmented callback + */ +function async(callback) +{ + var isAsync = false; + + // check if async happened + defer(function() { isAsync = true; }); + + return function async_callback(err, result) + { + if (isAsync) + { + callback(err, result); + } + else + { + defer(function nextTick_callback() + { + callback(err, result); + }); + } + }; +} diff --git a/_nodejs/node_modules/asynckit/lib/defer.js b/_nodejs/node_modules/asynckit/lib/defer.js new file mode 100644 index 0000000..b67110c --- /dev/null +++ b/_nodejs/node_modules/asynckit/lib/defer.js @@ -0,0 +1,26 @@ +module.exports = defer; + +/** + * Runs provided function on next iteration of the event loop + * + * @param {function} fn - function to run + */ +function defer(fn) +{ + var nextTick = typeof setImmediate == 'function' + ? setImmediate + : ( + typeof process == 'object' && typeof process.nextTick == 'function' + ? process.nextTick + : null + ); + + if (nextTick) + { + nextTick(fn); + } + else + { + setTimeout(fn, 0); + } +} diff --git a/_nodejs/node_modules/asynckit/lib/iterate.js b/_nodejs/node_modules/asynckit/lib/iterate.js new file mode 100644 index 0000000..5d2839a --- /dev/null +++ b/_nodejs/node_modules/asynckit/lib/iterate.js @@ -0,0 +1,75 @@ +var async = require('./async.js') + , abort = require('./abort.js') + ; + +// API +module.exports = iterate; + +/** + * Iterates over each job object + * + * @param {array|object} list - array or object (named list) to iterate over + * @param {function} iterator - iterator to run + * @param {object} state - current job status + * @param {function} callback - invoked when all elements processed + */ +function iterate(list, iterator, state, callback) +{ + // store current index + var key = state['keyedList'] ? state['keyedList'][state.index] : state.index; + + state.jobs[key] = runJob(iterator, key, list[key], function(error, output) + { + // don't repeat yourself + // skip secondary callbacks + if (!(key in state.jobs)) + { + return; + } + + // clean up jobs + delete state.jobs[key]; + + if (error) + { + // don't process rest of the results + // stop still active jobs + // and reset the list + abort(state); + } + else + { + state.results[key] = output; + } + + // return salvaged results + callback(error, state.results); + }); +} + +/** + * Runs iterator over provided job element + * + * @param {function} iterator - iterator to invoke + * @param {string|number} key - key/index of the element in the list of jobs + * @param {mixed} item - job description + * @param {function} callback - invoked after iterator is done with the job + * @returns {function|mixed} - job abort function or something else + */ +function runJob(iterator, key, item, callback) +{ + var aborter; + + // allow shortcut if iterator expects only two arguments + if (iterator.length == 2) + { + aborter = iterator(item, async(callback)); + } + // otherwise go with full three arguments + else + { + aborter = iterator(item, key, async(callback)); + } + + return aborter; +} diff --git a/_nodejs/node_modules/asynckit/lib/readable_asynckit.js b/_nodejs/node_modules/asynckit/lib/readable_asynckit.js new file mode 100644 index 0000000..78ad240 --- /dev/null +++ b/_nodejs/node_modules/asynckit/lib/readable_asynckit.js @@ -0,0 +1,91 @@ +var streamify = require('./streamify.js') + , defer = require('./defer.js') + ; + +// API +module.exports = ReadableAsyncKit; + +/** + * Base constructor for all streams + * used to hold properties/methods + */ +function ReadableAsyncKit() +{ + ReadableAsyncKit.super_.apply(this, arguments); + + // list of active jobs + this.jobs = {}; + + // add stream methods + this.destroy = destroy; + this._start = _start; + this._read = _read; +} + +/** + * Destroys readable stream, + * by aborting outstanding jobs + * + * @returns {void} + */ +function destroy() +{ + if (this.destroyed) + { + return; + } + + this.destroyed = true; + + if (typeof this.terminator == 'function') + { + this.terminator(); + } +} + +/** + * Starts provided jobs in async manner + * + * @private + */ +function _start() +{ + // first argument – runner function + var runner = arguments[0] + // take away first argument + , args = Array.prototype.slice.call(arguments, 1) + // second argument - input data + , input = args[0] + // last argument - result callback + , endCb = streamify.callback.call(this, args[args.length - 1]) + ; + + args[args.length - 1] = endCb; + // third argument - iterator + args[1] = streamify.iterator.call(this, args[1]); + + // allow time for proper setup + defer(function() + { + if (!this.destroyed) + { + this.terminator = runner.apply(null, args); + } + else + { + endCb(null, Array.isArray(input) ? [] : {}); + } + }.bind(this)); +} + + +/** + * Implement _read to comply with Readable streams + * Doesn't really make sense for flowing object mode + * + * @private + */ +function _read() +{ + +} diff --git a/_nodejs/node_modules/asynckit/lib/readable_parallel.js b/_nodejs/node_modules/asynckit/lib/readable_parallel.js new file mode 100644 index 0000000..5d2929f --- /dev/null +++ b/_nodejs/node_modules/asynckit/lib/readable_parallel.js @@ -0,0 +1,25 @@ +var parallel = require('../parallel.js'); + +// API +module.exports = ReadableParallel; + +/** + * Streaming wrapper to `asynckit.parallel` + * + * @param {array|object} list - array or object (named list) to iterate over + * @param {function} iterator - iterator to run + * @param {function} callback - invoked when all elements processed + * @returns {stream.Readable#} + */ +function ReadableParallel(list, iterator, callback) +{ + if (!(this instanceof ReadableParallel)) + { + return new ReadableParallel(list, iterator, callback); + } + + // turn on object mode + ReadableParallel.super_.call(this, {objectMode: true}); + + this._start(parallel, list, iterator, callback); +} diff --git a/_nodejs/node_modules/asynckit/lib/readable_serial.js b/_nodejs/node_modules/asynckit/lib/readable_serial.js new file mode 100644 index 0000000..7822698 --- /dev/null +++ b/_nodejs/node_modules/asynckit/lib/readable_serial.js @@ -0,0 +1,25 @@ +var serial = require('../serial.js'); + +// API +module.exports = ReadableSerial; + +/** + * Streaming wrapper to `asynckit.serial` + * + * @param {array|object} list - array or object (named list) to iterate over + * @param {function} iterator - iterator to run + * @param {function} callback - invoked when all elements processed + * @returns {stream.Readable#} + */ +function ReadableSerial(list, iterator, callback) +{ + if (!(this instanceof ReadableSerial)) + { + return new ReadableSerial(list, iterator, callback); + } + + // turn on object mode + ReadableSerial.super_.call(this, {objectMode: true}); + + this._start(serial, list, iterator, callback); +} diff --git a/_nodejs/node_modules/asynckit/lib/readable_serial_ordered.js b/_nodejs/node_modules/asynckit/lib/readable_serial_ordered.js new file mode 100644 index 0000000..3de89c4 --- /dev/null +++ b/_nodejs/node_modules/asynckit/lib/readable_serial_ordered.js @@ -0,0 +1,29 @@ +var serialOrdered = require('../serialOrdered.js'); + +// API +module.exports = ReadableSerialOrdered; +// expose sort helpers +module.exports.ascending = serialOrdered.ascending; +module.exports.descending = serialOrdered.descending; + +/** + * Streaming wrapper to `asynckit.serialOrdered` + * + * @param {array|object} list - array or object (named list) to iterate over + * @param {function} iterator - iterator to run + * @param {function} sortMethod - custom sort function + * @param {function} callback - invoked when all elements processed + * @returns {stream.Readable#} + */ +function ReadableSerialOrdered(list, iterator, sortMethod, callback) +{ + if (!(this instanceof ReadableSerialOrdered)) + { + return new ReadableSerialOrdered(list, iterator, sortMethod, callback); + } + + // turn on object mode + ReadableSerialOrdered.super_.call(this, {objectMode: true}); + + this._start(serialOrdered, list, iterator, sortMethod, callback); +} diff --git a/_nodejs/node_modules/asynckit/lib/state.js b/_nodejs/node_modules/asynckit/lib/state.js new file mode 100644 index 0000000..cbea7ad --- /dev/null +++ b/_nodejs/node_modules/asynckit/lib/state.js @@ -0,0 +1,37 @@ +// API +module.exports = state; + +/** + * Creates initial state object + * for iteration over list + * + * @param {array|object} list - list to iterate over + * @param {function|null} sortMethod - function to use for keys sort, + * or `null` to keep them as is + * @returns {object} - initial state object + */ +function state(list, sortMethod) +{ + var isNamedList = !Array.isArray(list) + , initState = + { + index : 0, + keyedList: isNamedList || sortMethod ? Object.keys(list) : null, + jobs : {}, + results : isNamedList ? {} : [], + size : isNamedList ? Object.keys(list).length : list.length + } + ; + + if (sortMethod) + { + // sort array keys based on it's values + // sort object's keys just on own merit + initState.keyedList.sort(isNamedList ? sortMethod : function(a, b) + { + return sortMethod(list[a], list[b]); + }); + } + + return initState; +} diff --git a/_nodejs/node_modules/asynckit/lib/streamify.js b/_nodejs/node_modules/asynckit/lib/streamify.js new file mode 100644 index 0000000..f56a1c9 --- /dev/null +++ b/_nodejs/node_modules/asynckit/lib/streamify.js @@ -0,0 +1,141 @@ +var async = require('./async.js'); + +// API +module.exports = { + iterator: wrapIterator, + callback: wrapCallback +}; + +/** + * Wraps iterators with long signature + * + * @this ReadableAsyncKit# + * @param {function} iterator - function to wrap + * @returns {function} - wrapped function + */ +function wrapIterator(iterator) +{ + var stream = this; + + return function(item, key, cb) + { + var aborter + , wrappedCb = async(wrapIteratorCallback.call(stream, cb, key)) + ; + + stream.jobs[key] = wrappedCb; + + // it's either shortcut (item, cb) + if (iterator.length == 2) + { + aborter = iterator(item, wrappedCb); + } + // or long format (item, key, cb) + else + { + aborter = iterator(item, key, wrappedCb); + } + + return aborter; + }; +} + +/** + * Wraps provided callback function + * allowing to execute snitch function before + * real callback + * + * @this ReadableAsyncKit# + * @param {function} callback - function to wrap + * @returns {function} - wrapped function + */ +function wrapCallback(callback) +{ + var stream = this; + + var wrapped = function(error, result) + { + return finisher.call(stream, error, result, callback); + }; + + return wrapped; +} + +/** + * Wraps provided iterator callback function + * makes sure snitch only called once, + * but passes secondary calls to the original callback + * + * @this ReadableAsyncKit# + * @param {function} callback - callback to wrap + * @param {number|string} key - iteration key + * @returns {function} wrapped callback + */ +function wrapIteratorCallback(callback, key) +{ + var stream = this; + + return function(error, output) + { + // don't repeat yourself + if (!(key in stream.jobs)) + { + callback(error, output); + return; + } + + // clean up jobs + delete stream.jobs[key]; + + return streamer.call(stream, error, {key: key, value: output}, callback); + }; +} + +/** + * Stream wrapper for iterator callback + * + * @this ReadableAsyncKit# + * @param {mixed} error - error response + * @param {mixed} output - iterator output + * @param {function} callback - callback that expects iterator results + */ +function streamer(error, output, callback) +{ + if (error && !this.error) + { + this.error = error; + this.pause(); + this.emit('error', error); + // send back value only, as expected + callback(error, output && output.value); + return; + } + + // stream stuff + this.push(output); + + // back to original track + // send back value only, as expected + callback(error, output && output.value); +} + +/** + * Stream wrapper for finishing callback + * + * @this ReadableAsyncKit# + * @param {mixed} error - error response + * @param {mixed} output - iterator output + * @param {function} callback - callback that expects final results + */ +function finisher(error, output, callback) +{ + // signal end of the stream + // only for successfully finished streams + if (!error) + { + this.push(null); + } + + // back to original track + callback(error, output); +} diff --git a/_nodejs/node_modules/asynckit/lib/terminator.js b/_nodejs/node_modules/asynckit/lib/terminator.js new file mode 100644 index 0000000..d6eb992 --- /dev/null +++ b/_nodejs/node_modules/asynckit/lib/terminator.js @@ -0,0 +1,29 @@ +var abort = require('./abort.js') + , async = require('./async.js') + ; + +// API +module.exports = terminator; + +/** + * Terminates jobs in the attached state context + * + * @this AsyncKitState# + * @param {function} callback - final callback to invoke after termination + */ +function terminator(callback) +{ + if (!Object.keys(this.jobs).length) + { + return; + } + + // fast forward iteration index + this.index = this.size; + + // abort jobs + abort(this); + + // send back results we have so far + async(callback)(null, this.results); +} diff --git a/_nodejs/node_modules/asynckit/package.json b/_nodejs/node_modules/asynckit/package.json new file mode 100644 index 0000000..51147d6 --- /dev/null +++ b/_nodejs/node_modules/asynckit/package.json @@ -0,0 +1,63 @@ +{ + "name": "asynckit", + "version": "0.4.0", + "description": "Minimal async jobs utility library, with streams support", + "main": "index.js", + "scripts": { + "clean": "rimraf coverage", + "lint": "eslint *.js lib/*.js test/*.js", + "test": "istanbul cover --reporter=json tape -- 'test/test-*.js' | tap-spec", + "win-test": "tape test/test-*.js", + "browser": "browserify -t browserify-istanbul test/lib/browserify_adjustment.js test/test-*.js | obake --coverage | tap-spec", + "report": "istanbul report", + "size": "browserify index.js | size-table asynckit", + "debug": "tape test/test-*.js" + }, + "pre-commit": [ + "clean", + "lint", + "test", + "browser", + "report", + "size" + ], + "repository": { + "type": "git", + "url": "git+https://github.com/alexindigo/asynckit.git" + }, + "keywords": [ + "async", + "jobs", + "parallel", + "serial", + "iterator", + "array", + "object", + "stream", + "destroy", + "terminate", + "abort" + ], + "author": "Alex Indigo ", + "license": "MIT", + "bugs": { + "url": "https://github.com/alexindigo/asynckit/issues" + }, + "homepage": "https://github.com/alexindigo/asynckit#readme", + "devDependencies": { + "browserify": "^13.0.0", + "browserify-istanbul": "^2.0.0", + "coveralls": "^2.11.9", + "eslint": "^2.9.0", + "istanbul": "^0.4.3", + "obake": "^0.1.2", + "phantomjs-prebuilt": "^2.1.7", + "pre-commit": "^1.1.3", + "reamde": "^1.1.0", + "rimraf": "^2.5.2", + "size-table": "^0.2.0", + "tap-spec": "^4.1.1", + "tape": "^4.5.1" + }, + "dependencies": {} +} diff --git a/_nodejs/node_modules/asynckit/parallel.js b/_nodejs/node_modules/asynckit/parallel.js new file mode 100644 index 0000000..3c50344 --- /dev/null +++ b/_nodejs/node_modules/asynckit/parallel.js @@ -0,0 +1,43 @@ +var iterate = require('./lib/iterate.js') + , initState = require('./lib/state.js') + , terminator = require('./lib/terminator.js') + ; + +// Public API +module.exports = parallel; + +/** + * Runs iterator over provided array elements in parallel + * + * @param {array|object} list - array or object (named list) to iterate over + * @param {function} iterator - iterator to run + * @param {function} callback - invoked when all elements processed + * @returns {function} - jobs terminator + */ +function parallel(list, iterator, callback) +{ + var state = initState(list); + + while (state.index < (state['keyedList'] || list).length) + { + iterate(list, iterator, state, function(error, result) + { + if (error) + { + callback(error, result); + return; + } + + // looks like it's the last one + if (Object.keys(state.jobs).length === 0) + { + callback(null, state.results); + return; + } + }); + + state.index++; + } + + return terminator.bind(state, callback); +} diff --git a/_nodejs/node_modules/asynckit/serial.js b/_nodejs/node_modules/asynckit/serial.js new file mode 100644 index 0000000..6cd949a --- /dev/null +++ b/_nodejs/node_modules/asynckit/serial.js @@ -0,0 +1,17 @@ +var serialOrdered = require('./serialOrdered.js'); + +// Public API +module.exports = serial; + +/** + * Runs iterator over provided array elements in series + * + * @param {array|object} list - array or object (named list) to iterate over + * @param {function} iterator - iterator to run + * @param {function} callback - invoked when all elements processed + * @returns {function} - jobs terminator + */ +function serial(list, iterator, callback) +{ + return serialOrdered(list, iterator, null, callback); +} diff --git a/_nodejs/node_modules/asynckit/serialOrdered.js b/_nodejs/node_modules/asynckit/serialOrdered.js new file mode 100644 index 0000000..607eafe --- /dev/null +++ b/_nodejs/node_modules/asynckit/serialOrdered.js @@ -0,0 +1,75 @@ +var iterate = require('./lib/iterate.js') + , initState = require('./lib/state.js') + , terminator = require('./lib/terminator.js') + ; + +// Public API +module.exports = serialOrdered; +// sorting helpers +module.exports.ascending = ascending; +module.exports.descending = descending; + +/** + * Runs iterator over provided sorted array elements in series + * + * @param {array|object} list - array or object (named list) to iterate over + * @param {function} iterator - iterator to run + * @param {function} sortMethod - custom sort function + * @param {function} callback - invoked when all elements processed + * @returns {function} - jobs terminator + */ +function serialOrdered(list, iterator, sortMethod, callback) +{ + var state = initState(list, sortMethod); + + iterate(list, iterator, state, function iteratorHandler(error, result) + { + if (error) + { + callback(error, result); + return; + } + + state.index++; + + // are we there yet? + if (state.index < (state['keyedList'] || list).length) + { + iterate(list, iterator, state, iteratorHandler); + return; + } + + // done here + callback(null, state.results); + }); + + return terminator.bind(state, callback); +} + +/* + * -- Sort methods + */ + +/** + * sort helper to sort array elements in ascending order + * + * @param {mixed} a - an item to compare + * @param {mixed} b - an item to compare + * @returns {number} - comparison result + */ +function ascending(a, b) +{ + return a < b ? -1 : a > b ? 1 : 0; +} + +/** + * sort helper to sort array elements in descending order + * + * @param {mixed} a - an item to compare + * @param {mixed} b - an item to compare + * @returns {number} - comparison result + */ +function descending(a, b) +{ + return -1 * ascending(a, b); +} diff --git a/_nodejs/node_modules/asynckit/stream.js b/_nodejs/node_modules/asynckit/stream.js new file mode 100644 index 0000000..d43465f --- /dev/null +++ b/_nodejs/node_modules/asynckit/stream.js @@ -0,0 +1,21 @@ +var inherits = require('util').inherits + , Readable = require('stream').Readable + , ReadableAsyncKit = require('./lib/readable_asynckit.js') + , ReadableParallel = require('./lib/readable_parallel.js') + , ReadableSerial = require('./lib/readable_serial.js') + , ReadableSerialOrdered = require('./lib/readable_serial_ordered.js') + ; + +// API +module.exports = +{ + parallel : ReadableParallel, + serial : ReadableSerial, + serialOrdered : ReadableSerialOrdered, +}; + +inherits(ReadableAsyncKit, Readable); + +inherits(ReadableParallel, ReadableAsyncKit); +inherits(ReadableSerial, ReadableAsyncKit); +inherits(ReadableSerialOrdered, ReadableAsyncKit); diff --git a/_nodejs/node_modules/axios/CHANGELOG.md b/_nodejs/node_modules/axios/CHANGELOG.md new file mode 100644 index 0000000..c199599 --- /dev/null +++ b/_nodejs/node_modules/axios/CHANGELOG.md @@ -0,0 +1,943 @@ +# Changelog + +### 0.27.2 (April 27, 2022) + +Fixes and Functionality: +- Fixed FormData posting in browser environment by reverting #3785 ([#4640](https://github.com/axios/axios/pull/4640)) +- Enhanced protocol parsing implementation ([#4639](https://github.com/axios/axios/pull/4639)) +- Fixed bundle size + +### 0.27.1 (April 26, 2022) + +Fixes and Functionality: +- Removed import of url module in browser build due to huge size overhead and builds being broken ([#4594](https://github.com/axios/axios/pull/4594)) +- Bumped follow-redirects to ^1.14.9 ([#4615](https://github.com/axios/axios/pull/4615)) + +### 0.27.0 (April 25, 2022) + +Breaking changes: +- New toFormData helper function that allows the implementor to pass an object and allow axios to convert it to FormData ([#3757](https://github.com/axios/axios/pull/3757)) +- Removed functionality that removed the the `Content-Type` request header when passing FormData ([#3785](https://github.com/axios/axios/pull/3785)) +- **(*)** Refactored error handling implementing AxiosError as a constructor, this is a large change to error handling on the whole ([#3645](https://github.com/axios/axios/pull/3645)) +- Separated responsibility for FormData instantiation between `transformRequest` and `toFormData` ([#4470](https://github.com/axios/axios/pull/4470)) +- **(*)** Improved and fixed multiple issues with FormData support ([#4448](https://github.com/axios/axios/pull/4448)) + +QOL and DevX improvements: +- Added a multipart/form-data testing playground allowing contributors to debug changes easily ([#4465](https://github.com/axios/axios/pull/4465)) + +Fixes and Functionality: +- Refactored project file structure to avoid circular imports ([#4515](https://github.com/axios/axios/pull/4516)) & ([#4516](https://github.com/axios/axios/pull/4516)) +- Bumped follow-redirects to ^1.14.9 ([#4562](https://github.com/axios/axios/pull/4562)) + +Internal and Tests: +- Updated dev dependencies to latest version + +Documentation: +- Fixing incorrect link in changelog ([#4551](https://github.com/axios/axios/pull/4551)) + +Notes: +- **(*)** Please read these pull requests before updating, these changes are very impactful and far reaching. + +### 0.26.1 (March 9, 2022) + +Fixes and Functionality: +- Refactored project file structure to avoid circular imports ([#4220](https://github.com/axios/axios/pull/4220)) + +### 0.26.0 (February 13, 2022) + +Fixes and Functionality: +- Fixed The timeoutErrorMessage property in config not work with Node.js ([#3581](https://github.com/axios/axios/pull/3581)) +- Added errors to be displayed when the query parsing process itself fails ([#3961](https://github.com/axios/axios/pull/3961)) +- Fix/remove url required ([#4426](https://github.com/axios/axios/pull/4426)) +- Update follow-redirects dependency due to Vulnerability ([#4462](https://github.com/axios/axios/pull/4462)) +- Bump karma from 6.3.11 to 6.3.14 ([#4461](https://github.com/axios/axios/pull/4461)) +- Bump follow-redirects from 1.14.7 to 1.14.8 ([#4473](https://github.com/axios/axios/pull/4473)) + +### 0.25.0 (January 18, 2022) + +Breaking changes: +- Fixing maxBodyLength enforcement ([#3786](https://github.com/axios/axios/pull/3786)) +- Don't rely on strict mode behavior for arguments ([#3470](https://github.com/axios/axios/pull/3470)) +- Adding error handling when missing url ([#3791](https://github.com/axios/axios/pull/3791)) +- Update isAbsoluteURL.js removing escaping of non-special characters ([#3809](https://github.com/axios/axios/pull/3809)) +- Use native Array.isArray() in utils.js ([#3836](https://github.com/axios/axios/pull/3836)) +- Adding error handling inside stream end callback ([#3967](https://github.com/axios/axios/pull/3967)) + +Fixes and Functionality: +- Added aborted even handler ([#3916](https://github.com/axios/axios/pull/3916)) +- Header types expanded allowing `boolean` and `number` types ([#4144](https://github.com/axios/axios/pull/4144)) +- Fix cancel signature allowing cancel message to be `undefined` ([#3153](https://github.com/axios/axios/pull/3153)) +- Updated type checks to be formulated better ([#3342](https://github.com/axios/axios/pull/3342)) +- Avoid unnecessary buffer allocations ([#3321](https://github.com/axios/axios/pull/3321)) +- Adding a socket handler to keep TCP connection live when processing long living requests ([#3422](https://github.com/axios/axios/pull/3422)) +- Added toFormData helper function ([#3757](https://github.com/axios/axios/pull/3757)) +- Adding responseEncoding prop type in AxiosRequestConfig ([#3918](https://github.com/axios/axios/pull/3918)) + +Internal and Tests: +- Adding axios-test-instance to ecosystem ([#3496](https://github.com/axios/axios/pull/3496)) +- Optimize the logic of isAxiosError ([#3546](https://github.com/axios/axios/pull/3546)) +- Add tests and documentation to display how multiple inceptors work ([#3564](https://github.com/axios/axios/pull/3564)) +- Updating follow-redirects to version 1.14.7 ([#4379](https://github.com/axios/axios/pull/4379)) + +Documentation: +- Fixing changelog to show correct pull request ([#4219](https://github.com/axios/axios/pull/4219)) +- Update upgrade guide for https proxy setting ([#3604](https://github.com/axios/axios/pull/3604)) + +Huge thanks to everyone who contributed to this release via code (authors listed below) or via reviews and triaging on GitHub: + +- [Jay](mailto:jasonsaayman@gmail.com) +- [Rijk van Zanten](https://github.com/rijkvanzanten) +- [Kohta Ito](https://github.com/koh110) +- [Brandon Faulkner](https://github.com/bfaulk96) +- [Stefano Magni](https://github.com/NoriSte) +- [enofan](https://github.com/fanguangyi) +- [Andrey Pechkurov](https://github.com/puzpuzpuz) +- [Doowonee](https://github.com/doowonee) +- [Emil Broman](https://github.com/emilbroman-eqt) +- [Remco Haszing](https://github.com/remcohaszing) +- [Black-Hole](https://github.com/BlackHole1) +- [Wolfram Kriesing](https://github.com/wolframkriesing) +- [Andrew Ovens](https://github.com/repl-andrew-ovens) +- [Paulo Renato](https://github.com/PauloRSF) +- [Ben Carp](https://github.com/carpben) +- [Hirotaka Tagawa](https://github.com/wafuwafu13) +- [狼族小狈](https://github.com/lzxb) +- [C. Lewis](https://github.com/ctjlewis) +- [Felipe Carvalho](https://github.com/FCarvalhoVII) +- [Daniel](https://github.com/djs113) +- [Gustavo Sales](https://github.com/gussalesdev) + +### 0.24.0 (October 25, 2021) + +Breaking changes: +- Revert: change type of AxiosResponse to any, please read lengthy discussion here: ([#4141](https://github.com/axios/axios/issues/4141)) pull request: ([#4186](https://github.com/axios/axios/pull/4186)) + +Huge thanks to everyone who contributed to this release via code (authors listed below) or via reviews and triaging on GitHub: + +- [Jay](mailto:jasonsaayman@gmail.com) +- [Rodry](https://github.com/ImRodry) +- [Remco Haszing](https://github.com/remcohaszing) +- [Isaiah Thomason](https://github.com/ITenthusiasm) + +### 0.23.0 (October 12, 2021) + +Breaking changes: +- Distinguish request and response data types ([#4116](https://github.com/axios/axios/pull/4116)) +- Change never type to unknown ([#4142](https://github.com/axios/axios/pull/4142)) +- Fixed TransitionalOptions typings ([#4147](https://github.com/axios/axios/pull/4147)) + +Fixes and Functionality: +- Adding globalObject: 'this' to webpack config ([#3176](https://github.com/axios/axios/pull/3176)) +- Adding insecureHTTPParser type to AxiosRequestConfig ([#4066](https://github.com/axios/axios/pull/4066)) +- Fix missing semicolon in typings ([#4115](https://github.com/axios/axios/pull/4115)) +- Fix response headers types ([#4136](https://github.com/axios/axios/pull/4136)) + +Internal and Tests: +- Improve timeout error when timeout is browser default ([#3209](https://github.com/axios/axios/pull/3209)) +- Fix node version on CI ([#4069](https://github.com/axios/axios/pull/4069)) +- Added testing to TypeScript portion of project ([#4140](https://github.com/axios/axios/pull/4140)) + +Documentation: +- Rename Angular to AngularJS ([#4114](https://github.com/axios/axios/pull/4114)) + +Huge thanks to everyone who contributed to this release via code (authors listed below) or via reviews and triaging on GitHub: + +- [Jay](mailto:jasonsaayman@gmail.com) +- [Evan-Finkelstein](https://github.com/Evan-Finkelstein) +- [Paweł Szymański](https://github.com/Jezorko) +- [Dobes Vandermeer](https://github.com/dobesv) +- [Claas Augner](https://github.com/caugner) +- [Remco Haszing](https://github.com/remcohaszing) +- [Evgeniy](https://github.com/egmen) +- [Dmitriy Mozgovoy](https://github.com/DigitalBrainJS) + +### 0.22.0 (October 01, 2021) + +Fixes and Functionality: +- Caseless header comparing in HTTP adapter ([#2880](https://github.com/axios/axios/pull/2880)) +- Avoid package.json import fixing issues and warnings related to this ([#4041](https://github.com/axios/axios/pull/4041)), ([#4065](https://github.com/axios/axios/pull/4065)) +- Fixed cancelToken leakage and added AbortController support ([#3305](https://github.com/axios/axios/pull/3305)) +- Updating CI to run on release branches +- Bump follow redirects version +- Fixed default transitional config for custom Axios instance; ([#4052](https://github.com/axios/axios/pull/4052)) + +Huge thanks to everyone who contributed to this release via code (authors listed below) or via reviews and triaging on GitHub: + +- [Jay](mailto:jasonsaayman@gmail.com) +- [Matt R. Wilson](https://github.com/mastermatt) +- [Xianming Zhong](https://github.com/chinesedfan) +- [Dmitriy Mozgovoy](https://github.com/DigitalBrainJS) + +### 0.21.4 (September 6, 2021) + +Fixes and Functionality: +- Fixing JSON transform when data is stringified. Providing backward compatibility and complying to the JSON RFC standard ([#4020](https://github.com/axios/axios/pull/4020)) + +Huge thanks to everyone who contributed to this release via code (authors listed below) or via reviews and triaging on GitHub: + +- [Jay](mailto:jasonsaayman@gmail.com) +- [Guillaume Fortaine](https://github.com/gfortaine) +- [Yusuke Kawasaki](https://github.com/kawanet) +- [Dmitriy Mozgovoy](https://github.com/DigitalBrainJS) + +### 0.21.3 (September 4, 2021) + +Fixes and Functionality: +- Fixing response interceptor not being called when request interceptor is attached ([#4013](https://github.com/axios/axios/pull/4013)) + +Huge thanks to everyone who contributed to this release via code (authors listed below) or via reviews and triaging on GitHub: + +- [Jay](mailto:jasonsaayman@gmail.com) +- [Julian Hollmann](https://github.com/nerdbeere) + +### 0.21.2 (September 4, 2021) + +Fixes and Functionality: + +- Updating axios requests to be delayed by pre-emptive promise creation ([#2702](https://github.com/axios/axios/pull/2702)) +- Adding "synchronous" and "runWhen" options to interceptors api ([#2702](https://github.com/axios/axios/pull/2702)) +- Updating of transformResponse ([#3377](https://github.com/axios/axios/pull/3377)) +- Adding ability to omit User-Agent header ([#3703](https://github.com/axios/axios/pull/3703)) +- Adding multiple JSON improvements ([#3688](https://github.com/axios/axios/pull/3688), [#3763](https://github.com/axios/axios/pull/3763)) +- Fixing quadratic runtime and extra memory usage when setting a maxContentLength ([#3738](https://github.com/axios/axios/pull/3738)) +- Adding parseInt to config.timeout ([#3781](https://github.com/axios/axios/pull/3781)) +- Adding custom return type support to interceptor ([#3783](https://github.com/axios/axios/pull/3783)) +- Adding security fix for ReDoS vulnerability ([#3980](https://github.com/axios/axios/pull/3980)) + +Internal and Tests: + +- Updating build dev dependencies ([#3401](https://github.com/axios/axios/pull/3401)) +- Fixing builds running on Travis CI ([#3538](https://github.com/axios/axios/pull/3538)) +- Updating follow redirect version ([#3694](https://github.com/axios/axios/pull/3694), [#3771](https://github.com/axios/axios/pull/3771)) +- Updating karma sauce launcher to fix failing sauce tests ([#3712](https://github.com/axios/axios/pull/3712), [#3717](https://github.com/axios/axios/pull/3717)) +- Updating content-type header for application/json to not contain charset field, according do RFC 8259 ([#2154](https://github.com/axios/axios/pull/2154)) +- Fixing tests by bumping karma-sauce-launcher version ([#3813](https://github.com/axios/axios/pull/3813)) +- Changing testing process from Travis CI to GitHub Actions ([#3938](https://github.com/axios/axios/pull/3938)) + +Documentation: + +- Updating documentation around the use of `AUTH_TOKEN` with multiple domain endpoints ([#3539](https://github.com/axios/axios/pull/3539)) +- Remove duplication of item in changelog ([#3523](https://github.com/axios/axios/pull/3523)) +- Fixing grammatical errors ([#2642](https://github.com/axios/axios/pull/2642)) +- Fixing spelling error ([#3567](https://github.com/axios/axios/pull/3567)) +- Moving gitpod mention ([#2637](https://github.com/axios/axios/pull/2637)) +- Adding new axios documentation website link ([#3681](https://github.com/axios/axios/pull/3681), [#3707](https://github.com/axios/axios/pull/3707)) +- Updating documentation around dispatching requests ([#3772](https://github.com/axios/axios/pull/3772)) +- Adding documentation for the type guard isAxiosError ([#3767](https://github.com/axios/axios/pull/3767)) +- Adding explanation of cancel token ([#3803](https://github.com/axios/axios/pull/3803)) +- Updating CI status badge ([#3953](https://github.com/axios/axios/pull/3953)) +- Fixing errors with JSON documentation ([#3936](https://github.com/axios/axios/pull/3936)) +- Fixing README typo under Request Config ([#3825](https://github.com/axios/axios/pull/3825)) +- Adding axios-multi-api to the ecosystem file ([#3817](https://github.com/axios/axios/pull/3817)) +- Adding SECURITY.md to properly disclose security vulnerabilities ([#3981](https://github.com/axios/axios/pull/3981)) + +Huge thanks to everyone who contributed to this release via code (authors listed below) or via reviews and triaging on GitHub: + +- [Jay](mailto:jasonsaayman@gmail.com) +- [Sasha Korotkov](https://github.com/SashaKoro) +- [Daniel Lopretto](https://github.com/timemachine3030) +- [Mike Bishop](https://github.com/MikeBishop) +- [Dmitriy Mozgovoy](https://github.com/DigitalBrainJS) +- [Mark](https://github.com/bimbiltu) +- [Philipe Gouveia Paixão](https://github.com/piiih) +- [hippo](https://github.com/hippo2cat) +- [ready-research](https://github.com/ready-research) +- [Xianming Zhong](https://github.com/chinesedfan) +- [Christopher Chrapka](https://github.com/OJezu) +- [Brian Anglin](https://github.com/anglinb) +- [Kohta Ito](https://github.com/koh110) +- [Ali Clark](https://github.com/aliclark) +- [caikan](https://github.com/caikan) +- [Elina Gorshkova](https://github.com/elinagorshkova) +- [Ryota Ikezawa](https://github.com/paveg) +- [Nisar Hassan Naqvi](https://github.com/nisarhassan12) +- [Jake](https://github.com/codemaster138) +- [TagawaHirotaka](https://github.com/wafuwafu13) +- [Johannes Jarbratt](https://github.com/johachi) +- [Mo Sattler](https://github.com/MoSattler) +- [Sam Carlton](https://github.com/ThatGuySam) +- [Matt Czapliński](https://github.com/MattCCC) +- [Ziding Zhang](https://github.com/zidingz) + +### 0.21.1 (December 21, 2020) + +Fixes and Functionality: + +- Hotfix: Prevent SSRF ([#3410](https://github.com/axios/axios/pull/3410)) +- Protocol not parsed when setting proxy config from env vars ([#3070](https://github.com/axios/axios/pull/3070)) +- Updating axios in types to be lower case ([#2797](https://github.com/axios/axios/pull/2797)) +- Adding a type guard for `AxiosError` ([#2949](https://github.com/axios/axios/pull/2949)) + +Internal and Tests: + +- Remove the skipping of the `socket` http test ([#3364](https://github.com/axios/axios/pull/3364)) +- Use different socket for Win32 test ([#3375](https://github.com/axios/axios/pull/3375)) + +Huge thanks to everyone who contributed to this release via code (authors listed below) or via reviews and triaging on GitHub: + +- Daniel Lopretto +- Jason Kwok +- Jay +- Jonathan Foster +- Remco Haszing +- Xianming Zhong + +### 0.21.0 (October 23, 2020) + +Fixes and Functionality: + +- Fixing requestHeaders.Authorization ([#3287](https://github.com/axios/axios/pull/3287)) +- Fixing node types ([#3237](https://github.com/axios/axios/pull/3237)) +- Fixing axios.delete ignores config.data ([#3282](https://github.com/axios/axios/pull/3282)) +- Revert "Fixing overwrite Blob/File type as Content-Type in browser. (#1773)" ([#3289](https://github.com/axios/axios/pull/3289)) +- Fixing an issue that type 'null' and 'undefined' is not assignable to validateStatus when typescript strict option is enabled ([#3200](https://github.com/axios/axios/pull/3200)) + +Internal and Tests: + +- Lock travis to not use node v15 ([#3361](https://github.com/axios/axios/pull/3361)) + +Documentation: + +- Fixing simple typo, existent -> existent ([#3252](https://github.com/axios/axios/pull/3252)) +- Fixing typos ([#3309](https://github.com/axios/axios/pull/3309)) + +Huge thanks to everyone who contributed to this release via code (authors listed below) or via reviews and triaging on GitHub: + +- Allan Cruz <57270969+Allanbcruz@users.noreply.github.com> +- George Cheng +- Jay +- Kevin Kirsche +- Remco Haszing +- Taemin Shin +- Tim Gates +- Xianming Zhong + +### 0.20.0 (August 20, 2020) + +Release of 0.20.0-pre as a full release with no other changes. + +### 0.20.0-pre (July 15, 2020) + +Fixes and Functionality: + +- Fixing response with utf-8 BOM can not parse to json ([#2419](https://github.com/axios/axios/pull/2419)) + - fix: remove byte order marker (UTF-8 BOM) when transform response + - fix: remove BOM only utf-8 + - test: utf-8 BOM + - fix: incorrect param name +- Refactor mergeConfig without utils.deepMerge ([#2844](https://github.com/axios/axios/pull/2844)) + - Adding failing test + - Fixing #2587 default custom config persisting + - Adding Concat keys and filter duplicates + - Fixed value from CPE + - update for review feedbacks + - no deepMerge + - only merge between plain objects + - fix rename + - always merge config by mergeConfig + - extract function mergeDeepProperties + - refactor mergeConfig with all keys, and add special logic for validateStatus + - add test for resetting headers + - add lots of tests and fix a bug + - should not inherit `data` + - use simple toString +- Fixing overwrite Blob/File type as Content-Type in browser. ([#1773](https://github.com/axios/axios/pull/1773)) +- Fixing an issue that type 'null' is not assignable to validateStatus ([#2773](https://github.com/axios/axios/pull/2773)) +- Fixing special char encoding ([#1671](https://github.com/axios/axios/pull/1671)) + - removing @ character from replacement list since it is a reserved character + - Updating buildURL test to not include the @ character + - Removing console logs +- Fixing password encoding with special characters in basic authentication ([#1492](https://github.com/axios/axios/pull/1492)) + - Fixing password encoding with special characters in basic authentication + - Adding test to check if password with non-Latin1 characters pass +- Fixing 'Network Error' in react native android ([#1487](https://github.com/axios/axios/pull/1487)) + There is a bug in react native Android platform when using get method. It will trigger a 'Network Error' when passing the requestData which is an empty string to request.send function. So if the requestData is an empty string we can set it to null as well to fix the bug. +- Fixing Cookie Helper with Async Components ([#1105](https://github.com/axios/axios/pull/1105)) ([#1107](https://github.com/axios/axios/pull/1107)) +- Fixing 'progressEvent' type ([#2851](https://github.com/axios/axios/pull/2851)) + - Fix 'progressEvent' type + - Update axios.ts +- Fixing getting local files (file://) failed ([#2470](https://github.com/axios/axios/pull/2470)) + - fix issue #2416, #2396 + - fix Eslint warn + - Modify judgment conditions + - add unit test + - update unit test + - update unit test +- Allow PURGE method in typings ([#2191](https://github.com/axios/axios/pull/2191)) +- Adding option to disable automatic decompression ([#2661](https://github.com/axios/axios/pull/2661)) + - Adding ability to disable auto decompression + - Updating decompress documentation in README + - Fixing test\unit\adapters\http.js lint errors + - Adding test for disabling auto decompression + - Removing changes that fixed lint errors in tests + - Removing formatting change to unit test +- Add independent `maxBodyLength` option ([#2781](https://github.com/axios/axios/pull/2781)) + - Add independent option to set the maximum size of the request body + - Remove maxBodyLength check + - Update README + - Assert for error code and message +- Adding responseEncoding to mergeConfig ([#1745](https://github.com/axios/axios/pull/1745)) +- Compatible with follow-redirect aborts the request ([#2689](https://github.com/axios/axios/pull/2689)) + - Compatible with follow-redirect aborts the request + - Use the error code +- Fix merging of params ([#2656](https://github.com/axios/axios/pull/2656)) + - Name function to avoid ESLint func-names warning + - Switch params config to merge list and update tests + - Restore testing of both false and null + - Restore test cases for keys without defaults + - Include test for non-object values that aren't false-y. +- Revert `finally` as `then` ([#2683](https://github.com/axios/axios/pull/2683)) + +Internal and Tests: + +- Fix stale bot config ([#3049](https://github.com/axios/axios/pull/3049)) + - fix stale bot config + - fix multiple lines +- Add days and change name to work ([#3035](https://github.com/axios/axios/pull/3035)) +- Update close-issues.yml ([#3031](https://github.com/axios/axios/pull/3031)) + - Update close-issues.yml + Update close message to read better 😄 + - Fix use of quotations + Use single quotes as per other .yml files + - Remove user name form message +- Add GitHub actions to close stale issues/prs ([#3029](https://github.com/axios/axios/pull/3029)) + - prepare stale actions + - update messages + - Add exempt labels and lighten up comments +- Add GitHub actions to close invalid issues ([#3022](https://github.com/axios/axios/pull/3022)) + - add close actions + - fix with checkout + - update issue templates + - add reminder + - update close message +- Add test with Node.js 12 ([#2860](https://github.com/axios/axios/pull/2860)) + - test with Node.js 12 + - test with latest +- Adding console log on sandbox server startup ([#2210](https://github.com/axios/axios/pull/2210)) + - Adding console log on sandbox server startup + - Update server.js + Add server error handling + - Update server.js + Better error message, remove retry. +- Adding tests for method `options` type definitions ([#1996](https://github.com/axios/axios/pull/1996)) + Update tests. +- Add test for redirecting with too large response ([#2695](https://github.com/axios/axios/pull/2695)) +- Fixing unit test failure in Windows OS ([#2601](https://github.com/axios/axios/pull/2601)) +- Fixing issue for HEAD method and gzipped response ([#2666](https://github.com/axios/axios/pull/2666)) +- Fix tests in browsers ([#2748](https://github.com/axios/axios/pull/2748)) +- chore: add `jsdelivr` and `unpkg` support ([#2443](https://github.com/axios/axios/pull/2443)) + +Documentation: + +- Adding support for URLSearchParams in node ([#1900](https://github.com/axios/axios/pull/1900)) + - Adding support for URLSearchParams in node + - Remove un-needed code + - Update utils.js + - Make changes as suggested +- Adding table of content (preview) ([#3050](https://github.com/axios/axios/pull/3050)) + - add toc (preview) + - remove toc in toc + Signed-off-by: Moni + - fix sublinks + - fix indentation + - remove redundant table links + - update caps and indent + - remove axios +- Replace 'blacklist' with 'blocklist' ([#3006](https://github.com/axios/axios/pull/3006)) +- docs(): Detailed config options environment. ([#2088](https://github.com/axios/axios/pull/2088)) + - docs(): Detailed config options environment. + - Update README.md +- Include axios-data-unpacker in ECOSYSTEM.md ([#2080](https://github.com/axios/axios/pull/2080)) +- Allow opening examples in Gitpod ([#1958](https://github.com/axios/axios/pull/1958)) +- Remove axios.all() and axios.spread() from Readme.md ([#2727](https://github.com/axios/axios/pull/2727)) + - remove axios.all(), axios.spread() + - replace example + - axios.all() -> Promise.all() + - axios.spread(function (acct, perms)) -> function (acct, perms) + - add deprecated mark +- Update README.md ([#2887](https://github.com/axios/axios/pull/2887)) + Small change to the data attribute doc of the config. A request body can also be set for DELETE methods but this wasn't mentioned in the documentation (it only mentioned POST, PUT and PATCH). Took my some 10-20 minutes until I realized that I don't need to manipulate the request body with transformRequest in the case of DELETE. +- Include swagger-taxos-codegen in ECOSYSTEM.md ([#2162](https://github.com/axios/axios/pull/2162)) +- Add CDNJS version badge in README.md ([#878](https://github.com/axios/axios/pull/878)) + This badge will show the version on CDNJS! +- Documentation update to clear up ambiguity in code examples ([#2928](https://github.com/axios/axios/pull/2928)) + - Made an adjustment to the documentation to clear up any ambiguity around the use of "fs". This should help clear up that the code examples with "fs" cannot be used on the client side. +- Update README.md about validateStatus ([#2912](https://github.com/axios/axios/pull/2912)) + Rewrote the comment from "Reject only if the status code is greater than or equal to 500" to "Resolve only if the status code is less than 500" +- Updating documentation for usage form-data ([#2805](https://github.com/axios/axios/pull/2805)) + Closes #2049 +- Fixing CHANGELOG.md issue link ([#2784](https://github.com/axios/axios/pull/2784)) +- Include axios-hooks in ECOSYSTEM.md ([#2003](https://github.com/axios/axios/pull/2003)) +- Added Response header access instructions ([#1901](https://github.com/axios/axios/pull/1901)) + - Added Response header access instructions + - Added note about using bracket notation +- Add `onUploadProgress` and `onDownloadProgress` are browser only ([#2763](https://github.com/axios/axios/pull/2763)) + Saw in #928 and #1966 that `onUploadProgress` and `onDownloadProgress` only work in the browser and was missing that from the README. +- Update ' sign to ` in proxy spec ([#2778](https://github.com/axios/axios/pull/2778)) +- Adding jsDelivr link in README ([#1110](https://github.com/axios/axios/pull/1110)) + - Adding jsDelivr link + - Add SRI + - Remove SRI + +Huge thanks to everyone who contributed to this release via code (authors listed +below) or via reviews and triaging on GitHub: + +- Alan Wang +- Alexandru Ungureanu +- Anubhav Srivastava +- Benny Neugebauer +- Cr <631807682@qq.com> +- David +- David Ko +- David Tanner +- Emily Morehouse +- Felipe Martins +- Fonger <5862369+Fonger@users.noreply.github.com> +- Frostack +- George Cheng +- grumblerchester +- Gustavo López +- hexaez <45806662+hexaez@users.noreply.github.com> +- huangzuizui +- Ian Wijma +- Jay +- jeffjing +- jennynju <46782518+jennynju@users.noreply.github.com> +- Jimmy Liao <52391190+jimmy-liao-gogoro@users.noreply.github.com> +- Jonathan Sharpe +- JounQin +- Justin Beckwith +- Kamil Posiadała <3dcreator.pl@gmail.com> +- Lukas Drgon +- marcinx +- Martti Laine +- Michał Zarach +- Moni +- Motonori Iwata <121048+iwata@users.noreply.github.com> +- Nikita Galkin +- Petr Mares +- Philippe Recto +- Remco Haszing +- rockcs1992 +- Ryan Bown +- Samina Fu +- Simone Busoli +- Spencer von der Ohe +- Sven Efftinge +- Taegyeoung Oh +- Taemin Shin +- Thibault Ehrhart <1208424+ehrhart@users.noreply.github.com> +- Xianming Zhong +- Yasu Flores +- Zac Delventhal + +### 0.19.2 (Jan 20, 2020) + +- Remove unnecessary XSS check ([#2679](https://github.com/axios/axios/pull/2679)) (see ([#2646](https://github.com/axios/axios/issues/2646)) for discussion) + +### 0.19.1 (Jan 7, 2020) + +Fixes and Functionality: + +- Fixing invalid agent issue ([#1904](https://github.com/axios/axios/pull/1904)) +- Fix ignore set withCredentials false ([#2582](https://github.com/axios/axios/pull/2582)) +- Delete useless default to hash ([#2458](https://github.com/axios/axios/pull/2458)) +- Fix HTTP/HTTPs agents passing to follow-redirect ([#1904](https://github.com/axios/axios/pull/1904)) +- Fix ignore set withCredentials false ([#2582](https://github.com/axios/axios/pull/2582)) +- Fix CI build failure ([#2570](https://github.com/axios/axios/pull/2570)) +- Remove dependency on is-buffer from package.json ([#1816](https://github.com/axios/axios/pull/1816)) +- Adding options typings ([#2341](https://github.com/axios/axios/pull/2341)) +- Adding Typescript HTTP method definition for LINK and UNLINK. ([#2444](https://github.com/axios/axios/pull/2444)) +- Update dist with newest changes, fixes Custom Attributes issue +- Change syntax to see if build passes ([#2488](https://github.com/axios/axios/pull/2488)) +- Update Webpack + deps, remove now unnecessary polyfills ([#2410](https://github.com/axios/axios/pull/2410)) +- Fix to prevent XSS, throw an error when the URL contains a JS script ([#2464](https://github.com/axios/axios/pull/2464)) +- Add custom timeout error copy in config ([#2275](https://github.com/axios/axios/pull/2275)) +- Add error toJSON example ([#2466](https://github.com/axios/axios/pull/2466)) +- Fixing Vulnerability A Fortify Scan finds a critical Cross-Site Scrip… ([#2451](https://github.com/axios/axios/pull/2451)) +- Fixing subdomain handling on no_proxy ([#2442](https://github.com/axios/axios/pull/2442)) +- Make redirection from HTTP to HTTPS work ([#2426](https://github.com/axios/axios/pull/2426)) and ([#2547](https://github.com/axios/axios/pull/2547)) +- Add toJSON property to AxiosError type ([#2427](https://github.com/axios/axios/pull/2427)) +- Fixing socket hang up error on node side for slow response. ([#1752](https://github.com/axios/axios/pull/1752)) +- Alternative syntax to send data into the body ([#2317](https://github.com/axios/axios/pull/2317)) +- Fixing custom config options ([#2207](https://github.com/axios/axios/pull/2207)) +- Fixing set `config.method` after mergeConfig for Axios.prototype.request ([#2383](https://github.com/axios/axios/pull/2383)) +- Axios create url bug ([#2290](https://github.com/axios/axios/pull/2290)) +- Do not modify config.url when using a relative baseURL (resolves [#1628](https://github.com/axios/axios/issues/1098)) ([#2391](https://github.com/axios/axios/pull/2391)) + +Internal: + +- Revert "Update Webpack + deps, remove now unnecessary polyfills" ([#2479](https://github.com/axios/axios/pull/2479)) +- Order of if/else blocks is causing unit tests mocking XHR. ([#2201](https://github.com/axios/axios/pull/2201)) +- Add license badge ([#2446](https://github.com/axios/axios/pull/2446)) +- Fix travis CI build [#2386](https://github.com/axios/axios/pull/2386) +- Fix cancellation error on build master. #2290 #2207 ([#2407](https://github.com/axios/axios/pull/2407)) + +Documentation: + +- Fixing typo in CHANGELOG.md: s/Functionallity/Functionality ([#2639](https://github.com/axios/axios/pull/2639)) +- Fix badge, use master branch ([#2538](https://github.com/axios/axios/pull/2538)) +- Fix typo in changelog [#2193](https://github.com/axios/axios/pull/2193) +- Document fix ([#2514](https://github.com/axios/axios/pull/2514)) +- Update docs with no_proxy change, issue #2484 ([#2513](https://github.com/axios/axios/pull/2513)) +- Fixing missing words in docs template ([#2259](https://github.com/axios/axios/pull/2259)) +- 🐛Fix request finally documentation in README ([#2189](https://github.com/axios/axios/pull/2189)) +- updating spelling and adding link to docs ([#2212](https://github.com/axios/axios/pull/2212)) +- docs: minor tweak ([#2404](https://github.com/axios/axios/pull/2404)) +- Update response interceptor docs ([#2399](https://github.com/axios/axios/pull/2399)) +- Update README.md ([#2504](https://github.com/axios/axios/pull/2504)) +- Fix word 'sintaxe' to 'syntax' in README.md ([#2432](https://github.com/axios/axios/pull/2432)) +- updating README: notes on CommonJS autocomplete ([#2256](https://github.com/axios/axios/pull/2256)) +- Fix grammar in README.md ([#2271](https://github.com/axios/axios/pull/2271)) +- Doc fixes, minor examples cleanup ([#2198](https://github.com/axios/axios/pull/2198)) + +### 0.19.0 (May 30, 2019) + +Fixes and Functionality: + +- Added support for no_proxy env variable ([#1693](https://github.com/axios/axios/pull/1693/files)) - Chance Dickson +- Unzip response body only for statuses != 204 ([#1129](https://github.com/axios/axios/pull/1129)) - drawski +- Destroy stream on exceeding maxContentLength (fixes [#1098](https://github.com/axios/axios/issues/1098)) ([#1485](https://github.com/axios/axios/pull/1485)) - Gadzhi Gadzhiev +- Makes Axios error generic to use AxiosResponse ([#1738](https://github.com/axios/axios/pull/1738)) - Suman Lama +- Fixing Mocha tests by locking follow-redirects version to 1.5.10 ([#1993](https://github.com/axios/axios/pull/1993)) - grumblerchester +- Allow uppercase methods in typings. ([#1781](https://github.com/axios/axios/pull/1781)) - Ken Powers +- Fixing building url with hash mark ([#1771](https://github.com/axios/axios/pull/1771)) - Anatoly Ryabov +- This commit fix building url with hash map (fragment identifier) when parameters are present: they must not be added after `#`, because client cut everything after `#` +- Preserve HTTP method when following redirect ([#1758](https://github.com/axios/axios/pull/1758)) - Rikki Gibson +- Add `getUri` signature to TypeScript definition. ([#1736](https://github.com/axios/axios/pull/1736)) - Alexander Trauzzi +- Adding isAxiosError flag to errors thrown by axios ([#1419](https://github.com/axios/axios/pull/1419)) - Ayush Gupta + +Internal: + +- Fixing .eslintrc without extension ([#1789](https://github.com/axios/axios/pull/1789)) - Manoel +- Fix failing SauceLabs tests by updating configuration - Emily Morehouse +- Add issue templates - Emily Morehouse + +Documentation: + +- Consistent coding style in README ([#1787](https://github.com/axios/axios/pull/1787)) - Ali Servet Donmez +- Add information about auth parameter to README ([#2166](https://github.com/axios/axios/pull/2166)) - xlaguna +- Add DELETE to list of methods that allow data as a config option ([#2169](https://github.com/axios/axios/pull/2169)) - Daniela Borges Matos de Carvalho +- Update ECOSYSTEM.md - Add Axios Endpoints ([#2176](https://github.com/axios/axios/pull/2176)) - Renan +- Add r2curl in ECOSYSTEM ([#2141](https://github.com/axios/axios/pull/2141)) - 유용우 / CX +- Update README.md - Add instructions for installing with yarn ([#2036](https://github.com/axios/axios/pull/2036)) - Victor Hermes +- Fixing spacing for README.md ([#2066](https://github.com/axios/axios/pull/2066)) - Josh McCarty +- Update README.md. - Change `.then` to `.finally` in example code ([#2090](https://github.com/axios/axios/pull/2090)) - Omar Cai +- Clarify what values responseType can have in Node ([#2121](https://github.com/axios/axios/pull/2121)) - Tyler Breisacher +- docs(ECOSYSTEM): add axios-api-versioning ([#2020](https://github.com/axios/axios/pull/2020)) - Weffe +- It seems that `responseType: 'blob'` doesn't actually work in Node (when I tried using it, response.data was a string, not a Blob, since Node doesn't have Blobs), so this clarifies that this option should only be used in the browser +- Update README.md. - Add Querystring library note ([#1896](https://github.com/axios/axios/pull/1896)) - Dmitriy Eroshenko +- Add react-hooks-axios to Libraries section of ECOSYSTEM.md ([#1925](https://github.com/axios/axios/pull/1925)) - Cody Chan +- Clarify in README that default timeout is 0 (no timeout) ([#1750](https://github.com/axios/axios/pull/1750)) - Ben Standefer + +### 0.19.0-beta.1 (Aug 9, 2018) + +**NOTE:** This is a beta version of this release. There may be functionality that is broken in +certain browsers, though we suspect that builds are hanging and not erroring. See +https://saucelabs.com/u/axios for the most up-to-date information. + +New Functionality: + +- Add getUri method ([#1712](https://github.com/axios/axios/issues/1712)) +- Add support for no_proxy env variable ([#1693](https://github.com/axios/axios/issues/1693)) +- Add toJSON to decorated Axios errors to facilitate serialization ([#1625](https://github.com/axios/axios/issues/1625)) +- Add second then on axios call ([#1623](https://github.com/axios/axios/issues/1623)) +- Typings: allow custom return types +- Add option to specify character set in responses (with http adapter) + +Fixes: + +- Fix Keep defaults local to instance ([#385](https://github.com/axios/axios/issues/385)) +- Correctly catch exception in http test ([#1475](https://github.com/axios/axios/issues/1475)) +- Fix accept header normalization ([#1698](https://github.com/axios/axios/issues/1698)) +- Fix http adapter to allow HTTPS connections via HTTP ([#959](https://github.com/axios/axios/issues/959)) +- Fix Removes usage of deprecated Buffer constructor. ([#1555](https://github.com/axios/axios/issues/1555), [#1622](https://github.com/axios/axios/issues/1622)) +- Fix defaults to use httpAdapter if available ([#1285](https://github.com/axios/axios/issues/1285)) + - Fixing defaults to use httpAdapter if available + - Use a safer, cross-platform method to detect the Node environment +- Fix Reject promise if request is cancelled by the browser ([#537](https://github.com/axios/axios/issues/537)) +- [Typescript] Fix missing type parameters on delete/head methods +- [NS]: Send `false` flag isStandardBrowserEnv for Nativescript +- Fix missing type parameters on delete/head +- Fix Default method for an instance always overwritten by get +- Fix type error when socketPath option in AxiosRequestConfig +- Capture errors on request data streams +- Decorate resolve and reject to clear timeout in all cases + +Huge thanks to everyone who contributed to this release via code (authors listed +below) or via reviews and triaging on GitHub: + +- Andrew Scott +- Anthony Gauthier +- arpit +- ascott18 +- Benedikt Rötsch +- Chance Dickson +- Dave Stewart +- Deric Cain +- Guillaume Briday +- Jacob Wejendorp +- Jim Lynch +- johntron +- Justin Beckwith +- Justin Beckwith +- Khaled Garbaya +- Lim Jing Rong +- Mark van den Broek +- Martti Laine +- mattridley +- mattridley +- Nicolas Del Valle +- Nilegfx +- pbarbiero +- Rikki Gibson +- Sako Hartounian +- Shane Fitzpatrick +- Stephan Schneider +- Steven +- Tim Garthwaite +- Tim Johns +- Yutaro Miyazaki + +### 0.18.0 (Feb 19, 2018) + +- Adding support for UNIX Sockets when running with Node.js ([#1070](https://github.com/axios/axios/pull/1070)) +- Fixing typings ([#1177](https://github.com/axios/axios/pull/1177)): + - AxiosRequestConfig.proxy: allows type false + - AxiosProxyConfig: added auth field +- Adding function signature in AxiosInstance interface so AxiosInstance can be invoked ([#1192](https://github.com/axios/axios/pull/1192), [#1254](https://github.com/axios/axios/pull/1254)) +- Allowing maxContentLength to pass through to redirected calls as maxBodyLength in follow-redirects config ([#1287](https://github.com/axios/axios/pull/1287)) +- Fixing configuration when using an instance - method can now be set ([#1342](https://github.com/axios/axios/pull/1342)) + +### 0.17.1 (Nov 11, 2017) + +- Fixing issue with web workers ([#1160](https://github.com/axios/axios/pull/1160)) +- Allowing overriding transport ([#1080](https://github.com/axios/axios/pull/1080)) +- Updating TypeScript typings ([#1165](https://github.com/axios/axios/pull/1165), [#1125](https://github.com/axios/axios/pull/1125), [#1131](https://github.com/axios/axios/pull/1131)) + +### 0.17.0 (Oct 21, 2017) + +- **BREAKING** Fixing issue with `baseURL` and interceptors ([#950](https://github.com/axios/axios/pull/950)) +- **BREAKING** Improving handing of duplicate headers ([#874](https://github.com/axios/axios/pull/874)) +- Adding support for disabling proxies ([#691](https://github.com/axios/axios/pull/691)) +- Updating TypeScript typings with generic type parameters ([#1061](https://github.com/axios/axios/pull/1061)) + +### 0.16.2 (Jun 3, 2017) + +- Fixing issue with including `buffer` in bundle ([#887](https://github.com/axios/axios/pull/887)) +- Including underlying request in errors ([#830](https://github.com/axios/axios/pull/830)) +- Convert `method` to lowercase ([#930](https://github.com/axios/axios/pull/930)) + +### 0.16.1 (Apr 8, 2017) + +- Improving HTTP adapter to return last request in case of redirects ([#828](https://github.com/axios/axios/pull/828)) +- Updating `follow-redirects` dependency ([#829](https://github.com/axios/axios/pull/829)) +- Adding support for passing `Buffer` in node ([#773](https://github.com/axios/axios/pull/773)) + +### 0.16.0 (Mar 31, 2017) + +- **BREAKING** Removing `Promise` from axios typings in favor of built-in type declarations ([#480](https://github.com/axios/axios/issues/480)) +- Adding `options` shortcut method ([#461](https://github.com/axios/axios/pull/461)) +- Fixing issue with using `responseType: 'json'` in browsers incompatible with XHR Level 2 ([#654](https://github.com/axios/axios/pull/654)) +- Improving React Native detection ([#731](https://github.com/axios/axios/pull/731)) +- Fixing `combineURLs` to support empty `relativeURL` ([#581](https://github.com/axios/axios/pull/581)) +- Removing `PROTECTION_PREFIX` support ([#561](https://github.com/axios/axios/pull/561)) + +### 0.15.3 (Nov 27, 2016) + +- Fixing issue with custom instances and global defaults ([#443](https://github.com/axios/axios/issues/443)) +- Renaming `axios.d.ts` to `index.d.ts` ([#519](https://github.com/axios/axios/issues/519)) +- Adding `get`, `head`, and `delete` to `defaults.headers` ([#509](https://github.com/axios/axios/issues/509)) +- Fixing issue with `btoa` and IE ([#507](https://github.com/axios/axios/issues/507)) +- Adding support for proxy authentication ([#483](https://github.com/axios/axios/pull/483)) +- Improving HTTP adapter to use `http` protocol by default ([#493](https://github.com/axios/axios/pull/493)) +- Fixing proxy issues ([#491](https://github.com/axios/axios/pull/491)) + +### 0.15.2 (Oct 17, 2016) + +- Fixing issue with calling `cancel` after response has been received ([#482](https://github.com/axios/axios/issues/482)) + +### 0.15.1 (Oct 14, 2016) + +- Fixing issue with UMD ([#485](https://github.com/axios/axios/issues/485)) + +### 0.15.0 (Oct 10, 2016) + +- Adding cancellation support ([#452](https://github.com/axios/axios/pull/452)) +- Moving default adapter to global defaults ([#437](https://github.com/axios/axios/pull/437)) +- Fixing issue with `file` URI scheme ([#440](https://github.com/axios/axios/pull/440)) +- Fixing issue with `params` objects that have no prototype ([#445](https://github.com/axios/axios/pull/445)) + +### 0.14.0 (Aug 27, 2016) + +- **BREAKING** Updating TypeScript definitions ([#419](https://github.com/axios/axios/pull/419)) +- **BREAKING** Replacing `agent` option with `httpAgent` and `httpsAgent` ([#387](https://github.com/axios/axios/pull/387)) +- **BREAKING** Splitting `progress` event handlers into `onUploadProgress` and `onDownloadProgress` ([#423](https://github.com/axios/axios/pull/423)) +- Adding support for `http_proxy` and `https_proxy` environment variables ([#366](https://github.com/axios/axios/pull/366)) +- Fixing issue with `auth` config option and `Authorization` header ([#397](https://github.com/axios/axios/pull/397)) +- Don't set XSRF header if `xsrfCookieName` is `null` ([#406](https://github.com/axios/axios/pull/406)) + +### 0.13.1 (Jul 16, 2016) + +- Fixing issue with response data not being transformed on error ([#378](https://github.com/axios/axios/issues/378)) + +### 0.13.0 (Jul 13, 2016) + +- **BREAKING** Improved error handling ([#345](https://github.com/axios/axios/pull/345)) +- **BREAKING** Response transformer now invoked in dispatcher not adapter ([10eb238](https://github.com/axios/axios/commit/10eb23865101f9347570552c04e9d6211376e25e)) +- **BREAKING** Request adapters now return a `Promise` ([157efd5](https://github.com/axios/axios/commit/157efd5615890301824e3121cc6c9d2f9b21f94a)) +- Fixing issue with `withCredentials` not being overwritten ([#343](https://github.com/axios/axios/issues/343)) +- Fixing regression with request transformer being called before request interceptor ([#352](https://github.com/axios/axios/issues/352)) +- Fixing custom instance defaults ([#341](https://github.com/axios/axios/issues/341)) +- Fixing instances created from `axios.create` to have same API as default axios ([#217](https://github.com/axios/axios/issues/217)) + +### 0.12.0 (May 31, 2016) + +- Adding support for `URLSearchParams` ([#317](https://github.com/axios/axios/pull/317)) +- Adding `maxRedirects` option ([#307](https://github.com/axios/axios/pull/307)) + +### 0.11.1 (May 17, 2016) + +- Fixing IE CORS support ([#313](https://github.com/axios/axios/pull/313)) +- Fixing detection of `FormData` ([#325](https://github.com/axios/axios/pull/325)) +- Adding `Axios` class to exports ([#321](https://github.com/axios/axios/pull/321)) + +### 0.11.0 (Apr 26, 2016) + +- Adding support for Stream with HTTP adapter ([#296](https://github.com/axios/axios/pull/296)) +- Adding support for custom HTTP status code error ranges ([#308](https://github.com/axios/axios/pull/308)) +- Fixing issue with ArrayBuffer ([#299](https://github.com/axios/axios/pull/299)) + +### 0.10.0 (Apr 20, 2016) + +- Fixing issue with some requests sending `undefined` instead of `null` ([#250](https://github.com/axios/axios/pull/250)) +- Fixing basic auth for HTTP adapter ([#252](https://github.com/axios/axios/pull/252)) +- Fixing request timeout for XHR adapter ([#227](https://github.com/axios/axios/pull/227)) +- Fixing IE8 support by using `onreadystatechange` instead of `onload` ([#249](https://github.com/axios/axios/pull/249)) +- Fixing IE9 cross domain requests ([#251](https://github.com/axios/axios/pull/251)) +- Adding `maxContentLength` option ([#275](https://github.com/axios/axios/pull/275)) +- Fixing XHR support for WebWorker environment ([#279](https://github.com/axios/axios/pull/279)) +- Adding request instance to response ([#200](https://github.com/axios/axios/pull/200)) + +### 0.9.1 (Jan 24, 2016) + +- Improving handling of request timeout in node ([#124](https://github.com/axios/axios/issues/124)) +- Fixing network errors not rejecting ([#205](https://github.com/axios/axios/pull/205)) +- Fixing issue with IE rejecting on HTTP 204 ([#201](https://github.com/axios/axios/issues/201)) +- Fixing host/port when following redirects ([#198](https://github.com/axios/axios/pull/198)) + +### 0.9.0 (Jan 18, 2016) + +- Adding support for custom adapters +- Fixing Content-Type header being removed when data is false ([#195](https://github.com/axios/axios/pull/195)) +- Improving XDomainRequest implementation ([#185](https://github.com/axios/axios/pull/185)) +- Improving config merging and order of precedence ([#183](https://github.com/axios/axios/pull/183)) +- Fixing XDomainRequest support for only <= IE9 ([#182](https://github.com/axios/axios/pull/182)) + +### 0.8.1 (Dec 14, 2015) + +- Adding support for passing XSRF token for cross domain requests when using `withCredentials` ([#168](https://github.com/axios/axios/pull/168)) +- Fixing error with format of basic auth header ([#178](https://github.com/axios/axios/pull/173)) +- Fixing error with JSON payloads throwing `InvalidStateError` in some cases ([#174](https://github.com/axios/axios/pull/174)) + +### 0.8.0 (Dec 11, 2015) + +- Adding support for creating instances of axios ([#123](https://github.com/axios/axios/pull/123)) +- Fixing http adapter to use `Buffer` instead of `String` in case of `responseType === 'arraybuffer'` ([#128](https://github.com/axios/axios/pull/128)) +- Adding support for using custom parameter serializer with `paramsSerializer` option ([#121](https://github.com/axios/axios/pull/121)) +- Fixing issue in IE8 caused by `forEach` on `arguments` ([#127](https://github.com/axios/axios/pull/127)) +- Adding support for following redirects in node ([#146](https://github.com/axios/axios/pull/146)) +- Adding support for transparent decompression if `content-encoding` is set ([#149](https://github.com/axios/axios/pull/149)) +- Adding support for transparent XDomainRequest to handle cross domain requests in IE9 ([#140](https://github.com/axios/axios/pull/140)) +- Adding support for HTTP basic auth via Authorization header ([#167](https://github.com/axios/axios/pull/167)) +- Adding support for baseURL option ([#160](https://github.com/axios/axios/pull/160)) + +### 0.7.0 (Sep 29, 2015) + +- Fixing issue with minified bundle in IE8 ([#87](https://github.com/axios/axios/pull/87)) +- Adding support for passing agent in node ([#102](https://github.com/axios/axios/pull/102)) +- Adding support for returning result from `axios.spread` for chaining ([#106](https://github.com/axios/axios/pull/106)) +- Fixing typescript definition ([#105](https://github.com/axios/axios/pull/105)) +- Fixing default timeout config for node ([#112](https://github.com/axios/axios/pull/112)) +- Adding support for use in web workers, and react-native ([#70](https://github.com/axios/axios/issue/70)), ([#98](https://github.com/axios/axios/pull/98)) +- Adding support for fetch like API `axios(url[, config])` ([#116](https://github.com/axios/axios/issues/116)) + +### 0.6.0 (Sep 21, 2015) + +- Removing deprecated success/error aliases +- Fixing issue with array params not being properly encoded ([#49](https://github.com/axios/axios/pull/49)) +- Fixing issue with User-Agent getting overridden ([#69](https://github.com/axios/axios/issues/69)) +- Adding support for timeout config ([#56](https://github.com/axios/axios/issues/56)) +- Removing es6-promise dependency +- Fixing issue preventing `length` to be used as a parameter ([#91](https://github.com/axios/axios/pull/91)) +- Fixing issue with IE8 ([#85](https://github.com/axios/axios/pull/85)) +- Converting build to UMD + +### 0.5.4 (Apr 08, 2015) + +- Fixing issue with FormData not being sent ([#53](https://github.com/axios/axios/issues/53)) + +### 0.5.3 (Apr 07, 2015) + +- Using JSON.parse unconditionally when transforming response string ([#55](https://github.com/axios/axios/issues/55)) + +### 0.5.2 (Mar 13, 2015) + +- Adding support for `statusText` in response ([#46](https://github.com/axios/axios/issues/46)) + +### 0.5.1 (Mar 10, 2015) + +- Fixing issue using strict mode ([#45](https://github.com/axios/axios/issues/45)) +- Fixing issue with standalone build ([#47](https://github.com/axios/axios/issues/47)) + +### 0.5.0 (Jan 23, 2015) + +- Adding support for intercepetors ([#14](https://github.com/axios/axios/issues/14)) +- Updating es6-promise dependency + +### 0.4.2 (Dec 10, 2014) + +- Fixing issue with `Content-Type` when using `FormData` ([#22](https://github.com/axios/axios/issues/22)) +- Adding support for TypeScript ([#25](https://github.com/axios/axios/issues/25)) +- Fixing issue with standalone build ([#29](https://github.com/axios/axios/issues/29)) +- Fixing issue with verbs needing to be capitalized in some browsers ([#30](https://github.com/axios/axios/issues/30)) + +### 0.4.1 (Oct 15, 2014) + +- Adding error handling to request for node.js ([#18](https://github.com/axios/axios/issues/18)) + +### 0.4.0 (Oct 03, 2014) + +- Adding support for `ArrayBuffer` and `ArrayBufferView` ([#10](https://github.com/axios/axios/issues/10)) +- Adding support for utf-8 for node.js ([#13](https://github.com/axios/axios/issues/13)) +- Adding support for SSL for node.js ([#12](https://github.com/axios/axios/issues/12)) +- Fixing incorrect `Content-Type` header ([#9](https://github.com/axios/axios/issues/9)) +- Adding standalone build without bundled es6-promise ([#11](https://github.com/axios/axios/issues/11)) +- Deprecating `success`/`error` in favor of `then`/`catch` + +### 0.3.1 (Sep 16, 2014) + +- Fixing missing post body when using node.js ([#3](https://github.com/axios/axios/issues/3)) + +### 0.3.0 (Sep 16, 2014) + +- Fixing `success` and `error` to properly receive response data as individual arguments ([#8](https://github.com/axios/axios/issues/8)) +- Updating `then` and `catch` to receive response data as a single object ([#6](https://github.com/axios/axios/issues/6)) +- Fixing issue with `all` not working ([#7](https://github.com/axios/axios/issues/7)) + +### 0.2.2 (Sep 14, 2014) + +- Fixing bundling with browserify ([#4](https://github.com/axios/axios/issues/4)) + +### 0.2.1 (Sep 12, 2014) + +- Fixing build problem causing ridiculous file sizes + +### 0.2.0 (Sep 12, 2014) + +- Adding support for `all` and `spread` +- Adding support for node.js ([#1](https://github.com/axios/axios/issues/1)) + +### 0.1.0 (Aug 29, 2014) + +- Initial release diff --git a/_nodejs/node_modules/axios/LICENSE b/_nodejs/node_modules/axios/LICENSE new file mode 100644 index 0000000..d36c80e --- /dev/null +++ b/_nodejs/node_modules/axios/LICENSE @@ -0,0 +1,19 @@ +Copyright (c) 2014-present Matt Zabriskie + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/_nodejs/node_modules/axios/README.md b/_nodejs/node_modules/axios/README.md new file mode 100755 index 0000000..66906d8 --- /dev/null +++ b/_nodejs/node_modules/axios/README.md @@ -0,0 +1,991 @@ +# axios + +[![npm version](https://img.shields.io/npm/v/axios.svg?style=flat-square)](https://www.npmjs.org/package/axios) +[![CDNJS](https://img.shields.io/cdnjs/v/axios.svg?style=flat-square)](https://cdnjs.com/libraries/axios) +![Build status](https://github.com/axios/axios/actions/workflows/ci.yml/badge.svg) +[![Gitpod Ready-to-Code](https://img.shields.io/badge/Gitpod-Ready--to--Code-blue?logo=gitpod)](https://gitpod.io/#https://github.com/axios/axios) +[![code coverage](https://img.shields.io/coveralls/mzabriskie/axios.svg?style=flat-square)](https://coveralls.io/r/mzabriskie/axios) +[![install size](https://packagephobia.now.sh/badge?p=axios)](https://packagephobia.now.sh/result?p=axios) +[![npm downloads](https://img.shields.io/npm/dm/axios.svg?style=flat-square)](http://npm-stat.com/charts.html?package=axios) +[![gitter chat](https://img.shields.io/gitter/room/mzabriskie/axios.svg?style=flat-square)](https://gitter.im/mzabriskie/axios) +[![code helpers](https://www.codetriage.com/axios/axios/badges/users.svg)](https://www.codetriage.com/axios/axios) +[![Known Vulnerabilities](https://snyk.io/test/npm/axios/badge.svg)](https://snyk.io/test/npm/axios) + +Promise based HTTP client for the browser and node.js + +> New axios docs website: [click here](https://axios-http.com/) + +## Table of Contents + + - [Features](#features) + - [Browser Support](#browser-support) + - [Installing](#installing) + - [Example](#example) + - [Axios API](#axios-api) + - [Request method aliases](#request-method-aliases) + - [Concurrency 👎](#concurrency-deprecated) + - [Creating an instance](#creating-an-instance) + - [Instance methods](#instance-methods) + - [Request Config](#request-config) + - [Response Schema](#response-schema) + - [Config Defaults](#config-defaults) + - [Global axios defaults](#global-axios-defaults) + - [Custom instance defaults](#custom-instance-defaults) + - [Config order of precedence](#config-order-of-precedence) + - [Interceptors](#interceptors) + - [Multiple Interceptors](#multiple-interceptors) + - [Handling Errors](#handling-errors) + - [Cancellation](#cancellation) + - [AbortController](#abortcontroller) + - [CancelToken 👎](#canceltoken-deprecated) + - [Using application/x-www-form-urlencoded format](#using-applicationx-www-form-urlencoded-format) + - [Browser](#browser) + - [Node.js](#nodejs) + - [Query string](#query-string) + - [Form data](#form-data) + - [Automatic serialization](#-automatic-serialization) + - [Manual FormData passing](#manual-formdata-passing) + - [Semver](#semver) + - [Promises](#promises) + - [TypeScript](#typescript) + - [Resources](#resources) + - [Credits](#credits) + - [License](#license) + +## Features + +- Make [XMLHttpRequests](https://developer.mozilla.org/en-US/docs/Web/API/XMLHttpRequest) from the browser +- Make [http](http://nodejs.org/api/http.html) requests from node.js +- Supports the [Promise](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Promise) API +- Intercept request and response +- Transform request and response data +- Cancel requests +- Automatic transforms for JSON data +- Client side support for protecting against [XSRF](http://en.wikipedia.org/wiki/Cross-site_request_forgery) + +## Browser Support + +![Chrome](https://raw.github.com/alrra/browser-logos/master/src/chrome/chrome_48x48.png) | ![Firefox](https://raw.github.com/alrra/browser-logos/master/src/firefox/firefox_48x48.png) | ![Safari](https://raw.github.com/alrra/browser-logos/master/src/safari/safari_48x48.png) | ![Opera](https://raw.github.com/alrra/browser-logos/master/src/opera/opera_48x48.png) | ![Edge](https://raw.github.com/alrra/browser-logos/master/src/edge/edge_48x48.png) | ![IE](https://raw.github.com/alrra/browser-logos/master/src/archive/internet-explorer_9-11/internet-explorer_9-11_48x48.png) | +--- | --- | --- | --- | --- | --- | +Latest ✔ | Latest ✔ | Latest ✔ | Latest ✔ | Latest ✔ | 11 ✔ | + +[![Browser Matrix](https://saucelabs.com/open_sauce/build_matrix/axios.svg)](https://saucelabs.com/u/axios) + +## Installing + +Using npm: + +```bash +$ npm install axios +``` + +Using bower: + +```bash +$ bower install axios +``` + +Using yarn: + +```bash +$ yarn add axios +``` + +Using jsDelivr CDN: + +```html + +``` + +Using unpkg CDN: + +```html + +``` + +## Example + +### note: CommonJS usage +In order to gain the TypeScript typings (for intellisense / autocomplete) while using CommonJS imports with `require()` use the following approach: + +```js +const axios = require('axios').default; + +// axios. will now provide autocomplete and parameter typings +``` + +Performing a `GET` request + +```js +const axios = require('axios').default; + +// Make a request for a user with a given ID +axios.get('/user?ID=12345') + .then(function (response) { + // handle success + console.log(response); + }) + .catch(function (error) { + // handle error + console.log(error); + }) + .then(function () { + // always executed + }); + +// Optionally the request above could also be done as +axios.get('/user', { + params: { + ID: 12345 + } + }) + .then(function (response) { + console.log(response); + }) + .catch(function (error) { + console.log(error); + }) + .then(function () { + // always executed + }); + +// Want to use async/await? Add the `async` keyword to your outer function/method. +async function getUser() { + try { + const response = await axios.get('/user?ID=12345'); + console.log(response); + } catch (error) { + console.error(error); + } +} +``` + +> **NOTE:** `async/await` is part of ECMAScript 2017 and is not supported in Internet +> Explorer and older browsers, so use with caution. + +Performing a `POST` request + +```js +axios.post('/user', { + firstName: 'Fred', + lastName: 'Flintstone' + }) + .then(function (response) { + console.log(response); + }) + .catch(function (error) { + console.log(error); + }); +``` + +Performing multiple concurrent requests + +```js +function getUserAccount() { + return axios.get('/user/12345'); +} + +function getUserPermissions() { + return axios.get('/user/12345/permissions'); +} + +Promise.all([getUserAccount(), getUserPermissions()]) + .then(function (results) { + const acct = results[0]; + const perm = results[1]; + }); +``` + +## axios API + +Requests can be made by passing the relevant config to `axios`. + +##### axios(config) + +```js +// Send a POST request +axios({ + method: 'post', + url: '/user/12345', + data: { + firstName: 'Fred', + lastName: 'Flintstone' + } +}); +``` + +```js +// GET request for remote image in node.js +axios({ + method: 'get', + url: 'http://bit.ly/2mTM3nY', + responseType: 'stream' +}) + .then(function (response) { + response.data.pipe(fs.createWriteStream('ada_lovelace.jpg')) + }); +``` + +##### axios(url[, config]) + +```js +// Send a GET request (default method) +axios('/user/12345'); +``` + +### Request method aliases + +For convenience, aliases have been provided for all common request methods. + +##### axios.request(config) +##### axios.get(url[, config]) +##### axios.delete(url[, config]) +##### axios.head(url[, config]) +##### axios.options(url[, config]) +##### axios.post(url[, data[, config]]) +##### axios.put(url[, data[, config]]) +##### axios.patch(url[, data[, config]]) + +###### NOTE +When using the alias methods `url`, `method`, and `data` properties don't need to be specified in config. + +### Concurrency (Deprecated) +Please use `Promise.all` to replace the below functions. + +Helper functions for dealing with concurrent requests. + +axios.all(iterable) +axios.spread(callback) + +### Creating an instance + +You can create a new instance of axios with a custom config. + +##### axios.create([config]) + +```js +const instance = axios.create({ + baseURL: 'https://some-domain.com/api/', + timeout: 1000, + headers: {'X-Custom-Header': 'foobar'} +}); +``` + +### Instance methods + +The available instance methods are listed below. The specified config will be merged with the instance config. + +##### axios#request(config) +##### axios#get(url[, config]) +##### axios#delete(url[, config]) +##### axios#head(url[, config]) +##### axios#options(url[, config]) +##### axios#post(url[, data[, config]]) +##### axios#put(url[, data[, config]]) +##### axios#patch(url[, data[, config]]) +##### axios#getUri([config]) + +## Request Config + +These are the available config options for making requests. Only the `url` is required. Requests will default to `GET` if `method` is not specified. + +```js +{ + // `url` is the server URL that will be used for the request + url: '/user', + + // `method` is the request method to be used when making the request + method: 'get', // default + + // `baseURL` will be prepended to `url` unless `url` is absolute. + // It can be convenient to set `baseURL` for an instance of axios to pass relative URLs + // to methods of that instance. + baseURL: 'https://some-domain.com/api/', + + // `transformRequest` allows changes to the request data before it is sent to the server + // This is only applicable for request methods 'PUT', 'POST', 'PATCH' and 'DELETE' + // The last function in the array must return a string or an instance of Buffer, ArrayBuffer, + // FormData or Stream + // You may modify the headers object. + transformRequest: [function (data, headers) { + // Do whatever you want to transform the data + + return data; + }], + + // `transformResponse` allows changes to the response data to be made before + // it is passed to then/catch + transformResponse: [function (data) { + // Do whatever you want to transform the data + + return data; + }], + + // `headers` are custom headers to be sent + headers: {'X-Requested-With': 'XMLHttpRequest'}, + + // `params` are the URL parameters to be sent with the request + // Must be a plain object or a URLSearchParams object + params: { + ID: 12345 + }, + + // `paramsSerializer` is an optional function in charge of serializing `params` + // (e.g. https://www.npmjs.com/package/qs, http://api.jquery.com/jquery.param/) + paramsSerializer: function (params) { + return Qs.stringify(params, {arrayFormat: 'brackets'}) + }, + + // `data` is the data to be sent as the request body + // Only applicable for request methods 'PUT', 'POST', 'DELETE , and 'PATCH' + // When no `transformRequest` is set, must be of one of the following types: + // - string, plain object, ArrayBuffer, ArrayBufferView, URLSearchParams + // - Browser only: FormData, File, Blob + // - Node only: Stream, Buffer + data: { + firstName: 'Fred' + }, + + // syntax alternative to send data into the body + // method post + // only the value is sent, not the key + data: 'Country=Brasil&City=Belo Horizonte', + + // `timeout` specifies the number of milliseconds before the request times out. + // If the request takes longer than `timeout`, the request will be aborted. + timeout: 1000, // default is `0` (no timeout) + + // `withCredentials` indicates whether or not cross-site Access-Control requests + // should be made using credentials + withCredentials: false, // default + + // `adapter` allows custom handling of requests which makes testing easier. + // Return a promise and supply a valid response (see lib/adapters/README.md). + adapter: function (config) { + /* ... */ + }, + + // `auth` indicates that HTTP Basic auth should be used, and supplies credentials. + // This will set an `Authorization` header, overwriting any existing + // `Authorization` custom headers you have set using `headers`. + // Please note that only HTTP Basic auth is configurable through this parameter. + // For Bearer tokens and such, use `Authorization` custom headers instead. + auth: { + username: 'janedoe', + password: 's00pers3cret' + }, + + // `responseType` indicates the type of data that the server will respond with + // options are: 'arraybuffer', 'document', 'json', 'text', 'stream' + // browser only: 'blob' + responseType: 'json', // default + + // `responseEncoding` indicates encoding to use for decoding responses (Node.js only) + // Note: Ignored for `responseType` of 'stream' or client-side requests + responseEncoding: 'utf8', // default + + // `xsrfCookieName` is the name of the cookie to use as a value for xsrf token + xsrfCookieName: 'XSRF-TOKEN', // default + + // `xsrfHeaderName` is the name of the http header that carries the xsrf token value + xsrfHeaderName: 'X-XSRF-TOKEN', // default + + // `onUploadProgress` allows handling of progress events for uploads + // browser only + onUploadProgress: function (progressEvent) { + // Do whatever you want with the native progress event + }, + + // `onDownloadProgress` allows handling of progress events for downloads + // browser only + onDownloadProgress: function (progressEvent) { + // Do whatever you want with the native progress event + }, + + // `maxContentLength` defines the max size of the http response content in bytes allowed in node.js + maxContentLength: 2000, + + // `maxBodyLength` (Node only option) defines the max size of the http request content in bytes allowed + maxBodyLength: 2000, + + // `validateStatus` defines whether to resolve or reject the promise for a given + // HTTP response status code. If `validateStatus` returns `true` (or is set to `null` + // or `undefined`), the promise will be resolved; otherwise, the promise will be + // rejected. + validateStatus: function (status) { + return status >= 200 && status < 300; // default + }, + + // `maxRedirects` defines the maximum number of redirects to follow in node.js. + // If set to 0, no redirects will be followed. + maxRedirects: 21, // default + + // `beforeRedirect` defines a function that will be called before redirect. + // Use this to adjust the request options upon redirecting, + // to inspect the latest response headers, + // or to cancel the request by throwing an error + // If maxRedirects is set to 0, `beforeRedirect` is not used. + beforeRedirect: (options, { headers }) => { + if (options.hostname === "example.com") { + options.auth = "user:password"; + } + }; + + // `socketPath` defines a UNIX Socket to be used in node.js. + // e.g. '/var/run/docker.sock' to send requests to the docker daemon. + // Only either `socketPath` or `proxy` can be specified. + // If both are specified, `socketPath` is used. + socketPath: null, // default + + // `httpAgent` and `httpsAgent` define a custom agent to be used when performing http + // and https requests, respectively, in node.js. This allows options to be added like + // `keepAlive` that are not enabled by default. + httpAgent: new http.Agent({ keepAlive: true }), + httpsAgent: new https.Agent({ keepAlive: true }), + + // `proxy` defines the hostname, port, and protocol of the proxy server. + // You can also define your proxy using the conventional `http_proxy` and + // `https_proxy` environment variables. If you are using environment variables + // for your proxy configuration, you can also define a `no_proxy` environment + // variable as a comma-separated list of domains that should not be proxied. + // Use `false` to disable proxies, ignoring environment variables. + // `auth` indicates that HTTP Basic auth should be used to connect to the proxy, and + // supplies credentials. + // This will set an `Proxy-Authorization` header, overwriting any existing + // `Proxy-Authorization` custom headers you have set using `headers`. + // If the proxy server uses HTTPS, then you must set the protocol to `https`. + proxy: { + protocol: 'https', + host: '127.0.0.1', + port: 9000, + auth: { + username: 'mikeymike', + password: 'rapunz3l' + } + }, + + // `cancelToken` specifies a cancel token that can be used to cancel the request + // (see Cancellation section below for details) + cancelToken: new CancelToken(function (cancel) { + }), + + // an alternative way to cancel Axios requests using AbortController + signal: new AbortController().signal, + + // `decompress` indicates whether or not the response body should be decompressed + // automatically. If set to `true` will also remove the 'content-encoding' header + // from the responses objects of all decompressed responses + // - Node only (XHR cannot turn off decompression) + decompress: true // default + + // `insecureHTTPParser` boolean. + // Indicates where to use an insecure HTTP parser that accepts invalid HTTP headers. + // This may allow interoperability with non-conformant HTTP implementations. + // Using the insecure parser should be avoided. + // see options https://nodejs.org/dist/latest-v12.x/docs/api/http.html#http_http_request_url_options_callback + // see also https://nodejs.org/en/blog/vulnerability/february-2020-security-releases/#strict-http-header-parsing-none + insecureHTTPParser: undefined // default + + // transitional options for backward compatibility that may be removed in the newer versions + transitional: { + // silent JSON parsing mode + // `true` - ignore JSON parsing errors and set response.data to null if parsing failed (old behaviour) + // `false` - throw SyntaxError if JSON parsing failed (Note: responseType must be set to 'json') + silentJSONParsing: true, // default value for the current Axios version + + // try to parse the response string as JSON even if `responseType` is not 'json' + forcedJSONParsing: true, + + // throw ETIMEDOUT error instead of generic ECONNABORTED on request timeouts + clarifyTimeoutError: false, + }, + + env: { + // The FormData class to be used to automatically serialize the payload into a FormData object + FormData: window?.FormData || global?.FormData + } +} +``` + +## Response Schema + +The response for a request contains the following information. + +```js +{ + // `data` is the response that was provided by the server + data: {}, + + // `status` is the HTTP status code from the server response + status: 200, + + // `statusText` is the HTTP status message from the server response + statusText: 'OK', + + // `headers` the HTTP headers that the server responded with + // All header names are lower cased and can be accessed using the bracket notation. + // Example: `response.headers['content-type']` + headers: {}, + + // `config` is the config that was provided to `axios` for the request + config: {}, + + // `request` is the request that generated this response + // It is the last ClientRequest instance in node.js (in redirects) + // and an XMLHttpRequest instance in the browser + request: {} +} +``` + +When using `then`, you will receive the response as follows: + +```js +axios.get('/user/12345') + .then(function (response) { + console.log(response.data); + console.log(response.status); + console.log(response.statusText); + console.log(response.headers); + console.log(response.config); + }); +``` + +When using `catch`, or passing a [rejection callback](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Promise/then) as second parameter of `then`, the response will be available through the `error` object as explained in the [Handling Errors](#handling-errors) section. + +## Config Defaults + +You can specify config defaults that will be applied to every request. + +### Global axios defaults + +```js +axios.defaults.baseURL = 'https://api.example.com'; + +// Important: If axios is used with multiple domains, the AUTH_TOKEN will be sent to all of them. +// See below for an example using Custom instance defaults instead. +axios.defaults.headers.common['Authorization'] = AUTH_TOKEN; + +axios.defaults.headers.post['Content-Type'] = 'application/x-www-form-urlencoded'; +``` + +### Custom instance defaults + +```js +// Set config defaults when creating the instance +const instance = axios.create({ + baseURL: 'https://api.example.com' +}); + +// Alter defaults after instance has been created +instance.defaults.headers.common['Authorization'] = AUTH_TOKEN; +``` + +### Config order of precedence + +Config will be merged with an order of precedence. The order is library defaults found in [lib/defaults.js](https://github.com/axios/axios/blob/master/lib/defaults.js#L28), then `defaults` property of the instance, and finally `config` argument for the request. The latter will take precedence over the former. Here's an example. + +```js +// Create an instance using the config defaults provided by the library +// At this point the timeout config value is `0` as is the default for the library +const instance = axios.create(); + +// Override timeout default for the library +// Now all requests using this instance will wait 2.5 seconds before timing out +instance.defaults.timeout = 2500; + +// Override timeout for this request as it's known to take a long time +instance.get('/longRequest', { + timeout: 5000 +}); +``` + +## Interceptors + +You can intercept requests or responses before they are handled by `then` or `catch`. + +```js +// Add a request interceptor +axios.interceptors.request.use(function (config) { + // Do something before request is sent + return config; + }, function (error) { + // Do something with request error + return Promise.reject(error); + }); + +// Add a response interceptor +axios.interceptors.response.use(function (response) { + // Any status code that lie within the range of 2xx cause this function to trigger + // Do something with response data + return response; + }, function (error) { + // Any status codes that falls outside the range of 2xx cause this function to trigger + // Do something with response error + return Promise.reject(error); + }); +``` + +If you need to remove an interceptor later you can. + +```js +const myInterceptor = axios.interceptors.request.use(function () {/*...*/}); +axios.interceptors.request.eject(myInterceptor); +``` + +You can add interceptors to a custom instance of axios. + +```js +const instance = axios.create(); +instance.interceptors.request.use(function () {/*...*/}); +``` + +When you add request interceptors, they are presumed to be asynchronous by default. This can cause a delay +in the execution of your axios request when the main thread is blocked (a promise is created under the hood for +the interceptor and your request gets put on the bottom of the call stack). If your request interceptors are synchronous you can add a flag +to the options object that will tell axios to run the code synchronously and avoid any delays in request execution. + +```js +axios.interceptors.request.use(function (config) { + config.headers.test = 'I am only a header!'; + return config; +}, null, { synchronous: true }); +``` + +If you want to execute a particular interceptor based on a runtime check, +you can add a `runWhen` function to the options object. The interceptor will not be executed **if and only if** the return +of `runWhen` is `false`. The function will be called with the config +object (don't forget that you can bind your own arguments to it as well.) This can be handy when you have an +asynchronous request interceptor that only needs to run at certain times. + +```js +function onGetCall(config) { + return config.method === 'get'; +} +axios.interceptors.request.use(function (config) { + config.headers.test = 'special get headers'; + return config; +}, null, { runWhen: onGetCall }); +``` + +### Multiple Interceptors + +Given you add multiple response interceptors +and when the response was fulfilled +- then each interceptor is executed +- then they are executed in the order they were added +- then only the last interceptor's result is returned +- then every interceptor receives the result of it's predecessor +- and when the fulfillment-interceptor throws + - then the following fulfillment-interceptor is not called + - then the following rejection-interceptor is called + - once caught, another following fulfill-interceptor is called again (just like in a promise chain). + +Read [the interceptor tests](./test/specs/interceptors.spec.js) for seeing all this in code. + +## Handling Errors + +```js +axios.get('/user/12345') + .catch(function (error) { + if (error.response) { + // The request was made and the server responded with a status code + // that falls out of the range of 2xx + console.log(error.response.data); + console.log(error.response.status); + console.log(error.response.headers); + } else if (error.request) { + // The request was made but no response was received + // `error.request` is an instance of XMLHttpRequest in the browser and an instance of + // http.ClientRequest in node.js + console.log(error.request); + } else { + // Something happened in setting up the request that triggered an Error + console.log('Error', error.message); + } + console.log(error.config); + }); +``` + +Using the `validateStatus` config option, you can define HTTP code(s) that should throw an error. + +```js +axios.get('/user/12345', { + validateStatus: function (status) { + return status < 500; // Resolve only if the status code is less than 500 + } +}) +``` + +Using `toJSON` you get an object with more information about the HTTP error. + +```js +axios.get('/user/12345') + .catch(function (error) { + console.log(error.toJSON()); + }); +``` + +## Cancellation + +### AbortController + +Starting from `v0.22.0` Axios supports AbortController to cancel requests in fetch API way: + +```js +const controller = new AbortController(); + +axios.get('/foo/bar', { + signal: controller.signal +}).then(function(response) { + //... +}); +// cancel the request +controller.abort() +``` + +### CancelToken `👎deprecated` + +You can also cancel a request using a *CancelToken*. + +> The axios cancel token API is based on the withdrawn [cancelable promises proposal](https://github.com/tc39/proposal-cancelable-promises). + +> This API is deprecated since v0.22.0 and shouldn't be used in new projects + +You can create a cancel token using the `CancelToken.source` factory as shown below: + +```js +const CancelToken = axios.CancelToken; +const source = CancelToken.source(); + +axios.get('/user/12345', { + cancelToken: source.token +}).catch(function (thrown) { + if (axios.isCancel(thrown)) { + console.log('Request canceled', thrown.message); + } else { + // handle error + } +}); + +axios.post('/user/12345', { + name: 'new name' +}, { + cancelToken: source.token +}) + +// cancel the request (the message parameter is optional) +source.cancel('Operation canceled by the user.'); +``` + +You can also create a cancel token by passing an executor function to the `CancelToken` constructor: + +```js +const CancelToken = axios.CancelToken; +let cancel; + +axios.get('/user/12345', { + cancelToken: new CancelToken(function executor(c) { + // An executor function receives a cancel function as a parameter + cancel = c; + }) +}); + +// cancel the request +cancel(); +``` + +> Note: you can cancel several requests with the same cancel token/abort controller. +> If a cancellation token is already cancelled at the moment of starting an Axios request, then the request is cancelled immediately, without any attempts to make real request. + +> During the transition period, you can use both cancellation APIs, even for the same request: + +## Using application/x-www-form-urlencoded format + +By default, axios serializes JavaScript objects to `JSON`. To send data in the `application/x-www-form-urlencoded` format instead, you can use one of the following options. + +### Browser + +In a browser, you can use the [`URLSearchParams`](https://developer.mozilla.org/en-US/docs/Web/API/URLSearchParams) API as follows: + +```js +const params = new URLSearchParams(); +params.append('param1', 'value1'); +params.append('param2', 'value2'); +axios.post('/foo', params); +``` + +> Note that `URLSearchParams` is not supported by all browsers (see [caniuse.com](http://www.caniuse.com/#feat=urlsearchparams)), but there is a [polyfill](https://github.com/WebReflection/url-search-params) available (make sure to polyfill the global environment). + +Alternatively, you can encode data using the [`qs`](https://github.com/ljharb/qs) library: + +```js +const qs = require('qs'); +axios.post('/foo', qs.stringify({ 'bar': 123 })); +``` + +Or in another way (ES6), + +```js +import qs from 'qs'; +const data = { 'bar': 123 }; +const options = { + method: 'POST', + headers: { 'content-type': 'application/x-www-form-urlencoded' }, + data: qs.stringify(data), + url, +}; +axios(options); +``` + +### Node.js + +#### Query string + +In node.js, you can use the [`querystring`](https://nodejs.org/api/querystring.html) module as follows: + +```js +const querystring = require('querystring'); +axios.post('http://something.com/', querystring.stringify({ foo: 'bar' })); +``` + +or ['URLSearchParams'](https://nodejs.org/api/url.html#url_class_urlsearchparams) from ['url module'](https://nodejs.org/api/url.html) as follows: + +```js +const url = require('url'); +const params = new url.URLSearchParams({ foo: 'bar' }); +axios.post('http://something.com/', params.toString()); +``` + +You can also use the [`qs`](https://github.com/ljharb/qs) library. + +> NOTE: +> The `qs` library is preferable if you need to stringify nested objects, as the `querystring` method has [known issues](https://github.com/nodejs/node-v0.x-archive/issues/1665) with that use case. + +#### Form data + +##### 🆕 Automatic serialization + +Starting from `v0.27.0`, Axios supports automatic object serialization to a FormData object if the request `Content-Type` +header is set to `multipart/form-data`. + +The following request will submit the data in a FormData format (Browser & Node.js): + +```js +import axios from 'axios'; + +axios.post('https://httpbin.org/post', {x: 1}, { + headers: { + 'Content-Type': 'multipart/form-data' + } +}).then(({data})=> console.log(data)); +``` + +In the `node.js` build, the ([`form-data`](https://github.com/form-data/form-data)) polyfill is used by default. + +You can overload the FormData class by setting the `env.FormData` config variable, +but you probably won't need it in most cases: + +```js +const axios= require('axios'); +var FormData = require('form-data'); + +axios.post('https://httpbin.org/post', {x: 1, buf: new Buffer(10)}, { + headers: { + 'Content-Type': 'multipart/form-data' + } +}).then(({data})=> console.log(data)); +``` + +Axios FormData serializer supports some special endings to perform the following operations: + +- `{}` - serialize the value with JSON.stringify +- `[]` - unwrap the array like object as separate fields with the same key + +```js +const axios= require('axios'); + +axios.post('https://httpbin.org/post', { + 'myObj{}': {x: 1, s: "foo"}, + 'files[]': document.querySelector('#fileInput').files +}, { + headers: { + 'Content-Type': 'multipart/form-data' + } +}).then(({data})=> console.log(data)); +``` + +Axios supports the following shortcut methods: `postForm`, `putForm`, `patchForm` +which are just the corresponding http methods with a header preset: `Content-Type`: `multipart/form-data`. + +FileList object can be passed directly: + +```js +await axios.postForm('https://httpbin.org/post', document.querySelector('#fileInput').files) +``` + +All files will be sent with the same field names: `files[]`; + +##### Manual FormData passing + +In node.js, you can use the [`form-data`](https://github.com/form-data/form-data) library as follows: + +```js +const FormData = require('form-data'); + +const form = new FormData(); +form.append('my_field', 'my value'); +form.append('my_buffer', new Buffer(10)); +form.append('my_file', fs.createReadStream('/foo/bar.jpg')); + +axios.post('https://example.com', form) +``` + +## Semver + +Until axios reaches a `1.0` release, breaking changes will be released with a new minor version. For example `0.5.1`, and `0.5.4` will have the same API, but `0.6.0` will have breaking changes. + +## Promises + +axios depends on a native ES6 Promise implementation to be [supported](http://caniuse.com/promises). +If your environment doesn't support ES6 Promises, you can [polyfill](https://github.com/jakearchibald/es6-promise). + +## TypeScript + +axios includes [TypeScript](http://typescriptlang.org) definitions and a type guard for axios errors. + +```typescript +let user: User = null; +try { + const { data } = await axios.get('/user?ID=12345'); + user = data.userDetails; +} catch (error) { + if (axios.isAxiosError(error)) { + handleAxiosError(error); + } else { + handleUnexpectedError(error); + } +} +``` + +## Online one-click setup + +You can use Gitpod an online IDE(which is free for Open Source) for contributing or running the examples online. + +[![Open in Gitpod](https://gitpod.io/button/open-in-gitpod.svg)](https://gitpod.io/#https://github.com/axios/axios/blob/master/examples/server.js) + + +## Resources + +* [Changelog](https://github.com/axios/axios/blob/master/CHANGELOG.md) +* [Upgrade Guide](https://github.com/axios/axios/blob/master/UPGRADE_GUIDE.md) +* [Ecosystem](https://github.com/axios/axios/blob/master/ECOSYSTEM.md) +* [Contributing Guide](https://github.com/axios/axios/blob/master/CONTRIBUTING.md) +* [Code of Conduct](https://github.com/axios/axios/blob/master/CODE_OF_CONDUCT.md) + +## Credits + +axios is heavily inspired by the [$http service](https://docs.angularjs.org/api/ng/service/$http) provided in [AngularJS](https://angularjs.org/). Ultimately axios is an effort to provide a standalone `$http`-like service for use outside of AngularJS. + +## License + +[MIT](LICENSE) diff --git a/_nodejs/node_modules/axios/SECURITY.md b/_nodejs/node_modules/axios/SECURITY.md new file mode 100644 index 0000000..353df9a --- /dev/null +++ b/_nodejs/node_modules/axios/SECURITY.md @@ -0,0 +1,5 @@ +# Security Policy + +## Reporting a Vulnerability + +Please report security issues to jasonsaayman@gmail.com diff --git a/_nodejs/node_modules/axios/UPGRADE_GUIDE.md b/_nodejs/node_modules/axios/UPGRADE_GUIDE.md new file mode 100644 index 0000000..fdcff1a --- /dev/null +++ b/_nodejs/node_modules/axios/UPGRADE_GUIDE.md @@ -0,0 +1,168 @@ +# Upgrade Guide + +### 0.18.x -> 0.19.0 + +#### HTTPS Proxies + +Routing through an https proxy now requires setting the `protocol` attribute of the proxy configuration to `https` + +### 0.15.x -> 0.16.0 + +#### `Promise` Type Declarations + +The `Promise` type declarations have been removed from the axios typings in favor of the built-in type declarations. If you use axios in a TypeScript project that targets `ES5`, please make sure to include the `es2015.promise` lib. Please see [this post](https://blog.mariusschulz.com/2016/11/25/typescript-2-0-built-in-type-declarations) for details. + +### 0.13.x -> 0.14.0 + +#### TypeScript Definitions + +The axios TypeScript definitions have been updated to match the axios API and use the ES2015 module syntax. + +Please use the following `import` statement to import axios in TypeScript: + +```typescript +import axios from 'axios'; + +axios.get('/foo') + .then(response => console.log(response)) + .catch(error => console.log(error)); +``` + +#### `agent` Config Option + +The `agent` config option has been replaced with two new options: `httpAgent` and `httpsAgent`. Please use them instead. + +```js +{ + // Define a custom agent for HTTP + httpAgent: new http.Agent({ keepAlive: true }), + // Define a custom agent for HTTPS + httpsAgent: new https.Agent({ keepAlive: true }) +} +``` + +#### `progress` Config Option + +The `progress` config option has been replaced with the `onUploadProgress` and `onDownloadProgress` options. + +```js +{ + // Define a handler for upload progress events + onUploadProgress: function (progressEvent) { + // ... + }, + + // Define a handler for download progress events + onDownloadProgress: function (progressEvent) { + // ... + } +} +``` + +### 0.12.x -> 0.13.0 + +The `0.13.0` release contains several changes to custom adapters and error handling. + +#### Error Handling + +Previous to this release an error could either be a server response with bad status code or an actual `Error`. With this release Promise will always reject with an `Error`. In the case that a response was received, the `Error` will also include the response. + +```js +axios.get('/user/12345') + .catch((error) => { + console.log(error.message); + console.log(error.code); // Not always specified + console.log(error.config); // The config that was used to make the request + console.log(error.response); // Only available if response was received from the server + }); +``` + +#### Request Adapters + +This release changes a few things about how request adapters work. Please take note if you are using your own custom adapter. + +1. Response transformer is now called outside of adapter. +2. Request adapter returns a `Promise`. + +This means that you no longer need to invoke `transformData` on response data. You will also no longer receive `resolve` and `reject` as arguments in your adapter. + +Previous code: + +```js +function myAdapter(resolve, reject, config) { + var response = { + data: transformData( + responseData, + responseHeaders, + config.transformResponse + ), + status: request.status, + statusText: request.statusText, + headers: responseHeaders + }; + settle(resolve, reject, response); +} +``` + +New code: + +```js +function myAdapter(config) { + return new Promise(function (resolve, reject) { + var response = { + data: responseData, + status: request.status, + statusText: request.statusText, + headers: responseHeaders + }; + settle(resolve, reject, response); + }); +} +``` + +See the related commits for more details: +- [Response transformers](https://github.com/axios/axios/commit/10eb23865101f9347570552c04e9d6211376e25e) +- [Request adapter Promise](https://github.com/axios/axios/commit/157efd5615890301824e3121cc6c9d2f9b21f94a) + +### 0.5.x -> 0.6.0 + +The `0.6.0` release contains mostly bug fixes, but there are a couple things to be aware of when upgrading. + +#### ES6 Promise Polyfill + +Up until the `0.6.0` release ES6 `Promise` was being polyfilled using [es6-promise](https://github.com/jakearchibald/es6-promise). With this release, the polyfill has been removed, and you will need to supply it yourself if your environment needs it. + +```js +require('es6-promise').polyfill(); +var axios = require('axios'); +``` + +This will polyfill the global environment, and only needs to be done once. + +#### `axios.success`/`axios.error` + +The `success`, and `error` aliases were deprecated in [0.4.0](https://github.com/axios/axios/blob/master/CHANGELOG.md#040-oct-03-2014). As of this release they have been removed entirely. Instead please use `axios.then`, and `axios.catch` respectively. + +```js +axios.get('some/url') + .then(function (res) { + /* ... */ + }) + .catch(function (err) { + /* ... */ + }); +``` + +#### UMD + +Previous versions of axios shipped with an AMD, CommonJS, and Global build. This has all been rolled into a single UMD build. + +```js +// AMD +require(['bower_components/axios/dist/axios'], function (axios) { + /* ... */ +}); + +// CommonJS +var axios = require('axios/dist/axios'); +``` diff --git a/_nodejs/node_modules/axios/dist/axios.js b/_nodejs/node_modules/axios/dist/axios.js new file mode 100644 index 0000000..7c0b76b --- /dev/null +++ b/_nodejs/node_modules/axios/dist/axios.js @@ -0,0 +1,2595 @@ +/* axios v0.27.2 | (c) 2022 by Matt Zabriskie */ +(function webpackUniversalModuleDefinition(root, factory) { + if(typeof exports === 'object' && typeof module === 'object') + module.exports = factory(); + else if(typeof define === 'function' && define.amd) + define([], factory); + else if(typeof exports === 'object') + exports["axios"] = factory(); + else + root["axios"] = factory(); +})(this, function() { +return /******/ (function(modules) { // webpackBootstrap +/******/ // The module cache +/******/ var installedModules = {}; +/******/ +/******/ // The require function +/******/ function __webpack_require__(moduleId) { +/******/ +/******/ // Check if module is in cache +/******/ if(installedModules[moduleId]) { +/******/ return installedModules[moduleId].exports; +/******/ } +/******/ // Create a new module (and put it into the cache) +/******/ var module = installedModules[moduleId] = { +/******/ i: moduleId, +/******/ l: false, +/******/ exports: {} +/******/ }; +/******/ +/******/ // Execute the module function +/******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__); +/******/ +/******/ // Flag the module as loaded +/******/ module.l = true; +/******/ +/******/ // Return the exports of the module +/******/ return module.exports; +/******/ } +/******/ +/******/ +/******/ // expose the modules object (__webpack_modules__) +/******/ __webpack_require__.m = modules; +/******/ +/******/ // expose the module cache +/******/ __webpack_require__.c = installedModules; +/******/ +/******/ // define getter function for harmony exports +/******/ __webpack_require__.d = function(exports, name, getter) { +/******/ if(!__webpack_require__.o(exports, name)) { +/******/ Object.defineProperty(exports, name, { enumerable: true, get: getter }); +/******/ } +/******/ }; +/******/ +/******/ // define __esModule on exports +/******/ __webpack_require__.r = function(exports) { +/******/ if(typeof Symbol !== 'undefined' && Symbol.toStringTag) { +/******/ Object.defineProperty(exports, Symbol.toStringTag, { value: 'Module' }); +/******/ } +/******/ Object.defineProperty(exports, '__esModule', { value: true }); +/******/ }; +/******/ +/******/ // create a fake namespace object +/******/ // mode & 1: value is a module id, require it +/******/ // mode & 2: merge all properties of value into the ns +/******/ // mode & 4: return value when already ns object +/******/ // mode & 8|1: behave like require +/******/ __webpack_require__.t = function(value, mode) { +/******/ if(mode & 1) value = __webpack_require__(value); +/******/ if(mode & 8) return value; +/******/ if((mode & 4) && typeof value === 'object' && value && value.__esModule) return value; +/******/ var ns = Object.create(null); +/******/ __webpack_require__.r(ns); +/******/ Object.defineProperty(ns, 'default', { enumerable: true, value: value }); +/******/ if(mode & 2 && typeof value != 'string') for(var key in value) __webpack_require__.d(ns, key, function(key) { return value[key]; }.bind(null, key)); +/******/ return ns; +/******/ }; +/******/ +/******/ // getDefaultExport function for compatibility with non-harmony modules +/******/ __webpack_require__.n = function(module) { +/******/ var getter = module && module.__esModule ? +/******/ function getDefault() { return module['default']; } : +/******/ function getModuleExports() { return module; }; +/******/ __webpack_require__.d(getter, 'a', getter); +/******/ return getter; +/******/ }; +/******/ +/******/ // Object.prototype.hasOwnProperty.call +/******/ __webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); }; +/******/ +/******/ // __webpack_public_path__ +/******/ __webpack_require__.p = ""; +/******/ +/******/ +/******/ // Load entry module and return exports +/******/ return __webpack_require__(__webpack_require__.s = "./index.js"); +/******/ }) +/************************************************************************/ +/******/ ({ + +/***/ "./index.js": +/*!******************!*\ + !*** ./index.js ***! + \******************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +module.exports = __webpack_require__(/*! ./lib/axios */ "./lib/axios.js"); + +/***/ }), + +/***/ "./lib/adapters/xhr.js": +/*!*****************************!*\ + !*** ./lib/adapters/xhr.js ***! + \*****************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var utils = __webpack_require__(/*! ./../utils */ "./lib/utils.js"); +var settle = __webpack_require__(/*! ./../core/settle */ "./lib/core/settle.js"); +var cookies = __webpack_require__(/*! ./../helpers/cookies */ "./lib/helpers/cookies.js"); +var buildURL = __webpack_require__(/*! ./../helpers/buildURL */ "./lib/helpers/buildURL.js"); +var buildFullPath = __webpack_require__(/*! ../core/buildFullPath */ "./lib/core/buildFullPath.js"); +var parseHeaders = __webpack_require__(/*! ./../helpers/parseHeaders */ "./lib/helpers/parseHeaders.js"); +var isURLSameOrigin = __webpack_require__(/*! ./../helpers/isURLSameOrigin */ "./lib/helpers/isURLSameOrigin.js"); +var transitionalDefaults = __webpack_require__(/*! ../defaults/transitional */ "./lib/defaults/transitional.js"); +var AxiosError = __webpack_require__(/*! ../core/AxiosError */ "./lib/core/AxiosError.js"); +var CanceledError = __webpack_require__(/*! ../cancel/CanceledError */ "./lib/cancel/CanceledError.js"); +var parseProtocol = __webpack_require__(/*! ../helpers/parseProtocol */ "./lib/helpers/parseProtocol.js"); + +module.exports = function xhrAdapter(config) { + return new Promise(function dispatchXhrRequest(resolve, reject) { + var requestData = config.data; + var requestHeaders = config.headers; + var responseType = config.responseType; + var onCanceled; + function done() { + if (config.cancelToken) { + config.cancelToken.unsubscribe(onCanceled); + } + + if (config.signal) { + config.signal.removeEventListener('abort', onCanceled); + } + } + + if (utils.isFormData(requestData) && utils.isStandardBrowserEnv()) { + delete requestHeaders['Content-Type']; // Let the browser set it + } + + var request = new XMLHttpRequest(); + + // HTTP basic authentication + if (config.auth) { + var username = config.auth.username || ''; + var password = config.auth.password ? unescape(encodeURIComponent(config.auth.password)) : ''; + requestHeaders.Authorization = 'Basic ' + btoa(username + ':' + password); + } + + var fullPath = buildFullPath(config.baseURL, config.url); + + request.open(config.method.toUpperCase(), buildURL(fullPath, config.params, config.paramsSerializer), true); + + // Set the request timeout in MS + request.timeout = config.timeout; + + function onloadend() { + if (!request) { + return; + } + // Prepare the response + var responseHeaders = 'getAllResponseHeaders' in request ? parseHeaders(request.getAllResponseHeaders()) : null; + var responseData = !responseType || responseType === 'text' || responseType === 'json' ? + request.responseText : request.response; + var response = { + data: responseData, + status: request.status, + statusText: request.statusText, + headers: responseHeaders, + config: config, + request: request + }; + + settle(function _resolve(value) { + resolve(value); + done(); + }, function _reject(err) { + reject(err); + done(); + }, response); + + // Clean up request + request = null; + } + + if ('onloadend' in request) { + // Use onloadend if available + request.onloadend = onloadend; + } else { + // Listen for ready state to emulate onloadend + request.onreadystatechange = function handleLoad() { + if (!request || request.readyState !== 4) { + return; + } + + // The request errored out and we didn't get a response, this will be + // handled by onerror instead + // With one exception: request that using file: protocol, most browsers + // will return status as 0 even though it's a successful request + if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) { + return; + } + // readystate handler is calling before onerror or ontimeout handlers, + // so we should call onloadend on the next 'tick' + setTimeout(onloadend); + }; + } + + // Handle browser request cancellation (as opposed to a manual cancellation) + request.onabort = function handleAbort() { + if (!request) { + return; + } + + reject(new AxiosError('Request aborted', AxiosError.ECONNABORTED, config, request)); + + // Clean up request + request = null; + }; + + // Handle low level network errors + request.onerror = function handleError() { + // Real errors are hidden from us by the browser + // onerror should only fire if it's a network error + reject(new AxiosError('Network Error', AxiosError.ERR_NETWORK, config, request, request)); + + // Clean up request + request = null; + }; + + // Handle timeout + request.ontimeout = function handleTimeout() { + var timeoutErrorMessage = config.timeout ? 'timeout of ' + config.timeout + 'ms exceeded' : 'timeout exceeded'; + var transitional = config.transitional || transitionalDefaults; + if (config.timeoutErrorMessage) { + timeoutErrorMessage = config.timeoutErrorMessage; + } + reject(new AxiosError( + timeoutErrorMessage, + transitional.clarifyTimeoutError ? AxiosError.ETIMEDOUT : AxiosError.ECONNABORTED, + config, + request)); + + // Clean up request + request = null; + }; + + // Add xsrf header + // This is only done if running in a standard browser environment. + // Specifically not if we're in a web worker, or react-native. + if (utils.isStandardBrowserEnv()) { + // Add xsrf header + var xsrfValue = (config.withCredentials || isURLSameOrigin(fullPath)) && config.xsrfCookieName ? + cookies.read(config.xsrfCookieName) : + undefined; + + if (xsrfValue) { + requestHeaders[config.xsrfHeaderName] = xsrfValue; + } + } + + // Add headers to the request + if ('setRequestHeader' in request) { + utils.forEach(requestHeaders, function setRequestHeader(val, key) { + if (typeof requestData === 'undefined' && key.toLowerCase() === 'content-type') { + // Remove Content-Type if data is undefined + delete requestHeaders[key]; + } else { + // Otherwise add header to the request + request.setRequestHeader(key, val); + } + }); + } + + // Add withCredentials to request if needed + if (!utils.isUndefined(config.withCredentials)) { + request.withCredentials = !!config.withCredentials; + } + + // Add responseType to request if needed + if (responseType && responseType !== 'json') { + request.responseType = config.responseType; + } + + // Handle progress if needed + if (typeof config.onDownloadProgress === 'function') { + request.addEventListener('progress', config.onDownloadProgress); + } + + // Not all browsers support upload events + if (typeof config.onUploadProgress === 'function' && request.upload) { + request.upload.addEventListener('progress', config.onUploadProgress); + } + + if (config.cancelToken || config.signal) { + // Handle cancellation + // eslint-disable-next-line func-names + onCanceled = function(cancel) { + if (!request) { + return; + } + reject(!cancel || (cancel && cancel.type) ? new CanceledError() : cancel); + request.abort(); + request = null; + }; + + config.cancelToken && config.cancelToken.subscribe(onCanceled); + if (config.signal) { + config.signal.aborted ? onCanceled() : config.signal.addEventListener('abort', onCanceled); + } + } + + if (!requestData) { + requestData = null; + } + + var protocol = parseProtocol(fullPath); + + if (protocol && [ 'http', 'https', 'file' ].indexOf(protocol) === -1) { + reject(new AxiosError('Unsupported protocol ' + protocol + ':', AxiosError.ERR_BAD_REQUEST, config)); + return; + } + + + // Send the request + request.send(requestData); + }); +}; + + +/***/ }), + +/***/ "./lib/axios.js": +/*!**********************!*\ + !*** ./lib/axios.js ***! + \**********************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var utils = __webpack_require__(/*! ./utils */ "./lib/utils.js"); +var bind = __webpack_require__(/*! ./helpers/bind */ "./lib/helpers/bind.js"); +var Axios = __webpack_require__(/*! ./core/Axios */ "./lib/core/Axios.js"); +var mergeConfig = __webpack_require__(/*! ./core/mergeConfig */ "./lib/core/mergeConfig.js"); +var defaults = __webpack_require__(/*! ./defaults */ "./lib/defaults/index.js"); + +/** + * Create an instance of Axios + * + * @param {Object} defaultConfig The default config for the instance + * @return {Axios} A new instance of Axios + */ +function createInstance(defaultConfig) { + var context = new Axios(defaultConfig); + var instance = bind(Axios.prototype.request, context); + + // Copy axios.prototype to instance + utils.extend(instance, Axios.prototype, context); + + // Copy context to instance + utils.extend(instance, context); + + // Factory for creating new instances + instance.create = function create(instanceConfig) { + return createInstance(mergeConfig(defaultConfig, instanceConfig)); + }; + + return instance; +} + +// Create the default instance to be exported +var axios = createInstance(defaults); + +// Expose Axios class to allow class inheritance +axios.Axios = Axios; + +// Expose Cancel & CancelToken +axios.CanceledError = __webpack_require__(/*! ./cancel/CanceledError */ "./lib/cancel/CanceledError.js"); +axios.CancelToken = __webpack_require__(/*! ./cancel/CancelToken */ "./lib/cancel/CancelToken.js"); +axios.isCancel = __webpack_require__(/*! ./cancel/isCancel */ "./lib/cancel/isCancel.js"); +axios.VERSION = __webpack_require__(/*! ./env/data */ "./lib/env/data.js").version; +axios.toFormData = __webpack_require__(/*! ./helpers/toFormData */ "./lib/helpers/toFormData.js"); + +// Expose AxiosError class +axios.AxiosError = __webpack_require__(/*! ../lib/core/AxiosError */ "./lib/core/AxiosError.js"); + +// alias for CanceledError for backward compatibility +axios.Cancel = axios.CanceledError; + +// Expose all/spread +axios.all = function all(promises) { + return Promise.all(promises); +}; +axios.spread = __webpack_require__(/*! ./helpers/spread */ "./lib/helpers/spread.js"); + +// Expose isAxiosError +axios.isAxiosError = __webpack_require__(/*! ./helpers/isAxiosError */ "./lib/helpers/isAxiosError.js"); + +module.exports = axios; + +// Allow use of default import syntax in TypeScript +module.exports.default = axios; + + +/***/ }), + +/***/ "./lib/cancel/CancelToken.js": +/*!