Enable the tuning of WOQ algorithm (#1328)

* support WOQ algos tuning
---------

Signed-off-by: Kaihui-intel <kaihui.tang@intel.com>
Signed-off-by: yuwenzho <yuwen.zhou@intel.com>
Co-authored-by: pre-commit-ci[bot] <66853113+pre-commit-ci[bot]@users.noreply.github.com>
Co-authored-by: yuwenzho <yuwen.zhou@intel.com>
Signed-off-by: bmyrcha <bartosz.myrcha@intel.com>

Author: 3 people

neural_compressor/adaptor/onnxrt.py

@@ -1632,25 +1632,36 @@ def quantize(self, tune_cfg, model, data_loader, q_func=None):
         Returns:
             (dict): quantized model
         """
+        if self.performance_only:
+            tmp_model = model
+        else:
+            try:
+                tmp_model = copy.deepcopy(model)
+            except Exception as e:  # pragma: no cover
+                logger.warning("Fail to deep copy the model due to {}, inplace is used now.".format(repr(e)))
+                tmp_model = model
+
         assert q_func is None, "quantization aware training has not been supported on ONNXRUNTIME"
         for precision in self.query_handler.get_precisions():
             if precision == "weight_only_integer":
                 self.quantizable_op_types += self.query_handler.get_op_types_by_precision(precision=precision)
-        self.quantizable_ops = self._query_quantizable_ops(model.model)
+        self.quantizable_ops = self._query_quantizable_ops(tmp_model.model)
 
+        self._update_tune_cfg(tune_cfg, tmp_model.model)
         quant_config = self._cfg_to_quantize_config(tune_cfg)
         algos = set([item["algorithm"] for key, item in quant_config.items() if isinstance(item, dict)])
         if "GPTQ" in algos:
             from neural_compressor.adaptor.ox_utils.weight_only import gptq_quantize
 
+            assert data_loader is not None, "GPTQ WOQ algorithm needs to pass 'calib_dataloader' to quantization.fit()"
             percdamp = self.recipes.get("gptq_args", {}).get("percdamp", 0.01)
             blocksize = self.recipes.get("gptq_args", {}).get("blocksize", 128)
             actorder = self.recipes.get("gptq_args", {}).get("actorder", False)
             mse = self.recipes.get("gptq_args", {}).get("mse", False)
             perchannel = self.recipes.get("gptq_args", {}).get("perchannel", True)
             calib_sampling_size = tune_cfg.get("calib_sampling_size", 1)
-            model = gptq_quantize(
-                model,
+            tmp_model = gptq_quantize(
+                tmp_model,
                 data_loader,
                 quant_config,
                 n_samples=calib_sampling_size,
@@ -1663,11 +1674,12 @@ def quantize(self, tune_cfg, model, data_loader, q_func=None):
         if "AWQ" in algos:
             from neural_compressor.adaptor.ox_utils.weight_only import awq_quantize
 
+            assert data_loader is not None, "AWQ WOQ algorithm needs to pass 'calib_dataloader' to quantization.fit()"
             enable_auto_scale = self.recipes.get("awq_args", {}).get("enable_auto_scale", True)
             enable_mse_search = self.recipes.get("awq_args", {}).get("enable_mse_search", True)
             calib_sampling_size = tune_cfg.get("calib_sampling_size", 1)
-            model = awq_quantize(
-                model,
+            tmp_model = awq_quantize(
+                tmp_model,
                 data_loader,
                 quant_config,
                 n_samples=calib_sampling_size,
@@ -1677,11 +1689,11 @@ def quantize(self, tune_cfg, model, data_loader, q_func=None):
         elif "RTN" in algos:
             from neural_compressor.adaptor.ox_utils.weight_only import rtn_quantize
 
-            model = rtn_quantize(model, quant_config)
-        model.q_config = copy.deepcopy(quant_config)
-        self._dump_model_op_stats(model, tune_cfg)
-        model.topological_sort()
-        return model
+            tmp_model = rtn_quantize(tmp_model, quant_config)
+        tmp_model.q_config = copy.deepcopy(quant_config)
+        self._dump_model_op_stats(tmp_model, tune_cfg)
+        tmp_model.topological_sort()
+        return tmp_model
 
     def _dump_model_op_stats(self, model, tune_cfg):
         import re
@@ -1747,6 +1759,31 @@ def _cfg_to_quantize_config(self, tune_cfg):
 
