|
| 1 | +## GDCC Set 1: Experimental binding free energy and binding enthalpy |
| 2 | +All measurements were done via isothermal titration calorimetry in 50 mM sodium phosphate buffer at pH 11.5 and 298 K. All values in kcal/mol. |
| 3 | + |
| 4 | +|Host|Guest|Guest ID|Guest SMILES|Exp ΔG [<sup>a</sup>](#Gibb16)|Exp ΔG SEM [<sup>a</sup>]|Exp ΔH [<sup>a</sup>](#Gibb16)|Exp ΔH SEM [<sup>a</sup>]|Comp. Studies| |
| 5 | +|----|--------------------------|--------|-----------------------|------|----------|------|----------|-------------| |
| 6 | +|OA |5-Hexynoic acid |3 |C#CCCCC(=O)O |-5.40|0.003| -7.71|0.05| [1](#YinGil)[2](#BosMichel)| |
| 7 | +|OA |3-Nitrobenzoic acid |4 |C1=CC(=CC(=C1)[N+](=O)[O−])C(=O)O |-5.34|0.005| -5.67|0.01| [1](#YinGil)[2](#BosMichel)| |
| 8 | +|OA |4-Cyanobenzoic acid |5 |C1=CC(=CC=C1C#N)C(=O)O |-4.73|0.01 | -4.45|0.08| [1](#YinGil)[2](#BosMichel)| |
| 9 | +|OA |4-Bromoadamantane-1-carboxylic acid |6 |C1C2CC3CC(C2)(CC1C3Br)C(=O)O |-9.37|0.01 |-14.78|0.02| [1](#YinGil)[2](#BosMichel)| |
| 10 | +|OA |N,N,N-Trimethylhexan-1-aminium |7 |CCCCCC[N+](C)(C)C |-4.49|0.01 | -5.91|0.10| [1](#YinGil)[2](#BosMichel)| |
| 11 | +|OA |Trimethylphenethylaminium |8 |C[N+](C)(C)CCC1=CC=CC=C1 |-3.72|0.01 | -9.96|0.11| [1](#YinGil)[2](#BosMichel)| |
| 12 | +|| |
| 13 | +|TEMOA |5-Hexynoic acid |3 |C#CCCCC(=O)O |-5.476 |0.006|-9.961|0.006| [1](#YinGil)[2](#BosMichel)| |
| 14 | +|TEMOA |3-Nitrobenzoic acid |4 |C1=CC(=CC(=C1)[N+](=O)[O−])C(=O)O |-4.52 |0.02 |-9.1 |0.1 | [1](#YinGil)[2](#BosMichel)| |
| 15 | +|TEMOA |4-Cyanobenzoic acid |5 |C1=CC(=CC=C1C#N)C(=O)O |-5.26 |0.01 |-7.6 |0.1 | [1](#YinGil)[2](#BosMichel)| |
| 16 | +|TEMOA |4-Bromoadamantane-1-carboxylic acid |6 |C1C2CC3CC(C2)(CC1C3Br)C(=O)O |only NMR data available| -- | -- | -- | [1](#YinGil)[2](#BosMichel)| |
| 17 | +|TEMOA |N,N,N-Trimethylhexan-1-aminium |7 |CCCCCC[N+](C)(C)C |-5.73 |0.06 |-6.62 |0.2 | [1](#YinGil)[2](#BosMichel)| |
| 18 | +|TEMOA |Trimethylphenethylaminium |8 |C[N+](C)(C)CCC1=CC=CC=C1 |only NMR data available| -- | -- | -- | [1](#YinGil)[2](#BosMichel)| |
| 19 | + |
| 20 | + |
| 21 | +a) <a name="Gibb16"></a> Experimental Data: Sullivan MR, Sokkalingam P, Nguyen T, Donahue JP, Gibb BC. 2016. Binding of carboxylate and trimethylammonium salts to octa-acid and TEMOA deep-cavity cavitands. J. Comput. Aided Mol. Des. 31:21–28. |
| 22 | + |
| 23 | +Computational Studies: |
| 24 | +1. <a name="YinGil"></a> Yin J, Henriksen NM, Slochower DR, Gilson MK. 2016. The SAMPL5 host-guest challenge: computing binding free energies and enthalpies from explicit solvent simulations by the attach-pull-release (APR) method. J. Comput. Aided Mol. Des. 31:133–45. |
| 25 | +2. <a name="BosMichel"></a> Bosisio S, Mey ASJS, Michel J. 2016. Blinded predictions of host-guest standard free energies of binding in the SAMPL5 challenge. J. Comput. Aided Mol. Des. 31(1):61–70. |
0 commit comments