***********************************!*\ + !*** ./lib/cancel/CancelToken.js ***! + \***********************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var CanceledError = __webpack_require__(/*! ./CanceledError */ "./lib/cancel/CanceledError.js"); + +/** + * A `CancelToken` is an object that can be used to request cancellation of an operation. + * + * @class + * @param {Function} executor The executor function. + */ +function CancelToken(executor) { + if (typeof executor !== 'function') { + throw new TypeError('executor must be a function.'); + } + + var resolvePromise; + + this.promise = new Promise(function promiseExecutor(resolve) { + resolvePromise = resolve; + }); + + var token = this; + + // eslint-disable-next-line func-names + this.promise.then(function(cancel) { + if (!token._listeners) return; + + var i; + var l = token._listeners.length; + + for (i = 0; i < l; i++) { + token._listeners[i](cancel); + } + token._listeners = null; + }); + + // eslint-disable-next-line func-names + this.promise.then = function(onfulfilled) { + var _resolve; + // eslint-disable-next-line func-names + var promise = new Promise(function(resolve) { + token.subscribe(resolve); + _resolve = resolve; + }).then(onfulfilled); + + promise.cancel = function reject() { + token.unsubscribe(_resolve); + }; + + return promise; + }; + + executor(function cancel(message) { + if (token.reason) { + // Cancellation has already been requested + return; + } + + token.reason = new CanceledError(message); + resolvePromise(token.reason); + }); +} + +/** + * Throws a `CanceledError` if cancellation has been requested. + */ +CancelToken.prototype.throwIfRequested = function throwIfRequested() { + if (this.reason) { + throw this.reason; + } +}; + +/** + * Subscribe to the cancel signal + */ + +CancelToken.prototype.subscribe = function subscribe(listener) { + if (this.reason) { + listener(this.reason); + return; + } + + if (this._listeners) { + this._listeners.push(listener); + } else { + this._listeners = [listener]; + } +}; + +/** + * Unsubscribe from the cancel signal + */ + +CancelToken.prototype.unsubscribe = function unsubscribe(listener) { + if (!this._listeners) { + return; + } + var index = this._listeners.indexOf(listener); + if (index !== -1) { + this._listeners.splice(index, 1); + } +}; + +/** + * Returns an object that contains a new `CancelToken` and a function that, when called, + * cancels the `CancelToken`. + */ +CancelToken.source = function source() { + var cancel; + var token = new CancelToken(function executor(c) { + cancel = c; + }); + return { + token: token, + cancel: cancel + }; +}; + +module.exports = CancelToken; + + +/***/ }), + +/***/ "./lib/cancel/CanceledError.js": +/*!*************************************!*\ + !*** ./lib/cancel/CanceledError.js ***! + \*************************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var AxiosError = __webpack_require__(/*! ../core/AxiosError */ "./lib/core/AxiosError.js"); +var utils = __webpack_require__(/*! ../utils */ "./lib/utils.js"); + +/** + * A `CanceledError` is an object that is thrown when an operation is canceled. + * + * @class + * @param {string=} message The message. + */ +function CanceledError(message) { + // eslint-disable-next-line no-eq-null,eqeqeq + AxiosError.call(this, message == null ? 'canceled' : message, AxiosError.ERR_CANCELED); + this.name = 'CanceledError'; +} + +utils.inherits(CanceledError, AxiosError, { + __CANCEL__: true +}); + +module.exports = CanceledError; + + +/***/ }), + +/***/ "./lib/cancel/isCancel.js": +/*!********************************!*\ + !*** ./lib/cancel/isCancel.js ***! + \********************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +module.exports = function isCancel(value) { + return !!(value && value.__CANCEL__); +}; + + +/***/ }), + +/***/ "./lib/core/Axios.js": +/*!***************************!*\ + !*** ./lib/core/Axios.js ***! + \***************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var utils = __webpack_require__(/*! ./../utils */ "./lib/utils.js"); +var buildURL = __webpack_require__(/*! ../helpers/buildURL */ "./lib/helpers/buildURL.js"); +var InterceptorManager = __webpack_require__(/*! ./InterceptorManager */ "./lib/core/InterceptorManager.js"); +var dispatchRequest = __webpack_require__(/*! ./dispatchRequest */ "./lib/core/dispatchRequest.js"); +var mergeConfig = __webpack_require__(/*! ./mergeConfig */ "./lib/core/mergeConfig.js"); +var buildFullPath = __webpack_require__(/*! ./buildFullPath */ "./lib/core/buildFullPath.js"); +var validator = __webpack_require__(/*! ../helpers/validator */ "./lib/helpers/validator.js"); + +var validators = validator.validators; +/** + * Create a new instance of Axios + * + * @param {Object} instanceConfig The default config for the instance + */ +function Axios(instanceConfig) { + this.defaults = instanceConfig; + this.interceptors = { + request: new InterceptorManager(), + response: new InterceptorManager() + }; +} + +/** + * Dispatch a request + * + * @param {Object} config The config specific for this request (merged with this.defaults) + */ +Axios.prototype.request = function request(configOrUrl, config) { + /*eslint no-param-reassign:0*/ + // Allow for axios('example/url'[, config]) a la fetch API + if (typeof configOrUrl === 'string') { + config = config || {}; + config.url = configOrUrl; + } else { + config = configOrUrl || {}; + } + + config = mergeConfig(this.defaults, config); + + // Set config.method + if (config.method) { + config.method = config.method.toLowerCase(); + } else if (this.defaults.method) { + config.method = this.defaults.method.toLowerCase(); + } else { + config.method = 'get'; + } + + var transitional = config.transitional; + + if (transitional !== undefined) { + validator.assertOptions(transitional, { + silentJSONParsing: validators.transitional(validators.boolean), + forcedJSONParsing: validators.transitional(validators.boolean), + clarifyTimeoutError: validators.transitional(validators.boolean) + }, false); + } + + // filter out skipped interceptors + var requestInterceptorChain = []; + var synchronousRequestInterceptors = true; + this.interceptors.request.forEach(function unshiftRequestInterceptors(interceptor) { + if (typeof interceptor.runWhen === 'function' && interceptor.runWhen(config) === false) { + return; + } + + synchronousRequestInterceptors = synchronousRequestInterceptors && interceptor.synchronous; + + requestInterceptorChain.unshift(interceptor.fulfilled, interceptor.rejected); + }); + + var responseInterceptorChain = []; + this.interceptors.response.forEach(function pushResponseInterceptors(interceptor) { + responseInterceptorChain.push(interceptor.fulfilled, interceptor.rejected); + }); + + var promise; + + if (!synchronousRequestInterceptors) { + var chain = [dispatchRequest, undefined]; + + Array.prototype.unshift.apply(chain, requestInterceptorChain); + chain = chain.concat(responseInterceptorChain); + + promise = Promise.resolve(config); + while (chain.length) { + promise = promise.then(chain.shift(), chain.shift()); + } + + return promise; + } + + + var newConfig = config; + while (requestInterceptorChain.length) { + var onFulfilled = requestInterceptorChain.shift(); + var onRejected = requestInterceptorChain.shift(); + try { + newConfig = onFulfilled(newConfig); + } catch (error) { + onRejected(error); + break; + } + } + + try { + promise = dispatchRequest(newConfig); + } catch (error) { + return Promise.reject(error); + } + + while (responseInterceptorChain.length) { + promise = promise.then(responseInterceptorChain.shift(), responseInterceptorChain.shift()); + } + + return promise; +}; + +Axios.prototype.getUri = function getUri(config) { + config = mergeConfig(this.defaults, config); + var fullPath = buildFullPath(config.baseURL, config.url); + return buildURL(fullPath, config.params, config.paramsSerializer); +}; + +// Provide aliases for supported request methods +utils.forEach(['delete', 'get', 'head', 'options'], function forEachMethodNoData(method) { + /*eslint func-names:0*/ + Axios.prototype[method] = function(url, config) { + return this.request(mergeConfig(config || {}, { + method: method, + url: url, + data: (config || {}).data + })); + }; +}); + +utils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) { + /*eslint func-names:0*/ + + function generateHTTPMethod(isForm) { + return function httpMethod(url, data, config) { + return this.request(mergeConfig(config || {}, { + method: method, + headers: isForm ? { + 'Content-Type': 'multipart/form-data' + } : {}, + url: url, + data: data + })); + }; + } + + Axios.prototype[method] = generateHTTPMethod(); + + Axios.prototype[method + 'Form'] = generateHTTPMethod(true); +}); + +module.exports = Axios; + + +/***/ }), + +/***/ "./lib/core/AxiosError.js": +/*!********************************!*\ + !*** ./lib/core/AxiosError.js ***! + \********************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var utils = __webpack_require__(/*! ../utils */ "./lib/utils.js"); + +/** + * Create an Error with the specified message, config, error code, request and response. + * + * @param {string} message The error message. + * @param {string} [code] The error code (for example, 'ECONNABORTED'). + * @param {Object} [config] The config. + * @param {Object} [request] The request. + * @param {Object} [response] The response. + * @returns {Error} The created error. + */ +function AxiosError(message, code, config, request, response) { + Error.call(this); + this.message = message; + this.name = 'AxiosError'; + code && (this.code = code); + config && (this.config = config); + request && (this.request = request); + response && (this.response = response); +} + +utils.inherits(AxiosError, Error, { + toJSON: function toJSON() { + return { + // Standard + message: this.message, + name: this.name, + // Microsoft + description: this.description, + number: this.number, + // Mozilla + fileName: this.fileName, + lineNumber: this.lineNumber, + columnNumber: this.columnNumber, + stack: this.stack, + // Axios + config: this.config, + code: this.code, + status: this.response && this.response.status ? this.response.status : null + }; + } +}); + +var prototype = AxiosError.prototype; +var descriptors = {}; + +[ + 'ERR_BAD_OPTION_VALUE', + 'ERR_BAD_OPTION', + 'ECONNABORTED', + 'ETIMEDOUT', + 'ERR_NETWORK', + 'ERR_FR_TOO_MANY_REDIRECTS', + 'ERR_DEPRECATED', + 'ERR_BAD_RESPONSE', + 'ERR_BAD_REQUEST', + 'ERR_CANCELED' +// eslint-disable-next-line func-names +].forEach(function(code) { + descriptors[code] = {value: code}; +}); + +Object.defineProperties(AxiosError, descriptors); +Object.defineProperty(prototype, 'isAxiosError', {value: true}); + +// eslint-disable-next-line func-names +AxiosError.from = function(error, code, config, request, response, customProps) { + var axiosError = Object.create(prototype); + + utils.toFlatObject(error, axiosError, function filter(obj) { + return obj !== Error.prototype; + }); + + AxiosError.call(axiosError, error.message, code, config, request, response); + + axiosError.name = error.name; + + customProps && Object.assign(axiosError, customProps); + + return axiosError; +}; + +module.exports = AxiosError; + + +/***/ }), + +/***/ "./lib/core/InterceptorManager.js": +/*!****************************************!*\ + !*** ./lib/core/InterceptorManager.js ***! + \****************************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var utils = __webpack_require__(/*! ./../utils */ "./lib/utils.js"); + +function InterceptorManager() { + this.handlers = []; +} + +/** + * Add a new interceptor to the stack + * + * @param {Function} fulfilled The function to handle `then` for a `Promise` + * @param {Function} rejected The function to handle `reject` for a `Promise` + * + * @return {Number} An ID used to remove interceptor later + */ +InterceptorManager.prototype.use = function use(fulfilled, rejected, options) { + this.handlers.push({ + fulfilled: fulfilled, + rejected: rejected, + synchronous: options ? options.synchronous : false, + runWhen: options ? options.runWhen : null + }); + return this.handlers.length - 1; +}; + +/** + * Remove an interceptor from the stack + * + * @param {Number} id The ID that was returned by `use` + */ +InterceptorManager.prototype.eject = function eject(id) { + if (this.handlers[id]) { + this.handlers[id] = null; + } +}; + +/** + * Iterate over all the registered interceptors + * + * This method is particularly useful for skipping over any + * interceptors that may have become `null` calling `eject`. + * + * @param {Function} fn The function to call for each interceptor + */ +InterceptorManager.prototype.forEach = function forEach(fn) { + utils.forEach(this.handlers, function forEachHandler(h) { + if (h !== null) { + fn(h); + } + }); +}; + +module.exports = InterceptorManager; + + +/***/ }), + +/***/ "./lib/core/buildFullPath.js": +/*!***********************************!*\ + !*** ./lib/core/buildFullPath.js ***! + \***********************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var isAbsoluteURL = __webpack_require__(/*! ../helpers/isAbsoluteURL */ "./lib/helpers/isAbsoluteURL.js"); +var combineURLs = __webpack_require__(/*! ../helpers/combineURLs */ "./lib/helpers/combineURLs.js"); + +/** + * Creates a new URL by combining the baseURL with the requestedURL, + * only when the requestedURL is not already an absolute URL. + * If the requestURL is absolute, this function returns the requestedURL untouched. + * + * @param {string} baseURL The base URL + * @param {string} requestedURL Absolute or relative URL to combine + * @returns {string} The combined full path + */ +module.exports = function buildFullPath(baseURL, requestedURL) { + if (baseURL && !isAbsoluteURL(requestedURL)) { + return combineURLs(baseURL, requestedURL); + } + return requestedURL; +}; + + +/***/ }), + +/***/ "./lib/core/dispatchRequest.js": +/*!*************************************!*\ + !*** ./lib/core/dispatchRequest.js ***! + \*************************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var utils = __webpack_require__(/*! ./../utils */ "./lib/utils.js"); +var transformData = __webpack_require__(/*! ./transformData */ "./lib/core/transformData.js"); +var isCancel = __webpack_require__(/*! ../cancel/isCancel */ "./lib/cancel/isCancel.js"); +var defaults = __webpack_require__(/*! ../defaults */ "./lib/defaults/index.js"); +var CanceledError = __webpack_require__(/*! ../cancel/CanceledError */ "./lib/cancel/CanceledError.js"); + +/** + * Throws a `CanceledError` if cancellation has been requested. + */ +function throwIfCancellationRequested(config) { + if (config.cancelToken) { + config.cancelToken.throwIfRequested(); + } + + if (config.signal && config.signal.aborted) { + throw new CanceledError(); + } +} + +/** + * Dispatch a request to the server using the configured adapter. + * + * @param {object} config The config that is to be used for the request + * @returns {Promise} The Promise to be fulfilled + */ +module.exports = function dispatchRequest(config) { + throwIfCancellationRequested(config); + + // Ensure headers exist + config.headers = config.headers || {}; + + // Transform request data + config.data = transformData.call( + config, + config.data, + config.headers, + config.transformRequest + ); + + // Flatten headers + config.headers = utils.merge( + config.headers.common || {}, + config.headers[config.method] || {}, + config.headers + ); + + utils.forEach( + ['delete', 'get', 'head', 'post', 'put', 'patch', 'common'], + function cleanHeaderConfig(method) { + delete config.headers[method]; + } + ); + + var adapter = config.adapter || defaults.adapter; + + return adapter(config).then(function onAdapterResolution(response) { + throwIfCancellationRequested(config); + + // Transform response data + response.data = transformData.call( + config, + response.data, + response.headers, + config.transformResponse + ); + + return response; + }, function onAdapterRejection(reason) { + if (!isCancel(reason)) { + throwIfCancellationRequested(config); + + // Transform response data + if (reason && reason.response) { + reason.response.data = transformData.call( + config, + reason.response.data, + reason.response.headers, + config.transformResponse + ); + } + } + + return Promise.reject(reason); + }); +}; + + +/***/ }), + +/***/ "./lib/core/mergeConfig.js": +/*!*********************************!*\ + !*** ./lib/core/mergeConfig.js ***! + \*********************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var utils = __webpack_require__(/*! ../utils */ "./lib/utils.js"); + +/** + * Config-specific merge-function which creates a new config-object + * by merging two configuration objects together. + * + * @param {Object} config1 + * @param {Object} config2 + * @returns {Object} New object resulting from merging config2 to config1 + */ +module.exports = function mergeConfig(config1, config2) { + // eslint-disable-next-line no-param-reassign + config2 = config2 || {}; + var config = {}; + + function getMergedValue(target, source) { + if (utils.isPlainObject(target) && utils.isPlainObject(source)) { + return utils.merge(target, source); + } else if (utils.isPlainObject(source)) { + return utils.merge({}, source); + } else if (utils.isArray(source)) { + return source.slice(); + } + return source; + } + + // eslint-disable-next-line consistent-return + function mergeDeepProperties(prop) { + if (!utils.isUndefined(config2[prop])) { + return getMergedValue(config1[prop], config2[prop]); + } else if (!utils.isUndefined(config1[prop])) { + return getMergedValue(undefined, config1[prop]); + } + } + + // eslint-disable-next-line consistent-return + function valueFromConfig2(prop) { + if (!utils.isUndefined(config2[prop])) { + return getMergedValue(undefined, config2[prop]); + } + } + + // eslint-disable-next-line consistent-return + function defaultToConfig2(prop) { + if (!utils.isUndefined(config2[prop])) { + return getMergedValue(undefined, config2[prop]); + } else if (!utils.isUndefined(config1[prop])) { + return getMergedValue(undefined, config1[prop]); + } + } + + // eslint-disable-next-line consistent-return + function mergeDirectKeys(prop) { + if (prop in config2) { + return getMergedValue(config1[prop], config2[prop]); + } else if (prop in config1) { + return getMergedValue(undefined, config1[prop]); + } + } + + var mergeMap = { + 'url': valueFromConfig2, + 'method': valueFromConfig2, + 'data': valueFromConfig2, + 'baseURL': defaultToConfig2, + 'transformRequest': defaultToConfig2, + 'transformResponse': defaultToConfig2, + 'paramsSerializer': defaultToConfig2, + 'timeout': defaultToConfig2, + 'timeoutMessage': defaultToConfig2, + 'withCredentials': defaultToConfig2, + 'adapter': defaultToConfig2, + 'responseType': defaultToConfig2, + 'xsrfCookieName': defaultToConfig2, + 'xsrfHeaderName': defaultToConfig2, + 'onUploadProgress': defaultToConfig2, + 'onDownloadProgress': defaultToConfig2, + 'decompress': defaultToConfig2, + 'maxContentLength': defaultToConfig2, + 'maxBodyLength': defaultToConfig2, + 'beforeRedirect': defaultToConfig2, + 'transport': defaultToConfig2, + 'httpAgent': defaultToConfig2, + 'httpsAgent': defaultToConfig2, + 'cancelToken': defaultToConfig2, + 'socketPath': defaultToConfig2, + 'responseEncoding': defaultToConfig2, + 'validateStatus': mergeDirectKeys + }; + + utils.forEach(Object.keys(config1).concat(Object.keys(config2)), function computeConfigValue(prop) { + var merge = mergeMap[prop] || mergeDeepProperties; + var configValue = merge(prop); + (utils.isUndefined(configValue) && merge !== mergeDirectKeys) || (config[prop] = configValue); + }); + + return config; +}; + + +/***/ }), + +/***/ "./lib/core/settle.js": +/*!****************************!*\ + !*** ./lib/core/settle.js ***! + \****************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var AxiosError = __webpack_require__(/*! ./AxiosError */ "./lib/core/AxiosError.js"); + +/** + * Resolve or reject a Promise based on response status. + * + * @param {Function} resolve A function that resolves the promise. + * @param {Function} reject A function that rejects the promise. + * @param {object} response The response. + */ +module.exports = function settle(resolve, reject, response) { + var validateStatus = response.config.validateStatus; + if (!response.status || !validateStatus || validateStatus(response.status)) { + resolve(response); + } else { + reject(new AxiosError( + 'Request failed with status code ' + response.status, + [AxiosError.ERR_BAD_REQUEST, AxiosError.ERR_BAD_RESPONSE][Math.floor(response.status / 100) - 4], + response.config, + response.request, + response + )); + } +}; + + +/***/ }), + +/***/ "./lib/core/transformData.js": +/*!***********************************!*\ + !*** ./lib/core/transformData.js ***! + \***********************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var utils = __webpack_require__(/*! ./../utils */ "./lib/utils.js"); +var defaults = __webpack_require__(/*! ../defaults */ "./lib/defaults/index.js"); + +/** + * Transform the data for a request or a response + * + * @param {Object|String} data The data to be transformed + * @param {Array} headers The headers for the request or response + * @param {Array|Function} fns A single function or Array of functions + * @returns {*} The resulting transformed data + */ +module.exports = function transformData(data, headers, fns) { + var context = this || defaults; + /*eslint no-param-reassign:0*/ + utils.forEach(fns, function transform(fn) { + data = fn.call(context, data, headers); + }); + + return data; +}; + + +/***/ }), + +/***/ "./lib/defaults/index.js": +/*!*******************************!*\ + !*** ./lib/defaults/index.js ***! + \*******************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var utils = __webpack_require__(/*! ../utils */ "./lib/utils.js"); +var normalizeHeaderName = __webpack_require__(/*! ../helpers/normalizeHeaderName */ "./lib/helpers/normalizeHeaderName.js"); +var AxiosError = __webpack_require__(/*! ../core/AxiosError */ "./lib/core/AxiosError.js"); +var transitionalDefaults = __webpack_require__(/*! ./transitional */ "./lib/defaults/transitional.js"); +var toFormData = __webpack_require__(/*! ../helpers/toFormData */ "./lib/helpers/toFormData.js"); + +var DEFAULT_CONTENT_TYPE = { + 'Content-Type': 'application/x-www-form-urlencoded' +}; + +function setContentTypeIfUnset(headers, value) { + if (!utils.isUndefined(headers) && utils.isUndefined(headers['Content-Type'])) { + headers['Content-Type'] = value; + } +} + +function getDefaultAdapter() { + var adapter; + if (typeof XMLHttpRequest !== 'undefined') { + // For browsers use XHR adapter + adapter = __webpack_require__(/*! ../adapters/xhr */ "./lib/adapters/xhr.js"); + } else if (typeof process !== 'undefined' && Object.prototype.toString.call(process) === '[object process]') { + // For node use HTTP adapter + adapter = __webpack_require__(/*! ../adapters/http */ "./lib/adapters/xhr.js"); + } + return adapter; +} + +function stringifySafely(rawValue, parser, encoder) { + if (utils.isString(rawValue)) { + try { + (parser || JSON.parse)(rawValue); + return utils.trim(rawValue); + } catch (e) { + if (e.name !== 'SyntaxError') { + throw e; + } + } + } + + return (encoder || JSON.stringify)(rawValue); +} + +var defaults = { + + transitional: transitionalDefaults, + + adapter: getDefaultAdapter(), + + transformRequest: [function transformRequest(data, headers) { + normalizeHeaderName(headers, 'Accept'); + normalizeHeaderName(headers, 'Content-Type'); + + if (utils.isFormData(data) || + utils.isArrayBuffer(data) || + utils.isBuffer(data) || + utils.isStream(data) || + utils.isFile(data) || + utils.isBlob(data) + ) { + return data; + } + if (utils.isArrayBufferView(data)) { + return data.buffer; + } + if (utils.isURLSearchParams(data)) { + setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8'); + return data.toString(); + } + + var isObjectPayload = utils.isObject(data); + var contentType = headers && headers['Content-Type']; + + var isFileList; + + if ((isFileList = utils.isFileList(data)) || (isObjectPayload && contentType === 'multipart/form-data')) { + var _FormData = this.env && this.env.FormData; + return toFormData(isFileList ? {'files[]': data} : data, _FormData && new _FormData()); + } else if (isObjectPayload || contentType === 'application/json') { + setContentTypeIfUnset(headers, 'application/json'); + return stringifySafely(data); + } + + return data; + }], + + transformResponse: [function transformResponse(data) { + var transitional = this.transitional || defaults.transitional; + var silentJSONParsing = transitional && transitional.silentJSONParsing; + var forcedJSONParsing = transitional && transitional.forcedJSONParsing; + var strictJSONParsing = !silentJSONParsing && this.responseType === 'json'; + + if (strictJSONParsing || (forcedJSONParsing && utils.isString(data) && data.length)) { + try { + return JSON.parse(data); + } catch (e) { + if (strictJSONParsing) { + if (e.name === 'SyntaxError') { + throw AxiosError.from(e, AxiosError.ERR_BAD_RESPONSE, this, null, this.response); + } + throw e; + } + } + } + + return data; + }], + + /** + * A timeout in milliseconds to abort a request. If set to 0 (default) a + * timeout is not created. + */ + timeout: 0, + + xsrfCookieName: 'XSRF-TOKEN', + xsrfHeaderName: 'X-XSRF-TOKEN', + + maxContentLength: -1, + maxBodyLength: -1, + + env: { + FormData: __webpack_require__(/*! ./env/FormData */ "./lib/helpers/null.js") + }, + + validateStatus: function validateStatus(status) { + return status >= 200 && status < 300; + }, + + headers: { + common: { + 'Accept': 'application/json, text/plain, */*' + } + } +}; + +utils.forEach(['delete', 'get', 'head'], function forEachMethodNoData(method) { + defaults.headers[method] = {}; +}); + +utils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) { + defaults.headers[method] = utils.merge(DEFAULT_CONTENT_TYPE); +}); + +module.exports = defaults; + + +/***/ }), + +/***/ "./lib/defaults/transitional.js": +/*!**************************************!*\ + !*** ./lib/defaults/transitional.js ***! + \**************************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +module.exports = { + silentJSONParsing: true, + forcedJSONParsing: true, + clarifyTimeoutError: false +}; + + +/***/ }), + +/***/ "./lib/env/data.js": +/*!*************************!*\ + !*** ./lib/env/data.js ***! + \*************************/ +/*! no static exports found */ +/***/ (function(module, exports) { + +module.exports = { + "version": "0.27.2" +}; + +/***/ }), + +/***/ "./lib/helpers/bind.js": +/*!*****************************!*\ + !*** ./lib/helpers/bind.js ***! + \*****************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +module.exports = function bind(fn, thisArg) { + return function wrap() { + var args = new Array(arguments.length); + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i]; + } + return fn.apply(thisArg, args); + }; +}; + + +/***/ }), + +/***/ "./lib/helpers/buildURL.js": +/*!*********************************!*\ + !*** ./lib/helpers/buildURL.js ***! + \*********************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var utils = __webpack_require__(/*! ./../utils */ "./lib/utils.js"); + +function encode(val) { + return encodeURIComponent(val). + replace(/%3A/gi, ':'). + replace(/%24/g, '$'). + replace(/%2C/gi, ','). + replace(/%20/g, '+'). + replace(/%5B/gi, '['). + replace(/%5D/gi, ']'); +} + +/** + * Build a URL by appending params to the end + * + * @param {string} url The base of the url (e.g., http://www.google.com) + * @param {object} [params] The params to be appended + * @returns {string} The formatted url + */ +module.exports = function buildURL(url, params, paramsSerializer) { + /*eslint no-param-reassign:0*/ + if (!params) { + return url; + } + + var serializedParams; + if (paramsSerializer) { + serializedParams = paramsSerializer(params); + } else if (utils.isURLSearchParams(params)) { + serializedParams = params.toString(); + } else { + var parts = []; + + utils.forEach(params, function serialize(val, key) { + if (val === null || typeof val === 'undefined') { + return; + } + + if (utils.isArray(val)) { + key = key + '[]'; + } else { + val = [val]; + } + + utils.forEach(val, function parseValue(v) { + if (utils.isDate(v)) { + v = v.toISOString(); + } else if (utils.isObject(v)) { + v = JSON.stringify(v); + } + parts.push(encode(key) + '=' + encode(v)); + }); + }); + + serializedParams = parts.join('&'); + } + + if (serializedParams) { + var hashmarkIndex = url.indexOf('#'); + if (hashmarkIndex !== -1) { + url = url.slice(0, hashmarkIndex); + } + + url += (url.indexOf('?') === -1 ? '?' : '&') + serializedParams; + } + + return url; +}; + + +/***/ }), + +/***/ "./lib/helpers/combineURLs.js": +/*!************************************!*\ + !*** ./lib/helpers/combineURLs.js ***! + \************************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +/** + * Creates a new URL by combining the specified URLs + * + * @param {string} baseURL The base URL + * @param {string} relativeURL The relative URL + * @returns {string} The combined URL + */ +module.exports = function combineURLs(baseURL, relativeURL) { + return relativeURL + ? baseURL.replace(/\/+$/, '') + '/' + relativeURL.replace(/^\/+/, '') + : baseURL; +}; + + +/***/ }), + +/***/ "./lib/helpers/cookies.js": +/*!********************************!*\ + !*** ./lib/helpers/cookies.js ***! + \********************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var utils = __webpack_require__(/*! ./../utils */ "./lib/utils.js"); + +module.exports = ( + utils.isStandardBrowserEnv() ? + + // Standard browser envs support document.cookie + (function standardBrowserEnv() { + return { + write: function write(name, value, expires, path, domain, secure) { + var cookie = []; + cookie.push(name + '=' + encodeURIComponent(value)); + + if (utils.isNumber(expires)) { + cookie.push('expires=' + new Date(expires).toGMTString()); + } + + if (utils.isString(path)) { + cookie.push('path=' + path); + } + + if (utils.isString(domain)) { + cookie.push('domain=' + domain); + } + + if (secure === true) { + cookie.push('secure'); + } + + document.cookie = cookie.join('; '); + }, + + read: function read(name) { + var match = document.cookie.match(new RegExp('(^|;\\s*)(' + name + ')=([^;]*)')); + return (match ? decodeURIComponent(match[3]) : null); + }, + + remove: function remove(name) { + this.write(name, '', Date.now() - 86400000); + } + }; + })() : + + // Non standard browser env (web workers, react-native) lack needed support. + (function nonStandardBrowserEnv() { + return { + write: function write() {}, + read: function read() { return null; }, + remove: function remove() {} + }; + })() +); + + +/***/ }), + +/***/ "./lib/helpers/isAbsoluteURL.js": +/*!**************************************!*\ + !*** ./lib/helpers/isAbsoluteURL.js ***! + \**************************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +/** + * Determines whether the specified URL is absolute + * + * @param {string} url The URL to test + * @returns {boolean} True if the specified URL is absolute, otherwise false + */ +module.exports = function isAbsoluteURL(url) { + // A URL is considered absolute if it begins with "://" or "//" (protocol-relative URL). + // RFC 3986 defines scheme name as a sequence of characters beginning with a letter and followed + // by any combination of letters, digits, plus, period, or hyphen. + return /^([a-z][a-z\d+\-.]*:)?\/\//i.test(url); +}; + + +/***/ }), + +/***/ "./lib/helpers/isAxiosError.js": +/*!*************************************!*\ + !*** ./lib/helpers/isAxiosError.js ***! + \*************************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var utils = __webpack_require__(/*! ./../utils */ "./lib/utils.js"); + +/** + * Determines whether the payload is an error thrown by Axios + * + * @param {*} payload The value to test + * @returns {boolean} True if the payload is an error thrown by Axios, otherwise false + */ +module.exports = function isAxiosError(payload) { + return utils.isObject(payload) && (payload.isAxiosError === true); +}; + + +/***/ }), + +/***/ "./lib/helpers/isURLSameOrigin.js": +/*!****************************************!*\ + !*** ./lib/helpers/isURLSameOrigin.js ***! + \****************************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var utils = __webpack_require__(/*! ./../utils */ "./lib/utils.js"); + +module.exports = ( + utils.isStandardBrowserEnv() ? + + // Standard browser envs have full support of the APIs needed to test + // whether the request URL is of the same origin as current location. + (function standardBrowserEnv() { + var msie = /(msie|trident)/i.test(navigator.userAgent); + var urlParsingNode = document.createElement('a'); + var originURL; + + /** + * Parse a URL to discover it's components + * + * @param {String} url The URL to be parsed + * @returns {Object} + */ + function resolveURL(url) { + var href = url; + + if (msie) { + // IE needs attribute set twice to normalize properties + urlParsingNode.setAttribute('href', href); + href = urlParsingNode.href; + } + + urlParsingNode.setAttribute('href', href); + + // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils + return { + href: urlParsingNode.href, + protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '', + host: urlParsingNode.host, + search: urlParsingNode.search ? urlParsingNode.search.replace(/^\?/, '') : '', + hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '', + hostname: urlParsingNode.hostname, + port: urlParsingNode.port, + pathname: (urlParsingNode.pathname.charAt(0) === '/') ? + urlParsingNode.pathname : + '/' + urlParsingNode.pathname + }; + } + + originURL = resolveURL(window.location.href); + + /** + * Determine if a URL shares the same origin as the current location + * + * @param {String} requestURL The URL to test + * @returns {boolean} True if URL shares the same origin, otherwise false + */ + return function isURLSameOrigin(requestURL) { + var parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL; + return (parsed.protocol === originURL.protocol && + parsed.host === originURL.host); + }; + })() : + + // Non standard browser envs (web workers, react-native) lack needed support. + (function nonStandardBrowserEnv() { + return function isURLSameOrigin() { + return true; + }; + })() +); + + +/***/ }), + +/***/ "./lib/helpers/normalizeHeaderName.js": +/*!********************************************!*\ + !*** ./lib/helpers/normalizeHeaderName.js ***! + \********************************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var utils = __webpack_require__(/*! ../utils */ "./lib/utils.js"); + +module.exports = function normalizeHeaderName(headers, normalizedName) { + utils.forEach(headers, function processHeader(value, name) { + if (name !== normalizedName && name.toUpperCase() === normalizedName.toUpperCase()) { + headers[normalizedName] = value; + delete headers[name]; + } + }); +}; + + +/***/ }), + +/***/ "./lib/helpers/null.js": +/*!*****************************!*\ + !*** ./lib/helpers/null.js ***! + \*****************************/ +/*! no static exports found */ +/***/ (function(module, exports) { + +// eslint-disable-next-line strict +module.exports = null; + + +/***/ }), + +/***/ "./lib/helpers/parseHeaders.js": +/*!*************************************!*\ + !*** ./lib/helpers/parseHeaders.js ***! + \*************************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var utils = __webpack_require__(/*! ./../utils */ "./lib/utils.js"); + +// Headers whose duplicates are ignored by node +// c.f. https://nodejs.org/api/http.html#http_message_headers +var ignoreDuplicateOf = [ + 'age', 'authorization', 'content-length', 'content-type', 'etag', + 'expires', 'from', 'host', 'if-modified-since', 'if-unmodified-since', + 'last-modified', 'location', 'max-forwards', 'proxy-authorization', + 'referer', 'retry-after', 'user-agent' +]; + +/** + * Parse headers into an object + * + * ``` + * Date: Wed, 27 Aug 2014 08:58:49 GMT + * Content-Type: application/json + * Connection: keep-alive + * Transfer-Encoding: chunked + * ``` + * + * @param {String} headers Headers needing to be parsed + * @returns {Object} Headers parsed into an object + */ +module.exports = function parseHeaders(headers) { + var parsed = {}; + var key; + var val; + var i; + + if (!headers) { return parsed; } + + utils.forEach(headers.split('\n'), function parser(line) { + i = line.indexOf(':'); + key = utils.trim(line.substr(0, i)).toLowerCase(); + val = utils.trim(line.substr(i + 1)); + + if (key) { + if (parsed[key] && ignoreDuplicateOf.indexOf(key) >= 0) { + return; + } + if (key === 'set-cookie') { + parsed[key] = (parsed[key] ? parsed[key] : []).concat([val]); + } else { + parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val; + } + } + }); + + return parsed; +}; + + +/***/ }), + +/***/ "./lib/helpers/parseProtocol.js": +/*!**************************************!*\ + !*** ./lib/helpers/parseProtocol.js ***! + \**************************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +module.exports = function parseProtocol(url) { + var match = /^([-+\w]{1,25})(:?\/\/|:)/.exec(url); + return match && match[1] || ''; +}; + + +/***/ }), + +/***/ "./lib/helpers/spread.js": +/*!*******************************!*\ + !*** ./lib/helpers/spread.js ***! + \*******************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +/** + * Syntactic sugar for invoking a function and expanding an array for arguments. + * + * Common use case would be to use `Function.prototype.apply`. + * + * ```js + * function f(x, y, z) {} + * var args = [1, 2, 3]; + * f.apply(null, args); + * ``` + * + * With `spread` this example can be re-written. + * + * ```js + * spread(function(x, y, z) {})([1, 2, 3]); + * ``` + * + * @param {Function} callback + * @returns {Function} + */ +module.exports = function spread(callback) { + return function wrap(arr) { + return callback.apply(null, arr); + }; +}; + + +/***/ }), + +/***/ "./lib/helpers/toFormData.js": +/*!***********************************!*\ + !*** ./lib/helpers/toFormData.js ***! + \***********************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var utils = __webpack_require__(/*! ../utils */ "./lib/utils.js"); + +/** + * Convert a data object to FormData + * @param {Object} obj + * @param {?Object} [formData] + * @returns {Object} + **/ + +function toFormData(obj, formData) { + // eslint-disable-next-line no-param-reassign + formData = formData || new FormData(); + + var stack = []; + + function convertValue(value) { + if (value === null) return ''; + + if (utils.isDate(value)) { + return value.toISOString(); + } + + if (utils.isArrayBuffer(value) || utils.isTypedArray(value)) { + return typeof Blob === 'function' ? new Blob([value]) : Buffer.from(value); + } + + return value; + } + + function build(data, parentKey) { + if (utils.isPlainObject(data) || utils.isArray(data)) { + if (stack.indexOf(data) !== -1) { + throw Error('Circular reference detected in ' + parentKey); + } + + stack.push(data); + + utils.forEach(data, function each(value, key) { + if (utils.isUndefined(value)) return; + var fullKey = parentKey ? parentKey + '.' + key : key; + var arr; + + if (value && !parentKey && typeof value === 'object') { + if (utils.endsWith(key, '{}')) { + // eslint-disable-next-line no-param-reassign + value = JSON.stringify(value); + } else if (utils.endsWith(key, '[]') && (arr = utils.toArray(value))) { + // eslint-disable-next-line func-names + arr.forEach(function(el) { + !utils.isUndefined(el) && formData.append(fullKey, convertValue(el)); + }); + return; + } + } + + build(value, fullKey); + }); + + stack.pop(); + } else { + formData.append(parentKey, convertValue(data)); + } + } + + build(obj); + + return formData; +} + +module.exports = toFormData; + + +/***/ }), + +/***/ "./lib/helpers/validator.js": +/*!**********************************!*\ + !*** ./lib/helpers/validator.js ***! + \**********************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var VERSION = __webpack_require__(/*! ../env/data */ "./lib/env/data.js").version; +var AxiosError = __webpack_require__(/*! ../core/AxiosError */ "./lib/core/AxiosError.js"); + +var validators = {}; + +// eslint-disable-next-line func-names +['object', 'boolean', 'number', 'function', 'string', 'symbol'].forEach(function(type, i) { + validators[type] = function validator(thing) { + return typeof thing === type || 'a' + (i < 1 ? 'n ' : ' ') + type; + }; +}); + +var deprecatedWarnings = {}; + +/** + * Transitional option validator + * @param {function|boolean?} validator - set to false if the transitional option has been removed + * @param {string?} version - deprecated version / removed since version + * @param {string?} message - some message with additional info + * @returns {function} + */ +validators.transitional = function transitional(validator, version, message) { + function formatMessage(opt, desc) { + return '[Axios v' + VERSION + '] Transitional option \'' + opt + '\'' + desc + (message ? '. ' + message : ''); + } + + // eslint-disable-next-line func-names + return function(value, opt, opts) { + if (validator === false) { + throw new AxiosError( + formatMessage(opt, ' has been removed' + (version ? ' in ' + version : '')), + AxiosError.ERR_DEPRECATED + ); + } + + if (version && !deprecatedWarnings[opt]) { + deprecatedWarnings[opt] = true; + // eslint-disable-next-line no-console + console.warn( + formatMessage( + opt, + ' has been deprecated since v' + version + ' and will be removed in the near future' + ) + ); + } + + return validator ? validator(value, opt, opts) : true; + }; +}; + +/** + * Assert object's properties type + * @param {object} options + * @param {object} schema + * @param {boolean?} allowUnknown + */ + +function assertOptions(options, schema, allowUnknown) { + if (typeof options !== 'object') { + throw new AxiosError('options must be an object', AxiosError.ERR_BAD_OPTION_VALUE); + } + var keys = Object.keys(options); + var i = keys.length; + while (i-- > 0) { + var opt = keys[i]; + var validator = schema[opt]; + if (validator) { + var value = options[opt]; + var result = value === undefined || validator(value, opt, options); + if (result !== true) { + throw new AxiosError('option ' + opt + ' must be ' + result, AxiosError.ERR_BAD_OPTION_VALUE); + } + continue; + } + if (allowUnknown !== true) { + throw new AxiosError('Unknown option ' + opt, AxiosError.ERR_BAD_OPTION); + } + } +} + +module.exports = { + assertOptions: assertOptions, + validators: validators +}; + + +/***/ }), + +/***/ "./lib/utils.js": +/*!**********************!*\ + !*** ./lib/utils.js ***! + \**********************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var bind = __webpack_require__(/*! ./helpers/bind */ "./lib/helpers/bind.js"); + +// utils is a library of generic helper functions non-specific to axios + +var toString = Object.prototype.toString; + +// eslint-disable-next-line func-names +var kindOf = (function(cache) { + // eslint-disable-next-line func-names + return function(thing) { + var str = toString.call(thing); + return cache[str] || (cache[str] = str.slice(8, -1).toLowerCase()); + }; +})(Object.create(null)); + +function kindOfTest(type) { + type = type.toLowerCase(); + return function isKindOf(thing) { + return kindOf(thing) === type; + }; +} + +/** + * Determine if a value is an Array + * + * @param {Object} val The value to test + * @returns {boolean} True if value is an Array, otherwise false + */ +function isArray(val) { + return Array.isArray(val); +} + +/** + * Determine if a value is undefined + * + * @param {Object} val The value to test + * @returns {boolean} True if the value is undefined, otherwise false + */ +function isUndefined(val) { + return typeof val === 'undefined'; +} + +/** + * Determine if a value is a Buffer + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Buffer, otherwise false + */ +function isBuffer(val) { + return val !== null && !isUndefined(val) && val.constructor !== null && !isUndefined(val.constructor) + && typeof val.constructor.isBuffer === 'function' && val.constructor.isBuffer(val); +} + +/** + * Determine if a value is an ArrayBuffer + * + * @function + * @param {Object} val The value to test + * @returns {boolean} True if value is an ArrayBuffer, otherwise false + */ +var isArrayBuffer = kindOfTest('ArrayBuffer'); + + +/** + * Determine if a value is a view on an ArrayBuffer + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a view on an ArrayBuffer, otherwise false + */ +function isArrayBufferView(val) { + var result; + if ((typeof ArrayBuffer !== 'undefined') && (ArrayBuffer.isView)) { + result = ArrayBuffer.isView(val); + } else { + result = (val) && (val.buffer) && (isArrayBuffer(val.buffer)); + } + return result; +} + +/** + * Determine if a value is a String + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a String, otherwise false + */ +function isString(val) { + return typeof val === 'string'; +} + +/** + * Determine if a value is a Number + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Number, otherwise false + */ +function isNumber(val) { + return typeof val === 'number'; +} + +/** + * Determine if a value is an Object + * + * @param {Object} val The value to test + * @returns {boolean} True if value is an Object, otherwise false + */ +function isObject(val) { + return val !== null && typeof val === 'object'; +} + +/** + * Determine if a value is a plain Object + * + * @param {Object} val The value to test + * @return {boolean} True if value is a plain Object, otherwise false + */ +function isPlainObject(val) { + if (kindOf(val) !== 'object') { + return false; + } + + var prototype = Object.getPrototypeOf(val); + return prototype === null || prototype === Object.prototype; +} + +/** + * Determine if a value is a Date + * + * @function + * @param {Object} val The value to test + * @returns {boolean} True if value is a Date, otherwise false + */ +var isDate = kindOfTest('Date'); + +/** + * Determine if a value is a File + * + * @function + * @param {Object} val The value to test + * @returns {boolean} True if value is a File, otherwise false + */ +var isFile = kindOfTest('File'); + +/** + * Determine if a value is a Blob + * + * @function + * @param {Object} val The value to test + * @returns {boolean} True if value is a Blob, otherwise false + */ +var isBlob = kindOfTest('Blob'); + +/** + * Determine if a value is a FileList + * + * @function + * @param {Object} val The value to test + * @returns {boolean} True if value is a File, otherwise false + */ +var isFileList = kindOfTest('FileList'); + +/** + * Determine if a value is a Function + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Function, otherwise false + */ +function isFunction(val) { + return toString.call(val) === '[object Function]'; +} + +/** + * Determine if a value is a Stream + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Stream, otherwise false + */ +function isStream(val) { + return isObject(val) && isFunction(val.pipe); +} + +/** + * Determine if a value is a FormData + * + * @param {Object} thing The value to test + * @returns {boolean} True if value is an FormData, otherwise false + */ +function isFormData(thing) { + var pattern = '[object FormData]'; + return thing && ( + (typeof FormData === 'function' && thing instanceof FormData) || + toString.call(thing) === pattern || + (isFunction(thing.toString) && thing.toString() === pattern) + ); +} + +/** + * Determine if a value is a URLSearchParams object + * @function + * @param {Object} val The value to test + * @returns {boolean} True if value is a URLSearchParams object, otherwise false + */ +var isURLSearchParams = kindOfTest('URLSearchParams'); + +/** + * Trim excess whitespace off the beginning and end of a string + * + * @param {String} str The String to trim + * @returns {String} The String freed of excess whitespace + */ +function trim(str) { + return str.trim ? str.trim() : str.replace(/^\s+|\s+$/g, ''); +} + +/** + * Determine if we're running in a standard browser environment + * + * This allows axios to run in a web worker, and react-native. + * Both environments support XMLHttpRequest, but not fully standard globals. + * + * web workers: + * typeof window -> undefined + * typeof document -> undefined + * + * react-native: + * navigator.product -> 'ReactNative' + * nativescript + * navigator.product -> 'NativeScript' or 'NS' + */ +function isStandardBrowserEnv() { + if (typeof navigator !== 'undefined' && (navigator.product === 'ReactNative' || + navigator.product === 'NativeScript' || + navigator.product === 'NS')) { + return false; + } + return ( + typeof window !== 'undefined' && + typeof document !== 'undefined' + ); +} + +/** + * Iterate over an Array or an Object invoking a function for each item. + * + * If `obj` is an Array callback will be called passing + * the value, index, and complete array for each item. + * + * If 'obj' is an Object callback will be called passing + * the value, key, and complete object for each property. + * + * @param {Object|Array} obj The object to iterate + * @param {Function} fn The callback to invoke for each item + */ +function forEach(obj, fn) { + // Don't bother if no value provided + if (obj === null || typeof obj === 'undefined') { + return; + } + + // Force an array if not already something iterable + if (typeof obj !== 'object') { + /*eslint no-param-reassign:0*/ + obj = [obj]; + } + + if (isArray(obj)) { + // Iterate over array values + for (var i = 0, l = obj.length; i < l; i++) { + fn.call(null, obj[i], i, obj); + } + } else { + // Iterate over object keys + for (var key in obj) { + if (Object.prototype.hasOwnProperty.call(obj, key)) { + fn.call(null, obj[key], key, obj); + } + } + } +} + +/** + * Accepts varargs expecting each argument to be an object, then + * immutably merges the properties of each object and returns result. + * + * When multiple objects contain the same key the later object in + * the arguments list will take precedence. + * + * Example: + * + * ```js + * var result = merge({foo: 123}, {foo: 456}); + * console.log(result.foo); // outputs 456 + * ``` + * + * @param {Object} obj1 Object to merge + * @returns {Object} Result of all merge properties + */ +function merge(/* obj1, obj2, obj3, ... */) { + var result = {}; + function assignValue(val, key) { + if (isPlainObject(result[key]) && isPlainObject(val)) { + result[key] = merge(result[key], val); + } else if (isPlainObject(val)) { + result[key] = merge({}, val); + } else if (isArray(val)) { + result[key] = val.slice(); + } else { + result[key] = val; + } + } + + for (var i = 0, l = arguments.length; i < l; i++) { + forEach(arguments[i], assignValue); + } + return result; +} + +/** + * Extends object a by mutably adding to it the properties of object b. + * + * @param {Object} a The object to be extended + * @param {Object} b The object to copy properties from + * @param {Object} thisArg The object to bind function to + * @return {Object} The resulting value of object a + */ +function extend(a, b, thisArg) { + forEach(b, function assignValue(val, key) { + if (thisArg && typeof val === 'function') { + a[key] = bind(val, thisArg); + } else { + a[key] = val; + } + }); + return a; +} + +/** + * Remove byte order marker. This catches EF BB BF (the UTF-8 BOM) + * + * @param {string} content with BOM + * @return {string} content value without BOM + */ +function stripBOM(content) { + if (content.charCodeAt(0) === 0xFEFF) { + content = content.slice(1); + } + return content; +} + +/** + * Inherit the prototype methods from one constructor into another + * @param {function} constructor + * @param {function} superConstructor + * @param {object} [props] + * @param {object} [descriptors] + */ + +function inherits(constructor, superConstructor, props, descriptors) { + constructor.prototype = Object.create(superConstructor.prototype, descriptors); + constructor.prototype.constructor = constructor; + props && Object.assign(constructor.prototype, props); +} + +/** + * Resolve object with deep prototype chain to a flat object + * @param {Object} sourceObj source object + * @param {Object} [destObj] + * @param {Function} [filter] + * @returns {Object} + */ + +function toFlatObject(sourceObj, destObj, filter) { + var props; + var i; + var prop; + var merged = {}; + + destObj = destObj || {}; + + do { + props = Object.getOwnPropertyNames(sourceObj); + i = props.length; + while (i-- > 0) { + prop = props[i]; + if (!merged[prop]) { + destObj[prop] = sourceObj[prop]; + merged[prop] = true; + } + } + sourceObj = Object.getPrototypeOf(sourceObj); + } while (sourceObj && (!filter || filter(sourceObj, destObj)) && sourceObj !== Object.prototype); + + return destObj; +} + +/* + * determines whether a string ends with the characters of a specified string + * @param {String} str + * @param {String} searchString + * @param {Number} [position= 0] + * @returns {boolean} + */ +function endsWith(str, searchString, position) { + str = String(str); + if (position === undefined || position > str.length) { + position = str.length; + } + position -= searchString.length; + var lastIndex = str.indexOf(searchString, position); + return lastIndex !== -1 && lastIndex === position; +} + + +/** + * Returns new array from array like object + * @param {*} [thing] + * @returns {Array} + */ +function toArray(thing) { + if (!thing) return null; + var i = thing.length; + if (isUndefined(i)) return null; + var arr = new Array(i); + while (i-- > 0) { + arr[i] = thing[i]; + } + return arr; +} + +// eslint-disable-next-line func-names +var isTypedArray = (function(TypedArray) { + // eslint-disable-next-line func-names + return function(thing) { + return TypedArray && thing instanceof TypedArray; + }; +})(typeof Uint8Array !== 'undefined' && Object.getPrototypeOf(Uint8Array)); + +module.exports = { + isArray: isArray, + isArrayBuffer: isArrayBuffer, + isBuffer: isBuffer, + isFormData: isFormData, + isArrayBufferView: isArrayBufferView, + isString: isString, + isNumber: isNumber, + isObject: isObject, + isPlainObject: isPlainObject, + isUndefined: isUndefined, + isDate: isDate, + isFile: isFile, + isBlob: isBlob, + isFunction: isFunction, + isStream: isStream, + isURLSearchParams: isURLSearchParams, + isStandardBrowserEnv: isStandardBrowserEnv, + forEach: forEach, + merge: merge, + extend: extend, + trim: trim, + stripBOM: stripBOM, + inherits: inherits, + toFlatObject: toFlatObject, + kindOf: kindOf, + kindOfTest: kindOfTest, + endsWith: endsWith, + toArray: toArray, + isTypedArray: isTypedArray, + isFileList: isFileList +}; + + +/***/ }) + +/******/ }); +}); +//# sourceMappingURL=axios.map \ No newline at end of file diff --git a/_nodejs/node_modules/axios/dist/axios.map b/_nodejs/node_modules/axios/dist/axios.map new file mode 100644 index 0000000..5c24df5 --- /dev/null +++ b/_nodejs/node_modules/axios/dist/axios.map @@ -0,0 +1 @@ +{"version":3,"sources":["webpack://axios/webpack/universalModuleDefinition","webpack://axios/webpack/bootstrap","webpack://axios/./index.js","webpack://axios/./lib/adapters/xhr.js","webpack://axios/./lib/axios.js","webpack://axios/./lib/cancel/CancelToken.js","webpack://axios/./lib/cancel/CanceledError.js","webpack://axios/./lib/cancel/isCancel.js","webpack://axios/./lib/core/Axios.js","webpack://axios/./lib/core/AxiosError.js","webpack://axios/./lib/core/InterceptorManager.js","webpack://axios/./lib/core/buildFullPath.js","webpack://axios/./lib/core/dispatchRequest.js","webpack://axios/./lib/core/mergeConfig.js","webpack://axios/./lib/core/settle.js","webpack://axios/./lib/core/transformData.js","webpack://axios/./lib/defaults/index.js","webpack://axios/./lib/defaults/transitional.js","webpack://axios/./lib/env/data.js","webpack://axios/./lib/helpers/bind.js","webpack://axios/./lib/helpers/buildURL.js","webpack://axios/./lib/helpers/combineURLs.js","webpack://axios/./lib/helpers/cookies.js","webpack://axios/./lib/helpers/isAbsoluteURL.js","webpack://axios/./lib/helpers/isAxiosError.js","webpack://axios/./lib/helpers/isURLSameOrigin.js","webpack://axios/./lib/helpers/normalizeHeaderName.js","webpack://axios/./lib/helpers/null.js","webpack://axios/./lib/helpers/parseHeaders.js","webpack://axios/./lib/helpers/parseProtocol.js","webpack://axios/./lib/helpers/spread.js","webpack://axios/./lib/helpers/toFormData.js","webpack://axios/./lib/helpers/validator.js","webpack://axios/./lib/utils.js"],"names":[],"mappings":"AAAA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC;AACD,O;QCVA;QACA;;QAEA;QACA;;QAEA;QACA;QACA;QACA;QACA;QACA;QACA;QACA;QACA;QACA;;QAEA;QACA;;QAEA;QACA;;QAEA;QACA;QACA;;;QAGA;QACA;;QAEA;QACA;;QAEA;QACA;QACA;QACA,0CAA0C,gCAAgC;QAC1E;QACA;;QAEA;QACA;QACA;QACA,wDAAwD,kBAAkB;QAC1E;QACA,iDAAiD,cAAc;QAC/D;;QAEA;QACA;QACA;QACA;QACA;QACA;QACA;QACA;QACA;QACA;QACA;QACA,yCAAyC,iCAAiC;QAC1E,gHAAgH,mBAAmB,EAAE;QACrI;QACA;;QAEA;QACA;QACA;QACA,2BAA2B,0BAA0B,EAAE;QACvD,iCAAiC,eAAe;QAChD;QACA;QACA;;QAEA;QACA,sDAAsD,+DAA+D;;QAErH;QACA;;;QAGA;QACA;;;;;;;;;;;;AClFA,iBAAiB,mBAAO,CAAC,mCAAa,E;;;;;;;;;;;;ACAzB;;AAEb,YAAY,mBAAO,CAAC,kCAAY;AAChC,aAAa,mBAAO,CAAC,8CAAkB;AACvC,cAAc,mBAAO,CAAC,sDAAsB;AAC5C,eAAe,mBAAO,CAAC,wDAAuB;AAC9C,oBAAoB,mBAAO,CAAC,0DAAuB;AACnD,mBAAmB,mBAAO,CAAC,gEAA2B;AACtD,sBAAsB,mBAAO,CAAC,sEAA8B;AAC5D,2BAA2B,mBAAO,CAAC,gEAA0B;AAC7D,iBAAiB,mBAAO,CAAC,oDAAoB;AAC7C,oBAAoB,mBAAO,CAAC,8DAAyB;AACrD,oBAAoB,mBAAO,CAAC,gEAA0B;;AAEtD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA,4CAA4C;AAC5C;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,OAAO;AACP;AACA;AACA,OAAO;;AAEP;AACA;AACA;;AAEA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA,OAAO;AACP;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;;;AAGA;AACA;AACA,GAAG;AACH;;;;;;;;;;;;;AC7Na;;AAEb,YAAY,mBAAO,CAAC,+BAAS;AAC7B,WAAW,mBAAO,CAAC,6CAAgB;AACnC,YAAY,mBAAO,CAAC,yCAAc;AAClC,kBAAkB,mBAAO,CAAC,qDAAoB;AAC9C,eAAe,mBAAO,CAAC,2CAAY;;AAEnC;AACA;AACA;AACA,WAAW,OAAO;AAClB,YAAY,MAAM;AAClB;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA,sBAAsB,mBAAO,CAAC,6DAAwB;AACtD,oBAAoB,mBAAO,CAAC,yDAAsB;AAClD,iBAAiB,mBAAO,CAAC,mDAAmB;AAC5C,gBAAgB,mBAAO,CAAC,qCAAY;AACpC,mBAAmB,mBAAO,CAAC,yDAAsB;;AAEjD;AACA,mBAAmB,mBAAO,CAAC,wDAAwB;;AAEnD;AACA;;AAEA;AACA;AACA;AACA;AACA,eAAe,mBAAO,CAAC,iDAAkB;;AAEzC;AACA,qBAAqB,mBAAO,CAAC,6DAAwB;;AAErD;;AAEA;AACA;;;;;;;;;;;;;AC/Da;;AAEb,oBAAoB,mBAAO,CAAC,sDAAiB;;AAE7C;AACA;AACA;AACA;AACA,WAAW,SAAS;AACpB;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA,GAAG;;AAEH;;AAEA;AACA;AACA;;AAEA;AACA;;AAEA,eAAe,OAAO;AACtB;AACA;AACA;AACA,GAAG;;AAEH;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;;AAEL;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,GAAG;AACH;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,GAAG;AACH;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,GAAG;AACH;AACA;AACA;AACA;AACA;;AAEA;;;;;;;;;;;;;ACtHa;;AAEb,iBAAiB,mBAAO,CAAC,oDAAoB;AAC7C,YAAY,mBAAO,CAAC,gCAAU;;AAE9B;AACA;AACA;AACA;AACA,WAAW,QAAQ;AACnB;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,CAAC;;AAED;;;;;;;;;;;;;ACrBa;;AAEb;AACA;AACA;;;;;;;;;;;;;ACJa;;AAEb,YAAY,mBAAO,CAAC,kCAAY;AAChC,eAAe,mBAAO,CAAC,sDAAqB;AAC5C,yBAAyB,mBAAO,CAAC,8DAAsB;AACvD,sBAAsB,mBAAO,CAAC,wDAAmB;AACjD,kBAAkB,mBAAO,CAAC,gDAAe;AACzC,oBAAoB,mBAAO,CAAC,oDAAiB;AAC7C,gBAAgB,mBAAO,CAAC,wDAAsB;;AAE9C;AACA;AACA;AACA;AACA,WAAW,OAAO;AAClB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB;AACA;AACA;AACA;AACA;AACA;AACA;AACA,GAAG;AACH;AACA;;AAEA;;AAEA;AACA;AACA;AACA,GAAG;AACH;AACA,GAAG;AACH;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA,GAAG;;AAEH;AACA;AACA;AACA,GAAG;;AAEH;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;;;AAGA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;;AAEA;AACA;AACA,GAAG;AACH;AACA;;AAEA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,gDAAgD;AAChD;AACA;AACA,yBAAyB;AACzB,KAAK;AACL;AACA,CAAC;;AAED;AACA;;AAEA;AACA;AACA,kDAAkD;AAClD;AACA;AACA;AACA,SAAS,KAAK;AACd;AACA;AACA,OAAO;AACP;AACA;;AAEA;;AAEA;AACA,CAAC;;AAED;;;;;;;;;;;;;AC/Ja;;AAEb,YAAY,mBAAO,CAAC,gCAAU;;AAE9B;AACA;AACA;AACA,WAAW,OAAO;AAClB,WAAW,OAAO;AAClB,WAAW,OAAO;AAClB,WAAW,OAAO;AAClB,WAAW,OAAO;AAClB,aAAa,MAAM;AACnB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC;;AAED;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB;AACvB,CAAC;;AAED;AACA,kDAAkD,YAAY;;AAE9D;AACA;AACA;;AAEA;AACA;AACA,GAAG;;AAEH;;AAEA;;AAEA;;AAEA;AACA;;AAEA;;;;;;;;;;;;;ACrFa;;AAEb,YAAY,mBAAO,CAAC,kCAAY;;AAEhC;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,SAAS;AACpB,WAAW,SAAS;AACpB;AACA,YAAY,OAAO;AACnB;AACA;AACA;AACA;AACA;AACA;AACA;AACA,GAAG;AACH;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,SAAS;AACpB;AACA;AACA;AACA;AACA;AACA;AACA,GAAG;AACH;;AAEA;;;;;;;;;;;;;ACrDa;;AAEb,oBAAoB,mBAAO,CAAC,gEAA0B;AACtD,kBAAkB,mBAAO,CAAC,4DAAwB;;AAElD;AACA;AACA;AACA;AACA;AACA,WAAW,OAAO;AAClB,WAAW,OAAO;AAClB,aAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;AACA;AACA;;;;;;;;;;;;;ACnBa;;AAEb,YAAY,mBAAO,CAAC,kCAAY;AAChC,oBAAoB,mBAAO,CAAC,oDAAiB;AAC7C,eAAe,mBAAO,CAAC,oDAAoB;AAC3C,eAAe,mBAAO,CAAC,4CAAa;AACpC,oBAAoB,mBAAO,CAAC,8DAAyB;;AAErD;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,+BAA+B;AAC/B,uCAAuC;AACvC;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,GAAG;AACH;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,GAAG;AACH;;;;;;;;;;;;;ACtFa;;AAEb,YAAY,mBAAO,CAAC,gCAAU;;AAE9B;AACA;AACA;AACA;AACA,WAAW,OAAO;AAClB,WAAW,OAAO;AAClB,aAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,KAAK;AACL,2BAA2B;AAC3B,KAAK;AACL;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,GAAG;;AAEH;AACA;;;;;;;;;;;;;ACnGa;;AAEb,iBAAiB,mBAAO,CAAC,8CAAc;;AAEvC;AACA;AACA;AACA,WAAW,SAAS;AACpB,WAAW,SAAS;AACpB,WAAW,OAAO;AAClB;AACA;AACA;AACA;AACA;AACA,GAAG;AACH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;;;;;;;;;;;;ACxBa;;AAEb,YAAY,mBAAO,CAAC,kCAAY;AAChC,eAAe,mBAAO,CAAC,4CAAa;;AAEpC;AACA;AACA;AACA,WAAW,cAAc;AACzB,WAAW,MAAM;AACjB,WAAW,eAAe;AAC1B,aAAa,EAAE;AACf;AACA;AACA;AACA;AACA;AACA;AACA,GAAG;;AAEH;AACA;;;;;;;;;;;;;ACrBa;;AAEb,YAAY,mBAAO,CAAC,gCAAU;AAC9B,0BAA0B,mBAAO,CAAC,4EAAgC;AAClE,iBAAiB,mBAAO,CAAC,oDAAoB;AAC7C,2BAA2B,mBAAO,CAAC,sDAAgB;AACnD,iBAAiB,mBAAO,CAAC,0DAAuB;;AAEhD;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,cAAc,mBAAO,CAAC,8CAAiB;AACvC,GAAG;AACH;AACA,cAAc,mBAAO,CAAC,+CAAkB;AACxC;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;;AAEA;;AAEA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wEAAwE;AACxE;AACA;;AAEA;AACA;;AAEA;;AAEA;AACA;AACA,sCAAsC,gBAAgB;AACtD,KAAK;AACL;AACA;AACA;;AAEA;AACA,GAAG;;AAEH;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,OAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,GAAG;;AAEH;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA,cAAc,mBAAO,CAAC,6CAAgB;AACtC,GAAG;;AAEH;AACA;AACA,GAAG;;AAEH;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,CAAC;;AAED;AACA;AACA,CAAC;;AAED;;;;;;;;;;;;;ACjJa;;AAEb;AACA;AACA;AACA;AACA;;;;;;;;;;;;ACNA;AACA;AACA,E;;;;;;;;;;;;ACFa;;AAEb;AACA;AACA;AACA,mBAAmB,iBAAiB;AACpC;AACA;AACA;AACA;AACA;;;;;;;;;;;;;ACVa;;AAEb,YAAY,mBAAO,CAAC,kCAAY;;AAEhC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,WAAW,OAAO;AAClB,aAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,GAAG;AACH;AACA,GAAG;AACH;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA,OAAO;AACP;AACA;;AAEA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA,OAAO;AACP,KAAK;;AAEL;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;;;;;;;;;;;;ACrEa;;AAEb;AACA;AACA;AACA,WAAW,OAAO;AAClB,WAAW,OAAO;AAClB,aAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;AACA;;;;;;;;;;;;;ACba;;AAEb,YAAY,mBAAO,CAAC,kCAAY;;AAEhC;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA,0CAA0C;AAC1C,SAAS;;AAET;AACA,4DAA4D,wBAAwB;AACpF;AACA,SAAS;;AAET;AACA;AACA;AACA;AACA,KAAK;;AAEL;AACA;AACA;AACA,kCAAkC;AAClC,+BAA+B,aAAa,EAAE;AAC9C;AACA;AACA,KAAK;AACL;;;;;;;;;;;;;ACpDa;;AAEb;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;;;;;;;;;;;;;ACba;;AAEb,YAAY,mBAAO,CAAC,kCAAY;;AAEhC;AACA;AACA;AACA,WAAW,EAAE;AACb,aAAa,QAAQ;AACrB;AACA;AACA;AACA;;;;;;;;;;;;;ACZa;;AAEb,YAAY,mBAAO,CAAC,kCAAY;;AAEhC;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,cAAc,OAAO;AACrB,gBAAgB;AAChB;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA,cAAc,OAAO;AACrB,gBAAgB,QAAQ;AACxB;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;;AAEL;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;;;;;;;;;;;;;ACnEa;;AAEb,YAAY,mBAAO,CAAC,gCAAU;;AAE9B;AACA;AACA;AACA;AACA;AACA;AACA,GAAG;AACH;;;;;;;;;;;;ACXA;AACA;;;;;;;;;;;;;ACDa;;AAEb,YAAY,mBAAO,CAAC,kCAAY;;AAEhC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;AACA;;AAEA,iBAAiB,eAAe;;AAEhC;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,OAAO;AACP;AACA;AACA;AACA,GAAG;;AAEH;AACA;;;;;;;;;;;;;ACpDa;;AAEb;AACA,wBAAwB,KAAK;AAC7B;AACA;;;;;;;;;;;;;ACLa;;AAEb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B;AAC/B;AACA;AACA,WAAW,SAAS;AACpB,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;;;;;;;;;;;;;AC1Ba;;AAEb,YAAY,mBAAO,CAAC,gCAAU;;AAE9B;AACA;AACA,WAAW,OAAO;AAClB,WAAW,QAAQ;AACnB,aAAa;AACb;;AAEA;AACA;AACA;;AAEA;;AAEA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;;AAEA;AACA,qCAAqC;AACrC;AACA;AACA,WAAW;AACX;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;;AAEA;AACA,OAAO;;AAEP;AACA,KAAK;AACL;AACA;AACA;;AAEA;;AAEA;AACA;;AAEA;;;;;;;;;;;;;ACvEa;;AAEb,cAAc,mBAAO,CAAC,sCAAa;AACnC,iBAAiB,mBAAO,CAAC,oDAAoB;;AAE7C;;AAEA;AACA;AACA;AACA;AACA;AACA,CAAC;;AAED;;AAEA;AACA;AACA,WAAW,kBAAkB;AAC7B,WAAW,QAAQ;AACnB,WAAW,QAAQ;AACnB,aAAa;AACb;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA,WAAW,OAAO;AAClB,WAAW,OAAO;AAClB,WAAW,SAAS;AACpB;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;;;;;;;;;;;;ACrFa;;AAEb,WAAW,mBAAO,CAAC,6CAAgB;;AAEnC;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC;;AAED;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;;;AAGA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;AACA;AACA;AACA;AACA,GAAG;AACH;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,YAAY,QAAQ;AACpB;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;;AAEA;AACA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;;AAEA;AACA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;;AAEA;AACA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,OAAO;AACpB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,aAAa;AACxB,WAAW,SAAS;AACpB;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,mCAAmC,OAAO;AAC1C;AACA;AACA,GAAG;AACH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,SAAS,GAAG,SAAS;AAC5C,2BAA2B;AAC3B;AACA;AACA,WAAW,OAAO;AAClB,aAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL,4BAA4B;AAC5B,KAAK;AACL;AACA,KAAK;AACL;AACA;AACA;;AAEA,uCAAuC,OAAO;AAC9C;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,WAAW,OAAO;AAClB,WAAW,OAAO;AAClB,YAAY,OAAO;AACnB;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA,GAAG;AACH;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,YAAY,OAAO;AACnB;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,WAAW,SAAS;AACpB,WAAW,SAAS;AACpB,WAAW,OAAO;AAClB,WAAW,OAAO;AAClB;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,WAAW,OAAO;AAClB,WAAW,OAAO;AAClB,WAAW,SAAS;AACpB,aAAa;AACb;;AAEA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,GAAG;;AAEH;AACA;;AAEA;AACA;AACA,WAAW,OAAO;AAClB,WAAW,OAAO;AAClB,WAAW,OAAO;AAClB,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;;AAGA;AACA;AACA,WAAW,EAAE;AACb,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC;;AAED;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA","file":"axios.js","sourcesContent":["(function webpackUniversalModuleDefinition(root, factory) {\n\tif(typeof exports === 'object' && typeof module === 'object')\n\t\tmodule.exports = factory();\n\telse if(typeof define === 'function' && define.amd)\n\t\tdefine([], factory);\n\telse if(typeof exports === 'object')\n\t\texports[\"axios\"] = factory();\n\telse\n\t\troot[\"axios\"] = factory();\n})(this, function() {\nreturn "," \t// The module cache\n \tvar installedModules = {};\n\n \t// The require function\n \tfunction __webpack_require__(moduleId) {\n\n \t\t// Check if module is in cache\n \t\tif(installedModules[moduleId]) {\n \t\t\treturn installedModules[moduleId].exports;\n \t\t}\n \t\t// Create a new module (and put it into the cache)\n \t\tvar module = installedModules[moduleId] = {\n \t\t\ti: moduleId,\n \t\t\tl: false,\n \t\t\texports: {}\n \t\t};\n\n \t\t// Execute the module function\n \t\tmodules[moduleId].call(module.exports, module, module.exports, __webpack_require__);\n\n \t\t// Flag the module as loaded\n \t\tmodule.l = true;\n\n \t\t// Return the exports of the module\n \t\treturn module.exports;\n \t}\n\n\n \t// expose the modules object (__webpack_modules__)\n \t__webpack_require__.m = modules;\n\n \t// expose the module cache\n \t__webpack_require__.c = installedModules;\n\n \t// define getter function for harmony exports\n \t__webpack_require__.d = function(exports, name, getter) {\n \t\tif(!