         return quantize_config
 
+    def _update_tune_cfg(self, tune_cfg, model):
+        """Update tune cfg according to woq_tuning_cfg."""
+        if tune_cfg.get("woq_tuning_cfg") is None:
+            return tune_cfg
+
+        from neural_compressor.strategy.utils.constant import WOQ_TUNING_ALGOS
+
+        woq_tuning_cfg = tune_cfg.get("woq_tuning_cfg")
+        new_woq_cfg = WOQ_TUNING_ALGOS.get(woq_tuning_cfg)
+
+        for node_cfg in tune_cfg["op"].values():
+            node_cfg["weight"].update(
+                {cfg_name: cfg_value for cfg_name, cfg_value in new_woq_cfg.items() if cfg_name in node_cfg["weight"]}
+            )
+
+        # find last matmul and set to fp32
+        if "DISABLE_LAST_MATMUL" in woq_tuning_cfg:
+            last_matmul = None
+            fp32_op_cfg = {"weight": {"dtype": "fp32"}, "activation": {"dtype": "fp32", "quant_mode": "fp32"}}
+            for node in model.graph.node:
+                if node.op_type in ["MatMul"]:
+                    last_matmul = (node.name, node.op_type)
+            if last_matmul in tune_cfg["op"]:
+                tune_cfg["op"][last_matmul].update(fp32_op_cfg)
+
     def query_fw_capability(self, model):
         """The function is used to query framework capability.
         TODO: will be replaced by framework query API

neural_compressor/strategy/auto.py

@@ -120,6 +120,12 @@ def next_tune_cfg(self):
         op_tuning_cfg["calib_sampling_size"] = calib_sampling_size_lst[0]
         if not self.cur_best_tuning_cfg:
             self.cur_best_tuning_cfg = deepcopy(op_tuning_cfg)
+
+        # try to tune a WeightOnlyQuant algorithm
+        if self._should_tuning_woq_algo():
+            for tune_cfg in self.tuning_woq_algo(tuning_space, deepcopy(self.cur_best_tuning_cfg)):
+                yield tune_cfg
+
         # try to tune sq alpha
         if self._should_tuning_sq_alpha(self.config.recipes):
             for tune_cfg in self.tuning_sq_alpha(tuning_space, deepcopy(self.cur_best_tuning_cfg), self.config.recipes):

neural_compressor/strategy/basic.py

@@ -312,6 +312,12 @@ def next_tune_cfg(self):
             stage1_max = 1e9  # TODO set a more appropriate value
             if not self.cur_best_tuning_cfg:
                 self.cur_best_tuning_cfg = deepcopy(initial_op_tuning_cfg)
+
+            # try to tune a WeightOnlyQuant algorithm
+            if self._should_tuning_woq_algo():
+                for tune_cfg in self.tuning_woq_algo(tuning_space, deepcopy(self.cur_best_tuning_cfg)):
+                    yield tune_cfg
+
             # try to tune sq alpha
             if self._should_tuning_sq_alpha(self.config.recipes):
                 for tune_cfg in self.tuning_sq_alpha(

neural_compressor/strategy/strategy.py

@@ -46,6 +46,7 @@
     DotDict,
     LazyImport,
     Statistics,
+    check_key_exist,
     dump_table,
     equal_dicts,
     fault_tolerant_file,
@@ -1153,6 +1154,40 @@ def tuning_sq_alpha(self, tuning_space, tuning_cfg, recipes):
         for tune_cfg in sq_sampler:
             yield tune_cfg
 
+    def _should_tuning_woq_algo(self):
+        """Currently, it's only available for the ORT backend with approach is weight_only.
+
+        It will be triggered when
+            a) quant_level is auto or quant_level is 1 && strategy is basic
+            b) and the "algorithm" is not set in op_type_dict
+            c) and woq will only trigger once
+        """
+        return (
+            "onnx" in self.framework.lower()
+            and "weight_only" in self.config.approach
+            and not check_key_exist(self.config.op_type_dict, "algorithm")
+            and not check_key_exist(self.tuning_history, "woq_tuning_cfg")
+        )
+
+    def tuning_woq_algo(self, tuning_space, tuning_cfg):
+        """Tuning weight only algorithm.
+
+        Args:
+            tuning_space: tuning space
+            tuning_cfg: the initial tuning config
+
+        Yields:
+            tuning config
+        """
+        logger.info("[STRATEGY] Start tuning Weight Only Quant' algo.")
+        woq_sampler = tuning_sampler_dict.get_class("woq_algorithm")(tuning_space, [], tuning_cfg)
+        for tune_cfg in woq_sampler:
+            yield tune_cfg
+
+        logger.info(
+            "[Strategy] The best tuning config with WeightOnlyQuant is" f"{self.cur_best_tuning_cfg['woq_tuning_cfg']}."
+        )
+
     def initial_dynamic_cfg_based_on_static_cfg(self, op_static_cfg: OpTuningConfig):
         """Init the dynamic tuning config according to the static config.
 
@@ -1322,6 +1357,7 @@ def _tune_cfg_converter(self, op_tuning_cfg):
         # For not tuning recipe, tune cfg use it directly
         tune_cfg["recipe_cfgs"].update(self._not_tuning_recipes_values)
         tune_cfg["trial_number"] = deepcopy(self.trials_count)
+        tune_cfg.setdefault("woq_tuning_cfg", op_tuning_cfg.get("woq_tuning_cfg"))
         # The sq-related args comes from user config, current best tuning config
         # TODO simplify the logic for transforming the arguments
         # update the sq-related args from self.cur_best_tuning_cfg

neural_compressor/strategy/utils/constant.py

@@ -16,6 +16,7 @@
 # limitations under the License.
 """Strategy constant."""
 
+
 PRECISION_LIST = ["bf16", "fp16", "fp32"]
 QUANT_MODE_SET = {"static", "dynamic"}
 LOWER_BIT_LIST = ["int4"]
@@ -56,3 +57,12 @@
     "last_conv_or_matmul_quantization",
     "pre_post_process_quantization",
 }
+
+
+WOQ_TUNING_ALGOS = {
+    "RTN_G32ASYM": {"algorithm": "RTN", "group_size": 32, "scheme": "asym"},
+    "GPTQ_G32ASYM": {"algorithm": "GPTQ", "group_size": 32, "scheme": "asym"},
+    "GPTQ_G32ASYM_DISABLE_LAST_MATMUL": {"algorithm": "GPTQ", "group_size": 32, "scheme": "asym"},
+    "GPTQ_G128ASYM": {"algorithm": "GPTQ", "group_size": 128, "scheme": "asym"},
+    "AWQ_G32ASYM": {"algorithm": "AWQ", "group_size": 32, "scheme": "asym"},
+}

neural_compressor/strategy/utils/tuning_sampler.py

@@ -23,6 +23,7 @@
 from typing import Any, Dict, List, Tuple, Union
 
 from ...utils import logger
+from ..utils.constant import WOQ_TUNING_ALGOS
 from .tuning_space import TuningSpace, pattern_to_internal, quant_mode_from_pattern
 from .tuning_structs import OpTuningConfig
 from .utility import ClassRegister
@@ -609,3 +610,34 @@ def __iter__(self):
             recipe_cfgs["smooth_quant_args"] = {"alpha": alpha}
             logger.debug(f"[STRATEGY] set smooth quant alpha with: {alpha:.4f}")
             yield new_tune_cfg
+
+
+@tuning_sampler_dict("woq_algorithm")
+class WeightOnlyQuantSampler(TuningSampler):
+    """Not displayed in API Docs."""
+
+    def __init__(
+        self,
+        tuning_space: TuningSpace,
+        tuning_order_lst: List[TuningOrder],
+        initial_op_tuning_cfg: Dict,
+    ):
+        """Init tuning sampler.
+
+        Args:
+            tuning_space: The tuning space.
+            tuning_order_lst: The traverse orders.
+            initial_op_tuning_cfg: The initialized tuning config.
+        """
+        super().__init__(tuning_space, tuning_order_lst, initial_op_tuning_cfg)
+
+    def __iter__(self):
+        """Yield the next tuning config.
+
+        Yields:
+            The next tuning config.
+        """
+        new_tune_cfg = copy.deepcopy(self.initial_op_tuning_cfg)
+        for algo in WOQ_TUNING_ALGOS.keys():
+            new_tune_cfg["woq_tuning_cfg"] = algo
+            yield new_tune_cfg

neural_compressor/utils/utility.py

@@ -1092,3 +1092,34 @@ def mse_metric_gap(fp32_tensor: Any, dequantize_tensor: Any) -> float:
     diff_tensor = fp32_tensor_norm - dequantize_tensor_norm
     euclidean_dist = np.sum(diff_tensor**2)  # type: ignore
     return euclidean_dist / fp32_tensor.size
+
+
+def check_key_exist(data, key):
+    """Recursively checks if a key exists in a dictionary or list.
+
+    Args:
+        data (dict or list): The dictionary or list to search.
+        key (any): The key to search for.
+
+    Returns:
+        bool: True if the key exists in the data structure, False otherwise.
+
+    Examples:
+        >>> check_key_exist({'a': 1, 'b': {'c': 2}}, 'c')
+        True
+        >>> check_key_exist([{'a': 1}, {'b': 2}], 'b')
+        True
+        >>> check_key_exist({'a': 1, 'b': [1, 2, 3]}, 'c')
+        False
+    """
+    if isinstance(data, dict):
+        if key in data:
+            return True
+        for value in data.values():
+            if check_key_exist(value, key):
+                return True
+    elif isinstance(data, list):
+        for item in data:
+            if check_key_exist(item, key):
+                return True
+    return False

test/adaptor/onnxrt_adaptor/test_weight_only_adaptor.py

@@ -1,3 +1,4 @@
+import copy
 import os
 import shutil
 import subprocess
@@ -9,6 +10,7 @@
 from transformers import AutoTokenizer
 
 from neural_compressor import PostTrainingQuantConfig, quantization
+from neural_compressor.utils.constant import FP32
 
 
 def Inference(model, data):
@@ -265,6 +267,79 @@ def test_GPTQ_quant(self):
         ]
         self.assertTrue(len(rtn_op_names) + 1, len(gptq_op_names))
 