__webpack_require__.o(exports, name)) {\n \t\t\tObject.defineProperty(exports, name, { enumerable: true, get: getter });\n \t\t}\n \t};\n\n \t// define __esModule on exports\n \t__webpack_require__.r = function(exports) {\n \t\tif(typeof Symbol !== 'undefined' && Symbol.toStringTag) {\n \t\t\tObject.defineProperty(exports, Symbol.toStringTag, { value: 'Module' });\n \t\t}\n \t\tObject.defineProperty(exports, '__esModule', { value: true });\n \t};\n\n \t// create a fake namespace object\n \t// mode & 1: value is a module id, require it\n \t// mode & 2: merge all properties of value into the ns\n \t// mode & 4: return value when already ns object\n \t// mode & 8|1: behave like require\n \t__webpack_require__.t = function(value, mode) {\n \t\tif(mode & 1) value = __webpack_require__(value);\n \t\tif(mode & 8) return value;\n \t\tif((mode & 4) && typeof value === 'object' && value && value.__esModule) return value;\n \t\tvar ns = Object.create(null);\n \t\t__webpack_require__.r(ns);\n \t\tObject.defineProperty(ns, 'default', { enumerable: true, value: value });\n \t\tif(mode & 2 && typeof value != 'string') for(var key in value) __webpack_require__.d(ns, key, function(key) { return value[key]; }.bind(null, key));\n \t\treturn ns;\n \t};\n\n \t// getDefaultExport function for compatibility with non-harmony modules\n \t__webpack_require__.n = function(module) {\n \t\tvar getter = module && module.__esModule ?\n \t\t\tfunction getDefault() { return module['default']; } :\n \t\t\tfunction getModuleExports() { return module; };\n \t\t__webpack_require__.d(getter, 'a', getter);\n \t\treturn getter;\n \t};\n\n \t// Object.prototype.hasOwnProperty.call\n \t__webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); };\n\n \t// __webpack_public_path__\n \t__webpack_require__.p = \"\";\n\n\n \t// Load entry module and return exports\n \treturn __webpack_require__(__webpack_require__.s = \"./index.js\");\n","module.exports = require('./lib/axios');","'use strict';\n\nvar utils = require('./../utils');\nvar settle = require('./../core/settle');\nvar cookies = require('./../helpers/cookies');\nvar buildURL = require('./../helpers/buildURL');\nvar buildFullPath = require('../core/buildFullPath');\nvar parseHeaders = require('./../helpers/parseHeaders');\nvar isURLSameOrigin = require('./../helpers/isURLSameOrigin');\nvar transitionalDefaults = require('../defaults/transitional');\nvar AxiosError = require('../core/AxiosError');\nvar CanceledError = require('../cancel/CanceledError');\nvar parseProtocol = require('../helpers/parseProtocol');\n\nmodule.exports = function xhrAdapter(config) {\n return new Promise(function dispatchXhrRequest(resolve, reject) {\n var requestData = config.data;\n var requestHeaders = config.headers;\n var responseType = config.responseType;\n var onCanceled;\n function done() {\n if (config.cancelToken) {\n config.cancelToken.unsubscribe(onCanceled);\n }\n\n if (config.signal) {\n config.signal.removeEventListener('abort', onCanceled);\n }\n }\n\n if (utils.isFormData(requestData) && utils.isStandardBrowserEnv()) {\n delete requestHeaders['Content-Type']; // Let the browser set it\n }\n\n var request = new XMLHttpRequest();\n\n // HTTP basic authentication\n if (config.auth) {\n var username = config.auth.username || '';\n var password = config.auth.password ? unescape(encodeURIComponent(config.auth.password)) : '';\n requestHeaders.Authorization = 'Basic ' + btoa(username + ':' + password);\n }\n\n var fullPath = buildFullPath(config.baseURL, config.url);\n\n request.open(config.method.toUpperCase(), buildURL(fullPath, config.params, config.paramsSerializer), true);\n\n // Set the request timeout in MS\n request.timeout = config.timeout;\n\n function onloadend() {\n if (!request) {\n return;\n }\n // Prepare the response\n var responseHeaders = 'getAllResponseHeaders' in request ? parseHeaders(request.getAllResponseHeaders()) : null;\n var responseData = !responseType || responseType === 'text' || responseType === 'json' ?\n request.responseText : request.response;\n var response = {\n data: responseData,\n status: request.status,\n statusText: request.statusText,\n headers: responseHeaders,\n config: config,\n request: request\n };\n\n settle(function _resolve(value) {\n resolve(value);\n done();\n }, function _reject(err) {\n reject(err);\n done();\n }, response);\n\n // Clean up request\n request = null;\n }\n\n if ('onloadend' in request) {\n // Use onloadend if available\n request.onloadend = onloadend;\n } else {\n // Listen for ready state to emulate onloadend\n request.onreadystatechange = function handleLoad() {\n if (!request || request.readyState !== 4) {\n return;\n }\n\n // The request errored out and we didn't get a response, this will be\n // handled by onerror instead\n // With one exception: request that using file: protocol, most browsers\n // will return status as 0 even though it's a successful request\n if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) {\n return;\n }\n // readystate handler is calling before onerror or ontimeout handlers,\n // so we should call onloadend on the next 'tick'\n setTimeout(onloadend);\n };\n }\n\n // Handle browser request cancellation (as opposed to a manual cancellation)\n request.onabort = function handleAbort() {\n if (!request) {\n return;\n }\n\n reject(new AxiosError('Request aborted', AxiosError.ECONNABORTED, config, request));\n\n // Clean up request\n request = null;\n };\n\n // Handle low level network errors\n request.onerror = function handleError() {\n // Real errors are hidden from us by the browser\n // onerror should only fire if it's a network error\n reject(new AxiosError('Network Error', AxiosError.ERR_NETWORK, config, request, request));\n\n // Clean up request\n request = null;\n };\n\n // Handle timeout\n request.ontimeout = function handleTimeout() {\n var timeoutErrorMessage = config.timeout ? 'timeout of ' + config.timeout + 'ms exceeded' : 'timeout exceeded';\n var transitional = config.transitional || transitionalDefaults;\n if (config.timeoutErrorMessage) {\n timeoutErrorMessage = config.timeoutErrorMessage;\n }\n reject(new AxiosError(\n timeoutErrorMessage,\n transitional.clarifyTimeoutError ? AxiosError.ETIMEDOUT : AxiosError.ECONNABORTED,\n config,\n request));\n\n // Clean up request\n request = null;\n };\n\n // Add xsrf header\n // This is only done if running in a standard browser environment.\n // Specifically not if we're in a web worker, or react-native.\n if (utils.isStandardBrowserEnv()) {\n // Add xsrf header\n var xsrfValue = (config.withCredentials || isURLSameOrigin(fullPath)) && config.xsrfCookieName ?\n cookies.read(config.xsrfCookieName) :\n undefined;\n\n if (xsrfValue) {\n requestHeaders[config.xsrfHeaderName] = xsrfValue;\n }\n }\n\n // Add headers to the request\n if ('setRequestHeader' in request) {\n utils.forEach(requestHeaders, function setRequestHeader(val, key) {\n if (typeof requestData === 'undefined' && key.toLowerCase() === 'content-type') {\n // Remove Content-Type if data is undefined\n delete requestHeaders[key];\n } else {\n // Otherwise add header to the request\n request.setRequestHeader(key, val);\n }\n });\n }\n\n // Add withCredentials to request if needed\n if (!utils.isUndefined(config.withCredentials)) {\n request.withCredentials = !!config.withCredentials;\n }\n\n // Add responseType to request if needed\n if (responseType && responseType !== 'json') {\n request.responseType = config.responseType;\n }\n\n // Handle progress if needed\n if (typeof config.onDownloadProgress === 'function') {\n request.addEventListener('progress', config.onDownloadProgress);\n }\n\n // Not all browsers support upload events\n if (typeof config.onUploadProgress === 'function' && request.upload) {\n request.upload.addEventListener('progress', config.onUploadProgress);\n }\n\n if (config.cancelToken || config.signal) {\n // Handle cancellation\n // eslint-disable-next-line func-names\n onCanceled = function(cancel) {\n if (!request) {\n return;\n }\n reject(!cancel || (cancel && cancel.type) ? new CanceledError() : cancel);\n request.abort();\n request = null;\n };\n\n config.cancelToken && config.cancelToken.subscribe(onCanceled);\n if (config.signal) {\n config.signal.aborted ? onCanceled() : config.signal.addEventListener('abort', onCanceled);\n }\n }\n\n if (!requestData) {\n requestData = null;\n }\n\n var protocol = parseProtocol(fullPath);\n\n if (protocol && [ 'http', 'https', 'file' ].indexOf(protocol) === -1) {\n reject(new AxiosError('Unsupported protocol ' + protocol + ':', AxiosError.ERR_BAD_REQUEST, config));\n return;\n }\n\n\n // Send the request\n request.send(requestData);\n });\n};\n","'use strict';\n\nvar utils = require('./utils');\nvar bind = require('./helpers/bind');\nvar Axios = require('./core/Axios');\nvar mergeConfig = require('./core/mergeConfig');\nvar defaults = require('./defaults');\n\n/**\n * Create an instance of Axios\n *\n * @param {Object} defaultConfig The default config for the instance\n * @return {Axios} A new instance of Axios\n */\nfunction createInstance(defaultConfig) {\n var context = new Axios(defaultConfig);\n var instance = bind(Axios.prototype.request, context);\n\n // Copy axios.prototype to instance\n utils.extend(instance, Axios.prototype, context);\n\n // Copy context to instance\n utils.extend(instance, context);\n\n // Factory for creating new instances\n instance.create = function create(instanceConfig) {\n return createInstance(mergeConfig(defaultConfig, instanceConfig));\n };\n\n return instance;\n}\n\n// Create the default instance to be exported\nvar axios = createInstance(defaults);\n\n// Expose Axios class to allow class inheritance\naxios.Axios = Axios;\n\n// Expose Cancel & CancelToken\naxios.CanceledError = require('./cancel/CanceledError');\naxios.CancelToken = require('./cancel/CancelToken');\naxios.isCancel = require('./cancel/isCancel');\naxios.VERSION = require('./env/data').version;\naxios.toFormData = require('./helpers/toFormData');\n\n// Expose AxiosError class\naxios.AxiosError = require('../lib/core/AxiosError');\n\n// alias for CanceledError for backward compatibility\naxios.Cancel = axios.CanceledError;\n\n// Expose all/spread\naxios.all = function all(promises) {\n return Promise.all(promises);\n};\naxios.spread = require('./helpers/spread');\n\n// Expose isAxiosError\naxios.isAxiosError = require('./helpers/isAxiosError');\n\nmodule.exports = axios;\n\n// Allow use of default import syntax in TypeScript\nmodule.exports.default = axios;\n","'use strict';\n\nvar CanceledError = require('./CanceledError');\n\n/**\n * A `CancelToken` is an object that can be used to request cancellation of an operation.\n *\n * @class\n * @param {Function} executor The executor function.\n */\nfunction CancelToken(executor) {\n if (typeof executor !== 'function') {\n throw new TypeError('executor must be a function.');\n }\n\n var resolvePromise;\n\n this.promise = new Promise(function promiseExecutor(resolve) {\n resolvePromise = resolve;\n });\n\n var token = this;\n\n // eslint-disable-next-line func-names\n this.promise.then(function(cancel) {\n if (!token._listeners) return;\n\n var i;\n var l = token._listeners.length;\n\n for (i = 0; i < l; i++) {\n token._listeners[i](cancel);\n }\n token._listeners = null;\n });\n\n // eslint-disable-next-line func-names\n this.promise.then = function(onfulfilled) {\n var _resolve;\n // eslint-disable-next-line func-names\n var promise = new Promise(function(resolve) {\n token.subscribe(resolve);\n _resolve = resolve;\n }).then(onfulfilled);\n\n promise.cancel = function reject() {\n token.unsubscribe(_resolve);\n };\n\n return promise;\n };\n\n executor(function cancel(message) {\n if (token.reason) {\n // Cancellation has already been requested\n return;\n }\n\n token.reason = new CanceledError(message);\n resolvePromise(token.reason);\n });\n}\n\n/**\n * Throws a `CanceledError` if cancellation has been requested.\n */\nCancelToken.prototype.throwIfRequested = function throwIfRequested() {\n if (this.reason) {\n throw this.reason;\n }\n};\n\n/**\n * Subscribe to the cancel signal\n */\n\nCancelToken.prototype.subscribe = function subscribe(listener) {\n if (this.reason) {\n listener(this.reason);\n return;\n }\n\n if (this._listeners) {\n this._listeners.push(listener);\n } else {\n this._listeners = [listener];\n }\n};\n\n/**\n * Unsubscribe from the cancel signal\n */\n\nCancelToken.prototype.unsubscribe = function unsubscribe(listener) {\n if (!this._listeners) {\n return;\n }\n var index = this._listeners.indexOf(listener);\n if (index !== -1) {\n this._listeners.splice(index, 1);\n }\n};\n\n/**\n * Returns an object that contains a new `CancelToken` and a function that, when called,\n * cancels the `CancelToken`.\n */\nCancelToken.source = function source() {\n var cancel;\n var token = new CancelToken(function executor(c) {\n cancel = c;\n });\n return {\n token: token,\n cancel: cancel\n };\n};\n\nmodule.exports = CancelToken;\n","'use strict';\n\nvar AxiosError = require('../core/AxiosError');\nvar utils = require('../utils');\n\n/**\n * A `CanceledError` is an object that is thrown when an operation is canceled.\n *\n * @class\n * @param {string=} message The message.\n */\nfunction CanceledError(message) {\n // eslint-disable-next-line no-eq-null,eqeqeq\n AxiosError.call(this, message == null ? 'canceled' : message, AxiosError.ERR_CANCELED);\n this.name = 'CanceledError';\n}\n\nutils.inherits(CanceledError, AxiosError, {\n __CANCEL__: true\n});\n\nmodule.exports = CanceledError;\n","'use strict';\n\nmodule.exports = function isCancel(value) {\n return !!(value && value.__CANCEL__);\n};\n","'use strict';\n\nvar utils = require('./../utils');\nvar buildURL = require('../helpers/buildURL');\nvar InterceptorManager = require('./InterceptorManager');\nvar dispatchRequest = require('./dispatchRequest');\nvar mergeConfig = require('./mergeConfig');\nvar buildFullPath = require('./buildFullPath');\nvar validator = require('../helpers/validator');\n\nvar validators = validator.validators;\n/**\n * Create a new instance of Axios\n *\n * @param {Object} instanceConfig The default config for the instance\n */\nfunction Axios(instanceConfig) {\n this.defaults = instanceConfig;\n this.interceptors = {\n request: new InterceptorManager(),\n response: new InterceptorManager()\n };\n}\n\n/**\n * Dispatch a request\n *\n * @param {Object} config The config specific for this request (merged with this.defaults)\n */\nAxios.prototype.request = function request(configOrUrl, config) {\n /*eslint no-param-reassign:0*/\n // Allow for axios('example/url'[, config]) a la fetch API\n if (typeof configOrUrl === 'string') {\n config = config || {};\n config.url = configOrUrl;\n } else {\n config = configOrUrl || {};\n }\n\n config = mergeConfig(this.defaults, config);\n\n // Set config.method\n if (config.method) {\n config.method = config.method.toLowerCase();\n } else if (this.defaults.method) {\n config.method = this.defaults.method.toLowerCase();\n } else {\n config.method = 'get';\n }\n\n var transitional = config.transitional;\n\n if (transitional !== undefined) {\n validator.assertOptions(transitional, {\n silentJSONParsing: validators.transitional(validators.boolean),\n forcedJSONParsing: validators.transitional(validators.boolean),\n clarifyTimeoutError: validators.transitional(validators.boolean)\n }, false);\n }\n\n // filter out skipped interceptors\n var requestInterceptorChain = [];\n var synchronousRequestInterceptors = true;\n this.interceptors.request.forEach(function unshiftRequestInterceptors(interceptor) {\n if (typeof interceptor.runWhen === 'function' && interceptor.runWhen(config) === false) {\n return;\n }\n\n synchronousRequestInterceptors = synchronousRequestInterceptors && interceptor.synchronous;\n\n requestInterceptorChain.unshift(interceptor.fulfilled, interceptor.rejected);\n });\n\n var responseInterceptorChain = [];\n this.interceptors.response.forEach(function pushResponseInterceptors(interceptor) {\n responseInterceptorChain.push(interceptor.fulfilled, interceptor.rejected);\n });\n\n var promise;\n\n if (!synchronousRequestInterceptors) {\n var chain = [dispatchRequest, undefined];\n\n Array.prototype.unshift.apply(chain, requestInterceptorChain);\n chain = chain.concat(responseInterceptorChain);\n\n promise = Promise.resolve(config);\n while (chain.length) {\n promise = promise.then(chain.shift(), chain.shift());\n }\n\n return promise;\n }\n\n\n var newConfig = config;\n while (requestInterceptorChain.length) {\n var onFulfilled = requestInterceptorChain.shift();\n var onRejected = requestInterceptorChain.shift();\n try {\n newConfig = onFulfilled(newConfig);\n } catch (error) {\n onRejected(error);\n break;\n }\n }\n\n try {\n promise = dispatchRequest(newConfig);\n } catch (error) {\n return Promise.reject(error);\n }\n\n while (responseInterceptorChain.length) {\n promise = promise.then(responseInterceptorChain.shift(), responseInterceptorChain.shift());\n }\n\n return promise;\n};\n\nAxios.prototype.getUri = function getUri(config) {\n config = mergeConfig(this.defaults, config);\n var fullPath = buildFullPath(config.baseURL, config.url);\n return buildURL(fullPath, config.params, config.paramsSerializer);\n};\n\n// Provide aliases for supported request methods\nutils.forEach(['delete', 'get', 'head', 'options'], function forEachMethodNoData(method) {\n /*eslint func-names:0*/\n Axios.prototype[method] = function(url, config) {\n return this.request(mergeConfig(config || {}, {\n method: method,\n url: url,\n data: (config || {}).data\n }));\n };\n});\n\nutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n /*eslint func-names:0*/\n\n function generateHTTPMethod(isForm) {\n return function httpMethod(url, data, config) {\n return this.request(mergeConfig(config || {}, {\n method: method,\n headers: isForm ? {\n 'Content-Type': 'multipart/form-data'\n } : {},\n url: url,\n data: data\n }));\n };\n }\n\n Axios.prototype[method] = generateHTTPMethod();\n\n Axios.prototype[method + 'Form'] = generateHTTPMethod(true);\n});\n\nmodule.exports = Axios;\n","'use strict';\n\nvar utils = require('../utils');\n\n/**\n * Create an Error with the specified message, config, error code, request and response.\n *\n * @param {string} message The error message.\n * @param {string} [code] The error code (for example, 'ECONNABORTED').\n * @param {Object} [config] The config.\n * @param {Object} [request] The request.\n * @param {Object} [response] The response.\n * @returns {Error} The created error.\n */\nfunction AxiosError(message, code, config, request, response) {\n Error.call(this);\n this.message = message;\n this.name = 'AxiosError';\n code && (this.code = code);\n config && (this.config = config);\n request && (this.request = request);\n response && (this.response = response);\n}\n\nutils.inherits(AxiosError, Error, {\n toJSON: function toJSON() {\n return {\n // Standard\n message: this.message,\n name: this.name,\n // Microsoft\n description: this.description,\n number: this.number,\n // Mozilla\n fileName: this.fileName,\n lineNumber: this.lineNumber,\n columnNumber: this.columnNumber,\n stack: this.stack,\n // Axios\n config: this.config,\n code: this.code,\n status: this.response && this.response.status ? this.response.status : null\n };\n }\n});\n\nvar prototype = AxiosError.prototype;\nvar descriptors = {};\n\n[\n 'ERR_BAD_OPTION_VALUE',\n 'ERR_BAD_OPTION',\n 'ECONNABORTED',\n 'ETIMEDOUT',\n 'ERR_NETWORK',\n 'ERR_FR_TOO_MANY_REDIRECTS',\n 'ERR_DEPRECATED',\n 'ERR_BAD_RESPONSE',\n 'ERR_BAD_REQUEST',\n 'ERR_CANCELED'\n// eslint-disable-next-line func-names\n].forEach(function(code) {\n descriptors[code] = {value: code};\n});\n\nObject.defineProperties(AxiosError, descriptors);\nObject.defineProperty(prototype, 'isAxiosError', {value: true});\n\n// eslint-disable-next-line func-names\nAxiosError.from = function(error, code, config, request, response, customProps) {\n var axiosError = Object.create(prototype);\n\n utils.toFlatObject(error, axiosError, function filter(obj) {\n return obj !== Error.prototype;\n });\n\n AxiosError.call(axiosError, error.message, code, config, request, response);\n\n axiosError.name = error.name;\n\n customProps && Object.assign(axiosError, customProps);\n\n return axiosError;\n};\n\nmodule.exports = AxiosError;\n","'use strict';\n\nvar utils = require('./../utils');\n\nfunction InterceptorManager() {\n this.handlers = [];\n}\n\n/**\n * Add a new interceptor to the stack\n *\n * @param {Function} fulfilled The function to handle `then` for a `Promise`\n * @param {Function} rejected The function to handle `reject` for a `Promise`\n *\n * @return {Number} An ID used to remove interceptor later\n */\nInterceptorManager.prototype.use = function use(fulfilled, rejected, options) {\n this.handlers.push({\n fulfilled: fulfilled,\n rejected: rejected,\n synchronous: options ? options.synchronous : false,\n runWhen: options ? options.runWhen : null\n });\n return this.handlers.length - 1;\n};\n\n/**\n * Remove an interceptor from the stack\n *\n * @param {Number} id The ID that was returned by `use`\n */\nInterceptorManager.prototype.eject = function eject(id) {\n if (this.handlers[id]) {\n this.handlers[id] = null;\n }\n};\n\n/**\n * Iterate over all the registered interceptors\n *\n * This method is particularly useful for skipping over any\n * interceptors that may have become `null` calling `eject`.\n *\n * @param {Function} fn The function to call for each interceptor\n */\nInterceptorManager.prototype.forEach = function forEach(fn) {\n utils.forEach(this.handlers, function forEachHandler(h) {\n if (h !== null) {\n fn(h);\n }\n });\n};\n\nmodule.exports = InterceptorManager;\n","'use strict';\n\nvar isAbsoluteURL = require('../helpers/isAbsoluteURL');\nvar combineURLs = require('../helpers/combineURLs');\n\n/**\n * Creates a new URL by combining the baseURL with the requestedURL,\n * only when the requestedURL is not already an absolute URL.\n * If the requestURL is absolute, this function returns the requestedURL untouched.\n *\n * @param {string} baseURL The base URL\n * @param {string} requestedURL Absolute or relative URL to combine\n * @returns {string} The combined full path\n */\nmodule.exports = function buildFullPath(baseURL, requestedURL) {\n if (baseURL && !isAbsoluteURL(requestedURL)) {\n return combineURLs(baseURL, requestedURL);\n }\n return requestedURL;\n};\n","'use strict';\n\nvar utils = require('./../utils');\nvar transformData = require('./transformData');\nvar isCancel = require('../cancel/isCancel');\nvar defaults = require('../defaults');\nvar CanceledError = require('../cancel/CanceledError');\n\n/**\n * Throws a `CanceledError` if cancellation has been requested.\n */\nfunction throwIfCancellationRequested(config) {\n if (config.cancelToken) {\n config.cancelToken.throwIfRequested();\n }\n\n if (config.signal && config.signal.aborted) {\n throw new CanceledError();\n }\n}\n\n/**\n * Dispatch a request to the server using the configured adapter.\n *\n * @param {object} config The config that is to be used for the request\n * @returns {Promise} The Promise to be fulfilled\n */\nmodule.exports = function dispatchRequest(config) {\n throwIfCancellationRequested(config);\n\n // Ensure headers exist\n config.headers = config.headers || {};\n\n // Transform request data\n config.data = transformData.call(\n config,\n config.data,\n config.headers,\n config.transformRequest\n );\n\n // Flatten headers\n config.headers = utils.merge(\n config.headers.common || {},\n config.headers[config.method] || {},\n config.headers\n );\n\n utils.forEach(\n ['delete', 'get', 'head', 'post', 'put', 'patch', 'common'],\n function cleanHeaderConfig(method) {\n delete config.headers[method];\n }\n );\n\n var adapter = config.adapter || defaults.adapter;\n\n return adapter(config).then(function onAdapterResolution(response) {\n throwIfCancellationRequested(config);\n\n // Transform response data\n response.data = transformData.call(\n config,\n response.data,\n response.headers,\n config.transformResponse\n );\n\n return response;\n }, function onAdapterRejection(reason) {\n if (!isCancel(reason)) {\n throwIfCancellationRequested(config);\n\n // Transform response data\n if (reason && reason.response) {\n reason.response.data = transformData.call(\n config,\n reason.response.data,\n reason.response.headers,\n config.transformResponse\n );\n }\n }\n\n return Promise.reject(reason);\n });\n};\n","'use strict';\n\nvar utils = require('../utils');\n\n/**\n * Config-specific merge-function which creates a new config-object\n * by merging two configuration objects together.\n *\n * @param {Object} config1\n * @param {Object} config2\n * @returns {Object} New object resulting from merging config2 to config1\n */\nmodule.exports = function mergeConfig(config1, config2) {\n // eslint-disable-next-line no-param-reassign\n config2 = config2 || {};\n var config = {};\n\n function getMergedValue(target, source) {\n if (utils.isPlainObject(target) && utils.isPlainObject(source)) {\n return utils.merge(target, source);\n } else if (utils.isPlainObject(source)) {\n return utils.merge({}, source);\n } else if (utils.isArray(source)) {\n return source.slice();\n }\n return source;\n }\n\n // eslint-disable-next-line consistent-return\n function mergeDeepProperties(prop) {\n if (!utils.isUndefined(config2[prop])) {\n return getMergedValue(config1[prop], config2[prop]);\n } else if (!utils.isUndefined(config1[prop])) {\n return getMergedValue(undefined, config1[prop]);\n }\n }\n\n // eslint-disable-next-line consistent-return\n function valueFromConfig2(prop) {\n if (!utils.isUndefined(config2[prop])) {\n return getMergedValue(undefined, config2[prop]);\n }\n }\n\n // eslint-disable-next-line consistent-return\n function defaultToConfig2(prop) {\n if (!utils.isUndefined(config2[prop])) {\n return getMergedValue(undefined, config2[prop]);\n } else if (!utils.isUndefined(config1[prop])) {\n return getMergedValue(undefined, config1[prop]);\n }\n }\n\n // eslint-disable-next-line consistent-return\n function mergeDirectKeys(prop) {\n if (prop in config2) {\n return getMergedValue(config1[prop], config2[prop]);\n } else if (prop in config1) {\n return getMergedValue(undefined, config1[prop]);\n }\n }\n\n var mergeMap = {\n 'url': valueFromConfig2,\n 'method': valueFromConfig2,\n 'data': valueFromConfig2,\n 'baseURL': defaultToConfig2,\n 'transformRequest': defaultToConfig2,\n 'transformResponse': defaultToConfig2,\n 'paramsSerializer': defaultToConfig2,\n 'timeout': defaultToConfig2,\n 'timeoutMessage': defaultToConfig2,\n 'withCredentials': defaultToConfig2,\n 'adapter': defaultToConfig2,\n 'responseType': defaultToConfig2,\n 'xsrfCookieName': defaultToConfig2,\n 'xsrfHeaderName': defaultToConfig2,\n 'onUploadProgress': defaultToConfig2,\n 'onDownloadProgress': defaultToConfig2,\n 'decompress': defaultToConfig2,\n 'maxContentLength': defaultToConfig2,\n 'maxBodyLength': defaultToConfig2,\n 'beforeRedirect': defaultToConfig2,\n 'transport': defaultToConfig2,\n 'httpAgent': defaultToConfig2,\n 'httpsAgent': defaultToConfig2,\n 'cancelToken': defaultToConfig2,\n 'socketPath': defaultToConfig2,\n 'responseEncoding': defaultToConfig2,\n 'validateStatus': mergeDirectKeys\n };\n\n utils.forEach(Object.keys(config1).concat(Object.keys(config2)), function computeConfigValue(prop) {\n var merge = mergeMap[prop] || mergeDeepProperties;\n var configValue = merge(prop);\n (utils.isUndefined(configValue) && merge !== mergeDirectKeys) || (config[prop] = configValue);\n });\n\n return config;\n};\n","'use strict';\n\nvar AxiosError = require('./AxiosError');\n\n/**\n * Resolve or reject a Promise based on response status.\n *\n * @param {Function} resolve A function that resolves the promise.\n * @param {Function} reject A function that rejects the promise.\n * @param {object} response The response.\n */\nmodule.exports = function settle(resolve, reject, response) {\n var validateStatus = response.config.validateStatus;\n if (!response.status || !validateStatus || validateStatus(response.status)) {\n resolve(response);\n } else {\n reject(new AxiosError(\n 'Request failed with status code ' + response.status,\n [AxiosError.ERR_BAD_REQUEST, AxiosError.ERR_BAD_RESPONSE][Math.floor(response.status / 100) - 4],\n response.config,\n response.request,\n response\n ));\n }\n};\n","'use strict';\n\nvar utils = require('./../utils');\nvar defaults = require('../defaults');\n\n/**\n * Transform the data for a request or a response\n *\n * @param {Object|String} data The data to be transformed\n * @param {Array} headers The headers for the request or response\n * @param {Array|Function} fns A single function or Array of functions\n * @returns {*} The resulting transformed data\n */\nmodule.exports = function transformData(data, headers, fns) {\n var context = this || defaults;\n /*eslint no-param-reassign:0*/\n utils.forEach(fns, function transform(fn) {\n data = fn.call(context, data, headers);\n });\n\n return data;\n};\n","'use strict';\n\nvar utils = require('../utils');\nvar normalizeHeaderName = require('../helpers/normalizeHeaderName');\nvar AxiosError = require('../core/AxiosError');\nvar transitionalDefaults = require('./transitional');\nvar toFormData = require('../helpers/toFormData');\n\nvar DEFAULT_CONTENT_TYPE = {\n 'Content-Type': 'application/x-www-form-urlencoded'\n};\n\nfunction setContentTypeIfUnset(headers, value) {\n if (!utils.isUndefined(headers) && utils.isUndefined(headers['Content-Type'])) {\n headers['Content-Type'] = value;\n }\n}\n\nfunction getDefaultAdapter() {\n var adapter;\n if (typeof XMLHttpRequest !== 'undefined') {\n // For browsers use XHR adapter\n adapter = require('../adapters/xhr');\n } else if (typeof process !== 'undefined' && Object.prototype.toString.call(process) === '[object process]') {\n // For node use HTTP adapter\n adapter = require('../adapters/http');\n }\n return adapter;\n}\n\nfunction stringifySafely(rawValue, parser, encoder) {\n if (utils.isString(rawValue)) {\n try {\n (parser || JSON.parse)(rawValue);\n return utils.trim(rawValue);\n } catch (e) {\n if (e.name !== 'SyntaxError') {\n throw e;\n }\n }\n }\n\n return (encoder || JSON.stringify)(rawValue);\n}\n\nvar defaults = {\n\n transitional: transitionalDefaults,\n\n adapter: getDefaultAdapter(),\n\n transformRequest: [function transformRequest(data, headers) {\n normalizeHeaderName(headers, 'Accept');\n normalizeHeaderName(headers, 'Content-Type');\n\n if (utils.isFormData(data) ||\n utils.isArrayBuffer(data) ||\n utils.isBuffer(data) ||\n utils.isStream(data) ||\n utils.isFile(data) ||\n utils.isBlob(data)\n ) {\n return data;\n }\n if (utils.isArrayBufferView(data)) {\n return data.buffer;\n }\n if (utils.isURLSearchParams(data)) {\n setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8');\n return data.toString();\n }\n\n var isObjectPayload = utils.isObject(data);\n var contentType = headers && headers['Content-Type'];\n\n var isFileList;\n\n if ((isFileList = utils.isFileList(data)) || (isObjectPayload && contentType === 'multipart/form-data')) {\n var _FormData = this.env && this.env.FormData;\n return toFormData(isFileList ? {'files[]': data} : data, _FormData && new _FormData());\n } else if (isObjectPayload || contentType === 'application/json') {\n setContentTypeIfUnset(headers, 'application/json');\n return stringifySafely(data);\n }\n\n return data;\n }],\n\n transformResponse: [function transformResponse(data) {\n var transitional = this.transitional || defaults.transitional;\n var silentJSONParsing = transitional && transitional.silentJSONParsing;\n var forcedJSONParsing = transitional && transitional.forcedJSONParsing;\n var strictJSONParsing = !silentJSONParsing && this.responseType === 'json';\n\n if (strictJSONParsing || (forcedJSONParsing && utils.isString(data) && data.length)) {\n try {\n return JSON.parse(data);\n } catch (e) {\n if (strictJSONParsing) {\n if (e.name === 'SyntaxError') {\n throw AxiosError.from(e, AxiosError.ERR_BAD_RESPONSE, this, null, this.response);\n }\n throw e;\n }\n }\n }\n\n return data;\n }],\n\n /**\n * A timeout in milliseconds to abort a request. If set to 0 (default) a\n * timeout is not created.\n */\n timeout: 0,\n\n xsrfCookieName: 'XSRF-TOKEN',\n xsrfHeaderName: 'X-XSRF-TOKEN',\n\n maxContentLength: -1,\n maxBodyLength: -1,\n\n env: {\n FormData: require('./env/FormData')\n },\n\n validateStatus: function validateStatus(status) {\n return status >= 200 && status < 300;\n },\n\n headers: {\n common: {\n 'Accept': 'application/json, text/plain, */*'\n }\n }\n};\n\nutils.forEach(['delete', 'get', 'head'], function forEachMethodNoData(method) {\n defaults.headers[method] = {};\n});\n\nutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n defaults.headers[method] = utils.merge(DEFAULT_CONTENT_TYPE);\n});\n\nmodule.exports = defaults;\n","'use strict';\n\nmodule.exports = {\n silentJSONParsing: true,\n forcedJSONParsing: true,\n clarifyTimeoutError: false\n};\n","module.exports = {\n \"version\": \"0.27.2\"\n};","'use strict';\n\nmodule.exports = function bind(fn, thisArg) {\n return function wrap() {\n var args = new Array(arguments.length);\n for (var i = 0; i < args.length; i++) {\n args[i] = arguments[i];\n }\n return fn.apply(thisArg, args);\n };\n};\n","'use strict';\n\nvar utils = require('./../utils');\n\nfunction encode(val) {\n return encodeURIComponent(val).\n replace(/%3A/gi, ':').\n replace(/%24/g, '$').\n replace(/%2C/gi, ',').\n replace(/%20/g, '+').\n replace(/%5B/gi, '[').\n replace(/%5D/gi, ']');\n}\n\n/**\n * Build a URL by appending params to the end\n *\n * @param {string} url The base of the url (e.g., http://www.google.com)\n * @param {object} [params] The params to be appended\n * @returns {string} The formatted url\n */\nmodule.exports = function buildURL(url, params, paramsSerializer) {\n /*eslint no-param-reassign:0*/\n if (!params) {\n return url;\n }\n\n var serializedParams;\n if (paramsSerializer) {\n serializedParams = paramsSerializer(params);\n } else if (utils.isURLSearchParams(params)) {\n serializedParams = params.toString();\n } else {\n var parts = [];\n\n utils.forEach(params, function serialize(val, key) {\n if (val === null || typeof val === 'undefined') {\n return;\n }\n\n if (utils.isArray(val)) {\n key = key + '[]';\n } else {\n val = [val];\n }\n\n utils.forEach(val, function parseValue(v) {\n if (utils.isDate(v)) {\n v = v.toISOString();\n } else if (utils.isObject(v)) {\n v = JSON.stringify(v);\n }\n parts.push(encode(key) + '=' + encode(v));\n });\n });\n\n serializedParams = parts.join('&');\n }\n\n if (serializedParams) {\n var hashmarkIndex = url.indexOf('#');\n if (hashmarkIndex !== -1) {\n url = url.slice(0, hashmarkIndex);\n }\n\n url += (url.indexOf('?') === -1 ? '?' : '&') + serializedParams;\n }\n\n return url;\n};\n","'use strict';\n\n/**\n * Creates a new URL by combining the specified URLs\n *\n * @param {string} baseURL The base URL\n * @param {string} relativeURL The relative URL\n * @returns {string} The combined URL\n */\nmodule.exports = function combineURLs(baseURL, relativeURL) {\n return relativeURL\n ? baseURL.replace(/\\/+$/, '') + '/' + relativeURL.replace(/^\\/+/, '')\n : baseURL;\n};\n","'use strict';\n\nvar utils = require('./../utils');\n\nmodule.exports = (\n utils.isStandardBrowserEnv() ?\n\n // Standard browser envs support document.cookie\n (function standardBrowserEnv() {\n return {\n write: function write(name, value, expires, path, domain, secure) {\n var cookie = [];\n cookie.push(name + '=' + encodeURIComponent(value));\n\n if (utils.isNumber(expires)) {\n cookie.push('expires=' + new Date(expires).toGMTString());\n }\n\n if (utils.isString(path)) {\n cookie.push('path=' + path);\n }\n\n if (utils.isString(domain)) {\n cookie.push('domain=' + domain);\n }\n\n if (secure === true) {\n cookie.push('secure');\n }\n\n document.cookie = cookie.join('; ');\n },\n\n read: function read(name) {\n var match = document.cookie.match(new RegExp('(^|;\\\\s*)(' + name + ')=([^;]*)'));\n return (match ? decodeURIComponent(match[3]) : null);\n },\n\n remove: function remove(name) {\n this.write(name, '', Date.now() - 86400000);\n }\n };\n })() :\n\n // Non standard browser env (web workers, react-native) lack needed support.\n (function nonStandardBrowserEnv() {\n return {\n write: function write() {},\n read: function read() { return null; },\n remove: function remove() {}\n };\n })()\n);\n","'use strict';\n\n/**\n * Determines whether the specified URL is absolute\n *\n * @param {string} url The URL to test\n * @returns {boolean} True if the specified URL is absolute, otherwise false\n */\nmodule.exports = function isAbsoluteURL(url) {\n // A URL is considered absolute if it begins with \"://\" or \"//\" (protocol-relative URL).\n // RFC 3986 defines scheme name as a sequence of characters beginning with a letter and followed\n // by any combination of letters, digits, plus, period, or hyphen.\n return /^([a-z][a-z\\d+\\-.]*:)?\\/\\//i.test(url);\n};\n","'use strict';\n\nvar utils = require('./../utils');\n\n/**\n * Determines whether the payload is an error thrown by Axios\n *\n * @param {*} payload The value to test\n * @returns {boolean} True if the payload is an error thrown by Axios, otherwise false\n */\nmodule.exports = function isAxiosError(payload) {\n return utils.isObject(payload) && (payload.isAxiosError === true);\n};\n","'use strict';\n\nvar utils = require('./../utils');\n\nmodule.exports = (\n utils.isStandardBrowserEnv() ?\n\n // Standard browser envs have full support of the APIs needed to test\n // whether the request URL is of the same origin as current location.\n (function standardBrowserEnv() {\n var msie = /(msie|trident)/i.test(navigator.userAgent);\n var urlParsingNode = document.createElement('a');\n var originURL;\n\n /**\n * Parse a URL to discover it's components\n *\n * @param {String} url The URL to be parsed\n * @returns {Object}\n */\n function resolveURL(url) {\n var href = url;\n\n if (msie) {\n // IE needs attribute set twice to normalize properties\n urlParsingNode.setAttribute('href', href);\n href = urlParsingNode.href;\n }\n\n urlParsingNode.setAttribute('href', href);\n\n // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils\n return {\n href: urlParsingNode.href,\n protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '',\n host: urlParsingNode.host,\n search: urlParsingNode.search ? urlParsingNode.search.replace(/^\\?/, '') : '',\n hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '',\n hostname: urlParsingNode.hostname,\n port: urlParsingNode.port,\n pathname: (urlParsingNode.pathname.charAt(0) === '/') ?\n urlParsingNode.pathname :\n '/' + urlParsingNode.pathname\n };\n }\n\n originURL = resolveURL(window.location.href);\n\n /**\n * Determine if a URL shares the same origin as the current location\n *\n * @param {String} requestURL The URL to test\n * @returns {boolean} True if URL shares the same origin, otherwise false\n */\n return function isURLSameOrigin(requestURL) {\n var parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL;\n return (parsed.protocol === originURL.protocol &&\n parsed.host === originURL.host);\n };\n })() :\n\n // Non standard browser envs (web workers, react-native) lack needed support.\n (function nonStandardBrowserEnv() {\n return function isURLSameOrigin() {\n return true;\n };\n })()\n);\n","'use strict';\n\nvar utils = require('../utils');\n\nmodule.exports = function normalizeHeaderName(headers, normalizedName) {\n utils.forEach(headers, function processHeader(value, name) {\n if (name !== normalizedName && name.toUpperCase() === normalizedName.toUpperCase()) {\n headers[normalizedName] = value;\n delete headers[name];\n }\n });\n};\n","// eslint-disable-next-line strict\nmodule.exports = null;\n","'use strict';\n\nvar utils = require('./../utils');\n\n// Headers whose duplicates are ignored by node\n// c.f. https://nodejs.org/api/http.html#http_message_headers\nvar ignoreDuplicateOf = [\n 'age', 'authorization', 'content-length', 'content-type', 'etag',\n 'expires', 'from', 'host', 'if-modified-since', 'if-unmodified-since',\n 'last-modified', 'location', 'max-forwards', 'proxy-authorization',\n 'referer', 'retry-after', 'user-agent'\n];\n\n/**\n * Parse headers into an object\n *\n * ```\n * Date: Wed, 27 Aug 2014 08:58:49 GMT\n * Content-Type: application/json\n * Connection: keep-alive\n * Transfer-Encoding: chunked\n * ```\n *\n * @param {String} headers Headers needing to be parsed\n * @returns {Object} Headers parsed into an object\n */\nmodule.exports = function parseHeaders(headers) {\n var parsed = {};\n var key;\n var val;\n var i;\n\n if (!headers) { return parsed; }\n\n utils.forEach(headers.split('\\n'), function parser(line) {\n i = line.indexOf(':');\n key = utils.trim(line.substr(0, i)).toLowerCase();\n val = utils.trim(line.substr(i + 1));\n\n if (key) {\n if (parsed[key] && ignoreDuplicateOf.indexOf(key) >= 0) {\n return;\n }\n if (key === 'set-cookie') {\n parsed[key] = (parsed[key] ? parsed[key] : []).concat([val]);\n } else {\n parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val;\n }\n }\n });\n\n return parsed;\n};\n","'use strict';\n\nmodule.exports = function parseProtocol(url) {\n var match = /^([-+\\w]{1,25})(:?\\/\\/|:)/.exec(url);\n return match && match[1] || '';\n};\n","'use strict';\n\n/**\n * Syntactic sugar for invoking a function and expanding an array for arguments.\n *\n * Common use case would be to use `Function.prototype.apply`.\n *\n * ```js\n * function f(x, y, z) {}\n * var args = [1, 2, 3];\n * f.apply(null, args);\n * ```\n *\n * With `spread` this example can be re-written.\n *\n * ```js\n * spread(function(x, y, z) {})([1, 2, 3]);\n * ```\n *\n * @param {Function} callback\n * @returns {Function}\n */\nmodule.exports = function spread(callback) {\n return function wrap(arr) {\n return callback.apply(null, arr);\n };\n};\n","'use strict';\n\nvar utils = require('../utils');\n\n/**\n * Convert a data object to FormData\n * @param {Object} obj\n * @param {?Object} [formData]\n * @returns {Object}\n **/\n\nfunction toFormData(obj, formData) {\n // eslint-disable-next-line no-param-reassign\n formData = formData || new FormData();\n\n var stack = [];\n\n function convertValue(value) {\n if (value === null) return '';\n\n if (utils.isDate(value)) {\n return value.toISOString();\n }\n\n if (utils.isArrayBuffer(value) || utils.isTypedArray(value)) {\n return typeof Blob === 'function' ? new Blob([value]) : Buffer.from(value);\n }\n\n return value;\n }\n\n function build(data, parentKey) {\n if (utils.isPlainObject(data) || utils.isArray(data)) {\n if (stack.indexOf(data) !== -1) {\n throw Error('Circular reference detected in ' + parentKey);\n }\n\n stack.push(data);\n\n utils.forEach(data, function each(value, key) {\n if (utils.isUndefined(value)) return;\n var fullKey = parentKey ? parentKey + '.' + key : key;\n var arr;\n\n if (value && !parentKey && typeof value === 'object') {\n if (utils.endsWith(key, '{}')) {\n // eslint-disable-next-line no-param-reassign\n value = JSON.stringify(value);\n } else if (utils.endsWith(key, '[]') && (arr = utils.toArray(value))) {\n // eslint-disable-next-line func-names\n arr.forEach(function(el) {\n !utils.isUndefined(el) && formData.append(fullKey, convertValue(el));\n });\n return;\n }\n }\n\n build(value, fullKey);\n });\n\n stack.pop();\n } else {\n formData.append(parentKey, convertValue(data));\n }\n }\n\n build(obj);\n\n return formData;\n}\n\nmodule.exports = toFormData;\n","'use strict';\n\nvar VERSION = require('../env/data').version;\nvar AxiosError = require('../core/AxiosError');\n\nvar validators = {};\n\n// eslint-disable-next-line func-names\n['object', 'boolean', 'number', 'function', 'string', 'symbol'].forEach(function(type, i) {\n validators[type] = function validator(thing) {\n return typeof thing === type || 'a' + (i < 1 ? 'n ' : ' ') + type;\n };\n});\n\nvar deprecatedWarnings = {};\n\n/**\n * Transitional option validator\n * @param {function|boolean?} validator - set to false if the transitional option has been removed\n * @param {string?} version - deprecated version / removed since version\n * @param {string?} message - some message with additional info\n * @returns {function}\n */\nvalidators.transitional = function transitional(validator, version, message) {\n function formatMessage(opt, desc) {\n return '[Axios v' + VERSION + '] Transitional option \\'' + opt + '\\'' + desc + (message ? '. ' + message : '');\n }\n\n // eslint-disable-next-line func-names\n return function(value, opt, opts) {\n if (validator === false) {\n throw new AxiosError(\n formatMessage(opt, ' has been removed' + (version ? ' in ' + version : '')),\n AxiosError.ERR_DEPRECATED\n );\n }\n\n if (version && !deprecatedWarnings[opt]) {\n deprecatedWarnings[opt] = true;\n // eslint-disable-next-line no-console\n console.warn(\n formatMessage(\n opt,\n ' has been deprecated since v' + version + ' and will be removed in the near future'\n )\n );\n }\n\n return validator ? validator(value, opt, opts) : true;\n };\n};\n\n/**\n * Assert object's properties type\n * @param {object} options\n * @param {object} schema\n * @param {boolean?} allowUnknown\n */\n\nfunction assertOptions(options, schema, allowUnknown) {\n if (typeof options !== 'object') {\n throw new AxiosError('options must be an object', AxiosError.ERR_BAD_OPTION_VALUE);\n }\n var keys = Object.keys(options);\n var i = keys.length;\n while (i-- > 0) {\n var opt = keys[i];\n var validator = schema[opt];\n if (validator) {\n var value = options[opt];\n var result = value === undefined || validator(value, opt, options);\n if (result !== true) {\n throw new AxiosError('option ' + opt + ' must be ' + result, AxiosError.ERR_BAD_OPTION_VALUE);\n }\n continue;\n }\n if (allowUnknown !== true) {\n throw new AxiosError('Unknown option ' + opt, AxiosError.ERR_BAD_OPTION);\n }\n }\n}\n\nmodule.exports = {\n assertOptions: assertOptions,\n validators: validators\n};\n","'use strict';\n\nvar bind = require('./helpers/bind');\n\n// utils is a library of generic helper functions non-specific to axios\n\nvar toString = Object.prototype.toString;\n\n// eslint-disable-next-line func-names\nvar kindOf = (function(cache) {\n // eslint-disable-next-line func-names\n return function(thing) {\n var str = toString.call(thing);\n return cache[str] || (cache[str] = str.slice(8, -1).toLowerCase());\n };\n})(Object.create(null));\n\nfunction kindOfTest(type) {\n type = type.toLowerCase();\n return function isKindOf(thing) {\n return kindOf(thing) === type;\n };\n}\n\n/**\n * Determine if a value is an Array\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an Array, otherwise false\n */\nfunction isArray(val) {\n return Array.isArray(val);\n}\n\n/**\n * Determine if a value is undefined\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if the value is undefined, otherwise false\n */\nfunction isUndefined(val) {\n return typeof val === 'undefined';\n}\n\n/**\n * Determine if a value is a Buffer\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Buffer, otherwise false\n */\nfunction isBuffer(val) {\n return val !== null && !isUndefined(val) && val.constructor !== null && !isUndefined(val.constructor)\n && typeof val.constructor.isBuffer === 'function' && val.constructor.isBuffer(val);\n}\n\n/**\n * Determine if a value is an ArrayBuffer\n *\n * @function\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an ArrayBuffer, otherwise false\n */\nvar isArrayBuffer = kindOfTest('ArrayBuffer');\n\n\n/**\n * Determine if a value is a view on an ArrayBuffer\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a view on an ArrayBuffer, otherwise false\n */\nfunction isArrayBufferView(val) {\n var result;\n if ((typeof ArrayBuffer !== 'undefined') && (ArrayBuffer.isView)) {\n result = ArrayBuffer.isView(val);\n } else {\n result = (val) && (val.buffer) && (isArrayBuffer(val.buffer));\n }\n return result;\n}\n\n/**\n * Determine if a value is a String\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a String, otherwise false\n */\nfunction isString(val) {\n return typeof val === 'string';\n}\n\n/**\n * Determine if a value is a Number\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Number, otherwise false\n */\nfunction isNumber(val) {\n return typeof val === 'number';\n}\n\n/**\n * Determine if a value is an Object\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an Object, otherwise false\n */\nfunction isObject(val) {\n return val !== null && typeof val === 'object';\n}\n\n/**\n * Determine if a value is a plain Object\n *\n * @param {Object} val The value to test\n * @return {boolean} True if value is a plain Object, otherwise false\n */\nfunction isPlainObject(val) {\n if (kindOf(val) !== 'object') {\n return false;\n }\n\n var prototype = Object.getPrototypeOf(val);\n return prototype === null || prototype === Object.prototype;\n}\n\n/**\n * Determine if a value is a Date\n *\n * @function\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Date, otherwise false\n */\nvar isDate = kindOfTest('Date');\n\n/**\n * Determine if a value is a File\n *\n * @function\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a File, otherwise false\n */\nvar isFile = kindOfTest('File');\n\n/**\n * Determine if a value is a Blob\n *\n * @function\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Blob, otherwise false\n */\nvar isBlob = kindOfTest('Blob');\n\n/**\n * Determine if a value is a FileList\n *\n * @function\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a File, otherwise false\n */\nvar isFileList = kindOfTest('FileList');\n\n/**\n * Determine if a value is a Function\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Function, otherwise false\n */\nfunction isFunction(val) {\n return toString.call(val) === '[object Function]';\n}\n\n/**\n * Determine if a value is a Stream\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Stream, otherwise false\n */\nfunction isStream(val) {\n return isObject(val) && isFunction(val.pipe);\n}\n\n/**\n * Determine if a value is a FormData\n *\n * @param {Object} thing The value to test\n * @returns {boolean} True if value is an FormData, otherwise false\n */\nfunction isFormData(thing) {\n var pattern = '[object FormData]';\n return thing && (\n (typeof FormData === 'function' && thing instanceof FormData) ||\n toString.call(thing) === pattern ||\n (isFunction(thing.toString) && thing.toString() === pattern)\n );\n}\n\n/**\n * Determine if a value is a URLSearchParams object\n * @function\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a URLSearchParams object, otherwise false\n */\nvar isURLSearchParams = kindOfTest('URLSearchParams');\n\n/**\n * Trim excess whitespace off the beginning and end of a string\n *\n * @param {String} str The String to trim\n * @returns {String} The String freed of excess whitespace\n */\nfunction trim(str) {\n return str.trim ? str.trim() : str.replace(/^\\s+|\\s+$/g, '');\n}\n\n/**\n * Determine if we're running in a standard browser environment\n *\n * This allows axios to run in a web worker, and react-native.\n * Both environments support XMLHttpRequest, but not fully standard globals.\n *\n * web workers:\n * typeof window -> undefined\n * typeof document -> undefined\n *\n * react-native:\n * navigator.product -> 'ReactNative'\n * nativescript\n * navigator.product -> 'NativeScript' or 'NS'\n */\nfunction isStandardBrowserEnv() {\n if (typeof navigator !== 'undefined' && (navigator.product === 'ReactNative' ||\n navigator.product === 'NativeScript' ||\n navigator.product === 'NS')) {\n return false;\n }\n return (\n typeof window !== 'undefined' &&\n typeof document !== 'undefined'\n );\n}\n\n/**\n * Iterate over an Array or an Object invoking a function for each item.\n *\n * If `obj` is an Array callback will be called passing\n * the value, index, and complete array for each item.\n *\n * If 'obj' is an Object callback will be called passing\n * the value, key, and complete object for each property.\n *\n * @param {Object|Array} obj The object to iterate\n * @param {Function} fn The callback to invoke for each item\n */\nfunction forEach(obj, fn) {\n // Don't bother if no value provided\n if (obj === null || typeof obj === 'undefined') {\n return;\n }\n\n // Force an array if not already something iterable\n if (typeof obj !== 'object') {\n /*eslint no-param-reassign:0*/\n obj = [obj];\n }\n\n if (isArray(obj)) {\n // Iterate over array values\n for (var i = 0, l = obj.length; i < l; i++) {\n fn.call(null, obj[i], i, obj);\n }\n } else {\n // Iterate over object keys\n for (var key in obj) {\n if (Object.prototype.hasOwnProperty.call(obj, key)) {\n fn.call(null, obj[key], key, obj);\n }\n }\n }\n}\n\n/**\n * Accepts varargs expecting each argument to be an object, then\n * immutably merges the properties of each object and returns result.\n *\n * When multiple objects contain the same key the later object in\n * the arguments list will take precedence.\n *\n * Example:\n *\n * ```js\n * var result = merge({foo: 123}, {foo: 456});\n * console.log(result.foo); // outputs 456\n * ```\n *\n * @param {Object} obj1 Object to merge\n * @returns {Object} Result of all merge properties\n */\nfunction merge(/* obj1, obj2, obj3, ... */) {\n var result = {};\n function assignValue(val, key) {\n if (isPlainObject(result[key]) && isPlainObject(val)) {\n result[key] = merge(result[key], val);\n } else if (isPlainObject(val)) {\n result[key] = merge({}, val);\n } else if (isArray(val)) {\n result[key] = val.slice();\n } else {\n result[key] = val;\n }\n }\n\n for (var i = 0, l = arguments.length; i < l; i++) {\n forEach(arguments[i], assignValue);\n }\n return result;\n}\n\n/**\n * Extends object a by mutably adding to it the properties of object b.\n *\n * @param {Object} a The object to be extended\n * @param {Object} b The object to copy properties from\n * @param {Object} thisArg The object to bind function to\n * @return {Object} The resulting value of object a\n */\nfunction extend(a, b, thisArg) {\n forEach(b, function assignValue(val, key) {\n if (thisArg && typeof val === 'function') {\n a[key] = bind(val, thisArg);\n } else {\n a[key] = val;\n }\n });\n return a;\n}\n\n/**\n * Remove byte order marker. This catches EF BB BF (the UTF-8 BOM)\n *\n * @param {string} content with BOM\n * @return {string} content value without BOM\n */\nfunction stripBOM(content) {\n if (content.charCodeAt(0) === 0xFEFF) {\n content = content.slice(1);\n }\n return content;\n}\n\n/**\n * Inherit the prototype methods from one constructor into another\n * @param {function} constructor\n * @param {function} superConstructor\n * @param {object} [props]\n * @param {object} [descriptors]\n */\n\nfunction inherits(constructor, superConstructor, props, descriptors) {\n constructor.prototype = Object.create(superConstructor.prototype, descriptors);\n constructor.prototype.constructor = constructor;\n props && Object.assign(constructor.prototype, props);\n}\n\n/**\n * Resolve object with deep prototype chain to a flat object\n * @param {Object} sourceObj source object\n * @param {Object} [destObj]\n * @param {Function} [filter]\n * @returns {Object}\n */\n\nfunction toFlatObject(sourceObj, destObj, filter) {\n var props;\n var i;\n var prop;\n var merged = {};\n\n destObj = destObj || {};\n\n do {\n props = Object.getOwnPropertyNames(sourceObj);\n i = props.length;\n while (i-- > 0) {\n prop = props[i];\n if (!merged[prop]) {\n destObj[prop] = sourceObj[prop];\n merged[prop] = true;\n }\n }\n sourceObj = Object.getPrototypeOf(sourceObj);\n } while (sourceObj && (!filter || filter(sourceObj, destObj)) && sourceObj !== Object.prototype);\n\n return destObj;\n}\n\n/*\n * determines whether a string ends with the characters of a specified string\n * @param {String} str\n * @param {String} searchString\n * @param {Number} [position= 0]\n * @returns {boolean}\n */\nfunction endsWith(str, searchString, position) {\n str = String(str);\n if (position === undefined || position > str.length) {\n position = str.length;\n }\n position -= searchString.length;\n var lastIndex = str.indexOf(searchString, position);\n return lastIndex !