+    def _test_woq_tune_common(self, eval_func, quant_level=1, **kwargs):
+        from neural_compressor import quantization
+        from neural_compressor.config import PostTrainingQuantConfig, TuningCriterion
+
+        tuning_criterion = TuningCriterion(max_trials=5)
+
+        fp32_model = copy.deepcopy(self.model)
+        conf = PostTrainingQuantConfig(
+            approach="weight_only", quant_level=quant_level, tuning_criterion=tuning_criterion, **kwargs
+        )
+        q_model = quantization.fit(
+            fp32_model,
+            conf,
+            calib_dataloader=self.dataloader,
+            eval_func=eval_func,
+        )
+        self.assertIsNotNone(q_model)
+        return q_model
+
+    def _count_woq_matmul(self, q_model, bits=4, group_size=32):
+        op_names = [
+            i.name
+            for i in q_model.nodes()
+            if i.op_type.startswith("MatMul") and i.input[1].endswith("_Q{}G{}".format(bits, group_size))
+        ]
+        return len(op_names)
+
+    def test_woq_tune(self):
+        from functools import partial
+
+        def fake_eval(model, eval_result_lst):
+            acc = eval_result_lst.pop(0)
+            return acc
+
+        quant_levels = ["auto", 1]
+        for quant_level in quant_levels:
+            # Expect tuning ends with WOQ algorithm 'RTN_G32ASYM'
+            partial_fake_eval = partial(fake_eval, eval_result_lst=[1, 1.1])
+            woq_model_1 = self._test_woq_tune_common(partial_fake_eval, quant_level)
+            self.assertEqual(self._count_woq_matmul(woq_model_1), 31)
+
+            # Expect tuning ends with WOQ algorithm 'GPTQ_G32ASYM'
+            partial_fake_eval = partial(fake_eval, eval_result_lst=[1, 0.8, 1.1])
+            woq_model_2 = self._test_woq_tune_common(partial_fake_eval, quant_level)
+            self.assertEqual(self._count_woq_matmul(woq_model_2), 31)
+
+            # Expect tuning ends with WOQ algorithm 'GPTQ_G32ASYM_DISABLE_LAST_MATMUL'
+            partial_fake_eval = partial(fake_eval, eval_result_lst=[1, 0.8, 0.8, 1.1])
+            woq_model_3 = self._test_woq_tune_common(partial_fake_eval, quant_level)
+            self.assertEqual(self._count_woq_matmul(woq_model_3), 30)
+
+            # Expect tuning ends with WOQ algorithm 'GPTQ_G128ASYM'
+            partial_fake_eval = partial(fake_eval, eval_result_lst=[1, 0.8, 0.8, 0.8, 1.1])
+            woq_model_4 = self._test_woq_tune_common(partial_fake_eval, quant_level)
+            self.assertEqual(self._count_woq_matmul(woq_model_4, group_size=128), 31)
+
+            # Expect tuning ends with WOQ algorithm 'AWQ_G32ASYM'
+            partial_fake_eval = partial(fake_eval, eval_result_lst=[1, 0.8, 0.8, 0.8, 0.8, 1.1])
+            woq_model_5 = self._test_woq_tune_common(partial_fake_eval, quant_level)
+            self.assertEqual(self._count_woq_matmul(woq_model_5), 31)
+
+        # test WOQ tuning with fallback
+        partial_fake_eval = partial(fake_eval, eval_result_lst=[1, 1.1])
+        woq_model = self._test_woq_tune_common(
+            partial_fake_eval, "auto", op_name_dict={"/transformer/h.*/attn/k_proj/MatMul": FP32}
+        )
+        self.assertEqual(self._count_woq_matmul(woq_model), 26)
+
+        # test 8 bits WOQ
+        partial_fake_eval = partial(fake_eval, eval_result_lst=[1, 1.1])
+        woq_model = self._test_woq_tune_common(partial_fake_eval, "auto", op_type_dict={".*": {"weight": {"bits": 8}}})
+        self.assertEqual(self._count_woq_matmul(woq_model, bits=8), 31)
+
 
 if __name__ == "__main__":
     unittest.main()