== -1 && lastIndex === position;\n}\n\n\n/**\n * Returns new array from array like object\n * @param {*} [thing]\n * @returns {Array}\n */\nfunction toArray(thing) {\n if (!thing) return null;\n var i = thing.length;\n if (isUndefined(i)) return null;\n var arr = new Array(i);\n while (i-- > 0) {\n arr[i] = thing[i];\n }\n return arr;\n}\n\n// eslint-disable-next-line func-names\nvar isTypedArray = (function(TypedArray) {\n // eslint-disable-next-line func-names\n return function(thing) {\n return TypedArray && thing instanceof TypedArray;\n };\n})(typeof Uint8Array !== 'undefined' && Object.getPrototypeOf(Uint8Array));\n\nmodule.exports = {\n isArray: isArray,\n isArrayBuffer: isArrayBuffer,\n isBuffer: isBuffer,\n isFormData: isFormData,\n isArrayBufferView: isArrayBufferView,\n isString: isString,\n isNumber: isNumber,\n isObject: isObject,\n isPlainObject: isPlainObject,\n isUndefined: isUndefined,\n isDate: isDate,\n isFile: isFile,\n isBlob: isBlob,\n isFunction: isFunction,\n isStream: isStream,\n isURLSearchParams: isURLSearchParams,\n isStandardBrowserEnv: isStandardBrowserEnv,\n forEach: forEach,\n merge: merge,\n extend: extend,\n trim: trim,\n stripBOM: stripBOM,\n inherits: inherits,\n toFlatObject: toFlatObject,\n kindOf: kindOf,\n kindOfTest: kindOfTest,\n endsWith: endsWith,\n toArray: toArray,\n isTypedArray: isTypedArray,\n isFileList: isFileList\n};\n"],"sourceRoot":""} \ No newline at end of file diff --git a/_nodejs/node_modules/axios/dist/axios.min.js b/_nodejs/node_modules/axios/dist/axios.min.js new file mode 100644 index 0000000..e8e4fc1 --- /dev/null +++ b/_nodejs/node_modules/axios/dist/axios.min.js @@ -0,0 +1,3 @@ +/* axios v0.27.2 | (c) 2022 by Matt Zabriskie */ +!function(e,t){"object"==typeof exports&&"object"==typeof module?module.exports=t():"function"==typeof define&&define.amd?define([],t):"object"==typeof exports?exports.axios=t():e.axios=t()}(this,(function(){return function(e){var t={};function n(r){if(t[r])return t[r].exports;var o=t[r]={i:r,l:!1,exports:{}};return e[r].call(o.exports,o,o.exports,n),o.l=!0,o.exports}return n.m=e,n.c=t,n.d=function(e,t,r){n.o(e,t)||Object.defineProperty(e,t,{enumerable:!0,get:r})},n.r=function(e){"undefined"!=typeof Symbol&&Symbol.toStringTag&&Object.defineProperty(e,Symbol.toStringTag,{value:"Module"}),Object.defineProperty(e,"__esModule",{value:!0})},n.t=function(e,t){if(1&t&&(e=n(e)),8&t)return e;if(4&t&&"object"==typeof e&&e&&e.__esModule)return e;var r=Object.create(null);if(n.r(r),Object.defineProperty(r,"default",{enumerable:!0,value:e}),2&t&&"string"!=typeof e)for(var o in e)n.d(r,o,function(t){return e[t]}.bind(null,o));return r},n.n=function(e){var t=e&&e.__esModule?function(){return e.default}:function(){return e};return n.d(t,"a",t),t},n.o=function(e,t){return Object.prototype.hasOwnProperty.call(e,t)},n.p="",n(n.s=13)}([function(e,t,n){"use strict";var r,o=n(4),i=Object.prototype.toString,s=(r=Object.create(null),function(e){var t=i.call(e);return r[t]||(r[t]=t.slice(8,-1).toLowerCase())});function a(e){return e=e.toLowerCase(),function(t){return s(t)===e}}function u(e){return Array.isArray(e)}function c(e){return void 0===e}var f=a("ArrayBuffer");function l(e){return null!==e&&"object"==typeof e}function p(e){if("object"!==s(e))return!1;var t=Object.getPrototypeOf(e);return null===t||t===Object.prototype}var d=a("Date"),h=a("File"),m=a("Blob"),v=a("FileList");function y(e){return"[object Function]"===i.call(e)}var g=a("URLSearchParams");function E(e,t){if(null!=e)if("object"!=typeof e&&(e=[e]),u(e))for(var n=0,r=e.length;n0;)s[i=r[o]]||(t[i]=e[i],s[i]=!0);e=Object.getPrototypeOf(e)}while(e&&(!n||n(e,t))&&e!==Object.prototype);return t},kindOf:s,kindOfTest:a,endsWith:function(e,t,n){e=String(e),(void 0===n||n>e.length)&&(n=e.length),n-=t.length;var r=e.indexOf(t,n);return-1!==r&&r===n},toArray:function(e){if(!e)return null;var t=e.length;if(c(t))return null;for(var n=new Array(t);t-- >0;)n[t]=e[t];return n},isTypedArray:O,isFileList:v}},function(e,t,n){"use strict";var r=n(0);function o(e,t,n,r,o){Error.call(this),this.message=e,this.name="AxiosError",t&&(this.code=t),n&&(this.config=n),r&&(this.request=r),o&&(this.response=o)}r.inherits(o,Error,{toJSON:function(){return{message:this.message,name:this.name,description:this.description,number:this.number,fileName:this.fileName,lineNumber:this.lineNumber,columnNumber:this.columnNumber,stack:this.stack,config:this.config,code:this.code,status:this.response&&this.response.status?this.response.status:null}}});var i=o.prototype,s={};["ERR_BAD_OPTION_VALUE","ERR_BAD_OPTION","ECONNABORTED","ETIMEDOUT","ERR_NETWORK","ERR_FR_TOO_MANY_REDIRECTS","ERR_DEPRECATED","ERR_BAD_RESPONSE","ERR_BAD_REQUEST","ERR_CANCELED"].forEach((function(e){s[e]={value:e}})),Object.defineProperties(o,s),Object.defineProperty(i,"isAxiosError",{value:!0}),o.from=function(e,t,n,s,a,u){var c=Object.create(i);return r.toFlatObject(e,c,(function(e){return e!==Error.prototype})),o.call(c,e.message,t,n,s,a),c.name=e.name,u&&Object.assign(c,u),c},e.exports=o},function(e,t,n){"use strict";var r=n(1);function o(e){r.call(this,null==e?"canceled":e,r.ERR_CANCELED),this.name="CanceledError"}n(0).inherits(o,r,{__CANCEL__:!0}),e.exports=o},function(e,t,n){"use strict";var r=n(0),o=n(19),i=n(1),s=n(6),a=n(7),u={"Content-Type":"application/x-www-form-urlencoded"};function c(e,t){!r.isUndefined(e)&&r.isUndefined(e["Content-Type"])&&(e["Content-Type"]=t)}var f,l={transitional:s,adapter:(("undefined"!=typeof XMLHttpRequest||"undefined"!=typeof process&&"[object process]"===Object.prototype.toString.call(process))&&(f=n(8)),f),transformRequest:[function(e,t){if(o(t,"Accept"),o(t,"Content-Type"),r.isFormData(e)||r.isArrayBuffer(e)||r.isBuffer(e)||r.isStream(e)||r.isFile(e)||r.isBlob(e))return e;if(r.isArrayBufferView(e))return e.buffer;if(r.isURLSearchParams(e))return c(t,"application/x-www-form-urlencoded;charset=utf-8"),e.toString();var n,i=r.isObject(e),s=t&&t["Content-Type"];if((n=r.isFileList(e))||i&&"multipart/form-data"===s){var u=this.env&&this.env.FormData;return a(n?{"files[]":e}:e,u&&new u)}return i||"application/json"===s?(c(t,"application/json"),function(e,t,n){if(r.isString(e))try{return(t||JSON.parse)(e),r.trim(e)}catch(e){if("SyntaxError"!==e.name)throw e}return(n||JSON.stringify)(e)}(e)):e}],transformResponse:[function(e){var t=this.transitional||l.transitional,n=t&&t.silentJSONParsing,o=t&&t.forcedJSONParsing,s=!n&&"json"===this.responseType;if(s||o&&r.isString(e)&&e.length)try{return JSON.parse(e)}catch(e){if(s){if("SyntaxError"===e.name)throw i.from(e,i.ERR_BAD_RESPONSE,this,null,this.response);throw e}}return e}],timeout:0,xsrfCookieName:"XSRF-TOKEN",xsrfHeaderName:"X-XSRF-TOKEN",maxContentLength:-1,maxBodyLength:-1,env:{FormData:n(27)},validateStatus:function(e){return e>=200&&e<300},headers:{common:{Accept:"application/json, text/plain, */*"}}};r.forEach(["delete","get","head"],(function(e){l.headers[e]={}})),r.forEach(["post","put","patch"],(function(e){l.headers[e]=r.merge(u)})),e.exports=l},function(e,t,n){"use strict";e.exports=function(e,t){return function(){for(var n=new Array(arguments.length),r=0;r=0)return;s[t]="set-cookie"===t?(s[t]?s[t]:[]).concat([n]):s[t]?s[t]+", "+n:n}})),s):s}},function(e,t,n){"use strict";var r=n(0);e.exports=r.isStandardBrowserEnv()?function(){var e,t=/(msie|trident)/i.test(navigator.userAgent),n=document.createElement("a");function o(e){var r=e;return t&&(n.setAttribute("href",r),r=n.href),n.setAttribute("href",r),{href:n.href,protocol:n.protocol?n.protocol.replace(/:$/,""):"",host:n.host,search:n.search?n.search.replace(/^\?/,""):"",hash:n.hash?n.hash.replace(/^#/,""):"",hostname:n.hostname,port:n.port,pathname:"/"===n.pathname.charAt(0)?n.pathname:"/"+n.pathname}}return e=o(window.location.href),function(t){var n=r.isString(t)?o(t):t;return n.protocol===e.protocol&&n.host===e.host}}():function(){return!0}},function(e,t,n){"use strict";e.exports=function(e){var t=/^([-+\w]{1,25})(:?\/\/|:)/.exec(e);return t&&t[1]||""}},function(e,t){e.exports=null},function(e,t,n){"use strict";var r=n(12).version,o=n(1),i={};["object","boolean","number","function","string","symbol"].forEach((function(e,t){i[e]=function(n){return typeof n===e||"a"+(t<1?"n ":" ")+e}}));var s={};i.transitional=function(e,t,n){function i(e,t){return"[Axios v"+r+"] Transitional option '"+e+"'"+t+(n?". "+n:"")}return function(n,r,a){if(!1===e)throw new o(i(r," has been removed"+(t?" in "+t:"")),o.ERR_DEPRECATED);return t&&!s[r]&&(s[r]=!0,console.warn(i(r," has been deprecated since v"+t+" and will be removed in the near future"))),!e||e(n,r,a)}},e.exports={assertOptions:function(e,t,n){if("object"!=typeof e)throw new o("options must be an object",o.ERR_BAD_OPTION_VALUE);for(var r=Object.keys(e),i=r.length;i-- >0;){var s=r[i],a=t[s];if(a){var u=e[s],c=void 0===u||a(u,s,e);if(!0!==c)throw new o("option "+s+" must be "+c,o.ERR_BAD_OPTION_VALUE)}else if(!0!==n)throw new o("Unknown option "+s,o.ERR_BAD_OPTION)}},validators:i}},function(e,t,n){"use strict";var r=n(2);function o(e){if("function"!=typeof e)throw new TypeError("executor must be a function.");var t;this.promise=new Promise((function(e){t=e}));var n=this;this.promise.then((function(e){if(n._listeners){var t,r=n._listeners.length;for(t=0;t undefined\n * typeof document -> undefined\n *\n * react-native:\n * navigator.product -> 'ReactNative'\n * nativescript\n * navigator.product -> 'NativeScript' or 'NS'\n */\nfunction isStandardBrowserEnv() {\n if (typeof navigator !== 'undefined' && (navigator.product === 'ReactNative' ||\n navigator.product === 'NativeScript' ||\n navigator.product === 'NS')) {\n return false;\n }\n return (\n typeof window !== 'undefined' &&\n typeof document !== 'undefined'\n );\n}\n\n/**\n * Iterate over an Array or an Object invoking a function for each item.\n *\n * If `obj` is an Array callback will be called passing\n * the value, index, and complete array for each item.\n *\n * If 'obj' is an Object callback will be called passing\n * the value, key, and complete object for each property.\n *\n * @param {Object|Array} obj The object to iterate\n * @param {Function} fn The callback to invoke for each item\n */\nfunction forEach(obj, fn) {\n // Don't bother if no value provided\n if (obj === null || typeof obj === 'undefined') {\n return;\n }\n\n // Force an array if not already something iterable\n if (typeof obj !== 'object') {\n /*eslint no-param-reassign:0*/\n obj = [obj];\n }\n\n if (isArray(obj)) {\n // Iterate over array values\n for (var i = 0, l = obj.length; i < l; i++) {\n fn.call(null, obj[i], i, obj);\n }\n } else {\n // Iterate over object keys\n for (var key in obj) {\n if (Object.prototype.hasOwnProperty.call(obj, key)) {\n fn.call(null, obj[key], key, obj);\n }\n }\n }\n}\n\n/**\n * Accepts varargs expecting each argument to be an object, then\n * immutably merges the properties of each object and returns result.\n *\n * When multiple objects contain the same key the later object in\n * the arguments list will take precedence.\n *\n * Example:\n *\n * ```js\n * var result = merge({foo: 123}, {foo: 456});\n * console.log(result.foo); // outputs 456\n * ```\n *\n * @param {Object} obj1 Object to merge\n * @returns {Object} Result of all merge properties\n */\nfunction merge(/* obj1, obj2, obj3, ... */) {\n var result = {};\n function assignValue(val, key) {\n if (isPlainObject(result[key]) && isPlainObject(val)) {\n result[key] = merge(result[key], val);\n } else if (isPlainObject(val)) {\n result[key] = merge({}, val);\n } else if (isArray(val)) {\n result[key] = val.slice();\n } else {\n result[key] = val;\n }\n }\n\n for (var i = 0, l = arguments.length; i < l; i++) {\n forEach(arguments[i], assignValue);\n }\n return result;\n}\n\n/**\n * Extends object a by mutably adding to it the properties of object b.\n *\n * @param {Object} a The object to be extended\n * @param {Object} b The object to copy properties from\n * @param {Object} thisArg The object to bind function to\n * @return {Object} The resulting value of object a\n */\nfunction extend(a, b, thisArg) {\n forEach(b, function assignValue(val, key) {\n if (thisArg && typeof val === 'function') {\n a[key] = bind(val, thisArg);\n } else {\n a[key] = val;\n }\n });\n return a;\n}\n\n/**\n * Remove byte order marker. This catches EF BB BF (the UTF-8 BOM)\n *\n * @param {string} content with BOM\n * @return {string} content value without BOM\n */\nfunction stripBOM(content) {\n if (content.charCodeAt(0) === 0xFEFF) {\n content = content.slice(1);\n }\n return content;\n}\n\n/**\n * Inherit the prototype methods from one constructor into another\n * @param {function} constructor\n * @param {function} superConstructor\n * @param {object} [props]\n * @param {object} [descriptors]\n */\n\nfunction inherits(constructor, superConstructor, props, descriptors) {\n constructor.prototype = Object.create(superConstructor.prototype, descriptors);\n constructor.prototype.constructor = constructor;\n props && Object.assign(constructor.prototype, props);\n}\n\n/**\n * Resolve object with deep prototype chain to a flat object\n * @param {Object} sourceObj source object\n * @param {Object} [destObj]\n * @param {Function} [filter]\n * @returns {Object}\n */\n\nfunction toFlatObject(sourceObj, destObj, filter) {\n var props;\n var i;\n var prop;\n var merged = {};\n\n destObj = destObj || {};\n\n do {\n props = Object.getOwnPropertyNames(sourceObj);\n i = props.length;\n while (i-- > 0) {\n prop = props[i];\n if (!merged[prop]) {\n destObj[prop] = sourceObj[prop];\n merged[prop] = true;\n }\n }\n sourceObj = Object.getPrototypeOf(sourceObj);\n } while (sourceObj && (!filter || filter(sourceObj, destObj)) && sourceObj !== Object.prototype);\n\n return destObj;\n}\n\n/*\n * determines whether a string ends with the characters of a specified string\n * @param {String} str\n * @param {String} searchString\n * @param {Number} [position= 0]\n * @returns {boolean}\n */\nfunction endsWith(str, searchString, position) {\n str = String(str);\n if (position === undefined || position > str.length) {\n position = str.length;\n }\n position -= searchString.length;\n var lastIndex = str.indexOf(searchString, position);\n return lastIndex !== -1 && lastIndex === position;\n}\n\n\n/**\n * Returns new array from array like object\n * @param {*} [thing]\n * @returns {Array}\n */\nfunction toArray(thing) {\n if (!thing) return null;\n var i = thing.length;\n if (isUndefined(i)) return null;\n var arr = new Array(i);\n while (i-- > 0) {\n arr[i] = thing[i];\n }\n return arr;\n}\n\n// eslint-disable-next-line func-names\nvar isTypedArray = (function(TypedArray) {\n // eslint-disable-next-line func-names\n return function(thing) {\n return TypedArray && thing instanceof TypedArray;\n };\n})(typeof Uint8Array !== 'undefined' && Object.getPrototypeOf(Uint8Array));\n\nmodule.exports = {\n isArray: isArray,\n isArrayBuffer: isArrayBuffer,\n isBuffer: isBuffer,\n isFormData: isFormData,\n isArrayBufferView: isArrayBufferView,\n isString: isString,\n isNumber: isNumber,\n isObject: isObject,\n isPlainObject: isPlainObject,\n isUndefined: isUndefined,\n isDate: isDate,\n isFile: isFile,\n isBlob: isBlob,\n isFunction: isFunction,\n isStream: isStream,\n isURLSearchParams: isURLSearchParams,\n isStandardBrowserEnv: isStandardBrowserEnv,\n forEach: forEach,\n merge: merge,\n extend: extend,\n trim: trim,\n stripBOM: stripBOM,\n inherits: inherits,\n toFlatObject: toFlatObject,\n kindOf: kindOf,\n kindOfTest: kindOfTest,\n endsWith: endsWith,\n toArray: toArray,\n isTypedArray: isTypedArray,\n isFileList: isFileList\n};\n","'use strict';\n\nvar utils = require('../utils');\n\n/**\n * Create an Error with the specified message, config, error code, request and response.\n *\n * @param {string} message The error message.\n * @param {string} [code] The error code (for example, 'ECONNABORTED').\n * @param {Object} [config] The config.\n * @param {Object} [request] The request.\n * @param {Object} [response] The response.\n * @returns {Error} The created error.\n */\nfunction AxiosError(message, code, config, request, response) {\n Error.call(this);\n this.message = message;\n this.name = 'AxiosError';\n code && (this.code = code);\n config && (this.config = config);\n request && (this.request = request);\n response && (this.response = response);\n}\n\nutils.inherits(AxiosError, Error, {\n toJSON: function toJSON() {\n return {\n // Standard\n message: this.message,\n name: this.name,\n // Microsoft\n description: this.description,\n number: this.number,\n // Mozilla\n fileName: this.fileName,\n lineNumber: this.lineNumber,\n columnNumber: this.columnNumber,\n stack: this.stack,\n // Axios\n config: this.config,\n code: this.code,\n status: this.response && this.response.status ? this.response.status : null\n };\n }\n});\n\nvar prototype = AxiosError.prototype;\nvar descriptors = {};\n\n[\n 'ERR_BAD_OPTION_VALUE',\n 'ERR_BAD_OPTION',\n 'ECONNABORTED',\n 'ETIMEDOUT',\n 'ERR_NETWORK',\n 'ERR_FR_TOO_MANY_REDIRECTS',\n 'ERR_DEPRECATED',\n 'ERR_BAD_RESPONSE',\n 'ERR_BAD_REQUEST',\n 'ERR_CANCELED'\n// eslint-disable-next-line func-names\n].forEach(function(code) {\n descriptors[code] = {value: code};\n});\n\nObject.defineProperties(AxiosError, descriptors);\nObject.defineProperty(prototype, 'isAxiosError', {value: true});\n\n// eslint-disable-next-line func-names\nAxiosError.from = function(error, code, config, request, response, customProps) {\n var axiosError = Object.create(prototype);\n\n utils.toFlatObject(error, axiosError, function filter(obj) {\n return obj !== Error.prototype;\n });\n\n AxiosError.call(axiosError, error.message, code, config, request, response);\n\n axiosError.name = error.name;\n\n customProps && Object.assign(axiosError, customProps);\n\n return axiosError;\n};\n\nmodule.exports = AxiosError;\n","'use strict';\n\nvar AxiosError = require('../core/AxiosError');\nvar utils = require('../utils');\n\n/**\n * A `CanceledError` is an object that is thrown when an operation is canceled.\n *\n * @class\n * @param {string=} message The message.\n */\nfunction CanceledError(message) {\n // eslint-disable-next-line no-eq-null,eqeqeq\n AxiosError.call(this, message == null ? 'canceled' : message, AxiosError.ERR_CANCELED);\n this.name = 'CanceledError';\n}\n\nutils.inherits(CanceledError, AxiosError, {\n __CANCEL__: true\n});\n\nmodule.exports = CanceledError;\n","'use strict';\n\nvar utils = require('../utils');\nvar normalizeHeaderName = require('../helpers/normalizeHeaderName');\nvar AxiosError = require('../core/AxiosError');\nvar transitionalDefaults = require('./transitional');\nvar toFormData = require('../helpers/toFormData');\n\nvar DEFAULT_CONTENT_TYPE = {\n 'Content-Type': 'application/x-www-form-urlencoded'\n};\n\nfunction setContentTypeIfUnset(headers, value) {\n if (!utils.isUndefined(headers) && utils.isUndefined(headers['Content-Type'])) {\n headers['Content-Type'] = value;\n }\n}\n\nfunction getDefaultAdapter() {\n var adapter;\n if (typeof XMLHttpRequest !== 'undefined') {\n // For browsers use XHR adapter\n adapter = require('../adapters/xhr');\n } else if (typeof process !== 'undefined' && Object.prototype.toString.call(process) === '[object process]') {\n // For node use HTTP adapter\n adapter = require('../adapters/http');\n }\n return adapter;\n}\n\nfunction stringifySafely(rawValue, parser, encoder) {\n if (utils.isString(rawValue)) {\n try {\n (parser || JSON.parse)(rawValue);\n return utils.trim(rawValue);\n } catch (e) {\n if (e.name !== 'SyntaxError') {\n throw e;\n }\n }\n }\n\n return (encoder || JSON.stringify)(rawValue);\n}\n\nvar defaults = {\n\n transitional: transitionalDefaults,\n\n adapter: getDefaultAdapter(),\n\n transformRequest: [function transformRequest(data, headers) {\n normalizeHeaderName(headers, 'Accept');\n normalizeHeaderName(headers, 'Content-Type');\n\n if (utils.isFormData(data) ||\n utils.isArrayBuffer(data) ||\n utils.isBuffer(data) ||\n utils.isStream(data) ||\n utils.isFile(data) ||\n utils.isBlob(data)\n ) {\n return data;\n }\n if (utils.isArrayBufferView(data)) {\n return data.buffer;\n }\n if (utils.isURLSearchParams(data)) {\n setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8');\n return data.toString();\n }\n\n var isObjectPayload = utils.isObject(data);\n var contentType = headers && headers['Content-Type'];\n\n var isFileList;\n\n if ((isFileList = utils.isFileList(data)) || (isObjectPayload && contentType === 'multipart/form-data')) {\n var _FormData = this.env && this.env.FormData;\n return toFormData(isFileList ? {'files[]': data} : data, _FormData && new _FormData());\n } else if (isObjectPayload || contentType === 'application/json') {\n setContentTypeIfUnset(headers, 'application/json');\n return stringifySafely(data);\n }\n\n return data;\n }],\n\n transformResponse: [function transformResponse(data) {\n var transitional = this.transitional || defaults.transitional;\n var silentJSONParsing = transitional && transitional.silentJSONParsing;\n var forcedJSONParsing = transitional && transitional.forcedJSONParsing;\n var strictJSONParsing = !silentJSONParsing && this.responseType === 'json';\n\n if (strictJSONParsing || (forcedJSONParsing && utils.isString(data) && data.length)) {\n try {\n return JSON.parse(data);\n } catch (e) {\n if (strictJSONParsing) {\n if (e.name === 'SyntaxError') {\n throw AxiosError.from(e, AxiosError.ERR_BAD_RESPONSE, this, null, this.response);\n }\n throw e;\n }\n }\n }\n\n return data;\n }],\n\n /**\n * A timeout in milliseconds to abort a request. If set to 0 (default) a\n * timeout is not created.\n */\n timeout: 0,\n\n xsrfCookieName: 'XSRF-TOKEN',\n xsrfHeaderName: 'X-XSRF-TOKEN',\n\n maxContentLength: -1,\n maxBodyLength: -1,\n\n env: {\n FormData: require('./env/FormData')\n },\n\n validateStatus: function validateStatus(status) {\n return status >= 200 && status < 300;\n },\n\n headers: {\n common: {\n 'Accept': 'application/json, text/plain, */*'\n }\n }\n};\n\nutils.forEach(['delete', 'get', 'head'], function forEachMethodNoData(method) {\n defaults.headers[method] = {};\n});\n\nutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n defaults.headers[method] = utils.merge(DEFAULT_CONTENT_TYPE);\n});\n\nmodule.exports = defaults;\n","'use strict';\n\nmodule.exports = function bind(fn, thisArg) {\n return function wrap() {\n var args = new Array(arguments.length);\n for (var i = 0; i < args.length; i++) {\n args[i] = arguments[i];\n }\n return fn.apply(thisArg, args);\n };\n};\n","'use strict';\n\nvar utils = require('./../utils');\n\nfunction encode(val) {\n return encodeURIComponent(val).\n replace(/%3A/gi, ':').\n replace(/%24/g, '$').\n replace(/%2C/gi, ',').\n replace(/%20/g, '+').\n replace(/%5B/gi, '[').\n replace(/%5D/gi, ']');\n}\n\n/**\n * Build a URL by appending params to the end\n *\n * @param {string} url The base of the url (e.g., http://www.google.com)\n * @param {object} [params] The params to be appended\n * @returns {string} The formatted url\n */\nmodule.exports = function buildURL(url, params, paramsSerializer) {\n /*eslint no-param-reassign:0*/\n if (!params) {\n return url;\n }\n\n var serializedParams;\n if (paramsSerializer) {\n serializedParams = paramsSerializer(params);\n } else if (utils.isURLSearchParams(params)) {\n serializedParams = params.toString();\n } else {\n var parts = [];\n\n utils.forEach(params, function serialize(val, key) {\n if (val === null || typeof val === 'undefined') {\n return;\n }\n\n if (utils.isArray(val)) {\n key = key + '[]';\n } else {\n val = [val];\n }\n\n utils.forEach(val, function parseValue(v) {\n if (utils.isDate(v)) {\n v = v.toISOString();\n } else if (utils.isObject(v)) {\n v = JSON.stringify(v);\n }\n parts.push(encode(key) + '=' + encode(v));\n });\n });\n\n serializedParams = parts.join('&');\n }\n\n if (serializedParams) {\n var hashmarkIndex = url.indexOf('#');\n if (hashmarkIndex !== -1) {\n url = url.slice(0, hashmarkIndex);\n }\n\n url += (url.indexOf('?') === -1 ? '?' : '&') + serializedParams;\n }\n\n return url;\n};\n","'use strict';\n\nmodule.exports = {\n silentJSONParsing: true,\n forcedJSONParsing: true,\n clarifyTimeoutError: false\n};\n","'use strict';\n\nvar utils = require('../utils');\n\n/**\n * Convert a data object to FormData\n * @param {Object} obj\n * @param {?Object} [formData]\n * @returns {Object}\n **/\n\nfunction toFormData(obj, formData) {\n // eslint-disable-next-line no-param-reassign\n formData = formData || new FormData();\n\n var stack = [];\n\n function convertValue(value) {\n if (value === null) return '';\n\n if (utils.isDate(value)) {\n return value.toISOString();\n }\n\n if (utils.isArrayBuffer(value) || utils.isTypedArray(value)) {\n return typeof Blob === 'function' ? new Blob([value]) : Buffer.from(value);\n }\n\n return value;\n }\n\n function build(data, parentKey) {\n if (utils.isPlainObject(data) || utils.isArray(data)) {\n if (stack.indexOf(data) !== -1) {\n throw Error('Circular reference detected in ' + parentKey);\n }\n\n stack.push(data);\n\n utils.forEach(data, function each(value, key) {\n if (utils.isUndefined(value)) return;\n var fullKey = parentKey ? parentKey + '.' + key : key;\n var arr;\n\n if (value && !parentKey && typeof value === 'object') {\n if (utils.endsWith(key, '{}')) {\n // eslint-disable-next-line no-param-reassign\n value = JSON.stringify(value);\n } else if (utils.endsWith(key, '[]') && (arr = utils.toArray(value))) {\n // eslint-disable-next-line func-names\n arr.forEach(function(el) {\n !utils.isUndefined(el) && formData.append(fullKey, convertValue(el));\n });\n return;\n }\n }\n\n build(value, fullKey);\n });\n\n stack.pop();\n } else {\n formData.append(parentKey, convertValue(data));\n }\n }\n\n build(obj);\n\n return formData;\n}\n\nmodule.exports = toFormData;\n","'use strict';\n\nvar utils = require('./../utils');\nvar settle = require('./../core/settle');\nvar cookies = require('./../helpers/cookies');\nvar buildURL = require('./../helpers/buildURL');\nvar buildFullPath = require('../core/buildFullPath');\nvar parseHeaders = require('./../helpers/parseHeaders');\nvar isURLSameOrigin = require('./../helpers/isURLSameOrigin');\nvar transitionalDefaults = require('../defaults/transitional');\nvar AxiosError = require('../core/AxiosError');\nvar CanceledError = require('../cancel/CanceledError');\nvar parseProtocol = require('../helpers/parseProtocol');\n\nmodule.exports = function xhrAdapter(config) {\n return new Promise(function dispatchXhrRequest(resolve, reject) {\n var requestData = config.data;\n var requestHeaders = config.headers;\n var responseType = config.responseType;\n var onCanceled;\n function done() {\n if (config.cancelToken) {\n config.cancelToken.unsubscribe(onCanceled);\n }\n\n if (config.signal) {\n config.signal.removeEventListener('abort', onCanceled);\n }\n }\n\n if (utils.isFormData(requestData) && utils.isStandardBrowserEnv()) {\n delete requestHeaders['Content-Type']; // Let the browser set it\n }\n\n var request = new XMLHttpRequest();\n\n // HTTP basic authentication\n if (config.auth) {\n var username = config.auth.username || '';\n var password = config.auth.password ? unescape(encodeURIComponent(config.auth.password)) : '';\n requestHeaders.Authorization = 'Basic ' + btoa(username + ':' + password);\n }\n\n var fullPath = buildFullPath(config.baseURL, config.url);\n\n request.open(config.method.toUpperCase(), buildURL(fullPath, config.params, config.paramsSerializer), true);\n\n // Set the request timeout in MS\n request.timeout = config.timeout;\n\n function onloadend() {\n if (!request) {\n return;\n }\n // Prepare the response\n var responseHeaders = 'getAllResponseHeaders' in request ? parseHeaders(request.getAllResponseHeaders()) : null;\n var responseData = !responseType || responseType === 'text' || responseType === 'json' ?\n request.responseText : request.response;\n var response = {\n data: responseData,\n status: request.status,\n statusText: request.statusText,\n headers: responseHeaders,\n config: config,\n request: request\n };\n\n settle(function _resolve(value) {\n resolve(value);\n done();\n }, function _reject(err) {\n reject(err);\n done();\n }, response);\n\n // Clean up request\n request = null;\n }\n\n if ('onloadend' in request) {\n // Use onloadend if available\n request.onloadend = onloadend;\n } else {\n // Listen for ready state to emulate onloadend\n request.onreadystatechange = function handleLoad() {\n if (!request || request.readyState !== 4) {\n return;\n }\n\n // The request errored out and we didn't get a response, this will be\n // handled by onerror instead\n // With one exception: request that using file: protocol, most browsers\n // will return status as 0 even though it's a successful request\n if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) {\n return;\n }\n // readystate handler is calling before onerror or ontimeout handlers,\n // so we should call onloadend on the next 'tick'\n setTimeout(onloadend);\n };\n }\n\n // Handle browser request cancellation (as opposed to a manual cancellation)\n request.onabort = function handleAbort() {\n if (!request) {\n return;\n }\n\n reject(new AxiosError('Request aborted', AxiosError.ECONNABORTED, config, request));\n\n // Clean up request\n request = null;\n };\n\n // Handle low level network errors\n request.onerror = function handleError() {\n // Real errors are hidden from us by the browser\n // onerror should only fire if it's a network error\n reject(new AxiosError('Network Error', AxiosError.ERR_NETWORK, config, request, request));\n\n // Clean up request\n request = null;\n };\n\n // Handle timeout\n request.ontimeout = function handleTimeout() {\n var timeoutErrorMessage = config.timeout ? 'timeout of ' + config.timeout + 'ms exceeded' : 'timeout exceeded';\n var transitional = config.transitional || transitionalDefaults;\n if (config.timeoutErrorMessage) {\n timeoutErrorMessage = config.timeoutErrorMessage;\n }\n reject(new AxiosError(\n timeoutErrorMessage,\n transitional.clarifyTimeoutError ? AxiosError.ETIMEDOUT : AxiosError.ECONNABORTED,\n config,\n request));\n\n // Clean up request\n request = null;\n };\n\n // Add xsrf header\n // This is only done if running in a standard browser environment.\n // Specifically not if we're in a web worker, or react-native.\n if (utils.isStandardBrowserEnv()) {\n // Add xsrf header\n var xsrfValue = (config.withCredentials || isURLSameOrigin(fullPath)) && config.xsrfCookieName ?\n cookies.read(config.xsrfCookieName) :\n undefined;\n\n if (xsrfValue) {\n requestHeaders[config.xsrfHeaderName] = xsrfValue;\n }\n }\n\n // Add headers to the request\n if ('setRequestHeader' in request) {\n utils.forEach(requestHeaders, function setRequestHeader(val, key) {\n if (typeof requestData === 'undefined' && key.toLowerCase() === 'content-type') {\n // Remove Content-Type if data is undefined\n delete requestHeaders[key];\n } else {\n // Otherwise add header to the request\n request.setRequestHeader(key, val);\n }\n });\n }\n\n // Add withCredentials to request if needed\n if (!utils.isUndefined(config.withCredentials)) {\n request.withCredentials = !!config.withCredentials;\n }\n\n // Add responseType to request if needed\n if (responseType && responseType !== 'json') {\n request.responseType = config.responseType;\n }\n\n // Handle progress if needed\n if (typeof config.onDownloadProgress === 'function') {\n request.addEventListener('progress', config.onDownloadProgress);\n }\n\n // Not all browsers support upload events\n if (typeof config.onUploadProgress === 'function' && request.upload) {\n request.upload.addEventListener('progress', config.onUploadProgress);\n }\n\n if (config.cancelToken || config.signal) {\n // Handle cancellation\n // eslint-disable-next-line func-names\n onCanceled = function(cancel) {\n if (!request) {\n return;\n }\n reject(!cancel || (cancel && cancel.type) ? new CanceledError() : cancel);\n request.abort();\n request = null;\n };\n\n config.cancelToken && config.cancelToken.subscribe(onCanceled);\n if (config.signal) {\n config.signal.aborted ? onCanceled() : config.signal.addEventListener('abort', onCanceled);\n }\n }\n\n if (!requestData) {\n requestData = null;\n }\n\n var protocol = parseProtocol(fullPath);\n\n if (protocol && [ 'http', 'https', 'file' ].indexOf(protocol) === -1) {\n reject(new AxiosError('Unsupported protocol ' + protocol + ':', AxiosError.ERR_BAD_REQUEST, config));\n return;\n }\n\n\n // Send the request\n request.send(requestData);\n });\n};\n","'use strict';\n\nvar isAbsoluteURL = require('../helpers/isAbsoluteURL');\nvar combineURLs = require('../helpers/combineURLs');\n\n/**\n * Creates a new URL by combining the baseURL with the requestedURL,\n * only when the requestedURL is not already an absolute URL.\n * If the requestURL is absolute, this function returns the requestedURL untouched.\n *\n * @param {string} baseURL The base URL\n * @param {string} requestedURL Absolute or relative URL to combine\n * @returns {string} The combined full path\n */\nmodule.exports = function buildFullPath(baseURL, requestedURL) {\n if (baseURL && !isAbsoluteURL(requestedURL)) {\n return combineURLs(baseURL, requestedURL);\n }\n return requestedURL;\n};\n","'use strict';\n\nmodule.exports = function isCancel(value) {\n return !!(value && value.__CANCEL__);\n};\n","'use strict';\n\nvar utils = require('../utils');\n\n/**\n * Config-specific merge-function which creates a new config-object\n * by merging two configuration objects together.\n *\n * @param {Object} config1\n * @param {Object} config2\n * @returns {Object} New object resulting from merging config2 to config1\n */\nmodule.exports = function mergeConfig(config1, config2) {\n // eslint-disable-next-line no-param-reassign\n config2 = config2 || {};\n var config = {};\n\n function getMergedValue(target, source) {\n if (utils.isPlainObject(target) && utils.isPlainObject(source)) {\n return utils.merge(target, source);\n } else if (utils.isPlainObject(source)) {\n return utils.merge({}, source);\n } else if (utils.isArray(source)) {\n return source.slice();\n }\n return source;\n }\n\n // eslint-disable-next-line consistent-return\n function mergeDeepProperties(prop) {\n if (!utils.isUndefined(config2[prop])) {\n return getMergedValue(config1[prop], config2[prop]);\n } else if (!utils.isUndefined(config1[prop])) {\n return getMergedValue(undefined, config1[prop]);\n }\n }\n\n // eslint-disable-next-line consistent-return\n function valueFromConfig2(prop) {\n if (!utils.isUndefined(config2[prop])) {\n return getMergedValue(undefined, config2[prop]);\n }\n }\n\n // eslint-disable-next-line consistent-return\n function defaultToConfig2(prop) {\n if (!utils.isUndefined(config2[prop])) {\n return getMergedValue(undefined, config2[prop]);\n } else if (!utils.isUndefined(config1[prop])) {\n return getMergedValue(undefined, config1[prop]);\n }\n }\n\n // eslint-disable-next-line consistent-return\n function mergeDirectKeys(prop) {\n if (prop in config2) {\n return getMergedValue(config1[prop], config2[prop]);\n } else if (prop in config1) {\n return getMergedValue(undefined, config1[prop]);\n }\n }\n\n var mergeMap = {\n 'url': valueFromConfig2,\n 'method': valueFromConfig2,\n 'data': valueFromConfig2,\n 'baseURL': defaultToConfig2,\n 'transformRequest': defaultToConfig2,\n 'transformResponse': defaultToConfig2,\n 'paramsSerializer': defaultToConfig2,\n 'timeout': defaultToConfig2,\n 'timeoutMessage': defaultToConfig2,\n 'withCredentials': defaultToConfig2,\n 'adapter': defaultToConfig2,\n 'responseType': defaultToConfig2,\n 'xsrfCookieName': defaultToConfig2,\n 'xsrfHeaderName': defaultToConfig2,\n 'onUploadProgress': defaultToConfig2,\n 'onDownloadProgress': defaultToConfig2,\n 'decompress': defaultToConfig2,\n 'maxContentLength': defaultToConfig2,\n 'maxBodyLength': defaultToConfig2,\n 'beforeRedirect': defaultToConfig2,\n 'transport': defaultToConfig2,\n 'httpAgent': defaultToConfig2,\n 'httpsAgent': defaultToConfig2,\n 'cancelToken': defaultToConfig2,\n 'socketPath': defaultToConfig2,\n 'responseEncoding': defaultToConfig2,\n 'validateStatus': mergeDirectKeys\n };\n\n utils.forEach(Object.keys(config1).concat(Object.keys(config2)), function computeConfigValue(prop) {\n var merge = mergeMap[prop] || mergeDeepProperties;\n var configValue = merge(prop);\n (utils.isUndefined(configValue) && merge !== mergeDirectKeys) || (config[prop] = configValue);\n });\n\n return config;\n};\n","module.exports = {\n \"version\": \"0.27.2\"\n};","module.exports = require('./lib/axios');","'use strict';\n\nvar utils = require('./utils');\nvar bind = require('./helpers/bind');\nvar Axios = require('./core/Axios');\nvar mergeConfig = require('./core/mergeConfig');\nvar defaults = require('./defaults');\n\n/**\n * Create an instance of Axios\n *\n * @param {Object} defaultConfig The default config for the instance\n * @return {Axios} A new instance of Axios\n */\nfunction createInstance(defaultConfig) {\n var context = new Axios(defaultConfig);\n var instance = bind(Axios.prototype.request, context);\n\n // Copy axios.prototype to instance\n utils.extend(instance, Axios.prototype, context);\n\n // Copy context to instance\n utils.extend(instance, context);\n\n // Factory for creating new instances\n instance.create = function create(instanceConfig) {\n return createInstance(mergeConfig(defaultConfig, instanceConfig));\n };\n\n return instance;\n}\n\n// Create the default instance to be exported\nvar axios = createInstance(defaults);\n\n// Expose Axios class to allow class inheritance\naxios.Axios = Axios;\n\n// Expose Cancel & CancelToken\naxios.CanceledError = require('./cancel/CanceledError');\naxios.CancelToken = require('./cancel/CancelToken');\naxios.isCancel = require('./cancel/isCancel');\naxios.VERSION = require('./env/data').version;\naxios.toFormData = require('./helpers/toFormData');\n\n// Expose AxiosError class\naxios.AxiosError = require('../lib/core/AxiosError');\n\n// alias for CanceledError for backward compatibility\naxios.Cancel = axios.CanceledError;\n\n// Expose all/spread\naxios.all = function all(promises) {\n return Promise.all(promises);\n};\naxios.spread = require('./helpers/spread');\n\n// Expose isAxiosError\naxios.isAxiosError = require('./helpers/isAxiosError');\n\nmodule.exports = axios;\n\n// Allow use of default import syntax in TypeScript\nmodule.exports.default = axios;\n","'use strict';\n\nvar utils = require('./../utils');\nvar buildURL = require('../helpers/buildURL');\nvar InterceptorManager = require('./InterceptorManager');\nvar dispatchRequest = require('./dispatchRequest');\nvar mergeConfig = require('./mergeConfig');\nvar buildFullPath = require('./buildFullPath');\nvar validator = require('../helpers/validator');\n\nvar validators = validator.validators;\n/**\n * Create a new instance of Axios\n *\n * @param {Object} instanceConfig The default config for the instance\n */\nfunction Axios(instanceConfig) {\n this.defaults = instanceConfig;\n this.interceptors = {\n request: new InterceptorManager(),\n response: new InterceptorManager()\n };\n}\n\n/**\n * Dispatch a request\n *\n * @param {Object} config The config specific for this request (merged with this.defaults)\n */\nAxios.prototype.request = function request(configOrUrl, config) {\n /*eslint no-param-reassign:0*/\n // Allow for axios('example/url'[, config]) a la fetch API\n if (typeof configOrUrl === 'string') {\n config = config || {};\n config.url = configOrUrl;\n } else {\n config = configOrUrl || {};\n }\n\n config = mergeConfig(this.defaults, config);\n\n // Set config.method\n if (config.method) {\n config.method = config.method.toLowerCase();\n } else if (this.defaults.method) {\n config.method = this.defaults.method.toLowerCase();\n } else {\n config.method = 'get';\n }\n\n var transitional = config.transitional;\n\n if (transitional !== undefined) {\n validator.assertOptions(transitional, {\n silentJSONParsing: validators.transitional(validators.boolean),\n forcedJSONParsing: validators.transitional(validators.boolean),\n clarifyTimeoutError: validators.transitional(validators.boolean)\n }, false);\n }\n\n // filter out skipped interceptors\n var requestInterceptorChain = [];\n var synchronousRequestInterceptors = true;\n this.interceptors.request.forEach(function unshiftRequestInterceptors(interceptor) {\n if (typeof interceptor.runWhen === 'function' && interceptor.runWhen(config) === false) {\n return;\n }\n\n synchronousRequestInterceptors = synchronousRequestInterceptors && interceptor.synchronous;\n\n requestInterceptorChain.unshift(interceptor.fulfilled, interceptor.rejected);\n });\n\n var responseInterceptorChain = [];\n this.interceptors.response.forEach(function pushResponseInterceptors(interceptor) {\n responseInterceptorChain.push(interceptor.fulfilled, interceptor.rejected);\n });\n\n var promise;\n\n if (!synchronousRequestInterceptors) {\n var chain = [dispatchRequest, undefined];\n\n Array.prototype.unshift.apply(chain, requestInterceptorChain);\n chain = chain.concat(responseInterceptorChain);\n\n promise = Promise.resolve(config);\n while (chain.length) {\n promise = promise.then(chain.shift(), chain.shift());\n }\n\n return promise;\n }\n\n\n var newConfig = config;\n while (requestInterceptorChain.length) {\n var onFulfilled = requestInterceptorChain.shift();\n var onRejected = requestInterceptorChain.shift();\n try {\n newConfig = onFulfilled(newConfig);\n } catch (error) {\n onRejected(error);\n break;\n }\n }\n\n try {\n promise = dispatchRequest(newConfig);\n } catch (error) {\n return Promise.reject(error);\n }\n\n while (responseInterceptorChain.length) {\n promise = promise.then(responseInterceptorChain.shift(), responseInterceptorChain.shift());\n }\n\n return promise;\n};\n\nAxios.prototype.getUri = function getUri(config) {\n config = mergeConfig(this.defaults, config);\n var fullPath = buildFullPath(config.baseURL, config.url);\n return buildURL(fullPath, config.params, config.paramsSerializer);\n};\n\n// Provide aliases for supported request methods\nutils.forEach(['delete', 'get', 'head', 'options'], function forEachMethodNoData(method) {\n /*eslint func-names:0*/\n Axios.prototype[method] = function(url, config) {\n return this.request(mergeConfig(config || {}, {\n method: method,\n url: url,\n data: (config || {}).data\n }));\n };\n});\n\nutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n /*eslint func-names:0*/\n\n function generateHTTPMethod(isForm) {\n return function httpMethod(url, data, config) {\n return this.request(mergeConfig(config || {}, {\n method: method,\n headers: isForm ? {\n 'Content-Type': 'multipart/form-data'\n } : {},\n url: url,\n data: data\n }));\n };\n }\n\n Axios.prototype[method] = generateHTTPMethod();\n\n Axios.prototype[method + 'Form'] = generateHTTPMethod(true);\n});\n\nmodule.exports = Axios;\n","'use strict';\n\nvar utils = require('./../utils');\n\nfunction InterceptorManager() {\n this.handlers = [];\n}\n\n/**\n * Add a new interceptor to the stack\n *\n * @param {Function} fulfilled The function to handle `then` for a `Promise`\n * @param {Function} rejected The function to handle `reject` for a `Promise`\n *\n * @return {Number} An ID used to remove interceptor later\n */\nInterceptorManager.prototype.use = function use(fulfilled, rejected, options) {\n this.handlers.push({\n fulfilled: fulfilled,\n rejected: rejected,\n synchronous: options ? options.synchronous : false,\n runWhen: options ? options.runWhen : null\n });\n return this.handlers.length - 1;\n};\n\n/**\n * Remove an interceptor from the stack\n *\n * @param {Number} id The ID that was returned by `use`\n */\nInterceptorManager.prototype.eject = function eject(id) {\n if (this.handlers[id]) {\n this.handlers[id] = null;\n }\n};\n\n/**\n * Iterate over all the registered interceptors\n *\n * This method is particularly useful for skipping over any\n * interceptors that may have become `null` calling `eject`.\n *\n * @param {Function} fn The function to call for each interceptor\n */\nInterceptorManager.prototype.forEach = function forEach(fn) {\n utils.forEach(this.handlers, function forEachHandler(h) {\n if (h !== null) {\n fn(h);\n }\n });\n};\n\nmodule.exports = InterceptorManager;\n","'use strict';\n\nvar utils = require('./../utils');\nvar transformData = require('./transformData');\nvar isCancel = require('../cancel/isCancel');\nvar defaults = require('../defaults');\nvar CanceledError = require('../cancel/CanceledError');\n\n/**\n * Throws a `CanceledError` if cancellation has been requested.\n */\nfunction throwIfCancellationRequested(config) {\n if (config.cancelToken) {\n config.cancelToken.throwIfRequested();\n }\n\n if (config.signal && config.signal.aborted) {\n throw new CanceledError();\n }\n}\n\n/**\n * Dispatch a request to the server using the configured adapter.\n *\n * @param {object} config The config that is to be used for the request\n * @returns {Promise} The Promise to be fulfilled\n */\nmodule.exports = function dispatchRequest(config) {\n throwIfCancellationRequested(config);\n\n // Ensure headers exist\n config.headers = config.headers || {};\n\n // Transform request data\n config.data = transformData.call(\n config,\n config.data,\n config.headers,\n config.transformRequest\n );\n\n // Flatten headers\n config.headers = utils.merge(\n config.headers.common || {},\n config.headers[config.method] || {},\n config.headers\n );\n\n utils.forEach(\n ['delete', 'get', 'head', 'post', 'put', 'patch', 'common'],\n function cleanHeaderConfig(method) {\n delete config.headers[method];\n }\n );\n\n var adapter = config.adapter || defaults.adapter;\n\n return adapter(config).then(function onAdapterResolution(response) {\n throwIfCancellationRequested(config);\n\n // Transform response data\n response.data = transformData.call(\n config,\n response.data,\n response.headers,\n config.transformResponse\n );\n\n return response;\n }, function onAdapterRejection(reason) {\n if (!isCancel(reason)) {\n throwIfCancellationRequested(config);\n\n // Transform response data\n if (reason && reason.response) {\n reason.response.data = transformData.call(\n config,\n reason.response.data,\n reason.response.headers,\n config.transformResponse\n );\n }\n }\n\n return Promise.reject(reason);\n });\n};\n","'use strict';\n\nvar utils = require('./../utils');\nvar defaults = require('../defaults');\n\n/**\n * Transform the data for a request or a response\n *\n * @param {Object|String} data The data to be transformed\n * @param {Array} headers The headers for the request or response\n * @param {Array|Function} fns A single function or Array of functions\n * @returns {*} The resulting transformed data\n */\nmodule.exports = function transformData(data, headers, fns) {\n var context = this || defaults;\n /*eslint no-param-reassign:0*/\n utils.forEach(fns, function transform(fn) {\n data = fn.call(context, data, headers);\n });\n\n return data;\n};\n","'use strict';\n\nvar utils = require('../utils');\n\nmodule.exports = function normalizeHeaderName(headers, normalizedName) {\n utils.forEach(headers, function processHeader(value, name) {\n if (name !== normalizedName && name.toUpperCase() === normalizedName.toUpperCase()) {\n headers[normalizedName] = value;\n delete headers[name];\n }\n });\n};\n","'use strict';\n\nvar AxiosError = require('./AxiosError');\n\n/**\n * Resolve or reject a Promise based on response status.\n *\n * @param {Function} resolve A function that resolves the promise.\n * @param {Function} reject A function that rejects the promise.\n * @param {object} response The response.\n */\nmodule.exports = function settle(resolve, reject, response) {\n var validateStatus = response.config.validateStatus;\n if (!response.status || !validateStatus || validateStatus(response.status)) {\n resolve(response);\n } else {\n reject(new AxiosError(\n 'Request failed with status code ' + response.status,\n [AxiosError.ERR_BAD_REQUEST, AxiosError.ERR_BAD_RESPONSE][Math.floor(response.status / 100) - 4],\n response.config,\n response.request,\n response\n ));\n }\n};\n","'use strict';\n\nvar utils = require('./../utils');\n\nmodule.exports = (\n utils.isStandardBrowserEnv() ?\n\n // Standard browser envs support document.cookie\n (function standardBrowserEnv() {\n return {\n write: function write(name, value, expires, path, domain, secure) {\n var cookie = [];\n cookie.push(name + '=' + encodeURIComponent(value));\n\n if (utils.isNumber(expires)) {\n cookie.push('expires=' + new Date(expires).toGMTString());\n }\n\n if (utils.isString(path)) {\n cookie.push('path=' + path);\n }\n\n if (utils.isString(domain)) {\n cookie.push('domain=' + domain);\n }\n\n if (secure === true) {\n cookie.push('secure');\n }\n\n document.cookie = cookie.join('; ');\n },\n\n read: function read(name) {\n var match = document.cookie.match(new RegExp('(^|;\\\\s*)(' + name + ')=([^;]*)'));\n return (match ? decodeURIComponent(match[3]) : null);\n },\n\n remove: function remove(name) {\n this.write(name, '', Date.now() - 86400000);\n }\n };\n })() :\n\n // Non standard browser env (web workers, react-native) lack needed support.\n (function nonStandardBrowserEnv() {\n return {\n write: function write() {},\n read: function read() { return null; },\n remove: function remove() {}\n };\n })()\n);\n","'use strict';\n\n/**\n * Determines whether the specified URL is absolute\n *\n * @param {string} url The URL to test\n * @returns {boolean} True if the specified URL is absolute, otherwise false\n */\nmodule.exports = function isAbsoluteURL(url) {\n // A URL is considered absolute if it begins with \"://\" or \"//\" (protocol-relative URL).\n // RFC 3986 defines scheme name as a sequence of characters beginning with a letter and followed\n // by any combination of letters, digits, plus, period, or hyphen.\n return /^([a-z][a-z\\d+\\-.]*:)?\\/\\//i.test(url);\n};\n","'use strict';\n\n/**\n * Creates a new URL by combining the specified URLs\n *\n * @param {string} baseURL The base URL\n * @param {string} relativeURL The relative URL\n * @returns {string} The combined URL\n */\nmodule.exports = function combineURLs(baseURL, relativeURL) {\n return relativeURL\n ? baseURL.replace(/\\/+$/, '') + '/' + relativeURL.replace(/^\\/+/, '')\n : baseURL;\n};\n","'use strict';\n\nvar utils = require('./../utils');\n\n// Headers whose duplicates are ignored by node\n// c.f. https://nodejs.org/api/http.html#http_message_headers\nvar ignoreDuplicateOf = [\n 'age', 'authorization', 'content-length', 'content-type', 'etag',\n 'expires', 'from', 'host', 'if-modified-since', 'if-unmodified-since',\n 'last-modified', 'location', 'max-forwards', 'proxy-authorization',\n 'referer', 'retry-after', 'user-agent'\n];\n\n/**\n * Parse headers into an object\n *\n * ```\n * Date: Wed, 27 Aug 2014 08:58:49 GMT\n * Content-Type: application/json\n * Connection: keep-alive\n * Transfer-Encoding: chunked\n * ```\n *\n * @param {String} headers Headers needing to be parsed\n * @returns {Object} Headers parsed into an object\n */\nmodule.exports = function parseHeaders(headers) {\n var parsed = {};\n var key;\n var val;\n var i;\n\n if (!headers) { return parsed; }\n\n utils.forEach(headers.split('\\n'), function parser(line) {\n i = line.indexOf(':');\n key = utils.trim(line.substr(0, i)).toLowerCase();\n val = utils.trim(line.substr(i + 1));\n\n if (key) {\n if (parsed[key] && ignoreDuplicateOf.indexOf(key) >= 0) {\n return;\n }\n if (key === 'set-cookie') {\n parsed[key] = (parsed[key] ? parsed[key] : []).concat([val]);\n } else {\n parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val;\n }\n }\n });\n\n return parsed;\n};\n","'use strict';\n\nvar utils = require('./../utils');\n\nmodule.exports = (\n utils.isStandardBrowserEnv() ?\n\n // Standard browser envs have full support of the APIs needed to test\n // whether the request URL is of the same origin as current location.\n (function standardBrowserEnv() {\n var msie = /(msie|trident)/i.test(navigator.userAgent);\n var urlParsingNode = document.createElement('a');\n var originURL;\n\n /**\n * Parse a URL to discover it's components\n *\n * @param {String} url The URL to be parsed\n * @returns {Object}\n */\n function resolveURL(url) {\n var href = url;\n\n if (msie) {\n // IE needs attribute set twice to normalize properties\n urlParsingNode.setAttribute('href', href);\n href = urlParsingNode.href;\n }\n\n urlParsingNode.setAttribute('href', href);\n\n // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils\n return {\n href: urlParsingNode.href,\n protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '',\n host: urlParsingNode.host,\n search: urlParsingNode.search ? urlParsingNode.search.replace(/^\\?/, '') : '',\n hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '',\n hostname: urlParsingNode.hostname,\n port: urlParsingNode.port,\n pathname: (urlParsingNode.pathname.charAt(0) === '/') ?\n urlParsingNode.pathname :\n '/' + urlParsingNode.pathname\n };\n }\n\n originURL = resolveURL(window.location.href);\n\n /**\n * Determine if a URL shares the same origin as the current location\n *\n * @param {String} requestURL The URL to test\n * @returns {boolean} True if URL shares the same origin, otherwise false\n */\n return function isURLSameOrigin(requestURL) {\n var parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL;\n return (parsed.protocol === originURL.protocol &&\n parsed.host === originURL.host);\n };\n })() :\n\n // Non standard browser envs (web workers, react-native) lack needed support.\n (function nonStandardBrowserEnv() {\n return function isURLSameOrigin() {\n return true;\n };\n })()\n);\n","'use strict';\n\nmodule.exports = function parseProtocol(url) {\n var match = /^([-+\\w]{1,25})(:?\\/\\/|:)/.exec(url);\n return match && match[1] || '';\n};\n","// eslint-disable-next-line strict\nmodule.exports = null;\n","'use strict';\n\nvar VERSION = require('../env/data').version;\nvar AxiosError = require('../core/AxiosError');\n\nvar validators = {};\n\n// eslint-disable-next-line func-names\n['object', 'boolean', 'number', 'function', 'string', 'symbol'].forEach(function(type, i) {\n validators[type] = function validator(thing) {\n return typeof thing === type || 'a' + (i < 1 ? 'n ' : ' ') + type;\n };\n});\n\nvar deprecatedWarnings = {};\n\n/**\n * Transitional option validator\n * @param {function|boolean?} validator - set to false if the transitional option has been removed\n * @param {string?} version - deprecated version / removed since version\n * @param {string?} message - some message with additional info\n * @returns {function}\n */\nvalidators.transitional = function transitional(validator, version, message) {\n function formatMessage(opt, desc) {\n return '[Axios v' + VERSION + '] Transitional option \\'' + opt + '\\'' + desc + (message ? '. ' + message : '');\n }\n\n // eslint-disable-next-line func-names\n return function(value, opt, opts) {\n if (validator === false) {\n throw new AxiosError(\n formatMessage(opt, ' has been removed' + (version ? ' in ' + version : '')),\n AxiosError.ERR_DEPRECATED\n );\n }\n\n if (version && !deprecatedWarnings[opt]) {\n deprecatedWarnings[opt] = true;\n // eslint-disable-next-line no-console\n console.warn(\n formatMessage(\n opt,\n ' has been deprecated since v' + version + ' and will be removed in the near future'\n )\n );\n }\n\n return validator ? validator(value, opt, opts) : true;\n };\n};\n\n/**\n * Assert object's properties type\n * @param {object} options\n * @param {object} schema\n * @param {boolean?} allowUnknown\n */\n\nfunction assertOptions(options, schema, allowUnknown) {\n if (typeof options !== 'object') {\n throw new AxiosError('options must be an object', AxiosError.ERR_BAD_OPTION_VALUE);\n }\n var keys = Object.keys(options);\n var i = keys.length;\n while (i-- > 0) {\n var opt = keys[i];\n var validator = schema[opt];\n if (validator) {\n var value = options[opt];\n var result = value === undefined || validator(value, opt, options);\n if (result !== true) {\n throw new AxiosError('option ' + opt + ' must be ' + result, AxiosError.ERR_BAD_OPTION_VALUE);\n }\n continue;\n }\n if (allowUnknown !== true) {\n throw new AxiosError('Unknown option ' + opt, AxiosError.ERR_BAD_OPTION);\n }\n }\n}\n\nmodule.exports = {\n assertOptions: assertOptions,\n validators: validators\n};\n","'use strict';\n\nvar CanceledError = require('./CanceledError');\n\n/**\n * A `CancelToken` is an object that can be used to request cancellation of an operation.\n *\n * @class\n * @param {Function} executor The executor function.\n */\nfunction CancelToken(executor) {\n if (typeof executor !== 'function') {\n throw new TypeError('executor must be a function.');\n }\n\n var resolvePromise;\n\n this.promise = new Promise(function promiseExecutor(resolve) {\n resolvePromise = resolve;\n });\n\n var token = this;\n\n // eslint-disable-next-line func-names\n this.promise.then(function(cancel) {\n if (!token._listeners) return;\n\n var i;\n var l = token._listeners.length;\n\n for (i = 0; i < l; i++) {\n token._listeners[i](cancel);\n }\n token._listeners = null;\n });\n\n // eslint-disable-next-line func-names\n this.promise.then = function(onfulfilled) {\n var _resolve;\n // eslint-disable-next-line func-names\n var promise = new Promise(function(resolve) {\n token.subscribe(resolve);\n _resolve = resolve;\n }).then(onfulfilled);\n\n promise.cancel = function reject() {\n token.unsubscribe(_resolve);\n };\n\n return promise;\n };\n\n executor(function cancel(message) {\n if (token.reason) {\n // Cancellation has already been requested\n return;\n }\n\n token.reason = new CanceledError(message);\n resolvePromise(token.reason);\n });\n}\n\n/**\n * Throws a `CanceledError` if cancellation has been requested.\n */\nCancelToken.prototype.throwIfRequested = function throwIfRequested() {\n if (this.reason) {\n throw this.reason;\n }\n};\n\n/**\n * Subscribe to the cancel signal\n */\n\nCancelToken.prototype.subscribe = function subscribe(listener) {\n if (this.reason) {\n listener(this.reason);\n return;\n }\n\n if (this._listeners) {\n this._listeners.push(listener);\n } else {\n this._listeners = [listener];\n }\n};\n\n/**\n * Unsubscribe from the cancel signal\n */\n\nCancelToken.prototype.unsubscribe = function unsubscribe(listener) {\n if (!this._listeners) {\n return;\n }\n var index = this._listeners.indexOf(listener);\n if (index !== -1) {\n this._listeners.splice(index, 1);\n }\n};\n\n/**\n * Returns an object that contains a new `CancelToken` and a function that, when called,\n * cancels the `CancelToken`.\n */\nCancelToken.source = function source() {\n var cancel;\n var token = new CancelToken(function executor(c) {\n cancel = c;\n });\n return {\n token: token,\n cancel: cancel\n };\n};\n\nmodule.exports = CancelToken;\n","'use strict';\n\n/**\n * Syntactic sugar for invoking a function and expanding an array for arguments.\n *\n * Common use case would be to use `Function.prototype.apply`.\n *\n * ```js\n * function f(x, y, z) {}\n * var args = [1, 2, 3];\n * f.apply(null, args);\n * ```\n *\n * With `spread` this example can be re-written.\n *\n * ```js\n * spread(function(x, y, z) {})([1, 2, 3]);\n * ```\n *\n * @param {Function} callback\n * @returns {Function}\n */\nmodule.exports = function spread(callback) {\n return function wrap(arr) {\n return callback.apply(null, arr);\n };\n};\n","'use strict';\n\nvar utils = require('./../utils');\n\n/**\n * Determines whether the payload is an error thrown by Axios\n *\n * @param {*} payload The value to test\n * @returns {boolean} True if the payload is an error thrown by Axios, otherwise false\n */\nmodule.exports = function isAxiosError(payload) {\n return utils.isObject(payload) && (payload.isAxiosError === true);\n};\n"],"sourceRoot":""} \ No newline at end of file diff --git a/_nodejs/node_modules/axios/index.d.ts b/_nodejs/node_modules/axios/index.d.ts new file mode 100644 index 0000000..0b9e1d3 --- /dev/null +++ b/_nodejs/node_modules/axios/index.d.ts @@ -0,0 +1,254 @@ +// TypeScript Version: 3.0 +export type AxiosRequestHeaders = Record; + +export type AxiosResponseHeaders = Record & { + "set-cookie"?: string[] +}; + +export interface AxiosRequestTransformer { + (data: any, headers?: AxiosRequestHeaders): any; +} + +export interface AxiosResponseTransformer { + (data: any, headers?: AxiosResponseHeaders): any; +} + +export interface AxiosAdapter { + (config: AxiosRequestConfig): AxiosPromise; +} + +export interface AxiosBasicCredentials { + username: string; + password: string; +} + +export interface AxiosProxyConfig { + host: string; + port: number; + auth?: { + username: string; + password: string; + }; + protocol?: string; +} + +export type Method = + | 'get' | 'GET' + | 'delete' | 'DELETE' + | 'head' | 'HEAD' + | 'options' | 'OPTIONS' + | 'post' | 'POST' + | 'put' | 'PUT' + | 'patch' | 'PATCH' + | 'purge' | 'PURGE' + | 'link' | 'LINK' + | 'unlink' | 'UNLINK'; + +export type ResponseType = + | 'arraybuffer' + | 'blob' + | 'document' + | 'json' + | 'text' + | 'stream'; + + export type responseEncoding = + | 'ascii' | 'ASCII' + | 'ansi' | 'ANSI' + | 'binary' | 'BINARY' + | 'base64' | 'BASE64' + | 'base64url' | 'BASE64URL' + | 'hex' | 'HEX' + | 'latin1' | 'LATIN1' + | 'ucs-2' | 'UCS-2' + | 'ucs2' | 'UCS2' + | 'utf-8' | 'UTF-8' + | 'utf8' | 'UTF8' + | 'utf16le' | 'UTF16LE'; + +export interface TransitionalOptions { + silentJSONParsing?: boolean; + forcedJSONParsing?: boolean; + clarifyTimeoutError?: boolean; +} + +export interface AxiosRequestConfig { + url?: string; + method?: Method | string; + baseURL?: string; + transformRequest?: AxiosRequestTransformer | AxiosRequestTransformer[]; + transformResponse?: AxiosResponseTransformer | AxiosResponseTransformer[]; + headers?: AxiosRequestHeaders; + params?: any; + paramsSerializer?: (params: any) => string; + data?: D; + timeout?: number; + timeoutErrorMessage?: string; + withCredentials?: boolean; + adapter?: AxiosAdapter; + auth?: AxiosBasicCredentials; + responseType?: ResponseType; + responseEncoding?: responseEncoding | string; + xsrfCookieName?: string; + xsrfHeaderName?: string; + onUploadProgress?: (progressEvent: any) => void; + onDownloadProgress?: (progressEvent: any) => void; + maxContentLength?: number; + validateStatus?: ((status: number) => boolean) | null; + maxBodyLength?: number; + maxRedirects?: number; + beforeRedirect?: (options: Record, responseDetails: {headers: Record}) => void; + socketPath?: string | null; + httpAgent?: any; + httpsAgent?: any; + proxy?: AxiosProxyConfig | false; + cancelToken?: CancelToken; + decompress?: boolean; + transitional?: TransitionalOptions; + signal?: AbortSignal; + insecureHTTPParser?: boolean; + env?: { + FormData?: new (...args: any[]) => object; + }; +} + +export interface HeadersDefaults { + common: AxiosRequestHeaders; + delete: AxiosRequestHeaders; + get: AxiosRequestHeaders; + head: AxiosRequestHeaders; + post: AxiosRequestHeaders; + put: AxiosRequestHeaders; + patch: AxiosRequestHeaders; + options?: AxiosRequestHeaders; + purge?: AxiosRequestHeaders; + link?: AxiosRequestHeaders; + unlink?: AxiosRequestHeaders; +} + +export interface AxiosDefaults extends Omit, 'headers'> { + headers: HeadersDefaults; +} + +export interface AxiosResponse { + data: T; + status: number; + statusText: string; + headers: AxiosResponseHeaders; + config: AxiosRequestConfig; + request?: any; +} + +export class AxiosError extends Error { + constructor( + message?: string, + code?: string, + config?: AxiosRequestConfig, + request?: any, + response?: AxiosResponse + ); + + config: AxiosRequestConfig; + code?: string; + request?: any; + response?: AxiosResponse; + isAxiosError: boolean; + status?: string; + toJSON: () => object; + static readonly ERR_FR_TOO_MANY_REDIRECTS = "ERR_FR_TOO_MANY_REDIRECTS"; + static readonly ERR_BAD_OPTION_VALUE = "ERR_BAD_OPTION_VALUE"; + static readonly ERR_BAD_OPTION = "ERR_BAD_OPTION"; + static readonly ERR_NETWORK = "ERR_NETWORK"; + static readonly ERR_DEPRECATED = "ERR_DEPRECATED"; + static readonly ERR_BAD_RESPONSE = "ERR_BAD_RESPONSE"; + static readonly ERR_BAD_REQUEST = "ERR_BAD_REQUEST"; + static readonly ERR_CANCELED = "ERR_CANCELED"; + static readonly ECONNABORTED = "ECONNABORTED"; + static readonly ETIMEDOUT = "ETIMEDOUT"; +} + +export class CanceledError extends AxiosError { +} + +export interface AxiosPromise extends Promise> { +} + +export interface CancelStatic { + new (message?: string): Cancel; +} + +export interface Cancel { + message: string | undefined; +} + +export interface Canceler { + (message?: string): void; +} + +export interface CancelTokenStatic { + new (executor: (cancel: Canceler) => void): CancelToken; + source(): CancelTokenSource; +} + +export interface CancelToken { + promise: Promise; + reason?: Cancel; + throwIfRequested(): void; +} + +export interface CancelTokenSource { + token: CancelToken; + cancel: Canceler; +} + +export interface AxiosInterceptorOptions { + synchronous?: boolean; + runWhen?: (config: AxiosRequestConfig) => boolean; +} + +export interface AxiosInterceptorManager { + use(onFulfilled?: (value: V) => T | Promise, onRejected?: (error: any) => any, options?: AxiosInterceptorOptions): number; + eject(id: number): void; +} + +export class Axios { + constructor(config?: AxiosRequestConfig); + defaults: AxiosDefaults; + interceptors: { + request: AxiosInterceptorManager; + response: AxiosInterceptorManager; + }; + getUri(config?: AxiosRequestConfig): string; + request, D = any>(config: AxiosRequestConfig): Promise; + get, D = any>(url: string, config?: AxiosRequestConfig): Promise; + delete, D = any>(url: string, config?: AxiosRequestConfig): Promise; + head, D = any>(url: string, config?: AxiosRequestConfig): Promise; + options, D = any>(url: string, config?: AxiosRequestConfig): Promise; + post, D = any>(url: string, data?: D, config?: AxiosRequestConfig): Promise; + put, D = any>(url: string, data?: D, config?: AxiosRequestConfig): Promise; + patch, D = any>(url: string, data?: D, config?: AxiosRequestConfig): Promise; + postForm, D = any>(url: string, data?: D, config?: AxiosRequestConfig): Promise; + putForm, D = any>(url: string, data?: D, config?: AxiosRequestConfig): Promise; + patchForm, D = any>(url: string, data?: D, config?: AxiosRequestConfig): Promise; +} + +export interface AxiosInstance extends Axios { + (config: AxiosRequestConfig): AxiosPromise; + (url: string, config?: AxiosRequestConfig): AxiosPromise; +} + +export interface AxiosStatic extends AxiosInstance { + create(config?: AxiosRequestConfig): AxiosInstance; + Cancel: CancelStatic; + CancelToken: CancelTokenStatic; + Axios: typeof Axios; + readonly VERSION: string; + isCancel(value: any): boolean; + all(values: Array>): Promise; + spread(callback: (...args: T[]) => R): (array: T[]) => R; + isAxiosError(payload: any): payload is AxiosError; +} + +declare const axios: AxiosStatic; + +export default axios; diff --git a/_nodejs/node_modules/axios/index.js b/_nodejs/node_modules/axios/index.js new file mode 100644 index 0000000..79dfd09 --- /dev/null +++ b/_nodejs/node_modules/axios/index.js @@ -0,0 +1 @@ +module.exports = require('./lib/axios'); \ No newline at end of file diff --git a/_nodejs/node_modules/axios/lib/adapters/README.md b/_nodejs/node_modules/axios/lib/adapters/README.md new file mode 100644 index 0000000..68f1118 --- /dev/null +++ b/_nodejs/node_modules/axios/lib/adapters/README.md @@ -0,0 +1,37 @@ +# axios // adapters + +The modules under `adapters/` are modules that handle dispatching a request and settling a returned `Promise` once a response is received. + +## Example + +```js +var settle = require('./../core/settle'); + +module.exports = function myAdapter(config) { + // At this point: + // - config has been merged with defaults + // - request transformers have already run + // - request interceptors have already run + + // Make the request using config provided + // Upon response settle the Promise + + return new Promise(function(resolve, reject) { + + var response = { + data: responseData, + status: request.status, + statusText: request.statusText, + headers: responseHeaders, + config: config, + request: request + }; + + settle(resolve, reject, response); + + // From here: + // - response transformers will run + // - response interceptors will run + }); +} +``` diff --git a/_nodejs/node_modules/axios/lib/adapters/http.js b/_nodejs/node_modules/axios/lib/adapters/http.js new file mode 100755 index 0000000..04a9aac --- /dev/null +++ b/_nodejs/node_modules/axios/lib/adapters/http.js @@ -0,0 +1,424 @@ +'use strict'; + +var utils = require('./../utils'); +var settle = require('./../core/settle'); +var buildFullPath = require('../core/buildFullPath'); +var buildURL = require('./../helpers/buildURL'); +var http = require('http'); +var https = require('https'); +var httpFollow = require('follow-redirects').http; +var httpsFollow = require('follow-redirects').https; +var url = require('url'); +var zlib = require('zlib'); +var VERSION = require('./../env/data').version; +var transitionalDefaults = require('../defaults/transitional'); +var AxiosError = require('../core/AxiosError'); +var CanceledError = require('../cancel/CanceledError'); + +var isHttps = /https:?/; + +var supportedProtocols = [ 'http:', 'https:', 'file:' ]; + +/** + * + * @param {http.ClientRequestArgs} options + * @param {AxiosProxyConfig} proxy + * @param {string} location + */ +function setProxy(options, proxy, location) { + options.hostname = proxy.host; + options.host = proxy.host; + options.port = proxy.port; + options.path = location; + + // Basic proxy authorization + if (proxy.auth) { + var base64 = Buffer.from(proxy.auth.username + ':' + proxy.auth.password, 'utf8').toString('base64'); + options.headers['Proxy-Authorization'] = 'Basic ' + base64; + } + + // If a proxy is used, any redirects must also pass through the proxy + options.beforeRedirect = function beforeRedirect(redirection) { + redirection.headers.host = redirection.host; + setProxy(redirection, proxy, redirection.href); + }; +} + +/*eslint consistent-return:0*/ +module.exports = function httpAdapter(config) { + return new Promise(function dispatchHttpRequest(resolvePromise, rejectPromise) { + var onCanceled; + function done() { + if (config.cancelToken) { + config.cancelToken.unsubscribe(onCanceled); + } + + if (config.signal) { + config.signal.removeEventListener('abort', onCanceled); + } + } + var resolve = function resolve(value) { + done(); + resolvePromise(value); + }; + var rejected = false; + var reject = function reject(value) { + done(); + rejected = true; + rejectPromise(value); + }; + var data = config.data; + var headers = config.headers; + var headerNames = {}; + + Object.keys(headers).forEach(function storeLowerName(name) { + headerNames[name.toLowerCase()] = name; + }); + + // Set User-Agent (required by some servers) + // See https://github.com/axios/axios/issues/69 + if ('user-agent' in headerNames) { + // User-Agent is specified; handle case where no UA header is desired + if (!headers[headerNames['user-agent']]) { + delete headers[headerNames['user-agent']]; + } + // Otherwise, use specified value + } else { + // Only set header if it hasn't been set in config + headers['User-Agent'] = 'axios/' + VERSION; + } + + // support for https://www.npmjs.com/package/form-data api + if (utils.isFormData(data) && utils.isFunction(data.getHeaders)) { + Object.assign(headers, data.getHeaders()); + } else if (data && !utils.isStream(data)) { + if (Buffer.isBuffer(data)) { + // Nothing to do... + } else if (utils.isArrayBuffer(data)) { + data = Buffer.from(new Uint8Array(data)); + } else if (utils.isString(data)) { + data = Buffer.from(data, 'utf-8'); + } else { + return reject(new AxiosError( + 'Data after transformation must be a string, an ArrayBuffer, a Buffer, or a Stream', + AxiosError.ERR_BAD_REQUEST, + config + )); + } + + if (config.maxBodyLength > -1 && data.length > config.maxBodyLength) { + return reject(new AxiosError( + 'Request body larger than maxBodyLength limit', + AxiosError.ERR_BAD_REQUEST, + config + )); + } + + // Add Content-Length header if data exists + if (!headerNames['content-length']) { + headers['Content-Length'] = data.length; + } + } + + // HTTP basic authentication + var auth = undefined; + if (config.auth) { + var username = config.auth.username || ''; + var password = config.auth.password || ''; + auth = username + ':' + password; + } + + // Parse url + var fullPath = buildFullPath(config.baseURL, config.url); + var parsed = url.parse(fullPath); + var protocol = parsed.protocol || supportedProtocols[0]; + + if (supportedProtocols.indexOf(protocol) === -1) { + return reject(new AxiosError( + 'Unsupported protocol ' + protocol, + AxiosError.ERR_BAD_REQUEST, + config + )); + } + + if (!auth && parsed.auth) { + var urlAuth = parsed.auth.split(':'); + var urlUsername = urlAuth[0] || ''; + var urlPassword = urlAuth[1] || ''; + auth = urlUsername + ':' + urlPassword; + } + + if (auth && headerNames.authorization) { + delete headers[headerNames.authorization]; + } + + var isHttpsRequest = isHttps.test(protocol); + var agent = isHttpsRequest ? config.httpsAgent : config.httpAgent; + + try { + buildURL(parsed.path, config.params, config.paramsSerializer).replace(/^\?/, ''); + } catch (err) { + var customErr = new Error(err.message); + customErr.config = config; + customErr.url = config.url; + customErr.exists = true; + reject(customErr); + } + + var options = { + path: buildURL(parsed.path, config.params, config.paramsSerializer).replace(/^\?/, ''), + method: config.method.toUpperCase(), + headers: headers, + agent: agent, + agents: { http: config.httpAgent, https: config.httpsAgent }, + auth: auth + }; + + if (config.socketPath) { + options.socketPath = config.socketPath; + } else { + options.hostname = parsed.hostname; + options.port = parsed.port; + } + + var proxy = config.proxy; + if (!proxy && proxy !== false) { + var proxyEnv = protocol.slice(0, -1) + '_proxy'; + var proxyUrl = process.env[proxyEnv] || process.env[proxyEnv.toUpperCase()]; + if (proxyUrl) { + var parsedProxyUrl = url.parse(proxyUrl); + var noProxyEnv = process.env.no_proxy || process.env.NO_PROXY; + var shouldProxy = true; + + if (noProxyEnv) { + var noProxy = noProxyEnv.split(',').map(function trim(s) { + return s.trim(); + }); + + shouldProxy = !noProxy.some(function proxyMatch(proxyElement) { + if (!proxyElement) { + return false; + } + if (proxyElement === '*') { + return true; + } + if (proxyElement[0] === '.' && + parsed.hostname.substr(parsed.hostname.length - proxyElement.length) === proxyElement) { + return true; + } + + return parsed.hostname === proxyElement; + }); + } + + if (shouldProxy) { + proxy = { + host: parsedProxyUrl.hostname, + port: parsedProxyUrl.port, + protocol: parsedProxyUrl.protocol + }; + + if (parsedProxyUrl.auth) { + var proxyUrlAuth = parsedProxyUrl.auth.split(':'); + proxy.auth = { + username: proxyUrlAuth[0], + password: proxyUrlAuth[1] + }; + } + } + } + } + + if (proxy) { + options.headers.host = parsed.hostname + (parsed.port ? ':' + parsed.port : ''); + setProxy(options, proxy, protocol + '//' + parsed.hostname + (parsed.port ? ':' + parsed.port : '') + options.path); + } + + var transport; + var isHttpsProxy = isHttpsRequest && (proxy ? isHttps.test(proxy.protocol) : true); + if (config.transport) { + transport = config.transport; + } else if (config.maxRedirects === 0) { + transport = isHttpsProxy ? https : http; + } else { + if (config.maxRedirects) { + options.maxRedirects = config.maxRedirects; + } + if (config.beforeRedirect) { + options.beforeRedirect = config.beforeRedirect; + } + transport = isHttpsProxy ? httpsFollow : httpFollow; + } + + if (config.maxBodyLength > -1) { + options.maxBodyLength = config.maxBodyLength; + } + + if (config.insecureHTTPParser) { + options.insecureHTTPParser = config.insecureHTTPParser; + } + + // Create the request + var req = transport.request(options, function handleResponse(res) { + if (req.aborted) return; + + // uncompress the response body transparently if required + var stream = res; + + // return the last request in case of redirects + var lastRequest = res.req || req; + + + // if no content, is HEAD request or decompress disabled we should not decompress + if (res.statusCode !== 204 && lastRequest.method !== 'HEAD' && config.decompress !== false) { + switch (res.headers['content-encoding']) { + /*eslint default-case:0*/ + case 'gzip': + case 'compress': + case 'deflate': + // add the unzipper to the body stream processing pipeline + stream = stream.pipe(zlib.createUnzip()); + + // remove the content-encoding in order to not confuse downstream operations + delete res.headers['content-encoding']; + break; + } + } + + var response = { + status: res.statusCode, + statusText: res.statusMessage, + headers: res.headers, + config: config, + request: lastRequest + }; + + if (config.responseType === 'stream') { + response.data = stream; + settle(resolve, reject, response); + } else { + var responseBuffer = []; + var totalResponseBytes = 0; + stream.on('data', function handleStreamData(chunk) { + responseBuffer.push(chunk); + totalResponseBytes += chunk.length; + + // make sure the content length is not over the maxContentLength if specified + if (config.maxContentLength > -1 && totalResponseBytes > config.maxContentLength) { + // stream.destoy() emit aborted event before calling reject() on Node.js v16 + rejected = true; + stream.destroy(); + reject(new AxiosError('maxContentLength size of ' + config.maxContentLength + ' exceeded', + AxiosError.ERR_BAD_RESPONSE, config, lastRequest)); + } + }); + + stream.on('aborted', function handlerStreamAborted() { + if (rejected) { + return; + } + stream.destroy(); + reject(new AxiosError( + 'maxContentLength size of ' + config.maxContentLength + ' exceeded', + AxiosError.ERR_BAD_RESPONSE, + config, + lastRequest + )); + }); + + stream.on('error', function handleStreamError(err) { + if (req.aborted) return; + reject(AxiosError.from(err, null, config, lastRequest)); + }); + + stream.on('end', function handleStreamEnd() { + try { + var responseData = responseBuffer.length === 1 ? responseBuffer[0] : Buffer.concat(responseBuffer); + if (config.responseType !== 'arraybuffer') { + responseData = responseData.toString(config.responseEncoding); + if (!config.responseEncoding || config.responseEncoding === 'utf8') { + responseData = utils.stripBOM(responseData); + } + } + response.data = responseData; + } catch (err) { + reject(AxiosError.from(err, null, config, response.request, response)); + } + settle(resolve, reject, response); + }); + } + }); + + // Handle errors + req.on('error', function handleRequestError(err) { + // @todo remove + // if (req.aborted && err.code !== AxiosError.ERR_FR_TOO_MANY_REDIRECTS) return; + reject(AxiosError.from(err, null, config, req)); + }); + + // set tcp keep alive to prevent drop connection by peer + req.on('socket', function handleRequestSocket(socket) { + // default interval of sending ack packet is 1 minute + socket.setKeepAlive(true, 1000 * 60); + }); + + // Handle request timeout + if (config.timeout) { + // This is forcing a int timeout to avoid problems if the `req` interface doesn't handle other types. + var timeout = parseInt(config.timeout, 10); + + if (isNaN(timeout)) { + reject(new AxiosError( + 'error trying to parse `config.timeout` to int', + AxiosError.ERR_BAD_OPTION_VALUE, + config, + req + )); + + return; + } + + // Sometime, the response will be very slow, and does not respond, the connect event will be block by event loop system. + // And timer callback will be fired, and abort() will be invoked before connection, then get "socket hang up" and code ECONNRESET. + // At this time, if we have a large number of request, nodejs will hang up some socket on background. and the number will up and up. + // And then these socket which be hang up will devoring CPU little by little. + // ClientRequest.setTimeout will be fired on the specify milliseconds, and can make sure that abort() will be fired after connect. + req.setTimeout(timeout, function handleRequestTimeout() { + req.abort(); + var transitional = config.transitional || transitionalDefaults; + reject(new AxiosError( + 'timeout of ' + timeout + 'ms exceeded', + transitional.clarifyTimeoutError ? AxiosError.ETIMEDOUT : AxiosError.ECONNABORTED, + config, + req + )); + }); + } + + if (config.cancelToken || config.signal) { + // Handle cancellation + // eslint-disable-next-line func-names + onCanceled = function(cancel) { + if (req.aborted) return; + + req.abort(); + reject(!cancel || (cancel && cancel.type) ? new CanceledError() : cancel); + }; + + config.cancelToken && config.cancelToken.subscribe(onCanceled); + if (config.signal) { + config.signal.aborted ? onCanceled() : config.signal.addEventListener('abort', onCanceled); + } + } + + + // Send the request + if (utils.isStream(data)) { + data.on('error', function handleStreamError(err) { + reject(AxiosError.from(err, config, null, req)); + }).pipe(req); + } else { + req.end(data); + } + }); +}; diff --git a/_nodejs/node_modules/axios/lib/adapters/xhr.js b/_nodejs/node_modules/axios/lib/adapters/xhr.js new file mode 100644 index 0000000..76d7e7a --- /dev/null +++ b/_nodejs/node_modules/axios/lib/adapters/xhr.js @@ -0,0 +1,222 @@ +'use strict'; + +var utils = require('./../utils'); +var settle = require('./../core/settle'); +var cookies = require('./../helpers/cookies'); +var buildURL = require('./../helpers/buildURL'); +var buildFullPath = require('../core/buildFullPath'); +var parseHeaders = require('./../helpers/parseHeaders'); +var isURLSameOrigin = require('./../helpers/isURLSameOrigin'); +var transitionalDefaults = require('../defaults/transitional'); +var AxiosError = require('../core/AxiosError'); +var CanceledError = require('../cancel/CanceledError'); +var parseProtocol = require('../helpers/parseProtocol'); + +module.exports = function xhrAdapter(config) { + return new Promise(function dispatchXhrRequest(resolve, reject) { + var requestData = config.data; + var requestHeaders = config.headers; + var responseType = config.responseType; + var onCanceled; + function done() { + if (config.cancelToken) { + config.cancelToken.unsubscribe(onCanceled); + } + + if (config.signal) { + config.signal.removeEventListener('abort', onCanceled); + } + } + + if (utils.isFormData(requestData) && utils.isStandardBrowserEnv()) { + delete requestHeaders['Content-Type']; // Let the browser set it + } + + var request = new XMLHttpRequest(); + + // HTTP basic authentication + if (config.auth) { + var username = config.auth.username || ''; + var password = config.auth.password ? unescape(encodeURIComponent(config.auth.password)) : ''; + requestHeaders.Authorization = 'Basic ' + btoa(username + ':' + password); + } + + var fullPath = buildFullPath(config.baseURL, config.url); + + request.open(config.method.toUpperCase(), buildURL(fullPath, config.params, config.paramsSerializer), true); + + // Set the request timeout in MS + request.timeout = config.timeout; + + function onloadend() { + if (!request) { + return; + } + // Prepare the response + var responseHeaders = 'getAllResponseHeaders' in request ? parseHeaders(request.getAllResponseHeaders()) : null; + var responseData = !responseType || responseType === 'text' || responseType === 'json' ? + request.responseText : request.response; + var response = { + data: responseData, + status: request.status, + statusText: request.statusText, + headers: responseHeaders, + config: config, + request: request + }; + + settle(function _resolve(value) { + resolve(value); + done(); + }, function _reject(err) { + reject(err); + done(); + }, response); + + // Clean up request + request = null; + } + + if ('onloadend' in request) { + // Use onloadend if available + request.onloadend = onloadend; + } else { + // Listen for ready state to emulate onloadend + request.onreadystatechange = function handleLoad() { + if (!request || request.readyState !== 4) { + return; + } + + // The request errored out and we didn't get a response, this will be + // handled by onerror instead + // With one exception: request that using file: protocol, most browsers + // will return status as 0 even though it's a successful request + if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) { + return; + } + // readystate handler is calling before onerror or ontimeout handlers, + // so we should call onloadend on the next 'tick' + setTimeout(onloadend); + }; + } + + // Handle browser request cancellation (as opposed to a manual cancellation) + request.onabort = function handleAbort() { + if (!request) { + return; + } + + reject(new AxiosError('Request aborted', AxiosError.ECONNABORTED, config, request)); + + // Clean up request + request = null; + }; + + // Handle low level network errors + request.onerror = function handleError() { + // Real errors are hidden from us by the browser + // onerror should only fire if it's a network error + reject(new AxiosError('Network Error', AxiosError.ERR_NETWORK, config, request, request)); + + // Clean up request + request = null; + }; + + // Handle timeout + request.ontimeout = function handleTimeout() { + var timeoutErrorMessage = config.timeout ? 'timeout of ' + config.timeout + 'ms exceeded' : 'timeout exceeded'; + var transitional = config.transitional || transitionalDefaults; + if (config.timeoutErrorMessage) { + timeoutErrorMessage = config.timeoutErrorMessage; + } + reject(new AxiosError( + timeoutErrorMessage, + transitional.clarifyTimeoutError ? AxiosError.ETIMEDOUT : AxiosError.ECONNABORTED, + config, + request)); + + // Clean up request + request = null; + }; + + // Add xsrf header + // This is only done if running in a standard browser environment. + // Specifically not if we're in a web worker, or react-native. + if (utils.isStandardBrowserEnv()) { + // Add xsrf header + var xsrfValue = (config.withCredentials || isURLSameOrigin(fullPath)) && config.xsrfCookieName ? + cookies.read(config.xsrfCookieName) : + undefined; + + if (xsrfValue) { + requestHeaders[config.xsrfHeaderName] = xsrfValue; + } + } + + // Add headers to the request + if ('setRequestHeader' in request) { + utils.forEach(requestHeaders, function setRequestHeader(val, key) { + if (typeof requestData === 'undefined' && key.toLowerCase() === 'content-type') { + // Remove Content-Type if data is undefined + delete requestHeaders[key]; + } else { + // Otherwise add header to the request + request.setRequestHeader(key, val); + } + }); + } + + // Add withCredentials to request if needed + if (!utils.isUndefined(config.withCredentials)) { + request.withCredentials = !!config.withCredentials; + } + + // Add responseType to request if needed + if (responseType && responseType !== 'json') { + request.responseType = config.responseType; + } + + // Handle progress if needed + if (typeof config.onDownloadProgress === 'function') { + request.addEventListener('progress', config.onDownloadProgress); + } + + // Not all browsers support upload events + if (typeof config.onUploadProgress === 'function' && request.upload) { + request.upload.addEventListener('progress', config.onUploadProgress); + } + + if (config.cancelToken || config.signal) { + // Handle cancellation + // eslint-disable-next-line func-names + onCanceled = function(cancel) { + if (!request) { + return; + } + reject(!cancel || (cancel && cancel.type) ? new CanceledError() : cancel); + request.abort(); + request = null; + }; + + config.cancelToken && config.cancelToken.subscribe(onCanceled); + if (config.signal) { + config.signal.aborted ? onCanceled() : config.signal.addEventListener('abort', onCanceled); + } + } + + if (!requestData) { + requestData = null; + } + + var protocol = parseProtocol(fullPath); + + if (protocol && [ 'http', 'https', 'file' ].indexOf(protocol) === -1) { + reject(new AxiosError('Unsupported protocol ' + protocol + ':', AxiosError.ERR_BAD_REQUEST, config)); + return; + } + + + // Send the request + request.send(requestData); + }); +}; diff --git a/_nodejs/node_modules/axios/lib/axios.js b/_nodejs/node_modules/axios/lib/axios.js new file mode 100644 index 0000000..cf6583c --- /dev/null +++ b/_nodejs/node_modules/axios/lib/axios.js @@ -0,0 +1,64 @@ +'use strict'; + +var utils = require('./utils'); +var bind = require('./helpers/bind'); +var Axios = require('./core/Axios'); +var mergeConfig = require('./core/mergeConfig'); +var defaults = require('./defaults'); + +/** + * Create an instance of Axios + * + * @param {Object} defaultConfig The default config for the instance + * @return {Axios} A new instance of Axios + */ +function createInstance(defaultConfig) { + var context = new Axios(defaultConfig); + var instance = bind(Axios.prototype.request, context); + + // Copy axios.prototype to instance + utils.extend(instance, Axios.prototype, context); + + // Copy context to instance + utils.extend(instance, context); + + // Factory for creating new instances + instance.create = function create(instanceConfig) { + return createInstance(mergeConfig(defaultConfig, instanceConfig)); + }; + + return instance; +} + +// Create the default instance to be exported +var axios = createInstance(defaults); + +// Expose Axios class to allow class inheritance +axios.Axios = Axios; + +// Expose Cancel & CancelToken +axios.CanceledError = require('./cancel/CanceledError'); +axios.CancelToken = require('./cancel/CancelToken'); +axios.isCancel = require('./cancel/isCancel'); +axios.VERSION = require('./env/data').version; +axios.toFormData = require('./helpers/toFormData'); + +// Expose AxiosError class +axios.AxiosError = require('../lib/core/AxiosError'); + +// alias for CanceledError for backward compatibility +axios.Cancel = axios.CanceledError; + +// Expose all/spread +axios.all = function all(promises) { + return Promise.all(promises); +}; +axios.spread = require('./helpers/spread'); + +// Expose isAxiosError +axios.isAxiosError = require('./helpers/isAxiosError'); + +module.exports = axios; + +// Allow use of default import syntax in TypeScript +module.exports.default = axios; diff --git a/_nodejs/node_modules/axios/lib/cancel/CancelToken.js b/_nodejs/node_modules/axios/lib/cancel/CancelToken.js new file mode 100644 index 0000000..ee7989f --- /dev/null +++ b/_nodejs/node_modules/axios/lib/cancel/CancelToken.js @@ -0,0 +1,119 @@ +'use strict'; + +var CanceledError = require('./CanceledError'); + +/** + * A `CancelToken` is an object that can be used to request cancellation of an operation. + * + * @class + * @param {Function} executor The executor function. + */ +function CancelToken(executor) { + if (typeof executor !== 'function') { + throw new TypeError('executor must be a function.'); + } + + var resolvePromise; + + this.promise = new Promise(function promiseExecutor(resolve) { + resolvePromise = resolve; + }); + + var token = this; + + // eslint-disable-next-line func-names + this.promise.then(function(cancel) { + if (!token._listeners) return; + + var i; + var l = token._listeners.length; + + for (i = 0; i < l; i++) { + token._listeners[i](cancel); + } + token._listeners = null; + }); + + // eslint-disable-next-line func-names + this.promise.then = function(onfulfilled) { + var _resolve; + // eslint-disable-next-line func-names + var promise = new Promise(function(resolve) { + token.subscribe(resolve); + _resolve = resolve; + }).then(onfulfilled); + + promise.cancel = function reject() { + token.unsubscribe(_resolve); + }; + + return promise; + }; + + executor(function cancel(message) { + if (token.reason) { + // Cancellation has already been requested + return; + } + + token.reason = new CanceledError(message); + resolvePromise(token.reason); + }); +} + +/** + * Throws a `CanceledError` if cancellation has been requested. + */ +CancelToken.prototype.throwIfRequested = function throwIfRequested() { + if (this.reason) { + throw this.reason; + } +}; + +/** + * Subscribe to the cancel signal + */ + +CancelToken.prototype.subscribe = function subscribe(listener) { + if (this.reason) { + listener(this.reason); + return; + } + + if (this._listeners) { + this._listeners.push(listener); + } else { + this._listeners = [listener]; + } +}; + +/** + * Unsubscribe from the cancel signal + */ + +CancelToken.prototype.unsubscribe = function unsubscribe(listener) { + if (!this._listeners) { + return; + } + var index = this._listeners.indexOf(listener); + if (index !== -1) { + this._listeners.splice(index, 1); + } +}; + +/** + * Returns an object that contains a new `CancelToken` and a function that, when called, + * cancels the `CancelToken`. + */ +CancelToken.source = function source() { + var cancel; + var token = new CancelToken(function executor(c) { + cancel = c; + }); + return { + token: token, + cancel: cancel + }; +}; + +module.exports = CancelToken; diff --git a/_nodejs/node_modules/axios/lib/cancel/CanceledError.js b/_nodejs/node_modules/axios/lib/cancel/CanceledError.js new file mode 100644 index 0000000..b7ceb02 --- /dev/null +++ b/_nodejs/node_modules/axios/lib/cancel/CanceledError.js @@ -0,0 +1,22 @@ +'use strict'; + +var AxiosError = require('../core/AxiosError'); +var utils = require('../utils'); + +/** + * A `CanceledError` is an object that is thrown when an operation is canceled. + * + * @class + * @param {string=} message The message. + */ +function CanceledError(message) { + // eslint-disable-next-line no-eq-null,eqeqeq + AxiosError.call(this, message == null ? 'canceled' : message, AxiosError.ERR_CANCELED); + this.name = 'CanceledError'; +} + +utils.inherits(CanceledError, AxiosError, { + __CANCEL__: true +}); + +module.exports = CanceledError; diff --git a/_nodejs/node_modules/axios/lib/cancel/isCancel.js b/_nodejs/node_modules/axios/lib/cancel/isCancel.js new file mode 100644 index 0000000..051f3ae --- /dev/null +++ b/_nodejs/node_modules/axios/lib/cancel/isCancel.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = function isCancel(value) { + return !!(value && value.__CANCEL__); +}; diff --git a/_nodejs/node_modules/axios/lib/core/Axios.js b/_nodejs/node_modules/axios/lib/core/Axios.js new file mode 100644 index 0000000..3a79171 --- /dev/null +++ b/_nodejs/node_modules/axios/lib/core/Axios.js @@ -0,0 +1,160 @@ +'use strict'; + +var utils = require('./../utils'); +var buildURL = require('../helpers/buildURL'); +var InterceptorManager = require('./InterceptorManager'); +var dispatchRequest = require('./dispatchRequest'); +var mergeConfig = require('./mergeConfig'); +var buildFullPath = require('./buildFullPath'); +var validator = require('../helpers/validator'); + +var validators = validator.validators; +/** + * Create a new instance of Axios + * + * @param {Object} instanceConfig The default config for the instance + */ +function Axios(instanceConfig) { + this.defaults = instanceConfig; + this.interceptors = { + request: new InterceptorManager(), + response: new InterceptorManager() + }; +} + +/** + * Dispatch a request + * + * @param {Object} config The config specific for this request (merged with this.defaults) + */ +Axios.prototype.request = function request(configOrUrl, config) { + /*eslint no-param-reassign:0*/ + // Allow for axios('example/url'[, config]) a la fetch API + if (typeof configOrUrl === 'string') { + config = config || {}; + config.url = configOrUrl; + } else { + config = configOrUrl || {}; + } + + config = mergeConfig(this.defaults, config); + + // Set config.method + if (config.method) { + config.method = config.method.toLowerCase(); + } else if (this.defaults.method) { + config.method = this.defaults.method.toLowerCase(); + } else { + config.method = 'get'; + } + + var transitional = config.transitional; + + if (transitional !== undefined) { + validator.assertOptions(transitional, { + silentJSONParsing: validators.transitional(validators.boolean), + forcedJSONParsing: validators.transitional(validators.boolean), + clarifyTimeoutError: validators.transitional(validators.boolean) + }, false); + } + + // filter out skipped interceptors + var requestInterceptorChain = []; + var synchronousRequestInterceptors = true; + this.interceptors.request.forEach(function unshiftRequestInterceptors(interceptor) { + if (typeof interceptor.runWhen === 'function' && interceptor.runWhen(config) === false) { + return; + } + + synchronousRequestInterceptors = synchronousRequestInterceptors && interceptor.synchronous; + + requestInterceptorChain.unshift(interceptor.fulfilled, interceptor.rejected); + }); + + var responseInterceptorChain = []; + this.interceptors.response.forEach(function pushResponseInterceptors(interceptor) { + responseInterceptorChain.push(interceptor.fulfilled, interceptor.rejected); + }); + + var promise; + + if (!synchronousRequestInterceptors) { + var chain = [dispatchRequest, undefined]; + + Array.prototype.unshift.apply(chain, requestInterceptorChain); + chain = chain.concat(responseInterceptorChain); + + promise = Promise.resolve(config); + while (chain.length) { + promise = promise.then(chain.shift(), chain.shift()); + } + + return promise; + } + + + var newConfig = config; + while (requestInterceptorChain.length) { + var onFulfilled = requestInterceptorChain.shift(); + var onRejected = requestInterceptorChain.shift(); + try { + newConfig = onFulfilled(newConfig); + } catch (error) { + onRejected(error); + break; + } + } + + try { + promise = dispatchRequest(newConfig); + } catch (error) { + return Promise.reject(error); + } + + while (responseInterceptorChain.length) { + promise = promise.then(responseInterceptorChain.shift(), responseInterceptorChain.shift()); + } + + return promise; +}; + +Axios.prototype.getUri = function getUri(config) { + config = mergeConfig(this.defaults, config); + var fullPath = buildFullPath(config.baseURL, config.url); + return buildURL(fullPath, config.params, config.paramsSerializer); +}; + +// Provide aliases for supported request methods +utils.forEach(['delete', 'get', 'head', 'options'], function forEachMethodNoData(method) { + /*eslint func-names:0*/ + Axios.prototype[method] = function(url, config) { + return this.request(mergeConfig(config || {}, { + method: method, + url: url, + data: (config || {}).data + })); + }; +}); + +utils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) { + /*eslint func-names:0*/ + + function generateHTTPMethod(isForm) { + return function httpMethod(url, data, config) { + return this.request(mergeConfig(config || {}, { + method: method, + headers: isForm ? { + 'Content-Type': 'multipart/form-data' + } : {}, + url: url, + data: data + })); + }; + } + + Axios.prototype[method] = generateHTTPMethod(); + + Axios.prototype[method + 'Form'] = generateHTTPMethod(true); +}); + +module.exports = Axios; diff --git a/_nodejs/node_modules/axios/lib/core/AxiosError.js b/_nodejs/node_modules/axios/lib/core/AxiosError.js new file mode 100644 index 0000000..52c806a --- /dev/null +++ b/_nodejs/node_modules/axios/lib/core/AxiosError.js @@ -0,0 +1,86 @@ +'use strict'; + +var utils = require('../utils'); + +/** + * Create an Error with the specified message, config, error code, request and response. + * + * @param {string} message The error message. + * @param {string} [code] The error code (for example, 'ECONNABORTED'). + * @param {Object} [config] The config. + * @param {Object} [request] The request. + * @param {Object} [response] The response. + * @returns {Error} The created error. + */ +function AxiosError(message, code, config, request, response) { + Error.call(this); + this.message = message; + this.name = 'AxiosError'; + code && (this.code = code); + config && (this.config = config); + request && (this.request = request); + response && (this.response = response); +} + +utils.inherits(AxiosError, Error, { + toJSON: function toJSON() { + return { + // Standard + message: this.message, + name: this.name, + // Microsoft + description: this.description, + number: this.number, + // Mozilla + fileName: this.fileName, + lineNumber: this.lineNumber, + columnNumber: this.columnNumber, + stack: this.stack, + // Axios + config: this.config, + code: this.code, + status: this.response && this.response.status ? this.response.status : null + }; + } +}); + +var prototype = AxiosError.prototype; +var descriptors = {}; + +[ + 'ERR_BAD_OPTION_VALUE', + 'ERR_BAD_OPTION', + 'ECONNABORTED', + 'ETIMEDOUT', + 'ERR_NETWORK', + 'ERR_FR_TOO_MANY_REDIRECTS', + 'ERR_DEPRECATED', + 'ERR_BAD_RESPONSE', + 'ERR_BAD_REQUEST', + 'ERR_CANCELED' +// eslint-disable-next-line func-names +].forEach(function(code) { + descriptors[code] = {value: code}; +}); + +Object.defineProperties(AxiosError, descriptors); +Object.defineProperty(prototype, 'isAxiosError', {value: true}); + +// eslint-disable-next-line func-names +AxiosError.from = function(error, code, config, request, response, customProps) { + var axiosError = Object.create(prototype); + + utils.toFlatObject(error, axiosError, function filter(obj) { + return obj !== Error.prototype; + }); + + AxiosError.call(axiosError, error.message, code, config, request, response); + + axiosError.name = error.name; + + customProps && Object.assign(axiosError, customProps); + + return axiosError; +}; + +module.exports = AxiosError; diff --git a/_nodejs/node_modules/axios/lib/core/InterceptorManager.js b/_nodejs/node_modules/axios/lib/core/InterceptorManager.js new file mode 100644 index 0000000..900f448 --- /dev/null +++ b/_nodejs/node_modules/axios/lib/core/InterceptorManager.js @@ -0,0 +1,54 @@ +'use strict'; + +var utils = require('./../utils'); + +function InterceptorManager() { + this.handlers = []; +} + +/** + * Add a new interceptor to the stack + * + * @param {Function} fulfilled The function to handle `then` for a `Promise` + * @param {Function} rejected The function to handle `reject` for a `Promise` + * + * @return {Number} An ID used to remove interceptor later + */ +InterceptorManager.prototype.use = function use(fulfilled, rejected, options) { + this.handlers.push({ + fulfilled: fulfilled, + rejected: rejected, + synchronous: options ? options.synchronous : false, + runWhen: options ? options.runWhen : null + }); + return this.handlers.length - 1; +}; + +/** + * Remove an interceptor from the stack + * + * @param {Number} id The ID that was returned by `use` + */ +InterceptorManager.prototype.eject = function eject(id) { + if (this.handlers[id]) { + this.handlers[id] = null; + } +}; + +/** + * Iterate over all the registered interceptors + * + * This method is particularly useful for skipping over any + * interceptors that may have become `null` calling `eject`. + * + * @param {Function} fn The function to call for each interceptor + */ +InterceptorManager.prototype.forEach = function forEach(fn) { + utils.forEach(this.handlers, function forEachHandler(h) { + if (h !== null) { + fn(h); + } + }); +}; + +module.exports = InterceptorManager; diff --git a/_nodejs/node_modules/axios/lib/core/README.md b/_nodejs/node_modules/axios/lib/core/README.md new file mode 100644 index 0000000..84559ce --- /dev/null +++ b/_nodejs/node_modules/axios/lib/core/README.md @@ -0,0 +1,8 @@ +# axios // core + +The modules found in `core/` should be modules that are specific to the domain logic of axios. These modules would most likely not make sense to be consumed outside of the axios module, as their logic is too specific. Some examples of core modules are: + +- Dispatching requests + - Requests sent via `adapters/` (see lib/adapters/README.md) +- Managing interceptors +- Handling config diff --git a/_nodejs/node_modules/axios/lib/core/buildFullPath.js b/_nodejs/node_modules/axios/lib/core/buildFullPath.js new file mode 100644 index 0000000..00b2b05 --- /dev/null +++ b/_nodejs/node_modules/axios/lib/core/buildFullPath.js @@ -0,0 +1,20 @@ +'use strict'; + +var isAbsoluteURL = require('../helpers/isAbsoluteURL'); +var combineURLs = require('../helpers/combineURLs'); + +/** + * Creates a new URL by combining the baseURL with the requestedURL, + * only when the requestedURL is not already an absolute URL. + * If the requestURL is absolute, this function returns the requestedURL untouched. + * + * @param {string} baseURL The base URL + * @param {string} requestedURL Absolute or relative URL to combine + * @returns {string} The combined full path + */ +module.exports = function buildFullPath(baseURL, requestedURL) { + if (baseURL && !isAbsoluteURL(requestedURL)) { + return combineURLs(baseURL, requestedURL); + } + return requestedURL; +}; diff --git a/_nodejs/node_modules/axios/lib/core/dispatchRequest.js b/_nodejs/node_modules/axios/lib/core/dispatchRequest.js new file mode 100644 index 0000000..fa1ad95 --- /dev/null +++ b/_nodejs/node_modules/axios/lib/core/dispatchRequest.js @@ -0,0 +1,87 @@ +'use strict'; + +var utils = require('./../utils'); +var transformData = require('./transformData'); +var isCancel = require('../cancel/isCancel'); +var defaults = require('../defaults'); +var CanceledError = require('../cancel/CanceledError'); + +/** + * Throws a `CanceledError` if cancellation has been requested. + */ +function throwIfCancellationRequested(config) { + if (config.cancelToken) { + config.cancelToken.throwIfRequested(); + } + + if (config.signal && config.signal.aborted) { + throw new CanceledError(); + } +} + +/** + * Dispatch a request to the server using the configured adapter. + * + * @param {object} config The config that is to be used for the request + * @returns {Promise} The Promise to be fulfilled + */ +module.exports = function dispatchRequest(config) { + throwIfCancellationRequested(config); + + // Ensure headers exist + config.headers = config.headers || {}; + + // Transform request data + config.data = transformData.call( + config, + config.data, + config.headers, + config.transformRequest + ); + + // Flatten headers + config.headers = utils.merge( + config.headers.common || {}, + config.headers[config.method] || {}, + config.headers + ); + + utils.forEach( + ['delete', 'get', 'head', 'post', 'put', 'patch', 'common'], + function cleanHeaderConfig(method) { + delete config.headers[method]; + } + ); + + var adapter = config.adapter || defaults.adapter; + + return adapter(config).then(function onAdapterResolution(response) { + throwIfCancellationRequested(config); + + // Transform response data + response.data = transformData.call( + config, + response.data, + response.headers, + config.transformResponse + ); + + return response; + }, function onAdapterRejection(reason) { + if (!isCancel(reason)) { + throwIfCancellationRequested(config); + + // Transform response data + if (reason && reason.response) { + reason.response.data = transformData.call( + config, + reason.response.data, + reason.response.headers, + config.transformResponse + ); + } + } + + return Promise.reject(reason); + }); +}; diff --git a/_nodejs/node_modules/axios/lib/core/mergeConfig.js b/_nodejs/node_modules/axios/lib/core/mergeConfig.js new file mode 100644 index 0000000..eb7aa39 --- /dev/null +++ b/_nodejs/node_modules/axios/lib/core/mergeConfig.js @@ -0,0 +1,100 @@ +'use strict'; + +var utils = require('../utils'); + +/** + * Config-specific merge-function which creates a new config-object + * by merging two configuration objects together. + * + * @param {Object} config1 + * @param {Object} config2 + * @returns {Object} New object resulting from merging config2 to config1 + */ +module.exports = function mergeConfig(config1, config2) { + // eslint-disable-next-line no-param-reassign + config2 = config2 || {}; + var config = {}; + + function getMergedValue(target, source) { + if (utils.isPlainObject(target) && utils.isPlainObject(source)) { + return utils.merge(target, source); + } else if (utils.isPlainObject(source)) { + return utils.merge({}, source); + } else if (utils.isArray(source)) { + return source.slice(); + } + return source; + } + + // eslint-disable-next-line consistent-return + function mergeDeepProperties(prop) { + if (!utils.isUndefined(config2[prop])) { + return getMergedValue(config1[prop], config2[prop]); + } else if (!utils.isUndefined(config1[prop])) { + return getMergedValue(undefined, config1[prop]); + } + } + + // eslint-disable-next-line consistent-return + function valueFromConfig2(prop) { + if (!utils.isUndefined(config2[prop])) { + return getMergedValue(undefined, config2[prop]); + } + } + + // eslint-disable-next-line consistent-return + function defaultToConfig2(prop) { + if (!utils.isUndefined(config2[prop])) { + return getMergedValue(undefined, config2[prop]); + } else if (!utils.isUndefined(config1[prop])) { + return getMergedValue(undefined, config1[prop]); + } + } + + // eslint-disable-next-line consistent-return + function mergeDirectKeys(prop) { + if (prop in config2) { + return getMergedValue(config1[prop], config2[prop]); + } else if (prop in config1) { + return getMergedValue(undefined, config1[prop]); + } + } + + var mergeMap = { + 'url': valueFromConfig2, + 'method': valueFromConfig2, + 'data': valueFromConfig2, + 'baseURL': defaultToConfig2, + 'transformRequest': defaultToConfig2, + 'transformResponse': defaultToConfig2, + 'paramsSerializer': defaultToConfig2, + 'timeout': defaultToConfig2, + 'timeoutMessage': defaultToConfig2, + 'withCredentials': defaultToConfig2, + 'adapter': defaultToConfig2, + 'responseType': defaultToConfig2, + 'xsrfCookieName': defaultToConfig2, + 'xsrfHeaderName': defaultToConfig2, + 'onUploadProgress': defaultToConfig2, + 'onDownloadProgress': defaultToConfig2, + 'decompress': defaultToConfig2, + 'maxContentLength': defaultToConfig2, + 'maxBodyLength': defaultToConfig2, + 'beforeRedirect': defaultToConfig2, + 'transport': defaultToConfig2, + 'httpAgent': defaultToConfig2, + 'httpsAgent': defaultToConfig2, + 'cancelToken': defaultToConfig2, + 'socketPath': defaultToConfig2, + 'responseEncoding': defaultToConfig2, + 'validateStatus': mergeDirectKeys + }; + + utils.forEach(Object.keys(config1).concat(Object.keys(config2)), function computeConfigValue(prop) { + var merge = mergeMap[prop] || mergeDeepProperties; + var configValue = merge(prop); + (utils.isUndefined(configValue) && merge !== mergeDirectKeys) || (config[prop] = configValue); + }); + + return config; +}; diff --git a/_nodejs/node_modules/axios/lib/core/settle.js b/_nodejs/node_modules/axios/lib/core/settle.js new file mode 100644 index 0000000..bbb9afa --- /dev/null +++ b/_nodejs/node_modules/axios/lib/core/settle.js @@ -0,0 +1,25 @@ +'use strict'; + +var AxiosError = require('./AxiosError'); + +/** + * Resolve or reject a Promise based on response status. + * + * @param {Function} resolve A function that resolves the promise. + * @param {Function} reject A function that rejects the promise. + * @param {object} response The response. + */ +module.exports = function settle(resolve, reject, response) { + var validateStatus = response.config.validateStatus; + if (!response.status || !validateStatus || validateStatus(response.status)) { + resolve(response); + } else { + reject(new AxiosError( + 'Request failed with status code ' + response.status, + [AxiosError.ERR_BAD_REQUEST, AxiosError.ERR_BAD_RESPONSE][Math.floor(response.status / 100) - 4], + response.config, + response.request, + response + )); + } +}; diff --git a/_nodejs/node_modules/axios/lib/core/transformData.js b/_nodejs/node_modules/axios/lib/core/transformData.js new file mode 100644 index 0000000..82ee7dd --- /dev/null +++ b/_nodejs/node_modules/axios/lib/core/transformData.js @@ -0,0 +1,22 @@ +'use strict'; + +var utils = require('./../utils'); +var defaults = require('../defaults'); + +/** + * Transform the data for a request or a response + * + * @param {Object|String} data The data to be transformed + * @param {Array} headers The headers for the request or response + * @param {Array|Function} fns A single function or Array of functions + * @returns {*} The resulting transformed data + */ +module.exports = function transformData(data, headers, fns) { + var context = this || defaults; + /*eslint no-param-reassign:0*/ + utils.forEach(fns, function transform(fn) { + data = fn.call(context, data, headers); + }); + + return data; +}; diff --git a/_nodejs/node_modules/axios/lib/defaults/env/FormData.js b/_nodejs/node_modules/axios/lib/defaults/env/FormData.js new file mode 100644 index 0000000..a8e6bdf --- /dev/null +++ b/_nodejs/node_modules/axios/lib/defaults/env/FormData.js @@ -0,0 +1,2 @@ +// eslint-disable-next-line strict +module.exports = require('form-data'); diff --git a/_nodejs/node_modules/axios/lib/defaults/index.js b/_nodejs/node_modules/axios/lib/defaults/index.js new file mode 100644 index 0000000..9199818 --- /dev/null +++ b/_nodejs/node_modules/axios/lib/defaults/index.js @@ -0,0 +1,146 @@ +'use strict'; + +var utils = require('../utils'); +var normalizeHeaderName = require('../helpers/normalizeHeaderName'); +var AxiosError = require('../core/AxiosError'); +var transitionalDefaults = require('./transitional'); +var toFormData = require('../helpers/toFormData'); + +var DEFAULT_CONTENT_TYPE = { + 'Content-Type': 'application/x-www-form-urlencoded' +}; + +function setContentTypeIfUnset(headers, value) { + if (!utils.isUndefined(headers) && utils.isUndefined(headers['Content-Type'])) { + headers['Content-Type'] = value; + } +} + +function getDefaultAdapter() { + var adapter; + if (typeof XMLHttpRequest !== 'undefined') { + // For browsers use XHR adapter + adapter = require('../adapters/xhr'); + } else if (typeof process !== 'undefined' && Object.prototype.toString.call(process) === '[object process]') { + // For node use HTTP adapter + adapter = require('../adapters/http'); + } + return adapter; +} + +function stringifySafely(rawValue, parser, encoder) { + if (utils.isString(rawValue)) { + try { + (parser || JSON.parse)(rawValue); + return utils.trim(rawValue); + } catch (e) { + if (e.name !== 'SyntaxError') { + throw e; + } + } + } + + return (encoder || JSON.stringify)(rawValue); +} + +var defaults = { + + transitional: transitionalDefaults, + + adapter: getDefaultAdapter(), + + transformRequest: [function transformRequest(data, headers) { + normalizeHeaderName(headers, 'Accept'); + normalizeHeaderName(headers, 'Content-Type'); + + if (utils.isFormData(data) || + utils.isArrayBuffer(data) || + utils.isBuffer(data) || + utils.isStream(data) || + utils.isFile(data) || + utils.isBlob(data) + ) { + return data; + } + if (utils.isArrayBufferView(data)) { + return data.buffer; + } + if (utils.isURLSearchParams(data)) { + setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8'); + return data.toString(); + } + + var isObjectPayload = utils.isObject(data); + var contentType = headers && headers['Content-Type']; + + var isFileList; + + if ((isFileList = utils.isFileList(data)) || (isObjectPayload && contentType === 'multipart/form-data')) { + var _FormData = this.env && this.env.FormData; + return toFormData(isFileList ? {'files[]': data} : data, _FormData && new _FormData()); + } else if (isObjectPayload || contentType === 'application/json') { + setContentTypeIfUnset(headers, 'application/json'); + return stringifySafely(data); + } + + return data; + }], + + transformResponse: [function transformResponse(data) { + var transitional = this.transitional || defaults.transitional; + var silentJSONParsing = transitional && transitional.silentJSONParsing; + var forcedJSONParsing = transitional && transitional.forcedJSONParsing; + var strictJSONParsing = !silentJSONParsing && this.responseType === 'json'; + + if (strictJSONParsing || (forcedJSONParsing && utils.isString(data) && data.length)) { + try { + return JSON.parse(data); + } catch (e) { + if (strictJSONParsing) { + if (e.name === 'SyntaxError') { + throw AxiosError.from(e, AxiosError.ERR_BAD_RESPONSE, this, null, this.response); + } + throw e; + } + } + } + + return data; + }], + + /** + * A timeout in milliseconds to abort a request. If set to 0 (default) a + * timeout is not created. + */ + timeout: 0, + + xsrfCookieName: 'XSRF-TOKEN', + xsrfHeaderName: 'X-XSRF-TOKEN', + + maxContentLength: -1, + maxBodyLength: -1, + + env: { + FormData: require('./env/FormData') + }, + + validateStatus: function validateStatus(status) { + return status >= 200 && status < 300; + }, + + headers: { + common: { + 'Accept': 'application/json, text/plain, */*' + } + } +}; + +utils.forEach(['delete', 'get', 'head'], function forEachMethodNoData(method) { + defaults.headers[method] = {}; +}); + +utils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) { + defaults.headers[method] = utils.merge(DEFAULT_CONTENT_TYPE); +}); + +module.exports = defaults; diff --git a/_nodejs/node_modules/axios/lib/defaults/transitional.js b/_nodejs/node_modules/axios/lib/defaults/transitional.js new file mode 100644 index 0000000..601dd7e --- /dev/null +++ b/_nodejs/node_modules/axios/lib/defaults/transitional.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = { + silentJSONParsing: true, + forcedJSONParsing: true, + clarifyTimeoutError: false +}; diff --git a/_nodejs/node_modules/axios/lib/env/README.md b/_nodejs/node_modules/axios/lib/env/README.md new file mode 100644 index 0000000..b41baff --- /dev/null +++ b/_nodejs/node_modules/axios/lib/env/README.md @@ -0,0 +1,3 @@ +# axios // env + +The `data.js` file is updated automatically when the package version is upgrading. Please do not edit it manually. diff --git a/_nodejs/node_modules/axios/lib/env/data.js b/_nodejs/node_modules/axios/lib/env/data.js new file mode 100644 index 0000000..62f7a0e --- /dev/null +++ b/_nodejs/node_modules/axios/lib/env/data.js @@ -0,0 +1,3 @@ +module.exports = { + "version": "0.27.2" +}; \ No newline at end of file diff --git a/_nodejs/node_modules/axios/lib/helpers/README.md b/_nodejs/node_modules/axios/lib/helpers/README.md new file mode 100644 index 0000000..4ae3419 --- /dev/null +++ b/_nodejs/node_modules/axios/lib/helpers/README.md @@ -0,0 +1,7 @@ +# axios // helpers + +The modules found in `helpers/` should be generic modules that are _not_ specific to the domain logic of axios. These modules could theoretically be published to npm on their own and consumed by other modules or apps. Some examples of generic modules are things like: + +- Browser polyfills +- Managing cookies +- Parsing HTTP headers diff --git a/_nodejs/node_modules/axios/lib/helpers/bind.js b/_nodejs/node_modules/axios/lib/helpers/bind.js new file mode 100644 index 0000000..6147c60 --- /dev/null +++ b/_nodejs/node_modules/axios/lib/helpers/bind.js @@ -0,0 +1,11 @@ +'use strict'; + +module.exports = function bind(fn, thisArg) { + return function wrap() { + var args = new Array(arguments.length); + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i]; + } + return fn.apply(thisArg, args); + }; +}; diff --git a/_nodejs/node_modules/axios/lib/helpers/buildURL.js b/_nodejs/node_modules/axios/lib/helpers/buildURL.js new file mode 100644 index 0000000..31595c3 --- /dev/null +++ b/_nodejs/node_modules/axios/lib/helpers/buildURL.js @@ -0,0 +1,70 @@ +'use strict'; + +var utils = require('./../utils'); + +function encode(val) { + return encodeURIComponent(val). + replace(/%3A/gi, ':'). + replace(/%24/g, '$'). + replace(/%2C/gi, ','). + replace(/%20/g, '+'). + replace(/%5B/gi, '['). + replace(/%5D/gi, ']'); +} + +/** + * Build a URL by appending params to the end + * + * @param {string} url The base of the url (e.g., http://www.google.com) + * @param {object} [params] The params to be appended + * @returns {string} The formatted url + */ +module.exports = function buildURL(url, params, paramsSerializer) { + /*eslint no-param-reassign:0*/ + if (!params) { + return url; + } + + var serializedParams; + if (paramsSerializer) { + serializedParams = paramsSerializer(params); + } else if (utils.isURLSearchParams(params)) { + serializedParams = params.toString(); + } else { + var parts = []; + + utils.forEach(params, function serialize(val, key) { + if (val === null || typeof val === 'undefined') { + return; + } + + if (utils.isArray(val)) { + key = key + '[]'; + } else { + val = [val]; + } + + utils.forEach(val, function parseValue(v) { + if (utils.isDate(v)) { + v = v.toISOString(); + } else if (utils.isObject(v)) { + v = JSON.stringify(v); + } + parts.push(encode(key) + '=' + encode(v)); + }); + }); + + serializedParams = parts.join('&'); + } + + if (serializedParams) { + var hashmarkIndex = url.indexOf('#'); + if (hashmarkIndex !== -1) { + url = url.slice(0, hashmarkIndex); + } + + url += (url.indexOf('?') === -1 ? '?' : '&') + serializedParams; + } + + return url; +}; diff --git a/_nodejs/node_modules/axios/lib/helpers/combineURLs.js b/_nodejs/node_modules/axios/lib/helpers/combineURLs.js new file mode 100644 index 0000000..f1b58a5 --- /dev/null +++ b/_nodejs/node_modules/axios/lib/helpers/combineURLs.js @@ -0,0 +1,14 @@ +'use strict'; + +/** + * Creates a new URL by combining the specified URLs + * + * @param {string} baseURL The base URL + * @param {string} relativeURL The relative URL + * @returns {string} The combined URL + */ +module.exports = function combineURLs(baseURL, relativeURL) { + return relativeURL + ? baseURL.replace(/\/+$/, '') + '/' + relativeURL.replace(/^\/+/, '') + : baseURL; +}; diff --git a/_nodejs/node_modules/axios/lib/helpers/cookies.js b/_nodejs/node_modules/axios/lib/helpers/cookies.js new file mode 100644 index 0000000..5a8a666 --- /dev/null +++ b/_nodejs/node_modules/axios/lib/helpers/cookies.js @@ -0,0 +1,53 @@ +'use strict'; + +var utils = require('./../utils'); + +module.exports = ( + utils.isStandardBrowserEnv() ? + + // Standard browser envs support document.cookie + (function standardBrowserEnv() { + return { + write: function write(name, value, expires, path, domain, secure) { + var cookie = []; + cookie.push(name + '=' + encodeURIComponent(value)); + + if (utils.isNumber(expires)) { + cookie.push('expires=' + new Date(expires).toGMTString()); + } + + if (utils.isString(path)) { + cookie.push('path=' + path); + } + + if (utils.isString(domain)) { + cookie.push('domain=' + domain); + } + + if (secure === true) { + cookie.push('secure'); + } + + document.cookie = cookie.join('; '); + }, + + read: function read(name) { + var match = document.cookie.match(new RegExp('(^|;\\s*)(' + name + ')=([^;]*)')); + return (match ? decodeURIComponent(match[3]) : null); + }, + + remove: function remove(name) { + this.write(name, '', Date.now() - 86400000); + } + }; + })() : + + // Non standard browser env (web workers, react-native) lack needed support. + (function nonStandardBrowserEnv() { + return { + write: function write() {}, + read: function read() { return null; }, + remove: function remove() {} + }; + })() +); diff --git a/_nodejs/node_modules/axios/lib/helpers/deprecatedMethod.js b/_nodejs/node_modules/axios/lib/helpers/deprecatedMethod.js new file mode 100644 index 0000000..ed40965 --- /dev/null +++ b/_nodejs/node_modules/axios/lib/helpers/deprecatedMethod.js @@ -0,0 +1,24 @@ +'use strict'; + +/*eslint no-console:0*/ + +/** + * Supply a warning to the developer that a method they are using + * has been deprecated. + * + * @param {string} method The name of the deprecated method + * @param {string} [instead] The alternate method to use if applicable + * @param {string} [docs] The documentation URL to get further details + */ +module.exports = function deprecatedMethod(method, instead, docs) { + try { + console.warn( + 'DEPRECATED method `' + method + '`.' + + (instead ? ' Use `' + instead + '` instead.' : '') + + ' This method will be removed in a future release.'); + + if (docs) { + console.warn('For more information about usage see ' + docs); + } + } catch (e) { /* Ignore */ } +}; diff --git a/_nodejs/node_modules/axios/lib/helpers/isAbsoluteURL.js b/_nodejs/node_modules/axios/lib/helpers/isAbsoluteURL.js new file mode 100644 index 0000000..43fea78 --- /dev/null +++ b/_nodejs/node_modules/axios/lib/helpers/isAbsoluteURL.js @@ -0,0 +1,14 @@ +'use strict'; + +/** + * Determines whether the specified URL is absolute + * + * @param {string} url The URL to test + * @returns {boolean} True if the specified URL is absolute, otherwise false + */ +module.exports = function isAbsoluteURL(url) { + // A URL is considered absolute if it begins with "://" or "//" (protocol-relative URL). + // RFC 3986 defines scheme name as a sequence of characters beginning with a letter and followed + // by any combination of letters, digits, plus, period, or hyphen. + return /^([a-z][a-z\d+\-.]*:)?\/\//i.test(url); +}; diff --git a/_nodejs/node_modules/axios/lib/helpers/isAxiosError.js b/_nodejs/node_modules/axios/lib/helpers/isAxiosError.js new file mode 100644 index 0000000..a037bec --- /dev/null +++ b/_nodejs/node_modules/axios/lib/helpers/isAxiosError.js @@ -0,0 +1,13 @@ +'use strict'; + +var utils = require('./../utils'); + +/** + * Determines whether the payload is an error thrown by Axios + * + * @param {*} payload The value to test + * @returns {boolean} True if the payload is an error thrown by Axios, otherwise false + */ +module.exports = function isAxiosError(payload) { + return utils.isObject(payload) && (payload.isAxiosError === true); +}; diff --git a/_nodejs/node_modules/axios/lib/helpers/isURLSameOrigin.js b/_nodejs/node_modules/axios/lib/helpers/isURLSameOrigin.js new file mode 100644 index 0000000..f1d89ad --- /dev/null +++ b/_nodejs/node_modules/axios/lib/helpers/isURLSameOrigin.js @@ -0,0 +1,68 @@ +'use strict'; + +var utils = require('./../utils'); + +module.exports = ( + utils.isStandardBrowserEnv() ? + + // Standard browser envs have full support of the APIs needed to test + // whether the request URL is of the same origin as current location. + (function standardBrowserEnv() { + var msie = /(msie|trident)/i.test(navigator.userAgent); + var urlParsingNode = document.createElement('a'); + var originURL; + + /** + * Parse a URL to discover it's components + * + * @param {String} url The URL to be parsed + * @returns {Object} + */ + function resolveURL(url) { + var href = url; + + if (msie) { + // IE needs attribute set twice to normalize properties + urlParsingNode.setAttribute('href', href); + href = urlParsingNode.href; + } + + urlParsingNode.setAttribute('href', href); + + // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils + return { + href: urlParsingNode.href, + protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '', + host: urlParsingNode.host, + search: urlParsingNode.search ? urlParsingNode.search.replace(/^\?/, '') : '', + hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '', + hostname: urlParsingNode.hostname, + port: urlParsingNode.port, + pathname: (urlParsingNode.pathname.charAt(0) === '/') ? + urlParsingNode.pathname : + '/' + urlParsingNode.pathname + }; + } + + originURL = resolveURL(window.location.href); + + /** + * Determine if a URL shares the same origin as the current location + * + * @param {String} requestURL The URL to test + * @returns {boolean} True if URL shares the same origin, otherwise false + */ + return function isURLSameOrigin(requestURL) { + var parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL; + return (parsed.protocol === originURL.protocol && + parsed.host === originURL.host); + }; + })() : + + // Non standard browser envs (web workers, react-native) lack needed support. + (function nonStandardBrowserEnv() { + return function isURLSameOrigin() { + return true; + }; + })() +); diff --git a/_nodejs/node_modules/axios/lib/helpers/normalizeHeaderName.js b/_nodejs/node_modules/axios/lib/helpers/normalizeHeaderName.js new file mode 100644 index 0000000..738c9fe --- /dev/null +++ b/_nodejs/node_modules/axios/lib/helpers/normalizeHeaderName.js @@ -0,0 +1,12 @@ +'use strict'; + +var utils = require('../utils'); + +module.exports = function normalizeHeaderName(headers, normalizedName) { + utils.forEach(headers, function processHeader(value, name) { + if (name !== normalizedName && name.toUpperCase() === normalizedName.toUpperCase()) { + headers[normalizedName] = value; + delete headers[name]; + } + }); +}; diff --git a/_nodejs/node_modules/axios/lib/helpers/null.js b/_nodejs/node_modules/axios/lib/helpers/null.js new file mode 100644 index 0000000..859bace --- /dev/null +++ b/_nodejs/node_modules/axios/lib/helpers/null.js @@ -0,0 +1,2 @@ +// eslint-disable-next-line strict +module.exports = null; diff --git a/_nodejs/node_modules/axios/lib/helpers/parseHeaders.js b/_nodejs/node_modules/axios/lib/helpers/parseHeaders.js new file mode 100644 index 0000000..8af2cc7 --- /dev/null +++ b/_nodejs/node_modules/axios/lib/helpers/parseHeaders.js @@ -0,0 +1,53 @@ +'use strict'; + +var utils = require('./../utils'); + +// Headers whose duplicates are ignored by node +// c.f. https://nodejs.org/api/http.html#http_message_headers +var ignoreDuplicateOf = [ + 'age', 'authorization', 'content-length', 'content-type', 'etag', + 'expires', 'from', 'host', 'if-modified-since', 'if-unmodified-since', + 'last-modified', 'location', 'max-forwards', 'proxy-authorization', + 'referer', 'retry-after', 'user-agent' +]; + +/** + * Parse headers into an object + * + * ``` + * Date: Wed, 27 Aug 2014 08:58:49 GMT + * Content-Type: application/json + * Connection: keep-alive + * Transfer-Encoding: chunked + * ``` + * + * @param {String} headers Headers needing to be parsed + * @returns {Object} Headers parsed into an object + */ +module.exports = function parseHeaders(headers) { + var parsed = {}; + var key; + var val; + var i; + + if (!headers) { return parsed; } + + utils.forEach(headers.split('\n'), function parser(line) { + i = line.indexOf(':'); + key = utils.trim(line.substr(0, i)).toLowerCase(); + val = utils.trim(line.substr(i + 1)); + + if (key) { + if (parsed[key] && ignoreDuplicateOf.indexOf(key) >= 0) { + return; + } + if (key === 'set-cookie') { + parsed[key] = (parsed[key] ? parsed[key] : []).concat([val]); + } else { + parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val; + } + } + }); + + return parsed; +}; diff --git a/_nodejs/node_modules/axios/lib/helpers/parseProtocol.js b/_nodejs/node_modules/axios/lib/helpers/parseProtocol.js new file mode 100644 index 0000000..10f3f02 --- /dev/null +++ b/_nodejs/node_modules/axios/lib/helpers/parseProtocol.js @@ -0,0 +1,6 @@ +'use strict'; + +module.exports = function parseProtocol(url) { + var match = /^([-+\w]{1,25})(:?\/\/|:)/.exec(url); + return match && match[1] || ''; +}; diff --git a/_nodejs/node_modules/axios/lib/helpers/spread.js b/_nodejs/node_modules/axios/lib/helpers/spread.js new file mode 100644 index 0000000..25e3cdd --- /dev/null +++ b/_nodejs/node_modules/axios/lib/helpers/spread.js @@ -0,0 +1,27 @@ +'use strict'; + +/** + * Syntactic sugar for invoking a function and expanding an array for arguments. + * + * Common use case would be to use `Function.prototype.apply`. + * + * ```js + * function f(x, y, z) {} + * var args = [1, 2, 3]; + * f.apply(null, args); + * ``` + * + * With `spread` this example can be re-written. + * + * ```js + * spread(function(x, y, z) {})([1, 2, 3]); + * ``` + * + * @param {Function} callback + * @returns {Function} + */ +module.exports = function spread(callback) { + return function wrap(arr) { + return callback.apply(null, arr); + }; +}; diff --git a/_nodejs/node_modules/axios/lib/helpers/toFormData.js b/_nodejs/node_modules/axios/lib/helpers/toFormData.js new file mode 100644 index 0000000..5e3cc0f --- /dev/null +++ b/_nodejs/node_modules/axios/lib/helpers/toFormData.js @@ -0,0 +1,72 @@ +'use strict'; + +var utils = require('../utils'); + +/** + * Convert a data object to FormData + * @param {Object} obj + * @param {?Object} [formData] + * @returns {Object} + **/ + +function toFormData(obj, formData) { + // eslint-disable-next-line no-param-reassign + formData = formData || new FormData(); + + var stack = []; + + function convertValue(value) { + if (value === null) return ''; + + if (utils.isDate(value)) { + return value.toISOString(); + } + + if (utils.isArrayBuffer(value) || utils.isTypedArray(value)) { + return typeof Blob === 'function' ? new Blob([value]) : Buffer.from(value); + } + + return value; + } + + function build(data, parentKey) { + if (utils.isPlainObject(data) || utils.isArray(data)) { + if (stack.indexOf(data) !== -1) { + throw Error('Circular reference detected in ' + parentKey); + } + + stack.push(data); + + utils.forEach(data, function each(value, key) { + if (utils.isUndefined(value)) return; + var fullKey = parentKey ? parentKey + '.' + key : key; + var arr; + + if (value && !parentKey && typeof value === 'object') { + if (utils.endsWith(key, '{}')) { + // eslint-disable-next-line no-param-reassign + value = JSON.stringify(value); + } else if (utils.endsWith(key, '[]') && (arr = utils.toArray(value))) { + // eslint-disable-next-line func-names + arr.forEach(function(el) { + !utils.isUndefined(el) && formData.append(fullKey, convertValue(el)); + }); + return; + } + } + + build(value, fullKey); + }); + + stack.pop(); + } else { + formData.append(parentKey, convertValue(data)); + } + } + + build(obj); + + return formData; +} + +module.exports = toFormData; diff --git a/_nodejs/node_modules/axios/lib/helpers/validator.js b/_nodejs/node_modules/axios/lib/helpers/validator.js new file mode 100644 index 0000000..8095b90 --- /dev/null +++ b/_nodejs/node_modules/axios/lib/helpers/validator.js @@ -0,0 +1,86 @@ +'use strict'; + +var VERSION = require('../env/data').version; +var AxiosError = require('../core/AxiosError'); + +var validators = {}; + +// eslint-disable-next-line func-names +['object', 'boolean', 'number', 'function', 'string', 'symbol'].forEach(function(type, i) { + validators[type] = function validator(thing) { + return typeof thing === type || 'a' + (i < 1 ? 'n ' : ' ') + type; + }; +}); + +var deprecatedWarnings = {}; + +/** + * Transitional option validator + * @param {function|boolean?} validator - set to false if the transitional option has been removed + * @param {string?} version - deprecated version / removed since version + * @param {string?} message - some message with additional info + * @returns {function} + */ +validators.transitional = function transitional(validator, version, message) { + function formatMessage(opt, desc) { + return '[Axios v' + VERSION + '] Transitional option \'' + opt + '\'' + desc + (message ? '. ' + message : ''); + } + + // eslint-disable-next-line func-names + return function(value, opt, opts) { + if (validator === false) { + throw new AxiosError( + formatMessage(opt, ' has been removed' + (version ? ' in ' + version : '')), + AxiosError.ERR_DEPRECATED + ); + } + + if (version && !deprecatedWarnings[opt]) { + deprecatedWarnings[opt] = true; + // eslint-disable-next-line no-console + console.warn( + formatMessage( + opt, + ' has been deprecated since v' + version + ' and will be removed in the near future' + ) + ); + } + + return validator ? validator(value, opt, opts) : true; + }; +}; + +/** + * Assert object's properties type + * @param {object} options + * @param {object} schema + * @param {boolean?} allowUnknown + */ + +function assertOptions(options, schema, allowUnknown) { + if (typeof options !== 'object') { + throw new AxiosError('options must be an object', AxiosError.ERR_BAD_OPTION_VALUE); + } + var keys = Object.keys(options); + var i = keys.length; + while (i-- > 0) { + var opt = keys[i]; + var validator = schema[opt]; + if (validator) { + var value = options[opt]; + var result = value === undefined || validator(value, opt, options); + if (result !== true) { + throw new AxiosError('option ' + opt + ' must be ' + result, AxiosError.ERR_BAD_OPTION_VALUE); + } + continue; + } + if (allowUnknown !== true) { + throw new AxiosError('Unknown option ' + opt, AxiosError.ERR_BAD_OPTION); + } + } +} + +module.exports = { + assertOptions: assertOptions, + validators: validators +}; diff --git a/_nodejs/node_modules/axios/lib/utils.js b/_nodejs/node_modules/axios/lib/utils.js new file mode 100644 index 0000000..18de154 --- /dev/null +++ b/_nodejs/node_modules/axios/lib/utils.js @@ -0,0 +1,470 @@ +'use strict'; + +var bind = require('./helpers/bind'); + +// utils is a library of generic helper functions non-specific to axios + +var toString = Object.prototype.toString; + +// eslint-disable-next-line func-names +var kindOf = (function(cache) { + // eslint-disable-next-line func-names + return function(thing) { + var str = toString.call(thing); + return cache[str] || (cache[str] = str.slice(8, -1).toLowerCase()); + }; +})(Object.create(null)); + +function kindOfTest(type) { + type = type.toLowerCase(); + return function isKindOf(thing) { + return kindOf(thing) === type; + }; +} + +/** + * Determine if a value is an Array + * + * @param {Object} val The value to test + * @returns {boolean} True if value is an Array, otherwise false + */ +function isArray(val) { + return Array.isArray(val); +} + +/** + * Determine if a value is undefined + * + * @param {Object} val The value to test + * @returns {boolean} True if the value is undefined, otherwise false + */ +function isUndefined(val) { + return typeof val === 'undefined'; +} + +/** + * Determine if a value is a Buffer + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Buffer, otherwise false + */ +function isBuffer(val) { + return val !== null && !isUndefined(val) && val.constructor !== null && !isUndefined(val.constructor) + && typeof val.constructor.isBuffer === 'function' && val.constructor.isBuffer(val); +} + +/** + * Determine if a value is an ArrayBuffer + * + * @function + * @param {Object} val The value to test + * @returns {boolean} True if value is an ArrayBuffer, otherwise false + */ +var isArrayBuffer = kindOfTest('ArrayBuffer'); + + +/** + * Determine if a value is a view on an ArrayBuffer + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a view on an ArrayBuffer, otherwise false + */ +function isArrayBufferView(val) { + var result; + if ((typeof ArrayBuffer !== 'undefined') && (ArrayBuffer.isView)) { + result = ArrayBuffer.isView(val); + } else { + result = (val) && (val.buffer) && (isArrayBuffer(val.buffer)); + } + return result; +} + +/** + * Determine if a value is a String + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a String, otherwise false + */ +function isString(val) { + return typeof val === 'string'; +} + +/** + * Determine if a value is a Number + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Number, otherwise false + */ +function isNumber(val) { + return typeof val === 'number'; +} + +/** + * Determine if a value is an Object + * + * @param {Object} val The value to test + * @returns {boolean} True if value is an Object, otherwise false + */ +function isObject(val) { + return val !== null && typeof val === 'object'; +} + +/** + * Determine if a value is a plain Object + * + * @param {Object} val The value to test + * @return {boolean} True if value is a plain Object, otherwise false + */ +function isPlainObject(val) { + if (kindOf(val) !== 'object') { + return false; + } + + var prototype = Object.getPrototypeOf(val); + return prototype === null || prototype === Object.prototype; +} + +/** + * Determine if a value is a Date + * + * @function + * @param {Object} val The value to test + * @returns {boolean} True if value is a Date, otherwise false + */ +var isDate = kindOfTest('Date'); + +/** + * Determine if a value is a File + * + * @function + * @param {Object} val The value to test + * @returns {boolean} True if value is a File, otherwise false + */ +var isFile = kindOfTest('File'); + +/** + * Determine if a value is a Blob + * + * @function + * @param {Object} val The value to test + * @returns {boolean} True if value is a Blob, otherwise false + */ +var isBlob = kindOfTest('Blob'); + +/** + * Determine if a value is a FileList + * + * @function + * @param {Object} val The value to test + * @returns {boolean} True if value is a File, otherwise false + */ +var isFileList = kindOfTest('FileList'); + +/** + * Determine if a value is a Function + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Function, otherwise false + */ +function isFunction(val) { + return toString.call(val) === '[object Function]'; +} + +/** + * Determine if a value is a Stream + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Stream, otherwise false + */ +function isStream(val) { + return isObject(val) && isFunction(val.pipe); +} + +/** + * Determine if a value is a FormData + * + * @param {Object} thing The value to test + * @returns {boolean} True if value is an FormData, otherwise false + */ +function isFormData(thing) { + var pattern = '[object FormData]'; + return thing && ( + (typeof FormData === 'function' && thing instanceof FormData) || + toString.call(thing) === pattern || + (isFunction(thing.toString) && thing.toString() === pattern) + ); +} + +/** + * Determine if a value is a URLSearchParams object + * @function + * @param {Object} val The value to test + * @returns {boolean} True if value is a URLSearchParams object, otherwise false + */ +var isURLSearchParams = kindOfTest('URLSearchParams'); + +/** + * Trim excess whitespace off the beginning and end of a string + * + * @param {String} str The String to trim + * @returns {String} The String freed of excess whitespace + */ +function trim(str) { + return str.trim ? str.trim() : str.replace(/^\s+|\s+$/g, ''); +} + +/** + * Determine if we're running in a standard browser environment + * + * This allows axios to run in a web worker, and react-native. + * Both environments support XMLHttpRequest, but not fully standard globals. + * + * web workers: + * typeof window -> undefined + * typeof document -> undefined + * + * react-native: + * navigator.product -> 'ReactNative' + * nativescript + * navigator.product -> 'NativeScript' or 'NS' + */ +function isStandardBrowserEnv() { + if (typeof navigator !== 'undefined' && (navigator.product === 'ReactNative' || + navigator.product === 'NativeScript' || + navigator.product === 'NS')) { + return false; + } + return ( + typeof window !== 'undefined' && + typeof document !== 'undefined' + ); +} + +/** + * Iterate over an Array or an Object invoking a function for each item. + * + * If `obj` is an Array callback will be called passing + * the value, index, and complete array for each item. + * + * If 'obj' is an Object callback will be called passing + * the value, key, and complete object for each property. + * + * @param {Object|Array} obj The object to iterate + * @param {Function} fn The callback to invoke for each item + */ +function forEach(obj, fn) { + // Don't bother if no value provided + if (obj === null || typeof obj === 'undefined') { + return; + } + + // Force an array if not already something iterable + if (typeof obj !== 'object') { + /*eslint no-param-reassign:0*/ + obj = [obj]; + } + + if (isArray(obj)) { + // Iterate over array values + for (var i = 0, l = obj.length; i < l; i++) { + fn.call(null, obj[i], i, obj); + } + } else { + // Iterate over object keys + for (var key in obj) { + if (Object.prototype.hasOwnProperty.call(obj, key)) { + fn.call(null, obj[key], key, obj); + } + } + } +} + +/** + * Accepts varargs expecting each argument to be an object, then + * immutably merges the properties of each object and returns result. + * + * When multiple objects contain the same key the later object in + * the arguments list will take precedence. + * + * Example: + * + * ```js + * var result = merge({foo: 123}, {foo: 456}); + * console.log(result.foo); // outputs 456 + * ``` + * + * @param {Object} obj1 Object to merge + * @returns {Object} Result of all merge properties + */ +function merge(/* obj1, obj2, obj3, ... */) { + var result = {}; + function assignValue(val, key) { + if (isPlainObject(result[key]) && isPlainObject(val)) { + result[key] = merge(result[key], val); + } else if (isPlainObject(val)) { + result[key] = merge({}, val); + } else if (isArray(val)) { + result[key] = val.slice(); + } else { + result[key] = val; + } + } + + for (var i = 0, l = arguments.length; i < l; i++) { + forEach(arguments[i], assignValue); + } + return result; +} + +/** + * Extends object a by mutably adding to it the properties of object b. + * + * @param {Object} a The object to be extended + * @param {Object} b The object to copy properties from + * @param {Object} thisArg The object to bind function to + * @return {Object} The resulting value of object a + */ +function extend(a, b, thisArg) { + forEach(b, function assignValue(val, key) { + if (thisArg && typeof val === 'function') { + a[key] = bind(val, thisArg); + } else { + a[key] = val; + } + }); + return a; +} + +/** + * Remove byte order marker. This catches EF BB BF (the UTF-8 BOM) + * + * @param {string} content with BOM + * @return {string} content value without BOM + */ +function stripBOM(content) { + if (content.charCodeAt(0) === 0xFEFF) { + content = content.slice(1); + } + return content; +} + +/** + * Inherit the prototype methods from one constructor into another + * @param {function} constructor + * @param {function} superConstructor + * @param {object} [props] + * @param {object} [descriptors] + */ + +function inherits(constructor, superConstructor, props, descriptors) { + constructor.prototype = Object.create(superConstructor.prototype, descriptors); + constructor.prototype.constructor = constructor; + props && Object.assign(constructor.prototype, props); +} + +/** + * Resolve object with deep prototype chain to a flat object + * @param {Object} sourceObj source object + * @param {Object} [destObj] + * @param {Function} [filter] + * @returns {Object} + */ + +function toFlatObject(sourceObj, destObj, filter) { + var props; + var i; + var prop; + var merged = {}; + + destObj = destObj || {}; + + do { + props = Object.getOwnPropertyNames(sourceObj); + i = props.length; + while (i-- > 0) { + prop = props[i]; + if (!merged[prop]) { + destObj[prop] = sourceObj[prop]; + merged[prop] = true; + } + } + sourceObj = Object.getPrototypeOf(sourceObj); + } while (sourceObj && (!filter || filter(sourceObj, destObj)) && sourceObj !== Object.prototype); + + return destObj; +} + +/* + * determines whether a string ends with the characters of a specified string + * @param {String} str + * @param {String} searchString + * @param {Number} [position= 0] + * @returns {boolean} + */ +function endsWith(str, searchString, position) { + str = String(str); + if (position === undefined || position > str.length) { + position = str.length; + } + position -= searchString.length; + var lastIndex = str.indexOf(searchString, position); + return lastIndex !== -1 && lastIndex === position; +} + + +/** + * Returns new array from array like object + * @param {*} [thing] + * @returns {Array} + */ +function toArray(thing) { + if (!thing) return null; + var i = thing.length; + if (isUndefined(i)) return null; + var arr = new Array(i); + while (i-- > 0) { + arr[i] = thing[i]; + } + return arr; +} + +// eslint-disable-next-line func-names +var isTypedArray = (function(TypedArray) { + // eslint-disable-next-line func-names + return function(thing) { + return TypedArray && thing instanceof TypedArray; + }; +})(typeof Uint8Array !== 'undefined' && Object.getPrototypeOf(Uint8Array)); + +module.exports = { + isArray: isArray, + isArrayBuffer: isArrayBuffer, + isBuffer: isBuffer, + isFormData: isFormData, + isArrayBufferView: isArrayBufferView, + isString: isString, + isNumber: isNumber, + isObject: isObject, + isPlainObject: isPlainObject, + isUndefined: isUndefined, + isDate: isDate, + isFile: isFile, + isBlob: isBlob, + isFunction: isFunction, + isStream: isStream, + isURLSearchParams: isURLSearchParams, + isStandardBrowserEnv: isStandardBrowserEnv, + forEach: forEach, + merge: merge, + extend: extend, + trim: trim, + stripBOM: stripBOM, + inherits: inherits, + toFlatObject: toFlatObject, + kindOf: kindOf, + kindOfTest: kindOfTest, + endsWith: endsWith, + toArray: toArray, + isTypedArray: isTypedArray, + isFileList: isFileList +}; diff --git a/_nodejs/node_modules/axios/package.json b/_nodejs/node_modules/axios/package.json new file mode 100644 index 0000000..ffd98e6 --- /dev/null +++ b/_nodejs/node_modules/axios/package.json @@ -0,0 +1,87 @@ +{ + "name": "axios", + "version": "0.27.2", + "description": "Promise based HTTP client for the browser and node.js", + "main": "index.js", + "types": "index.d.ts", + "scripts": { + "test": "grunt test && dtslint", + "start": "node ./sandbox/server.js", + "preversion": "grunt version && npm test", + "build": "NODE_ENV=production grunt build", + "examples": "node ./examples/server.js", + "coveralls": "cat coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js", + "fix": "eslint --fix lib/**/*.js" + }, + "repository": { + "type": "git", + "url": "https://github.com/axios/axios.git" + }, + "keywords": [ + "xhr", + "http", + "ajax", + "promise", + "node" + ], + "author": "Matt Zabriskie", + "license": "MIT", + "bugs": { + "url": "https://github.com/axios/axios/issues" + }, + "homepage": "https://axios-http.com", + "devDependencies": { + "abortcontroller-polyfill": "^1.7.3", + "coveralls": "^3.1.1", + "dtslint": "^4.2.1", + "es6-promise": "^4.2.8", + "formidable": "^2.0.1", + "grunt": "^1.4.1", + "grunt-banner": "^0.6.0", + "grunt-cli": "^1.4.3", + "grunt-contrib-clean": "^2.0.0", + "grunt-contrib-watch": "^1.1.0", + "grunt-eslint": "^24.0.0", + "grunt-karma": "^4.0.2", + "grunt-mocha-test": "^0.13.3", + "grunt-webpack": "^5.0.0", + "istanbul-instrumenter-loader": "^3.0.1", + "jasmine-core": "^2.4.1", + "karma": "^6.3.17", + "karma-chrome-launcher": "^3.1.1", + "karma-firefox-launcher": "^2.1.2", + "karma-jasmine": "^1.1.1", + "karma-jasmine-ajax": "^0.1.13", + "karma-safari-launcher": "^1.0.0", + "karma-sauce-launcher": "^4.3.6", + "karma-sinon": "^1.0.5", + "karma-sourcemap-loader": "^0.3.8", + "karma-webpack": "^4.0.2", + "load-grunt-tasks": "^5.1.0", + "minimist": "^1.2.6", + "mocha": "^8.2.1", + "sinon": "^4.5.0", + "terser-webpack-plugin": "^4.2.3", + "typescript": "^4.6.3", + "url-search-params": "^0.10.0", + "webpack": "^4.44.2", + "webpack-dev-server": "^3.11.0" + }, + "browser": { + "./lib/adapters/http.js": "./lib/adapters/xhr.js", + "./lib/defaults/env/FormData.js": "./lib/helpers/null.js" + }, + "jsdelivr": "dist/axios.min.js", + "unpkg": "dist/axios.min.js", + "typings": "./index.d.ts", + "dependencies": { + "follow-redirects": "^1.14.9", + "form-data": "^4.0.0" + }, + "bundlesize": [ + { + "path": "./dist/axios.min.js", + "threshold": "5kB" + } + ] +} diff --git a/_nodejs/node_modules/axios/tsconfig.json b/_nodejs/node_modules/axios/tsconfig.json new file mode 100644 index 0000000..6665188 --- /dev/null +++ b/_nodejs/node_modules/axios/tsconfig.json @@ -0,0 +1,14 @@ +{ + "compilerOptions": { + "module": "es2015", + "lib": ["dom", "es2015"], + "types": [], + "moduleResolution": "node", + "strict": true, + "noEmit": true, + "baseUrl": ".", + "paths": { + "axios": ["."] + } + } +} diff --git a/_nodejs/node_modules/axios/tslint.json b/_nodejs/node_modules/axios/tslint.json new file mode 100644 index 0000000..3ec44a7 --- /dev/null +++ b/_nodejs/node_modules/axios/tslint.json @@ -0,0 +1,6 @@ +{ + "extends": "dtslint/dtslint.json", + "rules": { + "no-unnecessary-generics": false + } +} diff --git a/_nodejs/node_modules/combined-stream/License b/_nodejs/node_modules/combined-stream/License new file mode 100644 index 0000000..4804b7a --- /dev/null +++ b/_nodejs/node_modules/combined-stream/License @@ -0,0 +1,19 @@ +Copyright (c) 2011 Debuggable Limited + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/_nodejs/node_modules/combined-stream/Readme.md b/_nodejs/node_modules/combined-stream/Readme.md new file mode 100644 index 0000000..9e367b5 --- /dev/null +++ b/_nodejs/node_modules/combined-stream/Readme.md @@ -0,0 +1,138 @@ +# combined-stream + +A stream that emits multiple other streams one after another. + +**NB** Currently `combined-stream` works with streams version 1 only. There is ongoing effort to switch this library to streams version 2. Any help is welcome. :) Meanwhile you can explore other libraries that provide streams2 support with more or less compatibility with `combined-stream`. + +- [combined-stream2](https://www.npmjs.com/package/combined-stream2): A drop-in streams2-compatible replacement for the combined-stream module. + +- [multistream](https://www.npmjs.com/package/multistream): A stream that emits multiple other streams one after another. + +## Installation + +``` bash +npm install combined-stream +``` + +## Usage + +Here is a simple example that shows how you can use combined-stream to combine +two files into one: + +``` javascript +var CombinedStream = require('combined-stream'); +var fs = require('fs'); + +var combinedStream = CombinedStream.create(); +combinedStream.append(fs.createReadStream('file1.txt')); +combinedStream.append(fs.createReadStream('file2.txt')); + +combinedStream.pipe(fs.createWriteStream('combined.txt')); +``` + +While the example above works great, it will pause all source streams until +they are needed. If you don't want that to happen, you can set `pauseStreams` +to `false`: + +``` javascript +var CombinedStream = require('combined-stream'); +var fs = require('fs'); + +var combinedStream = CombinedStream.create({pauseStreams: false}); +combinedStream.append(fs.createReadStream('file1.txt')); +combinedStream.append(fs.createReadStream('file2.txt')); + +combinedStream.pipe(fs.createWriteStream('combined.txt')); +``` + +However, what if you don't have all the source streams yet, or you don't want +to allocate the resources (file descriptors, memory, etc.) for them right away? +Well, in that case you can simply provide a callback that supplies the stream +by calling a `next()` function: + +``` javascript +var CombinedStream = require('combined-stream'); +var fs = require('fs'); + +var combinedStream = CombinedStream.create(); +combinedStream.append(function(next) { + next(fs.createReadStream('file1.txt')); +}); +combinedStream.append(function(next) { + next(fs.createReadStream('file2.txt')); +}); + +combinedStream.pipe(fs.createWriteStream('combined.txt')); +``` + +## API + +### CombinedStream.create([options]) + +Returns a new combined stream object. Available options are: + +* `maxDataSize` +* `pauseStreams` + +The effect of those options is described below. + +### combinedStream.pauseStreams = `true` + +Whether to apply back pressure to the underlaying streams. If set to `false`, +the underlaying streams will never be paused. If set to `true`, the +underlaying streams will be paused right after being appended, as well as when +`delayedStream.pipe()` wants to throttle. + +### combinedStream.maxDataSize = `2 * 1024 * 1024` + +The maximum amount of bytes (or characters) to buffer for all source streams. +If this value is exceeded, `combinedStream` emits an `'error'` event. + +### combinedStream.dataSize = `0` + +The amount of bytes (or characters) currently buffered by `combinedStream`. + +### combinedStream.append(stream) + +Appends the given `stream` to the combinedStream object. If `pauseStreams` is +set to `true, this stream will also be paused right away. + +`streams` can also be a function that takes one parameter called `next`. `next` +is a function that must be invoked in order to provide the `next` stream, see +example above. + +Regardless of how the `stream` is appended, combined-stream always attaches an +`'error'` listener to it, so you don't have to do that manually. + +Special case: `stream` can also be a String or Buffer. + +### combinedStream.write(data) + +You should not call this, `combinedStream` takes care of piping the appended +streams into itself for you. + +### combinedStream.resume() + +Causes `combinedStream` to start drain the streams it manages. The function is +idempotent, and also emits a `'resume'` event each time which usually goes to +the stream that is currently being drained. + +### combinedStream.pause(); + +If `combinedStream.pauseStreams` is set to `false`, this does nothing. +Otherwise a `'pause'` event is emitted, this goes to the stream that is +currently being drained, so you can use it to apply back pressure. + +### combinedStream.end(); + +Sets `combinedStream.writable` to false, emits an `'end'` event, and removes +all streams from the queue. + +### combinedStream.destroy(); + +Same as `combinedStream.end()`, except it emits a `'close'` event instead of +`'end'`. + +## License + +combined-stream is licensed under the MIT license. diff --git a/_nodejs/node_modules/combined-stream/lib/combined_stream.js b/_nodejs/node_modules/combined-stream/lib/combined_stream.js new file mode 100644 index 0000000..125f097 --- /dev/null +++ b/_nodejs/node_modules/combined-stream/lib/combined_stream.js @@ -0,0 +1,208 @@ +var util = require('util'); +var Stream = require('stream').Stream; +var DelayedStream = require('delayed-stream'); + +module.exports = CombinedStream; +function CombinedStream() { + this.writable = false; + this.readable = true; + this.dataSize = 0; + this.maxDataSize = 2 * 1024 * 1024; + this.pauseStreams = true; + + this._released = false; + this._streams = []; + this._currentStream = null; + this._insideLoop = false; + this._pendingNext = false; +} +util.inherits(CombinedStream, Stream); + +CombinedStream.create = function(options) { + var combinedStream = new this(); + + options = options || {}; + for (var option in options) { + combinedStream[option] = options[option]; + } + + return combinedStream; +}; + +CombinedStream.isStreamLike = function(stream) { + return (typeof stream !== 'function') + && (typeof stream !== 'string') + && (typeof stream !== 'boolean') + && (typeof stream !== 'number') + && (!Buffer.isBuffer(stream)); +}; + +CombinedStream.prototype.append = function(stream) { + var isStreamLike = CombinedStream.isStreamLike(stream); + + if (isStreamLike) { + if (!(stream instanceof DelayedStream)) { + var newStream = DelayedStream.create(stream, { + maxDataSize: Infinity, + pauseStream: this.pauseStreams, + }); + stream.on('data', this._checkDataSize.bind(this)); + stream = newStream; + } + + this._handleErrors(stream); + + if (this.pauseStreams) { + stream.pause(); + } + } + + this._streams.push(stream); + return this; +}; + +CombinedStream.prototype.pipe = function(dest, options) { + Stream.prototype.pipe.call(this, dest, options); + this.resume(); + return dest; +}; + +CombinedStream.prototype._getNext = function() { + this._currentStream = null; + + if (this._insideLoop) { + this._pendingNext = true; + return; // defer call + } + + this._insideLoop = true; + try { + do { + this._pendingNext = false; + this._realGetNext(); + } while (this._pendingNext); + } finally { + this._insideLoop = false; + } +}; + +CombinedStream.prototype._realGetNext = function() { + var stream = this._streams.shift(); + + + if (typeof stream == 'undefined') { + this.end(); + return; + } + + if (typeof stream !== 'function') { + this._pipeNext(stream); + return; + } + + var getStream = stream; + getStream(function(stream) { + var isStreamLike = CombinedStream.isStreamLike(stream); + if (isStreamLike) { + stream.on('data', this._checkDataSize.bind(this)); + this._handleErrors(stream); + } + + this._pipeNext(stream); + }.bind(this)); +}; + +CombinedStream.prototype._pipeNext = function(stream) { + this._currentStream = stream; + + var isStreamLike = CombinedStream.isStreamLike(stream); + if (isStreamLike) { + stream.on('end', this._getNext.bind(this)); + stream.pipe(this, {end: false}); + return; + } + + var value = stream; + this.write(value); + this._getNext(); +}; + +CombinedStream.prototype._handleErrors = function(stream) { + var self = this; + stream.on('error', function(err) { + self._emitError(err); + }); +}; + +CombinedStream.prototype.write = function(data) { + this.emit('data', data); +}; + +CombinedStream.prototype.pause = function() { + if (!this.pauseStreams) { + return; + } + + if(this.pauseStreams && this._currentStream && typeof(this._currentStream.pause) == 'function') this._currentStream.pause(); + this.emit('pause'); +}; + +CombinedStream.prototype.resume = function() { + if (!this._released) { + this._released = true; + this.writable = true; + this._getNext(); + } + + if(this.pauseStreams && this._currentStream && typeof(this._currentStream.resume) == 'function') this._currentStream.resume(); + this.emit('resume'); +}; + +CombinedStream.prototype.end = function() { + this._reset(); + this.emit('end'); +}; + +CombinedStream.prototype.destroy = function() { + this._reset(); + this.emit('close'); +}; + +CombinedStream.prototype._reset = function() { + this.writable = false; + this._streams = []; + this._currentStream = null; +}; + +CombinedStream.prototype._checkDataSize = function() { + this._updateDataSize(); + if (this.dataSize <= this.maxDataSize) { + return; + } + + var message = + 'DelayedStream#maxDataSize of ' + this.maxDataSize + ' bytes exceeded.'; + this._emitError(new Error(message)); +}; + +CombinedStream.prototype._updateDataSize = function() { + this.dataSize = 0; + + var self = this; + this._streams.forEach(function(stream) { + if (!stream.dataSize) { + return; + } + + self.dataSize += stream.dataSize; + }); + + if (this._currentStream && this._currentStream.dataSize) { + this.dataSize += this._currentStream.dataSize; + } +}; + +CombinedStream.prototype._emitError = function(err) { + this._reset(); + this.emit('error', err); +}; diff --git a/_nodejs/node_modules/combined-stream/package.json b/_nodejs/node_modules/combined-stream/package.json new file mode 100644 index 0000000..6982b6d --- /dev/null +++ b/_nodejs/node_modules/combined-stream/package.json @@ -0,0 +1,25 @@ +{ + "author": "Felix Geisendörfer (http://debuggable.com/)", + "name": "combined-stream", + "description": "A stream that emits multiple other streams one after another.", + "version": "1.0.8", + "homepage": "https://github.com/felixge/node-combined-stream", + "repository": { + "type": "git", + "url": "git://github.com/felixge/node-combined-stream.git" + }, + "main": "./lib/combined_stream", + "scripts": { + "test": "node test/run.js" + }, + "engines": { + "node": ">= 0.8" + }, + "dependencies": { + "delayed-stream": "~1.0.0" + }, + "devDependencies": { + "far": "~0.0.7" + }, + "license": "MIT" +} diff --git a/_nodejs/node_modules/combined-stream/yarn.lock b/_nodejs/node_modules/combined-stream/yarn.lock new file mode 100644 index 0000000..7edf418 --- /dev/null +++ b/_nodejs/node_modules/combined-stream/yarn.lock @@ -0,0 +1,17 @@ +# THIS IS AN AUTOGENERATED FILE. DO NOT EDIT THIS FILE DIRECTLY. +# yarn lockfile v1 + + +delayed-stream@~1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/delayed-stream/-/delayed-stream-1.0.0.tgz#df3ae199acadfb7d440aaae0b29e2272b24ec619" + +far@~0.0.7: + version "0.0.7" + resolved "https://registry.yarnpkg.com/far/-/far-0.0.7.tgz#01c1fd362bcd26ce9cf161af3938aa34619f79a7" + dependencies: + oop "0.0.3" + +oop@0.0.3: + version "0.0.3" + resolved "https://registry.yarnpkg.com/oop/-/oop-0.0.3.tgz#70fa405a5650891a194fdc82ca68dad6dabf4401" diff --git a/_nodejs/node_modules/delayed-stream/.npmignore b/_nodejs/node_modules/delayed-stream/.npmignore new file mode 100644 index 0000000..9daeafb --- /dev/null +++ b/_nodejs/node_modules/delayed-stream/.npmignore @@ -0,0 +1 @@ +test diff --git a/_nodejs/node_modules/delayed-stream/License b/_nodejs/node_modules/delayed-stream/License new file mode 100644 index 0000000..4804b7a --- /dev/null +++ b/_nodejs/node_modules/delayed-stream/License @@ -0,0 +1,19 @@ +Copyright (c) 2011 Debuggable Limited + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/_nodejs/node_modules/delayed-stream/Makefile b/_nodejs/node_modules/delayed-stream/Makefile new file mode 100644 index 0000000..b4ff85a --- /dev/null +++ b/_nodejs/node_modules/delayed-stream/Makefile @@ -0,0 +1,7 @@ +SHELL := /bin/bash + +test: + @./test/run.js + +.PHONY: test + diff --git a/_nodejs/node_modules/delayed-stream/Readme.md b/_nodejs/node_modules/delayed-stream/Readme.md new file mode 100644 index 0000000..aca36f9 --- /dev/null +++ b/_nodejs/node_modules/delayed-stream/Readme.md @@ -0,0 +1,141 @@ +# delayed-stream + +Buffers events from a stream until you are ready to handle them. + +## Installation + +``` bash +npm install delayed-stream +``` + +## Usage + +The following example shows how to write a http echo server that delays its +response by 1000 ms. + +``` javascript +var DelayedStream = require('delayed-stream'); +var http = require('http'); + +http.createServer(function(req, res) { + var delayed = DelayedStream.create(req); + + setTimeout(function() { + res.writeHead(200); + delayed.pipe(res); + }, 1000); +}); +``` + +If you are not using `Stream#pipe`, you can also manually release the buffered +events by calling `delayedStream.resume()`: + +``` javascript +var delayed = DelayedStream.create(req); + +setTimeout(function() { + // Emit all buffered events and resume underlaying source + delayed.resume(); +}, 1000); +``` + +## Implementation + +In order to use this meta stream properly, here are a few things you should +know about the implementation. + +### Event Buffering / Proxying + +All events of the `source` stream are hijacked by overwriting the `source.emit` +method. Until node implements a catch-all event listener, this is the only way. + +However, delayed-stream still continues to emit all events it captures on the +`source`, regardless of whether you have released the delayed stream yet or +not. + +Upon creation, delayed-stream captures all `source` events and stores them in +an internal event buffer. Once `delayedStream.release()` is called, all +buffered events are emitted on the `delayedStream`, and the event buffer is +cleared. After that, delayed-stream merely acts as a proxy for the underlaying +source. + +### Error handling + +Error events on `source` are buffered / proxied just like any other events. +However, `delayedStream.create` attaches a no-op `'error'` listener to the +`source`. This way you only have to handle errors on the `delayedStream` +object, rather than in two places. + +### Buffer limits + +delayed-stream provides a `maxDataSize` property that can be used to limit +the amount of data being buffered. In order to protect you from bad `source` +streams that don't react to `source.pause()`, this feature is enabled by +default. + +## API + +### DelayedStream.create(source, [options]) + +Returns a new `delayedStream`. Available options are: + +* `pauseStream` +* `maxDataSize` + +The description for those properties can be found below. + +### delayedStream.source + +The `source` stream managed by this object. This is useful if you are +passing your `delayedStream` around, and you still want to access properties +on the `source` object. + +### delayedStream.pauseStream = true + +Whether to pause the underlaying `source` when calling +`DelayedStream.create()`. Modifying this property afterwards has no effect. + +### delayedStream.maxDataSize = 1024 * 1024 + +The amount of data to buffer before emitting an `error`. + +If the underlaying source is emitting `Buffer` objects, the `maxDataSize` +refers to bytes. + +If the underlaying source is emitting JavaScript strings, the size refers to +characters. + +If you know what you are doing, you can set this property to `Infinity` to +disable this feature. You can also modify this property during runtime. + +### delayedStream.dataSize = 0 + +The amount of data buffered so far. + +### delayedStream.readable + +An ECMA5 getter that returns the value of `source.readable`. + +### delayedStream.resume() + +If the `delayedStream` has not been released so far, `delayedStream.release()` +is called. + +In either case, `source.resume()` is called. + +### delayedStream.pause() + +Calls `source.pause()`. + +### delayedStream.pipe(dest) + +Calls `delayedStream.resume()` and then proxies the arguments to `source.pipe`. + +### delayedStream.release() + +Emits and clears all events that have been buffered up so far. This does not +resume the underlaying source, use `delayedStream.resume()` instead. + +## License + +delayed-stream is licensed under the MIT license. diff --git a/_nodejs/node_modules/delayed-stream/lib/delayed_stream.js b/_nodejs/node_modules/delayed-stream/lib/delayed_stream.js new file mode 100644 index 0000000..b38fc85 --- /dev/null +++ b/_nodejs/node_modules/delayed-stream/lib/delayed_stream.js @@ -0,0 +1,107 @@ +var Stream = require('stream').Stream; +var util = require('util'); + +module.exports = DelayedStream; +function DelayedStream() { + this.source = null; + this.dataSize = 0; + this.maxDataSize = 1024 * 1024; + this.pauseStream = true; + + this._maxDataSizeExceeded = false; + this._released = false; + this._bufferedEvents = []; +} +util.inherits(DelayedStream, Stream); + +DelayedStream.create = function(source, options) { + var delayedStream = new this(); + + options = options || {}; + for (var option in options) { + delayedStream[option] = options[option]; + } + + delayedStream.source = source; + + var realEmit = source.emit; + source.emit = function() { + delayedStream._handleEmit(arguments); + return realEmit.apply(source, arguments); + }; + + source.on('error', function() {}); + if (delayedStream.pauseStream) { + source.pause(); + } + + return delayedStream; +}; + +Object.defineProperty(DelayedStream.prototype, 'readable', { + configurable: true, + enumerable: true, + get: function() { + return this.source.readable; + } +}); + +DelayedStream.prototype.setEncoding = function() { + return this.source.setEncoding.apply(this.source, arguments); +}; + +DelayedStream.prototype.resume = function() { + if (!this._released) { + this.release(); + } + + this.source.resume(); +}; + +DelayedStream.prototype.pause = function() { + this.source.pause(); +}; + +DelayedStream.prototype.release = function() { + this._released = true; + + this._bufferedEvents.forEach(function(args) { + this.emit.apply(this, args); + }.bind(this)); + this._bufferedEvents = []; +}; + +DelayedStream.prototype.pipe = function() { + var r = Stream.prototype.pipe.apply(this, arguments); + this.resume(); + return r; +}; + +DelayedStream.prototype._handleEmit = function(args) { + if (this._released) { + this.emit.apply(this, args); + return; + } + + if (args[0] === 'data') { + this.dataSize += args[1].length; + this._checkIfMaxDataSizeExceeded(); + } + + this._bufferedEvents.push(args); +}; + +DelayedStream.prototype._checkIfMaxDataSizeExceeded = function() { + if (this._maxDataSizeExceeded) { + return; + } + + if (this.dataSize <= this.maxDataSize) { + return; + } + + this._maxDataSizeExceeded = true; + var message = + 'DelayedStream#maxDataSize of ' + this.maxDataSize + ' bytes exceeded.' + this.emit('error', new Error(message)); +}; diff --git a/_nodejs/node_modules/delayed-stream/package.json b/_nodejs/node_modules/delayed-stream/package.json new file mode 100644 index 0000000..eea3291 --- /dev/null +++ b/_nodejs/node_modules/delayed-stream/package.json @@ -0,0 +1,27 @@ +{ + "author": "Felix Geisendörfer (http://debuggable.com/)", + "contributors": [ + "Mike Atkins " + ], + "name": "delayed-stream", + "description": "Buffers events from a stream until you are ready to handle them.", + "license": "MIT", + "version": "1.0.0", + "homepage": "https://github.com/felixge/node-delayed-stream", + "repository": { + "type": "git", + "url": "git://github.com/felixge/node-delayed-stream.git" + }, + "main": "./lib/delayed_stream", + "engines": { + "node": ">=0.4.0" + }, + "scripts": { + "test": "make test" + }, + "dependencies": {}, + "devDependencies": { + "fake": "0.2.0", + "far": "0.0.1" + } +} diff --git a/_nodejs/node_modules/follow-redirects/LICENSE b/_nodejs/node_modules/follow-redirects/LICENSE new file mode 100644 index 0000000..742cbad --- /dev/null +++ b/_nodejs/node_modules/follow-redirects/LICENSE @@ -0,0 +1,18 @@ +Copyright 2014–present Olivier Lalonde , James Talmage , Ruben Verborgh + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +of the Software, and to permit persons to whom the Software is furnished to do +so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR +IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/_nodejs/node_modules/follow-redirects/README.md b/_nodejs/node_modules/follow-redirects/README.md new file mode 100644 index 0000000..eb869a6 --- /dev/null +++ b/_nodejs/node_modules/follow-redirects/README.md @@ -0,0 +1,155 @@ +## Follow Redirects + +Drop-in replacement for Node's `http` and `https` modules that automatically follows redirects. + +[![npm version](https://img.shields.io/npm/v/follow-redirects.svg)](https://www.npmjs.com/package/follow-redirects) +[![Build Status](https://github.com/follow-redirects/follow-redirects/workflows/CI/badge.svg)](https://github.com/follow-redirects/follow-redirects/actions) +[![Coverage Status](https://coveralls.io/repos/follow-redirects/follow-redirects/badge.svg?branch=master)](https://coveralls.io/r/follow-redirects/follow-redirects?branch=master) +[![npm downloads](https://img.shields.io/npm/dm/follow-redirects.svg)](https://www.npmjs.com/package/follow-redirects) +[![Sponsor on GitHub](https://img.shields.io/static/v1?label=Sponsor&message=%F0%9F%92%96&logo=GitHub)](https://github.com/sponsors/RubenVerborgh) + +`follow-redirects` provides [request](https://nodejs.org/api/http.html#http_http_request_options_callback) and [get](https://nodejs.org/api/http.html#http_http_get_options_callback) + methods that behave identically to those found on the native [http](https://nodejs.org/api/http.html#http_http_request_options_callback) and [https](https://nodejs.org/api/https.html#https_https_request_options_callback) + modules, with the exception that they will seamlessly follow redirects. + +```javascript +const { http, https } = require('follow-redirects'); + +http.get('http://bit.ly/900913', response => { + response.on('data', chunk => { + console.log(chunk); + }); +}).on('error', err => { + console.error(err); +}); +``` + +You can inspect the final redirected URL through the `responseUrl` property on the `response`. +If no redirection happened, `responseUrl` is the original request URL. + +```javascript +const request = https.request({ + host: 'bitly.com', + path: '/UHfDGO', +}, response => { + console.log(response.responseUrl); + // 'http://duckduckgo.com/robots.txt' +}); +request.end(); +``` + +## Options +### Global options +Global options are set directly on the `follow-redirects` module: + +```javascript +const followRedirects = require('follow-redirects'); +followRedirects.maxRedirects = 10; +followRedirects.maxBodyLength = 20 * 1024 * 1024; // 20 MB +``` + +The following global options are supported: + +- `maxRedirects` (default: `21`) – sets the maximum number of allowed redirects; if exceeded, an error will be emitted. + +- `maxBodyLength` (default: 10MB) – sets the maximum size of the request body; if exceeded, an error will be emitted. + +### Per-request options +Per-request options are set by passing an `options` object: + +```javascript +const url = require('url'); +const { http, https } = require('follow-redirects'); + +const options = url.parse('http://bit.ly/900913'); +options.maxRedirects = 10; +options.beforeRedirect = (options, response, request) => { + // Use this to adjust the request options upon redirecting, + // to inspect the latest response headers, + // or to cancel the request by throwing an error + + // response.headers = the redirect response headers + // response.statusCode = the redirect response code (eg. 301, 307, etc.) + + // request.url = the requested URL that resulted in a redirect + // request.headers = the headers in the request that resulted in a redirect + // request.method = the method of the request that resulted in a redirect + if (options.hostname === "example.com") { + options.auth = "user:password"; + } +}; +http.request(options); +``` + +In addition to the [standard HTTP](https://nodejs.org/api/http.html#http_http_request_options_callback) and [HTTPS options](https://nodejs.org/api/https.html#https_https_request_options_callback), +the following per-request options are supported: +- `followRedirects` (default: `true`) – whether redirects should be followed. + +- `maxRedirects` (default: `21`) – sets the maximum number of allowed redirects; if exceeded, an error will be emitted. + +- `maxBodyLength` (default: 10MB) – sets the maximum size of the request body; if exceeded, an error will be emitted. + +- `beforeRedirect` (default: `undefined`) – optionally change the request `options` on redirects, or abort the request by throwing an error. + +- `agents` (default: `undefined`) – sets the `agent` option per protocol, since HTTP and HTTPS use different agents. Example value: `{ http: new http.Agent(), https: new https.Agent() }` + +- `trackRedirects` (default: `false`) – whether to store the redirected response details into the `redirects` array on the response object. + + +### Advanced usage +By default, `follow-redirects` will use the Node.js default implementations +of [`http`](https://nodejs.org/api/http.html) +and [`https`](https://nodejs.org/api/https.html). +To enable features such as caching and/or intermediate request tracking, +you might instead want to wrap `follow-redirects` around custom protocol implementations: + +```javascript +const { http, https } = require('follow-redirects').wrap({ + http: require('your-custom-http'), + https: require('your-custom-https'), +}); +``` + +Such custom protocols only need an implementation of the `request` method. + +## Browser Usage + +Due to the way the browser works, +the `http` and `https` browser equivalents perform redirects by default. + +By requiring `follow-redirects` this way: +```javascript +const http = require('follow-redirects/http'); +const https = require('follow-redirects/https'); +``` +you can easily tell webpack and friends to replace +`follow-redirect` by the built-in versions: + +```json +{ + "follow-redirects/http" : "http", + "follow-redirects/https" : "https" +} +``` + +## Contributing + +Pull Requests are always welcome. Please [file an issue](https://github.com/follow-redirects/follow-redirects/issues) + detailing your proposal before you invest your valuable time. Additional features and bug fixes should be accompanied + by tests. You can run the test suite locally with a simple `npm test` command. + +## Debug Logging + +`follow-redirects` uses the excellent [debug](https://www.npmjs.com/package/debug) for logging. To turn on logging + set the environment variable `DEBUG=follow-redirects` for debug output from just this module. When running the test + suite it is sometimes advantageous to set `DEBUG=*` to see output from the express server as well. + +## Authors + +- [Ruben Verborgh](https://ruben.verborgh.org/) +- [Olivier Lalonde](mailto:olalonde@gmail.com) +- [James Talmage](mailto:james@talmage.io) + +## License + +[MIT License](https://github.com/follow-redirects/follow-redirects/blob/master/LICENSE) diff --git a/_nodejs/node_modules/follow-redirects/debug.js b/_nodejs/node_modules/follow-redirects/debug.js new file mode 100644 index 0000000..decb77d --- /dev/null +++ b/_nodejs/node_modules/follow-redirects/debug.js @@ -0,0 +1,15 @@ +var debug; + +module.exports = function () { + if (!debug) { + try { + /* eslint global-require: off */ + debug = require("debug")("follow-redirects"); + } + catch (error) { /* */ } + if (typeof debug !== "function") { + debug = function () { /* */ }; + } + } + debug.apply(null, arguments); +}; diff --git a/_nodejs/node_modules/follow-redirects/http.js b/_nodejs/node_modules/follow-redirects/http.js new file mode 100644 index 0000000..695e356 --- /dev/null +++ b/_nodejs/node_modules/follow-redirects/http.js @@ -0,0 +1 @@ +module.exports = require("./").http; diff --git a/_nodejs/node_modules/follow-redirects/https.js b/_nodejs/node_modules/follow-redirects/https.js new file mode 100644 index 0000000..d21c921 --- /dev/null +++ b/_nodejs/node_modules/follow-redirects/https.js @@ -0,0 +1 @@ +module.exports = require("./").https; diff --git a/_nodejs/node_modules/follow-redirects/index.js b/_nodejs/node_modules/follow-redirects/index.js new file mode 100644 index 0000000..212f00a --- /dev/null +++ b/_nodejs/node_modules/follow-redirects/index.js @@ -0,0 +1,598 @@ +var url = require("url"); +var URL = url.URL; +var http = require("http"); +var https = require("https"); +var Writable = require("stream").Writable; +var assert = require("assert"); +var debug = require("./debug"); + +// Create handlers that pass events from native requests +var events = ["abort", "aborted", "connect", "error", "socket", "timeout"]; +var eventHandlers = Object.create(null); +events.forEach(function (event) { + eventHandlers[event] = function (arg1, arg2, arg3) { + this._redirectable.emit(event, arg1, arg2, arg3); + }; +}); + +// Error types with codes +var RedirectionError = createErrorType( + "ERR_FR_REDIRECTION_FAILURE", + "Redirected request failed" +); +var TooManyRedirectsError = createErrorType( + "ERR_FR_TOO_MANY_REDIRECTS", + "Maximum number of redirects exceeded" +); +var MaxBodyLengthExceededError = createErrorType( + "ERR_FR_MAX_BODY_LENGTH_EXCEEDED", + "Request body larger than maxBodyLength limit" +); +var WriteAfterEndError = createErrorType( + "ERR_STREAM_WRITE_AFTER_END", + "write after end" +); + +// An HTTP(S) request that can be redirected +function RedirectableRequest(options, responseCallback) { + // Initialize the request + Writable.call(this); + this._sanitizeOptions(options); + this._options = options; + this._ended = false; + this._ending = false; + this._redirectCount = 0; + this._redirects = []; + this._requestBodyLength = 0; + this._requestBodyBuffers = []; + + // Attach a callback if passed + if (responseCallback) { + this.on("response", responseCallback); + } + + // React to responses of native requests + var self = this; + this._onNativeResponse = function (response) { + self._processResponse(response); + }; + + // Perform the first request + this._performRequest(); +} +RedirectableRequest.prototype = Object.create(Writable.prototype); + +RedirectableRequest.prototype.abort = function () { + abortRequest(this._currentRequest); + this.emit("abort"); +}; + +// Writes buffered data to the current native request +RedirectableRequest.prototype.write = function (data, encoding, callback) { + // Writing is not allowed if end has been called + if (this._ending) { + throw new WriteAfterEndError(); + } + + // Validate input and shift parameters if necessary + if (!(typeof data === "string" || typeof data === "object" && ("length" in data))) { + throw new TypeError("data should be a string, Buffer or Uint8Array"); + } + if (typeof encoding === "function") { + callback = encoding; + encoding = null; + } + + // Ignore empty buffers, since writing them doesn't invoke the callback + // https://github.com/nodejs/node/issues/22066 + if (data.length === 0) { + if (callback) { + callback(); + } + return; + } + // Only write when we don't exceed the maximum body length + if (this._requestBodyLength + data.length <= this._options.maxBodyLength) { + this._requestBodyLength += data.length; + this._requestBodyBuffers.push({ data: data, encoding: encoding }); + this._currentRequest.write(data, encoding, callback); + } + // Error when we exceed the maximum body length + else { + this.emit("error", new MaxBodyLengthExceededError()); + this.abort(); + } +}; + +// Ends the current native request +RedirectableRequest.prototype.end = function (data, encoding, callback) { + // Shift parameters if necessary + if (typeof data === "function") { + callback = data; + data = encoding = null; + } + else if (typeof encoding === "function") { + callback = encoding; + encoding = null; + } + + // Write data if needed and end + if (!data) { + this._ended = this._ending = true; + this._currentRequest.end(null, null, callback); + } + else { + var self = this; + var currentRequest = this._currentRequest; + this.write(data, encoding, function () { + self._ended = true; + currentRequest.end(null, null, callback); + }); + this._ending = true; + } +}; + +// Sets a header value on the current native request +RedirectableRequest.prototype.setHeader = function (name, value) { + this._options.headers[name] = value; + this._currentRequest.setHeader(name, value); +}; + +// Clears a header value on the current native request +RedirectableRequest.prototype.removeHeader = function (name) { + delete this._options.headers[name]; + this._currentRequest.removeHeader(name); +}; + +// Global timeout for all underlying requests +RedirectableRequest.prototype.setTimeout = function (msecs, callback) { + var self = this; + + // Destroys the socket on timeout + function destroyOnTimeout(socket) { + socket.setTimeout(msecs); + socket.removeListener("timeout", socket.destroy); + socket.addListener("timeout", socket.destroy); + } + + // Sets up a timer to trigger a timeout event + function startTimer(socket) { + if (self._timeout) { + clearTimeout(self._timeout); + } + self._timeout = setTimeout(function () { + self.emit("timeout"); + clearTimer(); + }, msecs); + destroyOnTimeout(socket); + } + + // Stops a timeout from triggering + function clearTimer() { + // Clear the timeout + if (self._timeout) { + clearTimeout(self._timeout); + self._timeout = null; + } + + // Clean up all attached listeners + self.removeListener("abort", clearTimer); + self.removeListener("error", clearTimer); + self.removeListener("response", clearTimer); + if (callback) { + self.removeListener("timeout", callback); + } + if (!self.socket) { + self._currentRequest.removeListener("socket", startTimer); + } + } + + // Attach callback if passed + if (callback) { + this.on("timeout", callback); + } + + // Start the timer if or when the socket is opened + if (this.socket) { + startTimer(this.socket); + } + else { + this._currentRequest.once("socket", startTimer); + } + + // Clean up on events + this.on("socket", destroyOnTimeout); + this.on("abort", clearTimer); + this.on("error", clearTimer); + this.on("response", clearTimer); + + return this; +}; + +// Proxy all other public ClientRequest methods +[ + "flushHeaders", "getHeader", + "setNoDelay", "setSocketKeepAlive", +].forEach(function (method) { + RedirectableRequest.prototype[method] = function (a, b) { + return this._currentRequest[method](a, b); + }; +}); + +// Proxy all public ClientRequest properties +["aborted", "connection", "socket"].forEach(function (property) { + Object.defineProperty(RedirectableRequest.prototype, property, { + get: function () { return this._currentRequest[property]; }, + }); +}); + +RedirectableRequest.prototype._sanitizeOptions = function (options) { + // Ensure headers are always present + if (!options.headers) { + options.headers = {}; + } + + // Since http.request treats host as an alias of hostname, + // but the url module interprets host as hostname plus port, + // eliminate the host property to avoid confusion. + if (options.host) { + // Use hostname if set, because it has precedence + if (!options.hostname) { + options.hostname = options.host; + } + delete options.host; + } + + // Complete the URL object when necessary + if (!options.pathname && options.path) { + var searchPos = options.path.indexOf("?"); + if (searchPos < 0) { + options.pathname = options.path; + } + else { + options.pathname = options.path.substring(0, searchPos); + options.search = options.path.substring(searchPos); + } + } +}; + + +// Executes the next native request (initial or redirect) +RedirectableRequest.prototype._performRequest = function () { + // Load the native protocol + var protocol = this._options.protocol; + var nativeProtocol = this._options.nativeProtocols[protocol]; + if (!nativeProtocol) { + this.emit("error", new TypeError("Unsupported protocol " + protocol)); + return; + } + + // If specified, use the agent corresponding to the protocol + // (HTTP and HTTPS use different types of agents) + if (this._options.agents) { + var scheme = protocol.slice(0, -1); + this._options.agent = this._options.agents[scheme]; + } + + // Create the native request and set up its event handlers + var request = this._currentRequest = + nativeProtocol.request(this._options, this._onNativeResponse); + request._redirectable = this; + for (var event of events) { + request.on(event, eventHandlers[event]); + } + + // RFC7230§5.3.1: When making a request directly to an origin server, […] + // a client MUST send only the absolute path […] as the request-target. + this._currentUrl = /^\//.test(this._options.path) ? + url.format(this._options) : + // When making a request to a proxy, […] + // a client MUST send the target URI in absolute-form […]. + this._currentUrl = this._options.path; + + // End a redirected request + // (The first request must be ended explicitly with RedirectableRequest#end) + if (this._isRedirect) { + // Write the request entity and end + var i = 0; + var self = this; + var buffers = this._requestBodyBuffers; + (function writeNext(error) { + // Only write if this request has not been redirected yet + /* istanbul ignore else */ + if (request === self._currentRequest) { + // Report any write errors + /* istanbul ignore if */ + if (error) { + self.emit("error", error); + } + // Write the next buffer if there are still left + else if (i < buffers.length) { + var buffer = buffers[i++]; + /* istanbul ignore else */ + if (!request.finished) { + request.write(buffer.data, buffer.encoding, writeNext); + } + } + // End the request if `end` has been called on us + else if (self._ended) { + request.end(); + } + } + }()); + } +}; + +// Processes a response from the current native request +RedirectableRequest.prototype._processResponse = function (response) { + // Store the redirected response + var statusCode = response.statusCode; + if (this._options.trackRedirects) { + this._redirects.push({ + url: this._currentUrl, + headers: response.headers, + statusCode: statusCode, + }); + } + + // RFC7231§6.4: The 3xx (Redirection) class of status code indicates + // that further action needs to be taken by the user agent in order to + // fulfill the request. If a Location header field is provided, + // the user agent MAY automatically redirect its request to the URI + // referenced by the Location field value, + // even if the specific status code is not understood. + + // If the response is not a redirect; return it as-is + var location = response.headers.location; + if (!location || this._options.followRedirects === false || + statusCode < 300 || statusCode >= 400) { + response.responseUrl = this._currentUrl; + response.redirects = this._redirects; + this.emit("response", response); + + // Clean up + this._requestBodyBuffers = []; + return; + } + + // The response is a redirect, so abort the current request + abortRequest(this._currentRequest); + // Discard the remainder of the response to avoid waiting for data + response.destroy(); + + // RFC7231§6.4: A client SHOULD detect and intervene + // in cyclical redirections (i.e., "infinite" redirection loops). + if (++this._redirectCount > this._options.maxRedirects) { + this.emit("error", new TooManyRedirectsError()); + return; + } + + // Store the request headers if applicable + var requestHeaders; + var beforeRedirect = this._options.beforeRedirect; + if (beforeRedirect) { + requestHeaders = Object.assign({ + // The Host header was set by nativeProtocol.request + Host: response.req.getHeader("host"), + }, this._options.headers); + } + + // RFC7231§6.4: Automatic redirection needs to done with + // care for methods not known to be safe, […] + // RFC7231§6.4.2–3: For historical reasons, a user agent MAY change + // the request method from POST to GET for the subsequent request. + var method = this._options.method; + if ((statusCode === 301 || statusCode === 302) && this._options.method === "POST" || + // RFC7231§6.4.4: The 303 (See Other) status code indicates that + // the server is redirecting the user agent to a different resource […] + // A user agent can perform a retrieval request targeting that URI + // (a GET or HEAD request if using HTTP) […] + (statusCode === 303) && !/^(?:GET|HEAD)$/.test(this._options.method)) { + this._options.method = "GET"; + // Drop a possible entity and headers related to it + this._requestBodyBuffers = []; + removeMatchingHeaders(/^content-/i, this._options.headers); + } + + // Drop the Host header, as the redirect might lead to a different host + var currentHostHeader = removeMatchingHeaders(/^host$/i, this._options.headers); + + // If the redirect is relative, carry over the host of the last request + var currentUrlParts = url.parse(this._currentUrl); + var currentHost = currentHostHeader || currentUrlParts.host; + var currentUrl = /^\w+:/.test(location) ? this._currentUrl : + url.format(Object.assign(currentUrlParts, { host: currentHost })); + + // Determine the URL of the redirection + var redirectUrl; + try { + redirectUrl = url.resolve(currentUrl, location); + } + catch (cause) { + this.emit("error", new RedirectionError(cause)); + return; + } + + // Create the redirected request + debug("redirecting to", redirectUrl); + this._isRedirect = true; + var redirectUrlParts = url.parse(redirectUrl); + Object.assign(this._options, redirectUrlParts); + + // Drop confidential headers when redirecting to a less secure protocol + // or to a different domain that is not a superdomain + if (redirectUrlParts.protocol !== currentUrlParts.protocol && + redirectUrlParts.protocol !== "https:" || + redirectUrlParts.host !== currentHost && + !isSubdomain(redirectUrlParts.host, currentHost)) { + removeMatchingHeaders(/^(?:authorization|cookie)$/i, this._options.headers); + } + + // Evaluate the beforeRedirect callback + if (typeof beforeRedirect === "function") { + var responseDetails = { + headers: response.headers, + statusCode: statusCode, + }; + var requestDetails = { + url: currentUrl, + method: method, + headers: requestHeaders, + }; + try { + beforeRedirect(this._options, responseDetails, requestDetails); + } + catch (err) { + this.emit("error", err); + return; + } + this._sanitizeOptions(this._options); + } + + // Perform the redirected request + try { + this._performRequest(); + } + catch (cause) { + this.emit("error", new RedirectionError(cause)); + } +}; + +// Wraps the key/value object of protocols with redirect functionality +function wrap(protocols) { + // Default settings + var exports = { + maxRedirects: 21, + maxBodyLength: 10 * 1024 * 1024, + }; + + // Wrap each protocol + var nativeProtocols = {}; + Object.keys(protocols).forEach(function (scheme) { + var protocol = scheme + ":"; + var nativeProtocol = nativeProtocols[protocol] = protocols[scheme]; + var wrappedProtocol = exports[scheme] = Object.create(nativeProtocol); + + // Executes a request, following redirects + function request(input, options, callback) { + // Parse parameters + if (typeof input === "string") { + var urlStr = input; + try { + input = urlToOptions(new URL(urlStr)); + } + catch (err) { + /* istanbul ignore next */ + input = url.parse(urlStr); + } + } + else if (URL && (input instanceof URL)) { + input = urlToOptions(input); + } + else { + callback = options; + options = input; + input = { protocol: protocol }; + } + if (typeof options === "function") { + callback = options; + options = null; + } + + // Set defaults + options = Object.assign({ + maxRedirects: exports.maxRedirects, + maxBodyLength: exports.maxBodyLength, + }, input, options); + options.nativeProtocols = nativeProtocols; + + assert.equal(options.protocol, protocol, "protocol mismatch"); + debug("options", options); + return new RedirectableRequest(options, callback); + } + + // Executes a GET request, following redirects + function get(input, options, callback) { + var wrappedRequest = wrappedProtocol.request(input, options, callback); + wrappedRequest.end(); + return wrappedRequest; + } + + // Expose the properties on the wrapped protocol + Object.defineProperties(wrappedProtocol, { + request: { value: request, configurable: true, enumerable: true, writable: true }, + get: { value: get, configurable: true, enumerable: true, writable: true }, + }); + }); + return exports; +} + +/* istanbul ignore next */ +function noop() { /* empty */ } + +// from https://github.com/nodejs/node/blob/master/lib/internal/url.js +function urlToOptions(urlObject) { + var options = { + protocol: urlObject.protocol, + hostname: urlObject.hostname.startsWith("[") ? + /* istanbul ignore next */ + urlObject.hostname.slice(1, -1) : + urlObject.hostname, + hash: urlObject.hash, + search: urlObject.search, + pathname: urlObject.pathname, + path: urlObject.pathname + urlObject.search, + href: urlObject.href, + }; + if (urlObject.port !== "") { + options.port = Number(urlObject.port); + } + return options; +} + +function removeMatchingHeaders(regex, headers) { + var lastValue; + for (var header in headers) { + if (regex.test(header)) { + lastValue = headers[header]; + delete headers[header]; + } + } + return (lastValue === null || typeof lastValue === "undefined") ? + undefined : String(lastValue).trim(); +} + +function createErrorType(code, defaultMessage) { + function CustomError(cause) { + Error.captureStackTrace(this, this.constructor); + if (!cause) { + this.message = defaultMessage; + } + else { + this.message = defaultMessage + ": " + cause.message; + this.cause = cause; + } + } + CustomError.prototype = new Error(); + CustomError.prototype.constructor = CustomError; + CustomError.prototype.name = "Error [" + code + "]"; + CustomError.prototype.code = code; + return CustomError; +} + +function abortRequest(request) { + for (var event of events) { + request.removeListener(event, eventHandlers[event]); + } + request.on("error", noop); + request.abort(); +} + +function isSubdomain(subdomain, domain) { + const dot = subdomain.length - domain.length - 1; + return dot > 0 && subdomain[dot] === "." && subdomain.endsWith(domain); +} + +// Exports +module.exports = wrap({ http: http, https: https }); +module.exports.wrap = wrap; diff --git a/_nodejs/node_modules/follow-redirects/package.json b/_nodejs/node_modules/follow-redirects/package.json new file mode 100644 index 0000000..191a629 --- /dev/null +++ b/_nodejs/node_modules/follow-redirects/package.json @@ -0,0 +1,59 @@ +{ + "name": "follow-redirects", + "version": "1.15.1", + "description": "HTTP and HTTPS modules that follow redirects.", + "license": "MIT", + "main": "index.js", + "files": [ + "*.js" + ], + "engines": { + "node": ">=4.0" + }, + "scripts": { + "test": "npm run lint && npm run mocha", + "lint": "eslint *.js test", + "mocha": "nyc mocha" + }, + "repository": { + "type": "git", + "url": "git@github.com:follow-redirects/follow-redirects.git" + }, + "homepage": "https://github.com/follow-redirects/follow-redirects", + "bugs": { + "url": "https://github.com/follow-redirects/follow-redirects/issues" + }, + "keywords": [ + "http", + "https", + "url", + "redirect", + "client", + "location", + "utility" + ], + "author": "Ruben Verborgh (https://ruben.verborgh.org/)", + "contributors": [ + "Olivier Lalonde (http://www.syskall.com)", + "James Talmage " + ], + "funding": [ + { + "type": "individual", + "url": "https://github.com/sponsors/RubenVerborgh" + } + ], + "peerDependenciesMeta": { + "debug": { + "optional": true + } + }, + "devDependencies": { + "concat-stream": "^2.0.0", + "eslint": "^5.16.0", + "express": "^4.16.4", + "lolex": "^3.1.0", + "mocha": "^6.0.2", + "nyc": "^14.1.1" + } +} diff --git a/_nodejs/node_modules/form-data/License b/_nodejs/node_modules/form-data/License new file mode 100644 index 0000000..c7ff12a --- /dev/null +++ b/_nodejs/node_modules/form-data/License @@ -0,0 +1,19 @@ +Copyright (c) 2012 Felix Geisendörfer (felix@debuggable.com) and contributors + + Permission is hereby granted, free of charge, to any person obtaining a copy + of this software and associated documentation files (the "Software"), to deal + in the Software without restriction, including without limitation the rights + to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + copies of the Software, and to permit persons to whom the Software is + furnished to do so, subject to the following conditions: + + The above copyright notice and this permission notice shall be included in + all copies or substantial portions of the Software. + + THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + THE SOFTWARE. diff --git a/_nodejs/node_modules/form-data/README.md.bak b/_nodejs/node_modules/form-data/README.md.bak new file mode 100644 index 0000000..298a1a2 --- /dev/null +++ b/_nodejs/node_modules/form-data/README.md.bak @@ -0,0 +1,358 @@ +# Form-Data [![NPM Module](https://img.shields.io/npm/v/form-data.svg)](https://www.npmjs.com/package/form-data) [![Join the chat at https://gitter.im/form-data/form-data](http://form-data.github.io/images/gitterbadge.svg)](https://gitter.im/form-data/form-data) + +A library to create readable ```"multipart/form-data"``` streams. Can be used to submit forms and file uploads to other web applications. + +The API of this library is inspired by the [XMLHttpRequest-2 FormData Interface][xhr2-fd]. + +[xhr2-fd]: http://dev.w3.org/2006/webapi/XMLHttpRequest-2/Overview.html#the-formdata-interface + +[![Linux Build](https://img.shields.io/travis/form-data/form-data/v4.0.0.svg?label=linux:6.x-12.x)](https://travis-ci.org/form-data/form-data) +[![MacOS Build](https://img.shields.io/travis/form-data/form-data/v4.0.0.svg?label=macos:6.x-12.x)](https://travis-ci.org/form-data/form-data) +[![Windows Build](https://img.shields.io/travis/form-data/form-data/v4.0.0.svg?label=windows:6.x-12.x)](https://travis-ci.org/form-data/form-data) + +[![Coverage Status](https://img.shields.io/coveralls/form-data/form-data/v4.0.0.svg?label=code+coverage)](https://coveralls.io/github/form-data/form-data?branch=master) +[![Dependency Status](https://img.shields.io/david/form-data/form-data.svg)](https://david-dm.org/form-data/form-data) + +## Install + +``` +npm install --save form-data +``` + +## Usage + +In this example we are constructing a form with 3 fields that contain a string, +a buffer and a file stream. + +``` javascript +var FormData = require('form-data'); +var fs = require('fs'); + +var form = new FormData(); +form.append('my_field', 'my value'); +form.append('my_buffer', new Buffer(10)); +form.append('my_file', fs.createReadStream('/foo/bar.jpg')); +``` + +Also you can use http-response stream: + +``` javascript +var FormData = require('form-data'); +var http = require('http'); + +var form = new FormData(); + +http.request('http://nodejs.org/images/logo.png', function(response) { + form.append('my_field', 'my value'); + form.append('my_buffer', new Buffer(10)); + form.append('my_logo', response); +}); +``` + +Or @mikeal's [request](https://github.com/request/request) stream: + +``` javascript +var FormData = require('form-data'); +var request = require('request'); + +var form = new FormData(); + +form.append('my_field', 'my value'); +form.append('my_buffer', new Buffer(10)); +form.append('my_logo', request('http://nodejs.org/images/logo.png')); +``` + +In order to submit this form to a web application, call ```submit(url, [callback])``` method: + +``` javascript +form.submit('http://example.org/', function(err, res) { + // res – response object (http.IncomingMessage) // + res.resume(); +}); + +``` + +For more advanced request manipulations ```submit()``` method returns ```http.ClientRequest``` object, or you can choose from one of the alternative submission methods. + +### Custom options + +You can provide custom options, such as `maxDataSize`: + +``` javascript +var FormData = require('form-data'); + +var form = new FormData({ maxDataSize: 20971520 }); +form.append('my_field', 'my value'); +form.append('my_buffer', /* something big */); +``` + +List of available options could be found in [combined-stream](https://github.com/felixge/node-combined-stream/blob/master/lib/combined_stream.js#L7-L15) + +### Alternative submission methods + +You can use node's http client interface: + +``` javascript +var http = require('http'); + +var request = http.request({ + method: 'post', + host: 'example.org', + path: '/upload', + headers: form.getHeaders() +}); + +form.pipe(request); + +request.on('response', function(res) { + console.log(res.statusCode); +}); +``` + +Or if you would prefer the `'Content-Length'` header to be set for you: + +``` javascript +form.submit('example.org/upload', function(err, res) { + console.log(res.statusCode); +}); +``` + +To use custom headers and pre-known length in parts: + +``` javascript +var CRLF = '\r\n'; +var form = new FormData(); + +var options = { + header: CRLF + '--' + form.getBoundary() + CRLF + 'X-Custom-Header: 123' + CRLF + CRLF, + knownLength: 1 +}; + +form.append('my_buffer', buffer, options); + +form.submit('http://example.com/', function(err, res) { + if (err) throw err; + console.log('Done'); +}); +``` + +Form-Data can recognize and fetch all the required information from common types of streams (```fs.readStream```, ```http.response``` and ```mikeal's request```), for some other types of streams you'd need to provide "file"-related information manually: + +``` javascript +someModule.stream(function(err, stdout, stderr) { + if (err) throw err; + + var form = new FormData(); + + form.append('file', stdout, { + filename: 'unicycle.jpg', // ... or: + filepath: 'photos/toys/unicycle.jpg', + contentType: 'image/jpeg', + knownLength: 19806 + }); + + form.submit('http://example.com/', function(err, res) { + if (err) throw err; + console.log('Done'); + }); +}); +``` + +The `filepath` property overrides `filename` and may contain a relative path. This is typically used when uploading [multiple files from a directory](https://wicg.github.io/entries-api/#dom-htmlinputelement-webkitdirectory). + +For edge cases, like POST request to URL with query string or to pass HTTP auth credentials, object can be passed to `form.submit()` as first parameter: + +``` javascript +form.submit({ + host: 'example.com', + path: '/probably.php?extra=params', + auth: 'username:password' +}, function(err, res) { + console.log(res.statusCode); +}); +``` + +In case you need to also send custom HTTP headers with the POST request, you can use the `headers` key in first parameter of `form.submit()`: + +``` javascript +form.submit({ + host: 'example.com', + path: '/surelynot.php', + headers: {'x-test-header': 'test-header-value'} +}, function(err, res) { + console.log(res.statusCode); +}); +``` + +### Methods + +- [_Void_ append( **String** _field_, **Mixed** _value_ [, **Mixed** _options_] )](https://github.com/form-data/form-data#void-append-string-field-mixed-value--mixed-options-). +- [_Headers_ getHeaders( [**Headers** _userHeaders_] )](https://github.com/form-data/form-data#array-getheaders-array-userheaders-) +- [_String_ getBoundary()](https://github.com/form-data/form-data#string-getboundary) +- [_Void_ setBoundary()](https://github.com/form-data/form-data#void-setboundary) +- [_Buffer_ getBuffer()](https://github.com/form-data/form-data#buffer-getbuffer) +- [_Integer_ getLengthSync()](https://github.com/form-data/form-data#integer-getlengthsync) +- [_Integer_ getLength( **function** _callback_ )](https://github.com/form-data/form-data#integer-getlength-function-callback-) +- [_Boolean_ hasKnownLength()](https://github.com/form-data/form-data#boolean-hasknownlength) +- [_Request_ submit( _params_, **function** _callback_ )](https://github.com/form-data/form-data#request-submit-params-function-callback-) +- [_String_ toString()](https://github.com/form-data/form-data#string-tostring) + +#### _Void_ append( **String** _field_, **Mixed** _value_ [, **Mixed** _options_] ) +Append data to the form. You can submit about any format (string, integer, boolean, buffer, etc.). However, Arrays are not supported and need to be turned into strings by the user. +```javascript +var form = new FormData(); +form.append( 'my_string', 'my value' ); +form.append( 'my_integer', 1 ); +form.append( 'my_boolean', true ); +form.append( 'my_buffer', new Buffer(10) ); +form.append( 'my_array_as_json', JSON.stringify( ['bird','cute'] ) ) +``` + +You may provide a string for options, or an object. +```javascript +// Set filename by providing a string for options +form.append( 'my_file', fs.createReadStream('/foo/bar.jpg'), 'bar.jpg' ); + +// provide an object. +form.append( 'my_file', fs.createReadStream('/foo/bar.jpg'), {filename: 'bar.jpg', contentType: 'image/jpeg', knownLength: 19806} ); +``` + +#### _Headers_ getHeaders( [**Headers** _userHeaders_] ) +This method adds the correct `content-type` header to the provided array of `userHeaders`. + +#### _String_ getBoundary() +Return the boundary of the formData. By default, the boundary consists of 26 `-` followed by 24 numbers +for example: +```javascript +--------------------------515890814546601021194782 +``` + +#### _Void_ setBoundary(String _boundary_) +Set the boundary string, overriding the default behavior described above. + +_Note: The boundary must be unique and may not appear in the data._ + +#### _Buffer_ getBuffer() +Return the full formdata request package, as a Buffer. You can insert this Buffer in e.g. Axios to send multipart data. +```javascript +var form = new FormData(); +form.append( 'my_buffer', Buffer.from([0x4a,0x42,0x20,0x52,0x6f,0x63,0x6b,0x73]) ); +form.append( 'my_file', fs.readFileSync('/foo/bar.jpg') ); + +axios.post( 'https://example.com/path/to/api', + form.getBuffer(), + form.getHeaders() + ) +``` +**Note:** Because the output is of type Buffer, you can only append types that are accepted by Buffer: *string, Buffer, ArrayBuffer, Array, or Array-like Object*. A ReadStream for example will result in an error. + +#### _Integer_ getLengthSync() +Same as `getLength` but synchronous. + +_Note: getLengthSync __doesn't__ calculate streams length._ + +#### _Integer_ getLength( **function** _callback_ ) +Returns the `Content-Length` async. The callback is used to handle errors and continue once the length has been calculated +```javascript +this.getLength(function(err, length) { + if (err) { + this._error(err); + return; + } + + // add content length + request.setHeader('Content-Length', length); + + ... +}.bind(this)); +``` + +#### _Boolean_ hasKnownLength() +Checks if the length of added values is known. + +#### _Request_ submit( _params_, **function** _callback_ ) +Submit the form to a web application. +```javascript +var form = new FormData(); +form.append( 'my_string', 'Hello World' ); + +form.submit( 'http://example.com/', function(err, res) { + // res – response object (http.IncomingMessage) // + res.resume(); +} ); +``` + +#### _String_ toString() +Returns the form data as a string. Don't use this if you are sending files or buffers, use `getBuffer()` instead. + +### Integration with other libraries + +#### Request + +Form submission using [request](https://github.com/request/request): + +```javascript +var formData = { + my_field: 'my_value', + my_file: fs.createReadStream(__dirname + '/unicycle.jpg'), +}; + +request.post({url:'http://service.com/upload', formData: formData}, function(err, httpResponse, body) { + if (err) { + return console.error('upload failed:', err); + } + console.log('Upload successful! Server responded with:', body); +}); +``` + +For more details see [request readme](https://github.com/request/request#multipartform-data-multipart-form-uploads). + +#### node-fetch + +You can also submit a form using [node-fetch](https://github.com/bitinn/node-fetch): + +```javascript +var form = new FormData(); + +form.append('a', 1); + +fetch('http://example.com', { method: 'POST', body: form }) + .then(function(res) { + return res.json(); + }).then(function(json) { + console.log(json); + }); +``` + +#### axios + +In Node.js you can post a file using [axios](https://github.com/axios/axios): +```javascript +const form = new FormData(); +const stream = fs.createReadStream(PATH_TO_FILE); + +form.append('image', stream); + +// In Node.js environment you need to set boundary in the header field 'Content-Type' by calling method `getHeaders` +const formHeaders = form.getHeaders(); + +axios.post('http://example.com', form, { + headers: { + ...formHeaders, + }, +}) +.then(response => response) +.catch(error => error) +``` + +## Notes + +- ```getLengthSync()``` method DOESN'T calculate length for streams, use ```knownLength``` options as workaround. +- ```getLength(cb)``` will send an error as first parameter of callback if stream length cannot be calculated (e.g. send in custom streams w/o using ```knownLength```). +- ```submit``` will not add `content-length` if form length is unknown or not calculable. +- Starting version `2.x` FormData has dropped support for `node@0.10.x`. +- Starting version `3.x` FormData has dropped support for `node@4.x`. + +## License + +Form-Data is released under the [MIT](License) license. diff --git a/_nodejs/node_modules/form-data/Readme.md b/_nodejs/node_modules/form-data/Readme.md new file mode 100644 index 0000000..298a1a2 --- /dev/null +++ b/_nodejs/node_modules/form-data/Readme.md @@ -0,0 +1,358 @@ +# Form-Data [![NPM Module](https://img.shields.io/npm/v/form-data.svg)](https://www.npmjs.com/package/form-data) [![Join the chat at https://gitter.im/form-data/form-data](http://form-data.github.io/images/gitterbadge.svg)](https://gitter.im/form-data/form-data) + +A library to create readable ```"multipart/form-data"``` streams. Can be used to submit forms and file uploads to other web applications. + +The API of this library is inspired by the [XMLHttpRequest-2 FormData Interface][xhr2-fd]. + +[xhr2-fd]: http://dev.w3.org/2006/webapi/XMLHttpRequest-2/Overview.html#the-formdata-interface + +[![Linux Build](https://img.shields.io/travis/form-data/form-data/v4.0.0.svg?label=linux:6.x-12.x)](https://travis-ci.org/form-data/form-data) +[![MacOS Build](https://img.shields.io/travis/form-data/form-data/v4.0.0.svg?label=macos:6.x-12.x)](https://travis-ci.org/form-data/form-data) +[![Windows Build](https://img.shields.io/travis/form-data/form-data/v4.0.0.svg?label=windows:6.x-12.x)](https://travis-ci.org/form-data/form-data) + +[![Coverage Status](https://img.shields.io/coveralls/form-data/form-data/v4.0.0.svg?label=code+coverage)](https://coveralls.io/github/form-data/form-data?branch=master) +[![Dependency Status](https://img.shields.io/david/form-data/form-data.svg)](https://david-dm.org/form-data/form-data) + +## Install + +``` +npm install --save form-data +``` + +## Usage + +In this example we are constructing a form with 3 fields that contain a string, +a buffer and a file stream. + +``` javascript +var FormData = require('form-data'); +var fs = require('fs'); + +var form = new FormData(); +form.append('my_field', 'my value'); +form.append('my_buffer', new Buffer(10)); +form.append('my_file', fs.createReadStream('/foo/bar.jpg')); +``` + +Also you can use http-response stream: + +``` javascript +var FormData = require('form-data'); +var http = require('http'); + +var form = new FormData(); + +http.request('http://nodejs.org/images/logo.png', function(response) { + form.append('my_field', 'my value'); + form.append('my_buffer', new Buffer(10)); + form.append('my_logo', response); +}); +``` + +Or @mikeal's [request](https://github.com/request/request) stream: + +``` javascript +var FormData = require('form-data'); +var request = require('request'); + +var form = new FormData(); + +form.append('my_field', 'my value'); +form.append('my_buffer', new Buffer(10)); +form.append('my_logo', request('http://nodejs.org/images/logo.png')); +``` + +In order to submit this form to a web application, call ```submit(url, [callback])``` method: + +``` javascript +form.submit('http://example.org/', function(err, res) { + // res – response object (http.IncomingMessage) // + res.resume(); +}); + +``` + +For more advanced request manipulations ```submit()``` method returns ```http.ClientRequest``` object, or you can choose from one of the alternative submission methods. + +### Custom options + +You can provide custom options, such as `maxDataSize`: + +``` javascript +var FormData = require('form-data'); + +var form = new FormData({ maxDataSize: 20971520 }); +form.append('my_field', 'my value'); +form.append('my_buffer', /* something big */); +``` + +List of available options could be found in [combined-stream](https://github.com/felixge/node-combined-stream/blob/master/lib/combined_stream.js#L7-L15) + +### Alternative submission methods + +You can use node's http client interface: + +``` javascript +var http = require('http'); + +var request = http.request({ + method: 'post', + host: 'example.org', + path: '/upload', + headers: form.getHeaders() +}); + +form.pipe(request); + +request.on('response', function(res) { + console.log(res.statusCode); +}); +``` + +Or if you would prefer the `'Content-Length'` header to be set for you: + +``` javascript +form.submit('example.org/upload', function(err, res) { + console.log(res.statusCode); +}); +``` + +To use custom headers and pre-known length in parts: + +``` javascript +var CRLF = '\r\n'; +var form = new FormData(); + +var options = { + header: CRLF + '--' + form.getBoundary() + CRLF + 'X-Custom-Header: 123' + CRLF + CRLF, + knownLength: 1 +}; + +form.append('my_buffer', buffer, options); + +form.submit('http://example.com/', function(err, res) { + if (err) throw err; + console.log('Done'); +}); +``` + +Form-Data can recognize and fetch all the required information from common types of streams (```fs.readStream```, ```http.response``` and ```mikeal's request```), for some other types of streams you'd need to provide "file"-related information manually: + +``` javascript +someModule.stream(function(err, stdout, stderr) { + if (err) throw err; + + var form = new FormData(); + + form.append('file', stdout, { + filename: 'unicycle.jpg', // ... or: + filepath: 'photos/toys/unicycle.jpg', + contentType: 'image/jpeg', + knownLength: 19806 + }); + + form.submit('http://example.com/', function(err, res) { + if (err) throw err; + console.log('Done'); + }); +}); +``` + +The `filepath` property overrides `filename` and may contain a relative path. This is typically used when uploading [multiple files from a directory](https://wicg.github.io/entries-api/#dom-htmlinputelement-webkitdirectory). + +For edge cases, like POST request to URL with query string or to pass HTTP auth credentials, object can be passed to `form.submit()` as first parameter: + +``` javascript +form.submit({ + host: 'example.com', + path: '/probably.php?extra=params', + auth: 'username:password' +}, function(err, res) { + console.log(res.statusCode); +}); +``` + +In case you need to also send custom HTTP headers with the POST request, you can use the `headers` key in first parameter of `form.submit()`: + +``` javascript +form.submit({ + host: 'example.com', + path: '/surelynot.php', + headers: {'x-test-header': 'test-header-value'} +}, function(err, res) { + console.log(res.statusCode); +}); +``` + +### Methods + +- [_Void_ append( **String** _field_, **Mixed** _value_ [, **Mixed** _options_] )](https://github.com/form-data/form-data#void-append-string-field-mixed-value--mixed-options-). +- [_Headers_ getHeaders( [**Headers** _userHeaders_] )](https://github.com/form-data/form-data#array-getheaders-array-userheaders-) +- [_String_ getBoundary()](https://github.com/form-data/form-data#string-getboundary) +- [_Void_ setBoundary()](https://github.com/form-data/form-data#void-setboundary) +- [_Buffer_ getBuffer()](https://github.com/form-data/form-data#buffer-getbuffer) +- [_Integer_ getLengthSync()](https://github.com/form-data/form-data#integer-getlengthsync) +- [_Integer_ getLength( **function** _callback_ )](https://github.com/form-data/form-data#integer-getlength-function-callback-) +- [_Boolean_ hasKnownLength()](https://github.com/form-data/form-data#boolean-hasknownlength) +- [_Request_ submit( _params_, **function** _callback_ )](https://github.com/form-data/form-data#request-submit-params-function-callback-) +- [_String_ toString()](https://github.com/form-data/form-data#string-tostring) + +#### _Void_ append( **String** _field_, **Mixed** _value_ [, **Mixed** _options_] ) +Append data to the form. You can submit about any format (string, integer, boolean, buffer, etc.). However, Arrays are not supported and need to be turned into strings by the user. +```javascript +var form = new FormData(); +form.append( 'my_string', 'my value' ); +form.append( 'my_integer', 1 ); +form.append( 'my_boolean', true ); +form.append( 'my_buffer', new Buffer(10) ); +form.append( 'my_array_as_json', JSON.stringify( ['bird','cute'] ) ) +``` + +You may provide a string for options, or an object. +```javascript +// Set filename by providing a string for options +form.append( 'my_file', fs.createReadStream('/foo/bar.jpg'), 'bar.jpg' ); + +// provide an object. +form.append( 'my_file', fs.createReadStream('/foo/bar.jpg'), {filename: 'bar.jpg', contentType: 'image/jpeg', knownLength: 19806} ); +``` + +#### _Headers_ getHeaders( [**Headers** _userHeaders_] ) +This method adds the correct `content-type` header to the provided array of `userHeaders`. + +#### _String_ getBoundary() +Return the boundary of the formData. By default, the boundary consists of 26 `-` followed by 24 numbers +for example: +```javascript +--------------------------515890814546601021194782 +``` + +#### _Void_ setBoundary(String _boundary_) +Set the boundary string, overriding the default behavior described above. + +_Note: The boundary must be unique and may not appear in the data._ + +#### _Buffer_ getBuffer() +Return the full formdata request package, as a Buffer. You can insert this Buffer in e.g. Axios to send multipart data. +```javascript +var form = new FormData(); +form.append( 'my_buffer', Buffer.from([0x4a,0x42,0x20,0x52,0x6f,0x63,0x6b,0x73]) ); +form.append( 'my_file', fs.readFileSync('/foo/bar.jpg') ); + +axios.post( 'https://example.com/path/to/api', + form.getBuffer(), + form.getHeaders() + ) +``` +**Note:** Because the output is of type Buffer, you can only append types that are accepted by Buffer: *string, Buffer, ArrayBuffer, Array, or Array-like Object*. A ReadStream for example will result in an error. + +#### _Integer_ getLengthSync() +Same as `getLength` but synchronous. + +_Note: getLengthSync __doesn't__ calculate streams length._ + +#### _Integer_ getLength( **function** _callback_ ) +Returns the `Content-Length` async. The callback is used to handle errors and continue once the length has been calculated +```javascript +this.getLength(function(err, length) { + if (err) { + this._error(err); + return; + } + + // add content length + request.setHeader('Content-Length', length); + + ... +}.bind(this)); +``` + +#### _Boolean_ hasKnownLength() +Checks if the length of added values is known. + +#### _Request_ submit( _params_, **function** _callback_ ) +Submit the form to a web application. +```javascript +var form = new FormData(); +form.append( 'my_string', 'Hello World' ); + +form.submit( 'http://example.com/', function(err, res) { + // res – response object (http.IncomingMessage) // + res.resume(); +} ); +``` + +#### _String_ toString() +Returns the form data as a string. Don't use this if you are sending files or buffers, use `getBuffer()` instead. + +### Integration with other libraries + +#### Request + +Form submission using [request](https://github.com/request/request): + +```javascript +var formData = { + my_field: 'my_value', + my_file: fs.createReadStream(__dirname + '/unicycle.jpg'), +}; + +request.post({url:'http://service.com/upload', formData: formData}, function(err, httpResponse, body) { + if (err) { + return console.error('upload failed:', err); + } + console.log('Upload successful! Server responded with:', body); +}); +``` + +For more details see [request readme](https://github.com/request/request#multipartform-data-multipart-form-uploads). + +#### node-fetch + +You can also submit a form using [node-fetch](https://github.com/bitinn/node-fetch): + +```javascript +var form = new FormData(); + +form.append('a', 1); + +fetch('http://example.com', { method: 'POST', body: form }) + .then(function(res) { + return res.json(); + }).then(function(json) { + console.log(json); + }); +``` + +#### axios + +In Node.js you can post a file using [axios](https://github.com/axios/axios): +```javascript +const form = new FormData(); +const stream = fs.createReadStream(PATH_TO_FILE); + +form.append('image', stream); + +// In Node.js environment you need to set boundary in the header field 'Content-Type' by calling method `getHeaders` +const formHeaders = form.getHeaders(); + +axios.post('http://example.com', form, { + headers: { + ...formHeaders, + }, +}) +.then(response => response) +.catch(error => error) +``` + +## Notes + +- ```getLengthSync()``` method DOESN'T calculate length for streams, use ```knownLength``` options as workaround. +- ```getLength(cb)``` will send an error as first parameter of callback if stream length cannot be calculated (e.g. send in custom streams w/o using ```knownLength```). +- ```submit``` will not add `content-length` if form length is unknown or not calculable. +- Starting version `2.x` FormData has dropped support for `node@0.10.x`. +- Starting version `3.x` FormData has dropped support for `node@4.x`. + +## License + +Form-Data is released under the [MIT](License) license. diff --git a/_nodejs/node_modules/form-data/index.d.ts b/_nodejs/node_modules/form-data/index.d.ts new file mode 100644 index 0000000..295e9e9 --- /dev/null +++ b/_nodejs/node_modules/form-data/index.d.ts @@ -0,0 +1,62 @@ +// Definitions by: Carlos Ballesteros Velasco +// Leon Yu +// BendingBender +// Maple Miao + +/// +import * as stream from 'stream'; +import * as http from 'http'; + +export = FormData; + +// Extracted because @types/node doesn't export interfaces. +interface ReadableOptions { + highWaterMark?: number; + encoding?: string; + objectMode?: boolean; + read?(this: stream.Readable, size: number): void; + destroy?(this: stream.Readable, error: Error | null, callback: (error: Error | null) => void): void; + autoDestroy?: boolean; +} + +interface Options extends ReadableOptions { + writable?: boolean; + readable?: boolean; + dataSize?: number; + maxDataSize?: number; + pauseStreams?: boolean; +} + +declare class FormData extends stream.Readable { + constructor(options?: Options); + append(key: string, value: any, options?: FormData.AppendOptions | string): void; + getHeaders(userHeaders?: FormData.Headers): FormData.Headers; + submit( + params: string | FormData.SubmitOptions, + callback?: (error: Error | null, response: http.IncomingMessage) => void + ): http.ClientRequest; + getBuffer(): Buffer; + setBoundary(boundary: string): void; + getBoundary(): string; + getLength(callback: (err: Error | null, length: number) => void): void; + getLengthSync(): number; + hasKnownLength(): boolean; +} + +declare namespace FormData { + interface Headers { + [key: string]: any; + } + + interface AppendOptions { + header?: string | Headers; + knownLength?: number; + filename?: string; + filepath?: string; + contentType?: string; + } + + interface SubmitOptions extends http.RequestOptions { + protocol?: 'https:' | 'http:'; + } +} diff --git a/_nodejs/node_modules/form-data/lib/browser.js b/_nodejs/node_modules/form-data/lib/browser.js new file mode 100644 index 0000000..09e7c70 --- /dev/null +++ b/_nodejs/node_modules/form-data/lib/browser.js @@ -0,0 +1,2 @@ +/* eslint-env browser */ +module.exports = typeof self == 'object' ? self.FormData : window.FormData; diff --git a/_nodejs/node_modules/form-data/lib/form_data.js b/_nodejs/node_modules/form-data/lib/form_data.js new file mode 100644 index 0000000..18dc819 --- /dev/null +++ b/_nodejs/node_modules/form-data/lib/form_data.js @@ -0,0 +1,501 @@ +var CombinedStream = require('combined-stream'); +var util = require('util'); +var path = require('path'); +var http = require('http'); +var https = require('https'); +var parseUrl = require('url').parse; +var fs = require('fs'); +var Stream = require('stream').Stream; +var mime = require('mime-types'); +var asynckit = require('asynckit'); +var populate = require('./populate.js'); + +// Public API +module.exports = FormData; + +// make it a Stream +util.inherits(FormData, CombinedStream); + +/** + * Create readable "multipart/form-data" streams. + * Can be used to submit forms + * and file uploads to other web applications. + * + * @constructor + * @param {Object} options - Properties to be added/overriden for FormData and CombinedStream + */ +function FormData(options) { + if (!(this instanceof FormData)) { + return new FormData(options); + } + + this._overheadLength = 0; + this._valueLength = 0; + this._valuesToMeasure = []; + + CombinedStream.call(this); + + options = options || {}; + for (var option in options) { + this[option] = options[option]; + } +} + +FormData.LINE_BREAK = '\r\n'; +FormData.DEFAULT_CONTENT_TYPE = 'application/octet-stream'; + +FormData.prototype.append = function(field, value, options) { + + options = options || {}; + + // allow filename as single option + if (typeof options == 'string') { + options = {filename: options}; + } + + var append = CombinedStream.prototype.append.bind(this); + + // all that streamy business can't handle numbers + if (typeof value == 'number') { + value = '' + value; + } + + // https://github.com/felixge/node-form-data/issues/38 + if (util.isArray(value)) { + // Please convert your array into string + // the way web server expects it + this._error(new Error('Arrays are not supported.')); + return; + } + + var header = this._multiPartHeader(field, value, options); + var footer = this._multiPartFooter(); + + append(header); + append(value); + append(footer); + + // pass along options.knownLength + this._trackLength(header, value, options); +}; + +FormData.prototype._trackLength = function(header, value, options) { + var valueLength = 0; + + // used w/ getLengthSync(), when length is known. + // e.g. for streaming directly from a remote server, + // w/ a known file a size, and not wanting to wait for + // incoming file to finish to get its size. + if (options.knownLength != null) { + valueLength += +options.knownLength; + } else if (Buffer.isBuffer(value)) { + valueLength = value.length; + } else if (typeof value === 'string') { + valueLength = Buffer.byteLength(value); + } + + this._valueLength += valueLength; + + // @check why add CRLF? does this account for custom/multiple CRLFs? + this._overheadLength += + Buffer.byteLength(header) + + FormData.LINE_BREAK.length; + + // empty or either doesn't have path or not an http response or not a stream + if (!value || ( !value.path && !(value.readable && value.hasOwnProperty('httpVersion')) && !(value instanceof Stream))) { + return; + } + + // no need to bother with the length + if (!options.knownLength) { + this._valuesToMeasure.push(value); + } +}; + +FormData.prototype._lengthRetriever = function(value, callback) { + + if (value.hasOwnProperty('fd')) { + + // take read range into a account + // `end` = Infinity –> read file till the end + // + // TODO: Looks like there is bug in Node fs.createReadStream + // it doesn't respect `end` options without `start` options + // Fix it when node fixes it. + // https://github.com/joyent/node/issues/7819 + if (value.end != undefined && value.end != Infinity && value.start != undefined) { + + // when end specified + // no need to calculate range + // inclusive, starts with 0 + callback(null, value.end + 1 - (value.start ? value.start : 0)); + + // not that fast snoopy + } else { + // still need to fetch file size from fs + fs.stat(value.path, function(err, stat) { + + var fileSize; + + if (err) { + callback(err); + return; + } + + // update final size based on the range options + fileSize = stat.size - (value.start ? value.start : 0); + callback(null, fileSize); + }); + } + + // or http response + } else if (value.hasOwnProperty('httpVersion')) { + callback(null, +value.headers['content-length']); + + // or request stream http://github.com/mikeal/request + } else if (value.hasOwnProperty('httpModule')) { + // wait till response come back + value.on('response', function(response) { + value.pause(); + callback(null, +response.headers['content-length']); + }); + value.resume(); + + // something else + } else { + callback('Unknown stream'); + } +}; + +FormData.prototype._multiPartHeader = function(field, value, options) { + // custom header specified (as string)? + // it becomes responsible for boundary + // (e.g. to handle extra CRLFs on .NET servers) + if (typeof options.header == 'string') { + return options.header; + } + + var contentDisposition = this._getContentDisposition(value, options); + var contentType = this._getContentType(value, options); + + var contents = ''; + var headers = { + // add custom disposition as third element or keep it two elements if not + 'Content-Disposition': ['form-data', 'name="' + field + '"'].concat(contentDisposition || []), + // if no content type. allow it to be empty array + 'Content-Type': [].concat(contentType || []) + }; + + // allow custom headers. + if (typeof options.header == 'object') { + populate(headers, options.header); + } + + var header; + for (var prop in headers) { + if (!headers.hasOwnProperty(prop)) continue; + header = headers[prop]; + + // skip nullish headers. + if (header == null) { + continue; + } + + // convert all headers to arrays. + if (!Array.isArray(header)) { + header = [header]; + } + + // add non-empty headers. + if (header.length) { + contents += prop + ': ' + header.join('; ') + FormData.LINE_BREAK; + } + } + + return '--' + this.getBoundary() + FormData.LINE_BREAK + contents + FormData.LINE_BREAK; +}; + +FormData.prototype._getContentDisposition = function(value, options) { + + var filename + , contentDisposition + ; + + if (typeof options.filepath === 'string') { + // custom filepath for relative paths + filename = path.normalize(options.filepath).replace(/\\/g, '/'); + } else if (options.filename || value.name || value.path) { + // custom filename take precedence + // formidable and the browser add a name property + // fs- and request- streams have path property + filename = path.basename(options.filename || value.name || value.path); + } else if (value.readable && value.hasOwnProperty('httpVersion')) { + // or try http response + filename = path.basename(value.client._httpMessage.path || ''); + } + + if (filename) { + contentDisposition = 'filename="' + filename + '"'; + } + + return contentDisposition; +}; + +FormData.prototype._getContentType = function(value, options) { + + // use custom content-type above all + var contentType = options.contentType; + + // or try `name` from formidable, browser + if (!contentType && value.name) { + contentType = mime.lookup(value.name); + } + + // or try `path` from fs-, request- streams + if (!contentType && value.path) { + contentType = mime.lookup(value.path); + } + + // or if it's http-reponse + if (!contentType && value.readable && value.hasOwnProperty('httpVersion')) { + contentType = value.headers['content-type']; + } + + // or guess it from the filepath or filename + if (!contentType && (options.filepath || options.filename)) { + contentType = mime.lookup(options.filepath || options.filename); + } + + // fallback to the default content type if `value` is not simple value + if (!contentType && typeof value == 'object') { + contentType = FormData.DEFAULT_CONTENT_TYPE; + } + + return contentType; +}; + +FormData.prototype._multiPartFooter = function() { + return function(next) { + var footer = FormData.LINE_BREAK; + + var lastPart = (this._streams.length === 0); + if (lastPart) { + footer += this._lastBoundary(); + } + + next(footer); + }.bind(this); +}; + +FormData.prototype._lastBoundary = function() { + return '--' + this.getBoundary() + '--' + FormData.LINE_BREAK; +}; + +FormData.prototype.getHeaders = function(userHeaders) { + var header; + var formHeaders = { + 'content-type': 'multipart/form-data; boundary=' + this.getBoundary() + }; + + for (header in userHeaders) { + if (userHeaders.hasOwnProperty(header)) { + formHeaders[header.toLowerCase()] = userHeaders[header]; + } + } + + return formHeaders; +}; + +FormData.prototype.setBoundary = function(boundary) { + this._boundary = boundary; +}; + +FormData.prototype.getBoundary = function() { + if (!this._boundary) { + this._generateBoundary(); + } + + return this._boundary; +}; + +FormData.prototype.getBuffer = function() { + var dataBuffer = new Buffer.alloc( 0 ); + var boundary = this.getBoundary(); + + // Create the form content. Add Line breaks to the end of data. + for (var i = 0, len = this._streams.length; i < len; i++) { + if (typeof this._streams[i] !== 'function') { + + // Add content to the buffer. + if(Buffer.isBuffer(this._streams[i])) { + dataBuffer = Buffer.concat( [dataBuffer, this._streams[i]]); + }else { + dataBuffer = Buffer.concat( [dataBuffer, Buffer.from(this._streams[i])]); + } + + // Add break after content. + if (typeof this._streams[i] !== 'string' || this._streams[i].substring( 2, boundary.length + 2 ) !== boundary) { + dataBuffer = Buffer.concat( [dataBuffer, Buffer.from(FormData.LINE_BREAK)] ); + } + } + } + + // Add the footer and return the Buffer object. + return Buffer.concat( [dataBuffer, Buffer.from(this._lastBoundary())] ); +}; + +FormData.prototype._generateBoundary = function() { + // This generates a 50 character boundary similar to those used by Firefox. + // They are optimized for boyer-moore parsing. + var boundary = '--------------------------'; + for (var i = 0; i < 24; i++) { + boundary += Math.floor(Math.random() * 10).toString(16); + } + + this._boundary = boundary; +}; + +// Note: getLengthSync DOESN'T calculate streams length +// As workaround one can calculate file size manually +// and add it as knownLength option +FormData.prototype.getLengthSync = function() { + var knownLength = this._overheadLength + this._valueLength; + + // Don't get confused, there are 3 "internal" streams for each keyval pair + // so it basically checks if there is any value added to the form + if (this._streams.length) { + knownLength += this._lastBoundary().length; + } + + // https://github.com/form-data/form-data/issues/40 + if (!this.hasKnownLength()) { + // Some async length retrievers are present + // therefore synchronous length calculation is false. + // Please use getLength(callback) to get proper length + this._error(new Error('Cannot calculate proper length in synchronous way.')); + } + + return knownLength; +}; + +// Public API to check if length of added values is known +// https://github.com/form-data/form-data/issues/196 +// https://github.com/form-data/form-data/issues/262 +FormData.prototype.hasKnownLength = function() { + var hasKnownLength = true; + + if (this._valuesToMeasure.length) { + hasKnownLength = false; + } + + return hasKnownLength; +}; + +FormData.prototype.getLength = function(cb) { + var knownLength = this._overheadLength + this._valueLength; + + if (this._streams.length) { + knownLength += this._lastBoundary().length; + } + + if (!this._valuesToMeasure.length) { + process.nextTick(cb.bind(this, null, knownLength)); + return; + } + + asynckit.parallel(this._valuesToMeasure, this._lengthRetriever, function(err, values) { + if (err) { + cb(err); + return; + } + + values.forEach(function(length) { + knownLength += length; + }); + + cb(null, knownLength); + }); +}; + +FormData.prototype.submit = function(params, cb) { + var request + , options + , defaults = {method: 'post'} + ; + + // parse provided url if it's string + // or treat it as options object + if (typeof params == 'string') { + + params = parseUrl(params); + options = populate({ + port: params.port, + path: params.pathname, + host: params.hostname, + protocol: params.protocol + }, defaults); + + // use custom params + } else { + + options = populate(params, defaults); + // if no port provided use default one + if (!options.port) { + options.port = options.protocol == 'https:' ? 443 : 80; + } + } + + // put that good code in getHeaders to some use + options.headers = this.getHeaders(params.headers); + + // https if specified, fallback to http in any other case + if (options.protocol == 'https:') { + request = https.request(options); + } else { + request = http.request(options); + } + + // get content length and fire away + this.getLength(function(err, length) { + if (err && err !== 'Unknown stream') { + this._error(err); + return; + } + + // add content length + if (length) { + request.setHeader('Content-Length', length); + } + + this.pipe(request); + if (cb) { + var onResponse; + + var callback = function (error, responce) { + request.removeListener('error', callback); + request.removeListener('response', onResponse); + + return cb.call(this, error, responce); + }; + + onResponse = callback.bind(this, null); + + request.on('error', callback); + request.on('response', onResponse); + } + }.bind(this)); + + return request; +}; + +FormData.prototype._error = function(err) { + if (!this.error) { + this.error = err; + this.pause(); + this.emit('error', err); + } +}; + +FormData.prototype.toString = function () { + return '[object FormData]'; +}; diff --git a/_nodejs/node_modules/form-data/lib/populate.js b/_nodejs/node_modules/form-data/lib/populate.js new file mode 100644 index 0000000..4d35738 --- /dev/null +++ b/_nodejs/node_modules/form-data/lib/populate.js @@ -0,0 +1,10 @@ +// populates missing values +module.exports = function(dst, src) { + + Object.keys(src).forEach(function(prop) + { + dst[prop] = dst[prop] || src[prop]; + }); + + return dst; +}; diff --git a/_nodejs/node_modules/form-data/package.json b/_nodejs/node_modules/form-data/package.json new file mode 100644 index 0000000..0f20240 --- /dev/null +++ b/_nodejs/node_modules/form-data/package.json @@ -0,0 +1,68 @@ +{ + "author": "Felix Geisendörfer (http://debuggable.com/)", + "name": "form-data", + "description": "A library to create readable \"multipart/form-data\" streams. Can be used to submit forms and file uploads to other web applications.", + "version": "4.0.0", + "repository": { + "type": "git", + "url": "git://github.com/form-data/form-data.git" + }, + "main": "./lib/form_data", + "browser": "./lib/browser", + "typings": "./index.d.ts", + "scripts": { + "pretest": "rimraf coverage test/tmp", + "test": "istanbul cover test/run.js", + "posttest": "istanbul report lcov text", + "lint": "eslint lib/*.js test/*.js test/integration/*.js", + "report": "istanbul report lcov text", + "ci-lint": "is-node-modern 8 && npm run lint || is-node-not-modern 8", + "ci-test": "npm run test && npm run browser && npm run report", + "predebug": "rimraf coverage test/tmp", + "debug": "verbose=1 ./test/run.js", + "browser": "browserify -t browserify-istanbul test/run-browser.js | obake --coverage", + "check": "istanbul check-coverage coverage/coverage*.json", + "files": "pkgfiles --sort=name", + "get-version": "node -e \"console.log(require('./package.json').version)\"", + "update-readme": "sed -i.bak 's/\\/master\\.svg/\\/v'$(npm --silent run get-version)'.svg/g' README.md", + "restore-readme": "mv README.md.bak README.md", + "prepublish": "in-publish && npm run update-readme || not-in-publish", + "postpublish": "npm run restore-readme" + }, + "pre-commit": [ + "lint", + "ci-test", + "check" + ], + "engines": { + "node": ">= 6" + }, + "dependencies": { + "asynckit": "^0.4.0", + "combined-stream": "^1.0.8", + "mime-types": "^2.1.12" + }, + "devDependencies": { + "@types/node": "^12.0.10", + "browserify": "^13.1.1", + "browserify-istanbul": "^2.0.0", + "coveralls": "^3.0.4", + "cross-spawn": "^6.0.5", + "eslint": "^6.0.1", + "fake": "^0.2.2", + "far": "^0.0.7", + "formidable": "^1.0.17", + "in-publish": "^2.0.0", + "is-node-modern": "^1.0.0", + "istanbul": "^0.4.5", + "obake": "^0.1.2", + "puppeteer": "^1.19.0", + "pkgfiles": "^2.3.0", + "pre-commit": "^1.1.3", + "request": "^2.88.0", + "rimraf": "^2.7.1", + "tape": "^4.6.2", + "typescript": "^3.5.2" + }, + "license": "MIT" +} diff --git a/_nodejs/node_modules/log-prefix/README.md b/_nodejs/node_modules/log-prefix/README.md new file mode 100644 index 0000000..ed7795f --- /dev/null +++ b/_nodejs/node_modules/log-prefix/README.md @@ -0,0 +1,49 @@ +log-prefix +========== + +Prefix calls to console.log, console.warn, etc with whatever you'd like + +Example +------- + +``` js +console.log('before log-prefix'); +require('log-prefix')('==> %s <=='); +console.log('after log-prefix'); +``` + +yields + +``` +before log-prefix +==> after log-prefix <== +``` + +You can specify a function instead of a string. The function must return a +string to be used (good for dynamic values). + +``` js +require('log-prefix')(function() { return '[' + Date.now() + '] %s' }); +console.log('hello %s', 'world'); +``` + +yields + +``` +[1371582989993] hello world +``` + +Install +------ + + npm install log-prefix + +Tests +----- + + npm test + +License +------- + +MIT License diff --git a/_nodejs/node_modules/log-prefix/log-prefix.js b/_nodejs/node_modules/log-prefix/log-prefix.js new file mode 100644 index 0000000..54c9fa0 --- /dev/null +++ b/_nodejs/node_modules/log-prefix/log-prefix.js @@ -0,0 +1,20 @@ +var util = require('util'); +var funcs = { + log: console.log.bind(console), + info: console.info.bind(console), + warn: console.warn.bind(console), + error: console.error.bind(console), + debug: (console.debug || console.log).bind(console) +}; + +module.exports = patch; + +function patch(fn) { + Object.keys(funcs).forEach(function(k) { + console[k] = function() { + var s = typeof fn === 'function' ? fn() : fn; + arguments[0] = util.format(s, arguments[0]); + funcs[k].apply(console, arguments); + }; + }); +} diff --git a/_nodejs/node_modules/log-prefix/package.json b/_nodejs/node_modules/log-prefix/package.json new file mode 100644 index 0000000..f81e715 --- /dev/null +++ b/_nodejs/node_modules/log-prefix/package.json @@ -0,0 +1,29 @@ +{ + "name": "log-prefix", + "description": "Prefix calls to console.log, console.warn, etc with whatever you'd like", + "version": "0.1.1", + "author": "Dave Eddy (http://www.daveeddy.com)", + "contributors": [], + "main": "./log-prefix.js", + "repository": { + "type": "git", + "url": "git://github.com/bahamas10/node-log-prefix.git" + }, + "scripts": { + "test": "for f in tests/*; do echo \"$f\"; node \"$f\"; done; echo 'passed!'; exit 0" + }, + "dependencies": {}, + "devDependencies": {}, + "optionalDependencies": {}, + "engines": { + "node": "*" + }, + "keywords": [ + "console", + "console.log", + "log", + "logger", + "timestamp", + "prefix" + ] +} diff --git a/_nodejs/node_modules/log-prefix/tests/func.js b/_nodejs/node_modules/log-prefix/tests/func.js new file mode 100644 index 0000000..2971f40 --- /dev/null +++ b/_nodejs/node_modules/log-prefix/tests/func.js @@ -0,0 +1,7 @@ +require('../')(function() { return '[' + Date.now() + '] %s'; }); + +console.log('test %s', 'log'); +console.error('test %s', 'error'); +console.warn('test %s', 'warn'); +console.info('test %s', 'info'); +console.debug('test %s', 'debug'); diff --git a/_nodejs/node_modules/log-prefix/tests/simple.js b/_nodejs/node_modules/log-prefix/tests/simple.js new file mode 100644 index 0000000..0543d95 --- /dev/null +++ b/_nodejs/node_modules/log-prefix/tests/simple.js @@ -0,0 +1,7 @@ +require('../')('LOG: %s'); + +console.log('test %s', 'log'); +console.error('test %s', 'error'); +console.warn('test %s', 'warn'); +console.info('test %s', 'info'); +console.debug('test %s', 'debug'); diff --git a/_nodejs/node_modules/log-timestamp/README.md b/_nodejs/node_modules/log-timestamp/README.md new file mode 100644 index 0000000..c32c5d0 --- /dev/null +++ b/_nodejs/node_modules/log-timestamp/README.md @@ -0,0 +1,62 @@ +log-timestamp +============= + +Prepend timestamps to functions like console.log, console.warn, etc + +Example +------- + +``` js +console.log('Before log-timestamp'); +require('log-timestamp'); +console.log('After log-timestamp'); +``` + +yields + +``` +Before log-timestamp +[2012-08-23T20:08:32.000Z] After log-timestamp +``` + +You can specify a custom function as well + +``` js +require('log-timestamp')(function() { return 'date="' + new Date().toISOString() + '" message="%s"' }); +console.log('hello %s', 'world'); +``` + +yields + +``` +date="2012-08-23T20:08:37.000Z" message="hello world" +``` + +Also you can specify a custom prefix string + +``` js +require('log-timestamp')('#WHATEVER'); +console.log('hello world'); +``` + +yields + +``` +#WHATEVER [2012-08-23T20:08:37.000Z] hello world +``` + + +Install +------ + + npm install log-timestamp + +Tests +----- + + npm test + +License +------- + +MIT License diff --git a/_nodejs/node_modules/log-timestamp/log-timestamp.js b/_nodejs/node_modules/log-timestamp/log-timestamp.js new file mode 100644 index 0000000..f440a0d --- /dev/null +++ b/_nodejs/node_modules/log-timestamp/log-timestamp.js @@ -0,0 +1,21 @@ +var util = require('util'); + +var logprefix = require('log-prefix'); + +module.exports = patch; + +patch(); // patch when require'd + +function patch(prefix) { + if(typeof prefix === 'function') + logprefix(prefix); + else if(typeof prefix === 'string' && prefix) + logprefix(() => prefix + ' ' + timestamp()); + else + logprefix(timestamp); +} + +// the default date format to print +function timestamp() { + return '[' + new Date().toISOString() + ']'; +} diff --git a/_nodejs/node_modules/log-timestamp/package.json b/_nodejs/node_modules/log-timestamp/package.json new file mode 100644 index 0000000..4264638 --- /dev/null +++ b/_nodejs/node_modules/log-timestamp/package.json @@ -0,0 +1,30 @@ +{ + "name": "log-timestamp", + "description": "Prepend timestamps to functions like console.log, console.warn, etc", + "version": "0.3.0", + "author": "Dave Eddy (http://www.daveeddy.com)", + "contributors": [], + "main": "./log-timestamp.js", + "repository": { + "type": "git", + "url": "git://github.com/bahamas10/node-log-timestamp.git" + }, + "scripts": { + "test": "for f in tests/*; do echo \"$f\"; node \"$f\"; done; echo 'passed!'; exit 0" + }, + "dependencies": { + "log-prefix": "0.1.1" + }, + "devDependencies": {}, + "optionalDependencies": {}, + "engines": { + "node": "*" + }, + "keywords": [ + "console", + "console.log", + "log", + "logger", + "timestamp" + ] +} diff --git a/_nodejs/node_modules/log-timestamp/tests/format.js b/_nodejs/node_modules/log-timestamp/tests/format.js new file mode 100644 index 0000000..52f67b7 --- /dev/null +++ b/_nodejs/node_modules/log-timestamp/tests/format.js @@ -0,0 +1,5 @@ +#!/usr/bin/env node + +require('../'); + +console.log('Hello ==>%s<==', 'world'); diff --git a/_nodejs/node_modules/log-timestamp/tests/func.js b/_nodejs/node_modules/log-timestamp/tests/func.js new file mode 100644 index 0000000..293b8d6 --- /dev/null +++ b/_nodejs/node_modules/log-timestamp/tests/func.js @@ -0,0 +1,10 @@ +#!/usr/bin/env node + +require('../')(function() { + return '<<' + Date.now() + '>> %s'; +}); + +['debug', 'log', 'info', 'warn', 'error'].forEach(function(k) { + process.stdout.write('Testing ' + k + '\n'); + console[k]('Hello %s!', 'world'); +}); diff --git a/_nodejs/node_modules/log-timestamp/tests/object.js b/_nodejs/node_modules/log-timestamp/tests/object.js new file mode 100644 index 0000000..a51436a --- /dev/null +++ b/_nodejs/node_modules/log-timestamp/tests/object.js @@ -0,0 +1,5 @@ +#!/usr/bin/env node + +require('../'); + +console.log({foo: 'bar'}); diff --git a/_nodejs/node_modules/log-timestamp/tests/test.js b/_nodejs/node_modules/log-timestamp/tests/test.js new file mode 100644 index 0000000..1e5fa40 --- /dev/null +++ b/_nodejs/node_modules/log-timestamp/tests/test.js @@ -0,0 +1,8 @@ +#!/usr/bin/env node + +require('../'); + +['debug', 'log', 'info', 'warn', 'error'].forEach(function(k) { + process.stdout.write('Testing ' + k + '\n'); + console[k]('Hello %s!', 'world'); +});